diff --git a/README.md b/README.md index d70ed31..56daac9 100644 --- a/README.md +++ b/README.md @@ -93,6 +93,59 @@ You may also define `routes` for each middleware in `config/security.php` and ap Firewall will send a notification as soon as an attack has been detected. Emails entered in `notifications.email.to` config must be valid Laravel users in order to send notifications. Check out the Notifications documentation of Laravel for further information. +## .env Variables + +```sh +FIREWALL_ENABLED=true +FIREWALL_WHITELIST="127.0.0.0/24" + +FIREWALL_DB_CONNECTION="${DB_CONNECTION}" +FIREWALL_DB_PREFIX=security_ + +FIREWALL_CRON_ENABLED=false +FIREWALL_CRON_EXPRESSION="* * * * *" + +FIREWALL_BLOCK_VIEW=null +FIREWALL_BLOCK_REDIRECT=null +FIREWALL_BLOCK_ABORT=false +FIREWALL_BLOCK_CODE=403 + +FIREWALL_EMAIL_ENABLED=false +FIREWALL_EMAIL_NAME="${MAIL_FROM_NAME}" +FIREWALL_EMAIL_FROM="${MAIL_FROM_ADDRESS}" +FIREWALL_EMAIL_TO="webmaster@example.com" +FIREWALL_EMAIL_QUEUE=default + +FIREWALL_SLACK_ENABLED=false +FIREWALL_SLACK_EMOJI=":fire:" +FIREWALL_SLACK_FROM="Laravel Security" +FIREWALL_SLACK_TO= # webhook url +FIREWALL_SLACK_CHANNEL=null +FIREWALL_SLACK_QUEUE=default + +FIREWALL_DISCORD_ENABLED=false +FIREWALL_DISCORD_TO= # webhook url +FIREWALL_DISCORD_CHANNEL=null +FIREWALL_DISCORD_QUEUE=default + +FIREWALL_MIDDLEWARE_IP_ENABLED=true +FIREWALL_MIDDLEWARE_AGENT_ENABLED=true +FIREWALL_MIDDLEWARE_BOT_ENABLED=true +FIREWALL_MIDDLEWARE_GEO_ENABLED=true +FIREWALL_MIDDLEWARE_LFI_ENABLED=true +FIREWALL_MIDDLEWARE_LOGIN_ENABLED=true +FIREWALL_MIDDLEWARE_PHP_ENABLED=true +FIREWALL_MIDDLEWARE_REFERRER_ENABLED=true +FIREWALL_MIDDLEWARE_RFI_ENABLED=true +FIREWALL_MIDDLEWARE_SESSION_ENABLED=true +FIREWALL_MIDDLEWARE_SQLI_ENABLED=true +FIREWALL_MIDDLEWARE_SWEAR_ENABLED=true +FIREWALL_MIDDLEWARE_URL_ENABLED=true +FIREWALL_MIDDLEWARE_WHITELIST_ENABLED=true +FIREWALL_MIDDLEWARE_XSS_ENABLED=true +FIREWALL_MIDDLEWARE_KEYWORD_ENABLED=true +``` + ## Changelog Please see [Releases](../../releases) for more information on what has changed recently. @@ -110,6 +163,12 @@ Please review [our security policy](https://github.com/ozankurt/laravel-security - [ozankurt/laravel-security](https://github.com/ozankurt/laravel-security) - [All Contributors](../../contributors) +## Todo + +- [ ] logs/ips datatable +- [ ] ip by country breakdown -> datatable + chart +- [ ] type of attack breakdown -> datatable + chart + ## License The MIT License (MIT). Please see [LICENSE](LICENSE.md) for more information. diff --git a/composer.json b/composer.json index aa4077b..77a5c73 100644 --- a/composer.json +++ b/composer.json @@ -1,59 +1,61 @@ { - "name": "ozankurt/laravel-security", - "description": "Web Application Firewall (WAF) package for Laravel", - "keywords": [ - "laravel", - "firewall", - "security", - "waf", - "blacklist", - "xss", - "sqli", - "rfi", - "lfi" - ], - "license": "MIT", - "authors": [ - { - "name": "Ozan Kurt", - "email": "me@ozankurt.com", - "homepage": "https://ozankurt.com", - "role": "Developer" - } - ], - "require": { - "php": "^8.0", - "laravel/framework": "^9.0|^10.0|^11.0", - "guzzlehttp/guzzle": "^7.4", - "jenssegers/agent": "2.6.*" - }, - "require-dev": { - "phpunit/phpunit": "^9.5|^10.0", - "orchestra/testbench": "^7.4|^8.0" - }, - "autoload": { - "psr-4": { - "OzanKurt\\Security\\": "src" - } - }, - "autoload-dev": { - "psr-4": { - "OzanKurt\\Security\\Tests\\": "tests" - } - }, - "extra": { - "laravel": { - "providers": [ - "OzanKurt\\Security\\SecurityServiceProvider" - ] - } - }, - "scripts": { - "test": "vendor/bin/phpunit" - }, - "config": { - "allow-plugins": { - "composer/package-versions-deprecated": true - } + "name": "ozankurt/laravel-security", + "description": "Web Application Firewall (WAF) package for Laravel", + "keywords": [ + "laravel", + "firewall", + "security", + "waf", + "blacklist", + "xss", + "sqli", + "rfi", + "lfi" + ], + "license": "MIT", + "authors": [ + { + "name": "Ozan Kurt", + "email": "me@ozankurt.com", + "homepage": "https://ozankurt.com", + "role": "Developer" } + ], + "require": { + "php": "^8.0", + "laravel/framework": "^9.0|^10.0|^11.0", + "guzzlehttp/guzzle": "^7.4", + "jenssegers/agent": "2.6.*", + "voku/anti-xss": "~4.1.42", + "voku/portable-utf8": "^6.0.13" + }, + "require-dev": { + "phpunit/phpunit": "^9.5|^10.0", + "orchestra/testbench": "^7.4|^8.0" + }, + "autoload": { + "psr-4": { + "OzanKurt\\Security\\": "src" + } + }, + "autoload-dev": { + "psr-4": { + "OzanKurt\\Security\\Tests\\": "tests" + } + }, + "extra": { + "laravel": { + "providers": [ + "OzanKurt\\Security\\SecurityServiceProvider" + ] + } + }, + "scripts": { + "test": "vendor/bin/phpunit" + }, + "config": { + "allow-plugins": { + "composer/package-versions-deprecated": true + } + } } diff --git a/config/security.php b/config/security.php index 52002d0..26b35ce 100644 --- a/config/security.php +++ b/config/security.php @@ -4,7 +4,18 @@ 'enabled' => env('FIREWALL_ENABLED', true), - 'whitelist' => explode(',', env('FIREWALL_WHITELIST', '')), + 'whitelist' => explode(',', env('FIREWALL_WHITELIST', '127.0.0.0/24')), + + 'dashboard' => [ + 'enabled' => env('FIREWALL_DASHBOARD_ENABLED', true), + 'route_prefix' => 'security', + 'route_name' => 'security.', + 'date_format' => 'd/m/Y H:i:s', + 'middleware' => [ + 'auth', + OzanKurt\Security\Http\Middleware\SecurityDashboardMiddleware::class, + ], + ], 'database' => [ 'connection' => env('FIREWALL_DB_CONNECTION', env('DB_CONNECTION', 'mysql')), @@ -35,10 +46,10 @@ 'responses' => [ 'block' => [ - 'view' => env('FIREWALL_BLOCK_VIEW', null), - 'redirect' => env('FIREWALL_BLOCK_REDIRECT', null), - 'abort' => env('FIREWALL_BLOCK_ABORT', false), - 'code' => env('FIREWALL_BLOCK_CODE', 403), + 'view' => null, + 'redirect' => null, + 'abort' => false, + 'code' => 403, //'exception' => \OzanKurt\Security\Exceptions\AccessDenied::class, ], @@ -63,6 +74,12 @@ 'queue' => env('FIREWALL_SLACK_QUEUE', 'default'), ], + 'discord' => [ + 'enabled' => env('FIREWALL_DISCORD_ENABLED', false), + 'webhook_url' => env('FIREWALL_DISCORD_WEBHOOK_URL'), + 'queue' => env('FIREWALL_DISCORD_QUEUE', 'default'), + ], + ], 'all_middleware' => [ @@ -424,6 +441,16 @@ 'xss' => [ 'enabled' => env('FIREWALL_MIDDLEWARE_XSS_ENABLED', env('FIREWALL_ENABLED', true)), + 'mode' => 'block', // 'block', 'clean' + + 'allow_blade_echoes' => false, + + 'blade_echo_tags' => [ + ['{!!', '!!}'], + ['{{', '}}'], + ['{{{', '}}}'], + ], + 'methods' => ['post', 'put', 'patch'], 'routes' => [ diff --git a/database/migrations/create_ips_table.php b/database/migrations/create_ips_table.php index 7ae7cb6..93d907a 100644 --- a/database/migrations/create_ips_table.php +++ b/database/migrations/create_ips_table.php @@ -6,13 +6,23 @@ return new class extends Migration { + protected string $tableName; + + public function __construct() + { + $this->connection = config('security.database.connection'); + $this->tableName = config('security.database.table_prefix') . config('security.database.ip.table'); + } + public function up(): void { - Schema::connection(config('security.database.connection'))->create(config('security.database.ip.table'), function (Blueprint $table) { + Schema::create($this->tableName, function (Blueprint $table) { $table->id(); - $table->string('ip')->index('ip'); + $table->string('ip')->index(); $table->foreignId('log_id')->nullable()->index(); + $table->string('entry_type')->nullable(); $table->boolean('is_blocked')->default(1); + $table->unsignedInteger('request_count')->default(0); $table->timestamps(); $table->softDeletes(); }); @@ -20,6 +30,6 @@ public function up(): void public function down(): void { - Schema::connection(config('security.database.connection'))->drop(config('security.database.ip.table')); + Schema::drop($this->tableName); } }; diff --git a/database/migrations/create_logs_table.php b/database/migrations/create_logs_table.php index 39f34a3..ed3f34f 100644 --- a/database/migrations/create_logs_table.php +++ b/database/migrations/create_logs_table.php @@ -7,12 +7,20 @@ return new class extends Migration { + protected string $tableName; + + public function __construct() + { + $this->connection = config('security.database.connection'); + $this->tableName = config('security.database.table_prefix') . config('security.database.log.table'); + } + public function up(): void { - Schema::connection(config('security.database.connection'))->create(config('security.database.log.table'), function (Blueprint $table) { + Schema::create($this->tableName, function (Blueprint $table) { $table->increments('id'); $table->foreignId('user_id')->nullable()->index(); - $table->string('middleware')->index(); + $table->string('middleware')->nullable()->index(); $table->string('level')->default(LogLevel::MEDIUM)->index(); $table->string('ip')->index(); $table->text('url')->nullable(); @@ -26,6 +34,6 @@ public function up(): void public function down(): void { - Schema::connection(config('security.database.connection'))->drop(config('security.database.log.table')); + Schema::drop($this->tableName); } }; diff --git a/public/css/bootstrap.min.css b/public/css/bootstrap.min.css new file mode 100644 index 0000000..3993414 --- /dev/null +++ b/public/css/bootstrap.min.css @@ -0,0 +1,6 @@ +@charset "UTF-8";/*! + * Bootstrap v5.3.3 (https://getbootstrap.com/) + * Copyright 2011-2024 The Bootstrap Authors + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */:root,[data-bs-theme=light]{--bs-blue:#0d6efd;--bs-indigo:#6610f2;--bs-purple:#6f42c1;--bs-pink:#d63384;--bs-red:#dc3545;--bs-orange:#fd7e14;--bs-yellow:#ffc107;--bs-green:#198754;--bs-teal:#20c997;--bs-cyan:#0dcaf0;--bs-black:#000;--bs-white:#fff;--bs-gray:#6c757d;--bs-gray-dark:#343a40;--bs-gray-100:#f8f9fa;--bs-gray-200:#e9ecef;--bs-gray-300:#dee2e6;--bs-gray-400:#ced4da;--bs-gray-500:#adb5bd;--bs-gray-600:#6c757d;--bs-gray-700:#495057;--bs-gray-800:#343a40;--bs-gray-900:#212529;--bs-primary:#0d6efd;--bs-secondary:#6c757d;--bs-success:#198754;--bs-info:#0dcaf0;--bs-warning:#ffc107;--bs-danger:#dc3545;--bs-light:#f8f9fa;--bs-dark:#212529;--bs-primary-rgb:13,110,253;--bs-secondary-rgb:108,117,125;--bs-success-rgb:25,135,84;--bs-info-rgb:13,202,240;--bs-warning-rgb:255,193,7;--bs-danger-rgb:220,53,69;--bs-light-rgb:248,249,250;--bs-dark-rgb:33,37,41;--bs-primary-text-emphasis:#052c65;--bs-secondary-text-emphasis:#2b2f32;--bs-success-text-emphasis:#0a3622;--bs-info-text-emphasis:#055160;--bs-warning-text-emphasis:#664d03;--bs-danger-text-emphasis:#58151c;--bs-light-text-emphasis:#495057;--bs-dark-text-emphasis:#495057;--bs-primary-bg-subtle:#cfe2ff;--bs-secondary-bg-subtle:#e2e3e5;--bs-success-bg-subtle:#d1e7dd;--bs-info-bg-subtle:#cff4fc;--bs-warning-bg-subtle:#fff3cd;--bs-danger-bg-subtle:#f8d7da;--bs-light-bg-subtle:#fcfcfd;--bs-dark-bg-subtle:#ced4da;--bs-primary-border-subtle:#9ec5fe;--bs-secondary-border-subtle:#c4c8cb;--bs-success-border-subtle:#a3cfbb;--bs-info-border-subtle:#9eeaf9;--bs-warning-border-subtle:#ffe69c;--bs-danger-border-subtle:#f1aeb5;--bs-light-border-subtle:#e9ecef;--bs-dark-border-subtle:#adb5bd;--bs-white-rgb:255,255,255;--bs-black-rgb:0,0,0;--bs-font-sans-serif:system-ui,-apple-system,"Segoe UI",Roboto,"Helvetica Neue","Noto Sans","Liberation Sans",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--bs-font-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--bs-gradient:linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));--bs-body-font-family:var(--bs-font-sans-serif);--bs-body-font-size:1rem;--bs-body-font-weight:400;--bs-body-line-height:1.5;--bs-body-color:#212529;--bs-body-color-rgb:33,37,41;--bs-body-bg:#fff;--bs-body-bg-rgb:255,255,255;--bs-emphasis-color:#000;--bs-emphasis-color-rgb:0,0,0;--bs-secondary-color:rgba(33, 37, 41, 0.75);--bs-secondary-color-rgb:33,37,41;--bs-secondary-bg:#e9ecef;--bs-secondary-bg-rgb:233,236,239;--bs-tertiary-color:rgba(33, 37, 41, 0.5);--bs-tertiary-color-rgb:33,37,41;--bs-tertiary-bg:#f8f9fa;--bs-tertiary-bg-rgb:248,249,250;--bs-heading-color:inherit;--bs-link-color:#0d6efd;--bs-link-color-rgb:13,110,253;--bs-link-decoration:underline;--bs-link-hover-color:#0a58ca;--bs-link-hover-color-rgb:10,88,202;--bs-code-color:#d63384;--bs-highlight-color:#212529;--bs-highlight-bg:#fff3cd;--bs-border-width:1px;--bs-border-style:solid;--bs-border-color:#dee2e6;--bs-border-color-translucent:rgba(0, 0, 0, 0.175);--bs-border-radius:0.375rem;--bs-border-radius-sm:0.25rem;--bs-border-radius-lg:0.5rem;--bs-border-radius-xl:1rem;--bs-border-radius-xxl:2rem;--bs-border-radius-2xl:var(--bs-border-radius-xxl);--bs-border-radius-pill:50rem;--bs-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-box-shadow-sm:0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);--bs-box-shadow-lg:0 1rem 3rem rgba(0, 0, 0, 0.175);--bs-box-shadow-inset:inset 0 1px 2px rgba(0, 0, 0, 0.075);--bs-focus-ring-width:0.25rem;--bs-focus-ring-opacity:0.25;--bs-focus-ring-color:rgba(13, 110, 253, 0.25);--bs-form-valid-color:#198754;--bs-form-valid-border-color:#198754;--bs-form-invalid-color:#dc3545;--bs-form-invalid-border-color:#dc3545}[data-bs-theme=dark]{color-scheme:dark;--bs-body-color:#dee2e6;--bs-body-color-rgb:222,226,230;--bs-body-bg:#212529;--bs-body-bg-rgb:33,37,41;--bs-emphasis-color:#fff;--bs-emphasis-color-rgb:255,255,255;--bs-secondary-color:rgba(222, 226, 230, 0.75);--bs-secondary-color-rgb:222,226,230;--bs-secondary-bg:#343a40;--bs-secondary-bg-rgb:52,58,64;--bs-tertiary-color:rgba(222, 226, 230, 0.5);--bs-tertiary-color-rgb:222,226,230;--bs-tertiary-bg:#2b3035;--bs-tertiary-bg-rgb:43,48,53;--bs-primary-text-emphasis:#6ea8fe;--bs-secondary-text-emphasis:#a7acb1;--bs-success-text-emphasis:#75b798;--bs-info-text-emphasis:#6edff6;--bs-warning-text-emphasis:#ffda6a;--bs-danger-text-emphasis:#ea868f;--bs-light-text-emphasis:#f8f9fa;--bs-dark-text-emphasis:#dee2e6;--bs-primary-bg-subtle:#031633;--bs-secondary-bg-subtle:#161719;--bs-success-bg-subtle:#051b11;--bs-info-bg-subtle:#032830;--bs-warning-bg-subtle:#332701;--bs-danger-bg-subtle:#2c0b0e;--bs-light-bg-subtle:#343a40;--bs-dark-bg-subtle:#1a1d20;--bs-primary-border-subtle:#084298;--bs-secondary-border-subtle:#41464b;--bs-success-border-subtle:#0f5132;--bs-info-border-subtle:#087990;--bs-warning-border-subtle:#997404;--bs-danger-border-subtle:#842029;--bs-light-border-subtle:#495057;--bs-dark-border-subtle:#343a40;--bs-heading-color:inherit;--bs-link-color:#6ea8fe;--bs-link-hover-color:#8bb9fe;--bs-link-color-rgb:110,168,254;--bs-link-hover-color-rgb:139,185,254;--bs-code-color:#e685b5;--bs-highlight-color:#dee2e6;--bs-highlight-bg:#664d03;--bs-border-color:#495057;--bs-border-color-translucent:rgba(255, 255, 255, 0.15);--bs-form-valid-color:#75b798;--bs-form-valid-border-color:#75b798;--bs-form-invalid-color:#ea868f;--bs-form-invalid-border-color:#ea868f}*,::after,::before{box-sizing:border-box}@media (prefers-reduced-motion:no-preference){:root{scroll-behavior:smooth}}body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:transparent}hr{margin:1rem 0;color:inherit;border:0;border-top:var(--bs-border-width) solid;opacity:.25}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2;color:var(--bs-heading-color)}.h1,h1{font-size:calc(1.375rem + 1.5vw)}@media (min-width:1200px){.h1,h1{font-size:2.5rem}}.h2,h2{font-size:calc(1.325rem + .9vw)}@media (min-width:1200px){.h2,h2{font-size:2rem}}.h3,h3{font-size:calc(1.3rem + .6vw)}@media (min-width:1200px){.h3,h3{font-size:1.75rem}}.h4,h4{font-size:calc(1.275rem + .3vw)}@media (min-width:1200px){.h4,h4{font-size:1.5rem}}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}p{margin-top:0;margin-bottom:1rem}abbr[title]{-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;-webkit-text-decoration-skip-ink:none;text-decoration-skip-ink:none}address{margin-bottom:1rem;font-style:normal;line-height:inherit}ol,ul{padding-left:2rem}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}b,strong{font-weight:bolder}.small,small{font-size:.875em}.mark,mark{padding:.1875em;color:var(--bs-highlight-color);background-color:var(--bs-highlight-bg)}sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,1));text-decoration:underline}a:hover{--bs-link-color-rgb:var(--bs-link-hover-color-rgb)}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}code,kbd,pre,samp{font-family:var(--bs-font-monospace);font-size:1em}pre{display:block;margin-top:0;margin-bottom:1rem;overflow:auto;font-size:.875em}pre code{font-size:inherit;color:inherit;word-break:normal}code{font-size:.875em;color:var(--bs-code-color);word-wrap:break-word}a>code{color:inherit}kbd{padding:.1875rem .375rem;font-size:.875em;color:var(--bs-body-bg);background-color:var(--bs-body-color);border-radius:.25rem}kbd kbd{padding:0;font-size:1em}figure{margin:0 0 1rem}img,svg{vertical-align:middle}table{caption-side:bottom;border-collapse:collapse}caption{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-secondary-color);text-align:left}th{text-align:inherit;text-align:-webkit-match-parent}tbody,td,tfoot,th,thead,tr{border-color:inherit;border-style:solid;border-width:0}label{display:inline-block}button{border-radius:0}button:focus:not(:focus-visible){outline:0}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,select{text-transform:none}[role=button]{cursor:pointer}select{word-wrap:normal}select:disabled{opacity:1}[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator{display:none!important}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[type=button]:not(:disabled),[type=reset]:not(:disabled),[type=submit]:not(:disabled),button:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}textarea{resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{float:left;width:100%;padding:0;margin-bottom:.5rem;font-size:calc(1.275rem + .3vw);line-height:inherit}@media (min-width:1200px){legend{font-size:1.5rem}}legend+*{clear:left}::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-text,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}::file-selector-button{font:inherit;-webkit-appearance:button}output{display:inline-block}iframe{border:0}summary{display:list-item;cursor:pointer}progress{vertical-align:baseline}[hidden]{display:none!important}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:calc(1.625rem + 4.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-1{font-size:5rem}}.display-2{font-size:calc(1.575rem + 3.9vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-2{font-size:4.5rem}}.display-3{font-size:calc(1.525rem + 3.3vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-3{font-size:4rem}}.display-4{font-size:calc(1.475rem + 2.7vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-4{font-size:3.5rem}}.display-5{font-size:calc(1.425rem + 2.1vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-5{font-size:3rem}}.display-6{font-size:calc(1.375rem + 1.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-6{font-size:2.5rem}}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:.875em;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote>:last-child{margin-bottom:0}.blockquote-footer{margin-top:-1rem;margin-bottom:1rem;font-size:.875em;color:#6c757d}.blockquote-footer::before{content:"— "}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:var(--bs-body-bg);border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:.875em;color:var(--bs-secondary-color)}.container,.container-fluid,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{--bs-gutter-x:1.5rem;--bs-gutter-y:0;width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-right:auto;margin-left:auto}@media (min-width:576px){.container,.container-sm{max-width:540px}}@media (min-width:768px){.container,.container-md,.container-sm{max-width:720px}}@media (min-width:992px){.container,.container-lg,.container-md,.container-sm{max-width:960px}}@media (min-width:1200px){.container,.container-lg,.container-md,.container-sm,.container-xl{max-width:1140px}}@media (min-width:1400px){.container,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{max-width:1320px}}:root{--bs-breakpoint-xs:0;--bs-breakpoint-sm:576px;--bs-breakpoint-md:768px;--bs-breakpoint-lg:992px;--bs-breakpoint-xl:1200px;--bs-breakpoint-xxl:1400px}.row{--bs-gutter-x:1.5rem;--bs-gutter-y:0;display:flex;flex-wrap:wrap;margin-top:calc(-1 * var(--bs-gutter-y));margin-right:calc(-.5 * var(--bs-gutter-x));margin-left:calc(-.5 * var(--bs-gutter-x))}.row>*{flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-top:var(--bs-gutter-y)}.col{flex:1 0 0%}.row-cols-auto>*{flex:0 0 auto;width:auto}.row-cols-1>*{flex:0 0 auto;width:100%}.row-cols-2>*{flex:0 0 auto;width:50%}.row-cols-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-4>*{flex:0 0 auto;width:25%}.row-cols-5>*{flex:0 0 auto;width:20%}.row-cols-6>*{flex:0 0 auto;width:16.66666667%}.col-auto{flex:0 0 auto;width:auto}.col-1{flex:0 0 auto;width:8.33333333%}.col-2{flex:0 0 auto;width:16.66666667%}.col-3{flex:0 0 auto;width:25%}.col-4{flex:0 0 auto;width:33.33333333%}.col-5{flex:0 0 auto;width:41.66666667%}.col-6{flex:0 0 auto;width:50%}.col-7{flex:0 0 auto;width:58.33333333%}.col-8{flex:0 0 auto;width:66.66666667%}.col-9{flex:0 0 auto;width:75%}.col-10{flex:0 0 auto;width:83.33333333%}.col-11{flex:0 0 auto;width:91.66666667%}.col-12{flex:0 0 auto;width:100%}.offset-1{margin-left:8.33333333%}.offset-2{margin-left:16.66666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.33333333%}.offset-5{margin-left:41.66666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.33333333%}.offset-8{margin-left:66.66666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.33333333%}.offset-11{margin-left:91.66666667%}.g-0,.gx-0{--bs-gutter-x:0}.g-0,.gy-0{--bs-gutter-y:0}.g-1,.gx-1{--bs-gutter-x:0.25rem}.g-1,.gy-1{--bs-gutter-y:0.25rem}.g-2,.gx-2{--bs-gutter-x:0.5rem}.g-2,.gy-2{--bs-gutter-y:0.5rem}.g-3,.gx-3{--bs-gutter-x:1rem}.g-3,.gy-3{--bs-gutter-y:1rem}.g-4,.gx-4{--bs-gutter-x:1.5rem}.g-4,.gy-4{--bs-gutter-y:1.5rem}.g-5,.gx-5{--bs-gutter-x:3rem}.g-5,.gy-5{--bs-gutter-y:3rem}@media (min-width:576px){.col-sm{flex:1 0 0%}.row-cols-sm-auto>*{flex:0 0 auto;width:auto}.row-cols-sm-1>*{flex:0 0 auto;width:100%}.row-cols-sm-2>*{flex:0 0 auto;width:50%}.row-cols-sm-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-sm-4>*{flex:0 0 auto;width:25%}.row-cols-sm-5>*{flex:0 0 auto;width:20%}.row-cols-sm-6>*{flex:0 0 auto;width:16.66666667%}.col-sm-auto{flex:0 0 auto;width:auto}.col-sm-1{flex:0 0 auto;width:8.33333333%}.col-sm-2{flex:0 0 auto;width:16.66666667%}.col-sm-3{flex:0 0 auto;width:25%}.col-sm-4{flex:0 0 auto;width:33.33333333%}.col-sm-5{flex:0 0 auto;width:41.66666667%}.col-sm-6{flex:0 0 auto;width:50%}.col-sm-7{flex:0 0 auto;width:58.33333333%}.col-sm-8{flex:0 0 auto;width:66.66666667%}.col-sm-9{flex:0 0 auto;width:75%}.col-sm-10{flex:0 0 auto;width:83.33333333%}.col-sm-11{flex:0 0 auto;width:91.66666667%}.col-sm-12{flex:0 0 auto;width:100%}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333333%}.offset-sm-2{margin-left:16.66666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333333%}.offset-sm-5{margin-left:41.66666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333333%}.offset-sm-8{margin-left:66.66666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333333%}.offset-sm-11{margin-left:91.66666667%}.g-sm-0,.gx-sm-0{--bs-gutter-x:0}.g-sm-0,.gy-sm-0{--bs-gutter-y:0}.g-sm-1,.gx-sm-1{--bs-gutter-x:0.25rem}.g-sm-1,.gy-sm-1{--bs-gutter-y:0.25rem}.g-sm-2,.gx-sm-2{--bs-gutter-x:0.5rem}.g-sm-2,.gy-sm-2{--bs-gutter-y:0.5rem}.g-sm-3,.gx-sm-3{--bs-gutter-x:1rem}.g-sm-3,.gy-sm-3{--bs-gutter-y:1rem}.g-sm-4,.gx-sm-4{--bs-gutter-x:1.5rem}.g-sm-4,.gy-sm-4{--bs-gutter-y:1.5rem}.g-sm-5,.gx-sm-5{--bs-gutter-x:3rem}.g-sm-5,.gy-sm-5{--bs-gutter-y:3rem}}@media (min-width:768px){.col-md{flex:1 0 0%}.row-cols-md-auto>*{flex:0 0 auto;width:auto}.row-cols-md-1>*{flex:0 0 auto;width:100%}.row-cols-md-2>*{flex:0 0 auto;width:50%}.row-cols-md-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-md-4>*{flex:0 0 auto;width:25%}.row-cols-md-5>*{flex:0 0 auto;width:20%}.row-cols-md-6>*{flex:0 0 auto;width:16.66666667%}.col-md-auto{flex:0 0 auto;width:auto}.col-md-1{flex:0 0 auto;width:8.33333333%}.col-md-2{flex:0 0 auto;width:16.66666667%}.col-md-3{flex:0 0 auto;width:25%}.col-md-4{flex:0 0 auto;width:33.33333333%}.col-md-5{flex:0 0 auto;width:41.66666667%}.col-md-6{flex:0 0 auto;width:50%}.col-md-7{flex:0 0 auto;width:58.33333333%}.col-md-8{flex:0 0 auto;width:66.66666667%}.col-md-9{flex:0 0 auto;width:75%}.col-md-10{flex:0 0 auto;width:83.33333333%}.col-md-11{flex:0 0 auto;width:91.66666667%}.col-md-12{flex:0 0 auto;width:100%}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333333%}.offset-md-2{margin-left:16.66666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333333%}.offset-md-5{margin-left:41.66666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333333%}.offset-md-8{margin-left:66.66666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333333%}.offset-md-11{margin-left:91.66666667%}.g-md-0,.gx-md-0{--bs-gutter-x:0}.g-md-0,.gy-md-0{--bs-gutter-y:0}.g-md-1,.gx-md-1{--bs-gutter-x:0.25rem}.g-md-1,.gy-md-1{--bs-gutter-y:0.25rem}.g-md-2,.gx-md-2{--bs-gutter-x:0.5rem}.g-md-2,.gy-md-2{--bs-gutter-y:0.5rem}.g-md-3,.gx-md-3{--bs-gutter-x:1rem}.g-md-3,.gy-md-3{--bs-gutter-y:1rem}.g-md-4,.gx-md-4{--bs-gutter-x:1.5rem}.g-md-4,.gy-md-4{--bs-gutter-y:1.5rem}.g-md-5,.gx-md-5{--bs-gutter-x:3rem}.g-md-5,.gy-md-5{--bs-gutter-y:3rem}}@media (min-width:992px){.col-lg{flex:1 0 0%}.row-cols-lg-auto>*{flex:0 0 auto;width:auto}.row-cols-lg-1>*{flex:0 0 auto;width:100%}.row-cols-lg-2>*{flex:0 0 auto;width:50%}.row-cols-lg-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-lg-4>*{flex:0 0 auto;width:25%}.row-cols-lg-5>*{flex:0 0 auto;width:20%}.row-cols-lg-6>*{flex:0 0 auto;width:16.66666667%}.col-lg-auto{flex:0 0 auto;width:auto}.col-lg-1{flex:0 0 auto;width:8.33333333%}.col-lg-2{flex:0 0 auto;width:16.66666667%}.col-lg-3{flex:0 0 auto;width:25%}.col-lg-4{flex:0 0 auto;width:33.33333333%}.col-lg-5{flex:0 0 auto;width:41.66666667%}.col-lg-6{flex:0 0 auto;width:50%}.col-lg-7{flex:0 0 auto;width:58.33333333%}.col-lg-8{flex:0 0 auto;width:66.66666667%}.col-lg-9{flex:0 0 auto;width:75%}.col-lg-10{flex:0 0 auto;width:83.33333333%}.col-lg-11{flex:0 0 auto;width:91.66666667%}.col-lg-12{flex:0 0 auto;width:100%}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333333%}.offset-lg-2{margin-left:16.66666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333333%}.offset-lg-5{margin-left:41.66666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333333%}.offset-lg-8{margin-left:66.66666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333333%}.offset-lg-11{margin-left:91.66666667%}.g-lg-0,.gx-lg-0{--bs-gutter-x:0}.g-lg-0,.gy-lg-0{--bs-gutter-y:0}.g-lg-1,.gx-lg-1{--bs-gutter-x:0.25rem}.g-lg-1,.gy-lg-1{--bs-gutter-y:0.25rem}.g-lg-2,.gx-lg-2{--bs-gutter-x:0.5rem}.g-lg-2,.gy-lg-2{--bs-gutter-y:0.5rem}.g-lg-3,.gx-lg-3{--bs-gutter-x:1rem}.g-lg-3,.gy-lg-3{--bs-gutter-y:1rem}.g-lg-4,.gx-lg-4{--bs-gutter-x:1.5rem}.g-lg-4,.gy-lg-4{--bs-gutter-y:1.5rem}.g-lg-5,.gx-lg-5{--bs-gutter-x:3rem}.g-lg-5,.gy-lg-5{--bs-gutter-y:3rem}}@media (min-width:1200px){.col-xl{flex:1 0 0%}.row-cols-xl-auto>*{flex:0 0 auto;width:auto}.row-cols-xl-1>*{flex:0 0 auto;width:100%}.row-cols-xl-2>*{flex:0 0 auto;width:50%}.row-cols-xl-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-xl-4>*{flex:0 0 auto;width:25%}.row-cols-xl-5>*{flex:0 0 auto;width:20%}.row-cols-xl-6>*{flex:0 0 auto;width:16.66666667%}.col-xl-auto{flex:0 0 auto;width:auto}.col-xl-1{flex:0 0 auto;width:8.33333333%}.col-xl-2{flex:0 0 auto;width:16.66666667%}.col-xl-3{flex:0 0 auto;width:25%}.col-xl-4{flex:0 0 auto;width:33.33333333%}.col-xl-5{flex:0 0 auto;width:41.66666667%}.col-xl-6{flex:0 0 auto;width:50%}.col-xl-7{flex:0 0 auto;width:58.33333333%}.col-xl-8{flex:0 0 auto;width:66.66666667%}.col-xl-9{flex:0 0 auto;width:75%}.col-xl-10{flex:0 0 auto;width:83.33333333%}.col-xl-11{flex:0 0 auto;width:91.66666667%}.col-xl-12{flex:0 0 auto;width:100%}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333333%}.offset-xl-2{margin-left:16.66666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333333%}.offset-xl-5{margin-left:41.66666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333333%}.offset-xl-8{margin-left:66.66666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333333%}.offset-xl-11{margin-left:91.66666667%}.g-xl-0,.gx-xl-0{--bs-gutter-x:0}.g-xl-0,.gy-xl-0{--bs-gutter-y:0}.g-xl-1,.gx-xl-1{--bs-gutter-x:0.25rem}.g-xl-1,.gy-xl-1{--bs-gutter-y:0.25rem}.g-xl-2,.gx-xl-2{--bs-gutter-x:0.5rem}.g-xl-2,.gy-xl-2{--bs-gutter-y:0.5rem}.g-xl-3,.gx-xl-3{--bs-gutter-x:1rem}.g-xl-3,.gy-xl-3{--bs-gutter-y:1rem}.g-xl-4,.gx-xl-4{--bs-gutter-x:1.5rem}.g-xl-4,.gy-xl-4{--bs-gutter-y:1.5rem}.g-xl-5,.gx-xl-5{--bs-gutter-x:3rem}.g-xl-5,.gy-xl-5{--bs-gutter-y:3rem}}@media (min-width:1400px){.col-xxl{flex:1 0 0%}.row-cols-xxl-auto>*{flex:0 0 auto;width:auto}.row-cols-xxl-1>*{flex:0 0 auto;width:100%}.row-cols-xxl-2>*{flex:0 0 auto;width:50%}.row-cols-xxl-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-xxl-4>*{flex:0 0 auto;width:25%}.row-cols-xxl-5>*{flex:0 0 auto;width:20%}.row-cols-xxl-6>*{flex:0 0 auto;width:16.66666667%}.col-xxl-auto{flex:0 0 auto;width:auto}.col-xxl-1{flex:0 0 auto;width:8.33333333%}.col-xxl-2{flex:0 0 auto;width:16.66666667%}.col-xxl-3{flex:0 0 auto;width:25%}.col-xxl-4{flex:0 0 auto;width:33.33333333%}.col-xxl-5{flex:0 0 auto;width:41.66666667%}.col-xxl-6{flex:0 0 auto;width:50%}.col-xxl-7{flex:0 0 auto;width:58.33333333%}.col-xxl-8{flex:0 0 auto;width:66.66666667%}.col-xxl-9{flex:0 0 auto;width:75%}.col-xxl-10{flex:0 0 auto;width:83.33333333%}.col-xxl-11{flex:0 0 auto;width:91.66666667%}.col-xxl-12{flex:0 0 auto;width:100%}.offset-xxl-0{margin-left:0}.offset-xxl-1{margin-left:8.33333333%}.offset-xxl-2{margin-left:16.66666667%}.offset-xxl-3{margin-left:25%}.offset-xxl-4{margin-left:33.33333333%}.offset-xxl-5{margin-left:41.66666667%}.offset-xxl-6{margin-left:50%}.offset-xxl-7{margin-left:58.33333333%}.offset-xxl-8{margin-left:66.66666667%}.offset-xxl-9{margin-left:75%}.offset-xxl-10{margin-left:83.33333333%}.offset-xxl-11{margin-left:91.66666667%}.g-xxl-0,.gx-xxl-0{--bs-gutter-x:0}.g-xxl-0,.gy-xxl-0{--bs-gutter-y:0}.g-xxl-1,.gx-xxl-1{--bs-gutter-x:0.25rem}.g-xxl-1,.gy-xxl-1{--bs-gutter-y:0.25rem}.g-xxl-2,.gx-xxl-2{--bs-gutter-x:0.5rem}.g-xxl-2,.gy-xxl-2{--bs-gutter-y:0.5rem}.g-xxl-3,.gx-xxl-3{--bs-gutter-x:1rem}.g-xxl-3,.gy-xxl-3{--bs-gutter-y:1rem}.g-xxl-4,.gx-xxl-4{--bs-gutter-x:1.5rem}.g-xxl-4,.gy-xxl-4{--bs-gutter-y:1.5rem}.g-xxl-5,.gx-xxl-5{--bs-gutter-x:3rem}.g-xxl-5,.gy-xxl-5{--bs-gutter-y:3rem}}.table{--bs-table-color-type:initial;--bs-table-bg-type:initial;--bs-table-color-state:initial;--bs-table-bg-state:initial;--bs-table-color:var(--bs-emphasis-color);--bs-table-bg:var(--bs-body-bg);--bs-table-border-color:var(--bs-border-color);--bs-table-accent-bg:transparent;--bs-table-striped-color:var(--bs-emphasis-color);--bs-table-striped-bg:rgba(var(--bs-emphasis-color-rgb), 0.05);--bs-table-active-color:var(--bs-emphasis-color);--bs-table-active-bg:rgba(var(--bs-emphasis-color-rgb), 0.1);--bs-table-hover-color:var(--bs-emphasis-color);--bs-table-hover-bg:rgba(var(--bs-emphasis-color-rgb), 0.075);width:100%;margin-bottom:1rem;vertical-align:top;border-color:var(--bs-table-border-color)}.table>:not(caption)>*>*{padding:.5rem .5rem;color:var(--bs-table-color-state,var(--bs-table-color-type,var(--bs-table-color)));background-color:var(--bs-table-bg);border-bottom-width:var(--bs-border-width);box-shadow:inset 0 0 0 9999px var(--bs-table-bg-state,var(--bs-table-bg-type,var(--bs-table-accent-bg)))}.table>tbody{vertical-align:inherit}.table>thead{vertical-align:bottom}.table-group-divider{border-top:calc(var(--bs-border-width) * 2) solid currentcolor}.caption-top{caption-side:top}.table-sm>:not(caption)>*>*{padding:.25rem .25rem}.table-bordered>:not(caption)>*{border-width:var(--bs-border-width) 0}.table-bordered>:not(caption)>*>*{border-width:0 var(--bs-border-width)}.table-borderless>:not(caption)>*>*{border-bottom-width:0}.table-borderless>:not(:first-child){border-top-width:0}.table-striped>tbody>tr:nth-of-type(odd)>*{--bs-table-color-type:var(--bs-table-striped-color);--bs-table-bg-type:var(--bs-table-striped-bg)}.table-striped-columns>:not(caption)>tr>:nth-child(2n){--bs-table-color-type:var(--bs-table-striped-color);--bs-table-bg-type:var(--bs-table-striped-bg)}.table-active{--bs-table-color-state:var(--bs-table-active-color);--bs-table-bg-state:var(--bs-table-active-bg)}.table-hover>tbody>tr:hover>*{--bs-table-color-state:var(--bs-table-hover-color);--bs-table-bg-state:var(--bs-table-hover-bg)}.table-primary{--bs-table-color:#000;--bs-table-bg:#cfe2ff;--bs-table-border-color:#a6b5cc;--bs-table-striped-bg:#c5d7f2;--bs-table-striped-color:#000;--bs-table-active-bg:#bacbe6;--bs-table-active-color:#000;--bs-table-hover-bg:#bfd1ec;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-secondary{--bs-table-color:#000;--bs-table-bg:#e2e3e5;--bs-table-border-color:#b5b6b7;--bs-table-striped-bg:#d7d8da;--bs-table-striped-color:#000;--bs-table-active-bg:#cbccce;--bs-table-active-color:#000;--bs-table-hover-bg:#d1d2d4;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-success{--bs-table-color:#000;--bs-table-bg:#d1e7dd;--bs-table-border-color:#a7b9b1;--bs-table-striped-bg:#c7dbd2;--bs-table-striped-color:#000;--bs-table-active-bg:#bcd0c7;--bs-table-active-color:#000;--bs-table-hover-bg:#c1d6cc;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-info{--bs-table-color:#000;--bs-table-bg:#cff4fc;--bs-table-border-color:#a6c3ca;--bs-table-striped-bg:#c5e8ef;--bs-table-striped-color:#000;--bs-table-active-bg:#badce3;--bs-table-active-color:#000;--bs-table-hover-bg:#bfe2e9;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-warning{--bs-table-color:#000;--bs-table-bg:#fff3cd;--bs-table-border-color:#ccc2a4;--bs-table-striped-bg:#f2e7c3;--bs-table-striped-color:#000;--bs-table-active-bg:#e6dbb9;--bs-table-active-color:#000;--bs-table-hover-bg:#ece1be;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-danger{--bs-table-color:#000;--bs-table-bg:#f8d7da;--bs-table-border-color:#c6acae;--bs-table-striped-bg:#eccccf;--bs-table-striped-color:#000;--bs-table-active-bg:#dfc2c4;--bs-table-active-color:#000;--bs-table-hover-bg:#e5c7ca;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-light{--bs-table-color:#000;--bs-table-bg:#f8f9fa;--bs-table-border-color:#c6c7c8;--bs-table-striped-bg:#ecedee;--bs-table-striped-color:#000;--bs-table-active-bg:#dfe0e1;--bs-table-active-color:#000;--bs-table-hover-bg:#e5e6e7;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-dark{--bs-table-color:#fff;--bs-table-bg:#212529;--bs-table-border-color:#4d5154;--bs-table-striped-bg:#2c3034;--bs-table-striped-color:#fff;--bs-table-active-bg:#373b3e;--bs-table-active-color:#fff;--bs-table-hover-bg:#323539;--bs-table-hover-color:#fff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-responsive{overflow-x:auto;-webkit-overflow-scrolling:touch}@media (max-width:575.98px){.table-responsive-sm{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:767.98px){.table-responsive-md{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:991.98px){.table-responsive-lg{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1199.98px){.table-responsive-xl{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1399.98px){.table-responsive-xxl{overflow-x:auto;-webkit-overflow-scrolling:touch}}.form-label{margin-bottom:.5rem}.col-form-label{padding-top:calc(.375rem + var(--bs-border-width));padding-bottom:calc(.375rem + var(--bs-border-width));margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + var(--bs-border-width));padding-bottom:calc(.5rem + var(--bs-border-width));font-size:1.25rem}.col-form-label-sm{padding-top:calc(.25rem + var(--bs-border-width));padding-bottom:calc(.25rem + var(--bs-border-width));font-size:.875rem}.form-text{margin-top:.25rem;font-size:.875em;color:var(--bs-secondary-color)}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-body-bg);background-clip:padding-box;border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control[type=file]{overflow:hidden}.form-control[type=file]:not(:disabled):not([readonly]){cursor:pointer}.form-control:focus{color:var(--bs-body-color);background-color:var(--bs-body-bg);border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-control::-webkit-date-and-time-value{min-width:85px;height:1.5em;margin:0}.form-control::-webkit-datetime-edit{display:block;padding:0}.form-control::-moz-placeholder{color:var(--bs-secondary-color);opacity:1}.form-control::placeholder{color:var(--bs-secondary-color);opacity:1}.form-control:disabled{background-color:var(--bs-secondary-bg);opacity:1}.form-control::-webkit-file-upload-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:var(--bs-body-color);background-color:var(--bs-tertiary-bg);pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:var(--bs-border-width);border-radius:0;-webkit-transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}.form-control::file-selector-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:var(--bs-body-color);background-color:var(--bs-tertiary-bg);pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:var(--bs-border-width);border-radius:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control::-webkit-file-upload-button{-webkit-transition:none;transition:none}.form-control::file-selector-button{transition:none}}.form-control:hover:not(:disabled):not([readonly])::-webkit-file-upload-button{background-color:var(--bs-secondary-bg)}.form-control:hover:not(:disabled):not([readonly])::file-selector-button{background-color:var(--bs-secondary-bg)}.form-control-plaintext{display:block;width:100%;padding:.375rem 0;margin-bottom:0;line-height:1.5;color:var(--bs-body-color);background-color:transparent;border:solid transparent;border-width:var(--bs-border-width) 0}.form-control-plaintext:focus{outline:0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm{padding-right:0;padding-left:0}.form-control-sm{min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2));padding:.25rem .5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.form-control-sm::-webkit-file-upload-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-sm::file-selector-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-lg{min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));padding:.5rem 1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}.form-control-lg::-webkit-file-upload-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}.form-control-lg::file-selector-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}textarea.form-control{min-height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2))}textarea.form-control-sm{min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))}textarea.form-control-lg{min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))}.form-control-color{width:3rem;height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2));padding:.375rem}.form-control-color:not(:disabled):not([readonly]){cursor:pointer}.form-control-color::-moz-color-swatch{border:0!important;border-radius:var(--bs-border-radius)}.form-control-color::-webkit-color-swatch{border:0!important;border-radius:var(--bs-border-radius)}.form-control-color.form-control-sm{height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))}.form-control-color.form-control-lg{height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))}.form-select{--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");display:block;width:100%;padding:.375rem 2.25rem .375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-body-bg);background-image:var(--bs-form-select-bg-img),var(--bs-form-select-bg-icon,none);background-repeat:no-repeat;background-position:right .75rem center;background-size:16px 12px;border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-select{transition:none}}.form-select:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-select[multiple],.form-select[size]:not([size="1"]){padding-right:.75rem;background-image:none}.form-select:disabled{background-color:var(--bs-secondary-bg)}.form-select:-moz-focusring{color:transparent;text-shadow:0 0 0 var(--bs-body-color)}.form-select-sm{padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.form-select-lg{padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}[data-bs-theme=dark] .form-select{--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23dee2e6' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e")}.form-check{display:block;min-height:1.5rem;padding-left:1.5em;margin-bottom:.125rem}.form-check .form-check-input{float:left;margin-left:-1.5em}.form-check-reverse{padding-right:1.5em;padding-left:0;text-align:right}.form-check-reverse .form-check-input{float:right;margin-right:-1.5em;margin-left:0}.form-check-input{--bs-form-check-bg:var(--bs-body-bg);flex-shrink:0;width:1em;height:1em;margin-top:.25em;vertical-align:top;-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-form-check-bg);background-image:var(--bs-form-check-bg-image);background-repeat:no-repeat;background-position:center;background-size:contain;border:var(--bs-border-width) solid var(--bs-border-color);-webkit-print-color-adjust:exact;color-adjust:exact;print-color-adjust:exact}.form-check-input[type=checkbox]{border-radius:.25em}.form-check-input[type=radio]{border-radius:50%}.form-check-input:active{filter:brightness(90%)}.form-check-input:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-check-input:checked{background-color:#0d6efd;border-color:#0d6efd}.form-check-input:checked[type=checkbox]{--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.form-check-input:checked[type=radio]{--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")}.form-check-input[type=checkbox]:indeterminate{background-color:#0d6efd;border-color:#0d6efd;--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}.form-check-input:disabled{pointer-events:none;filter:none;opacity:.5}.form-check-input:disabled~.form-check-label,.form-check-input[disabled]~.form-check-label{cursor:default;opacity:.5}.form-switch{padding-left:2.5em}.form-switch .form-check-input{--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");width:2em;margin-left:-2.5em;background-image:var(--bs-form-switch-bg);background-position:left center;border-radius:2em;transition:background-position .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-switch .form-check-input{transition:none}}.form-switch .form-check-input:focus{--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2386b7fe'/%3e%3c/svg%3e")}.form-switch .form-check-input:checked{background-position:right center;--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")}.form-switch.form-check-reverse{padding-right:2.5em;padding-left:0}.form-switch.form-check-reverse .form-check-input{margin-right:-2.5em;margin-left:0}.form-check-inline{display:inline-block;margin-right:1rem}.btn-check{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.btn-check:disabled+.btn,.btn-check[disabled]+.btn{pointer-events:none;filter:none;opacity:.65}[data-bs-theme=dark] .form-switch .form-check-input:not(:checked):not(:focus){--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%28255, 255, 255, 0.25%29'/%3e%3c/svg%3e")}.form-range{width:100%;height:1.5rem;padding:0;-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:transparent}.form-range:focus{outline:0}.form-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range::-moz-focus-outer{border:0}.form-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;-webkit-appearance:none;appearance:none;background-color:#0d6efd;border:0;border-radius:1rem;-webkit-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-range::-webkit-slider-thumb{-webkit-transition:none;transition:none}}.form-range::-webkit-slider-thumb:active{background-color:#b6d4fe}.form-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:var(--bs-secondary-bg);border-color:transparent;border-radius:1rem}.form-range::-moz-range-thumb{width:1rem;height:1rem;-moz-appearance:none;appearance:none;background-color:#0d6efd;border:0;border-radius:1rem;-moz-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-range::-moz-range-thumb{-moz-transition:none;transition:none}}.form-range::-moz-range-thumb:active{background-color:#b6d4fe}.form-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:var(--bs-secondary-bg);border-color:transparent;border-radius:1rem}.form-range:disabled{pointer-events:none}.form-range:disabled::-webkit-slider-thumb{background-color:var(--bs-secondary-color)}.form-range:disabled::-moz-range-thumb{background-color:var(--bs-secondary-color)}.form-floating{position:relative}.form-floating>.form-control,.form-floating>.form-control-plaintext,.form-floating>.form-select{height:calc(3.5rem + calc(var(--bs-border-width) * 2));min-height:calc(3.5rem + calc(var(--bs-border-width) * 2));line-height:1.25}.form-floating>label{position:absolute;top:0;left:0;z-index:2;height:100%;padding:1rem .75rem;overflow:hidden;text-align:start;text-overflow:ellipsis;white-space:nowrap;pointer-events:none;border:var(--bs-border-width) solid transparent;transform-origin:0 0;transition:opacity .1s ease-in-out,transform .1s ease-in-out}@media (prefers-reduced-motion:reduce){.form-floating>label{transition:none}}.form-floating>.form-control,.form-floating>.form-control-plaintext{padding:1rem .75rem}.form-floating>.form-control-plaintext::-moz-placeholder,.form-floating>.form-control::-moz-placeholder{color:transparent}.form-floating>.form-control-plaintext::placeholder,.form-floating>.form-control::placeholder{color:transparent}.form-floating>.form-control-plaintext:not(:-moz-placeholder-shown),.form-floating>.form-control:not(:-moz-placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:focus,.form-floating>.form-control-plaintext:not(:placeholder-shown),.form-floating>.form-control:focus,.form-floating>.form-control:not(:placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:-webkit-autofill,.form-floating>.form-control:-webkit-autofill{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-select{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control:not(:-moz-placeholder-shown)~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label,.form-floating>.form-control:focus~label,.form-floating>.form-control:not(:placeholder-shown)~label,.form-floating>.form-select~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control:not(:-moz-placeholder-shown)~label::after{position:absolute;inset:1rem 0.375rem;z-index:-1;height:1.5em;content:"";background-color:var(--bs-body-bg);border-radius:var(--bs-border-radius)}.form-floating>.form-control-plaintext~label::after,.form-floating>.form-control:focus~label::after,.form-floating>.form-control:not(:placeholder-shown)~label::after,.form-floating>.form-select~label::after{position:absolute;inset:1rem 0.375rem;z-index:-1;height:1.5em;content:"";background-color:var(--bs-body-bg);border-radius:var(--bs-border-radius)}.form-floating>.form-control:-webkit-autofill~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label{border-width:var(--bs-border-width) 0}.form-floating>.form-control:disabled~label,.form-floating>:disabled~label{color:#6c757d}.form-floating>.form-control:disabled~label::after,.form-floating>:disabled~label::after{background-color:var(--bs-secondary-bg)}.input-group{position:relative;display:flex;flex-wrap:wrap;align-items:stretch;width:100%}.input-group>.form-control,.input-group>.form-floating,.input-group>.form-select{position:relative;flex:1 1 auto;width:1%;min-width:0}.input-group>.form-control:focus,.input-group>.form-floating:focus-within,.input-group>.form-select:focus{z-index:5}.input-group .btn{position:relative;z-index:2}.input-group .btn:focus{z-index:5}.input-group-text{display:flex;align-items:center;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);text-align:center;white-space:nowrap;background-color:var(--bs-tertiary-bg);border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius)}.input-group-lg>.btn,.input-group-lg>.form-control,.input-group-lg>.form-select,.input-group-lg>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}.input-group-sm>.btn,.input-group-sm>.form-control,.input-group-sm>.form-select,.input-group-sm>.input-group-text{padding:.25rem .5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.input-group-lg>.form-select,.input-group-sm>.form-select{padding-right:3rem}.input-group:not(.has-validation)>.dropdown-toggle:nth-last-child(n+3),.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-control,.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-select,.input-group:not(.has-validation)>:not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group.has-validation>.dropdown-toggle:nth-last-child(n+4),.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-control,.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-select,.input-group.has-validation>:nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>:not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback){margin-left:calc(var(--bs-border-width) * -1);border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.form-floating:not(:first-child)>.form-control,.input-group>.form-floating:not(:first-child)>.form-select{border-top-left-radius:0;border-bottom-left-radius:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:var(--bs-form-valid-color)}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:var(--bs-success);border-radius:var(--bs-border-radius)}.is-valid~.valid-feedback,.is-valid~.valid-tooltip,.was-validated :valid~.valid-feedback,.was-validated :valid~.valid-tooltip{display:block}.form-control.is-valid,.was-validated .form-control:valid{border-color:var(--bs-form-valid-border-color);padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-valid:focus,.was-validated .form-control:valid:focus{border-color:var(--bs-form-valid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-valid,.was-validated .form-select:valid{border-color:var(--bs-form-valid-border-color)}.form-select.is-valid:not([multiple]):not([size]),.form-select.is-valid:not([multiple])[size="1"],.was-validated .form-select:valid:not([multiple]):not([size]),.was-validated .form-select:valid:not([multiple])[size="1"]{--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");padding-right:4.125rem;background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-valid:focus,.was-validated .form-select:valid:focus{border-color:var(--bs-form-valid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.form-control-color.is-valid,.was-validated .form-control-color:valid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-valid,.was-validated .form-check-input:valid{border-color:var(--bs-form-valid-border-color)}.form-check-input.is-valid:checked,.was-validated .form-check-input:valid:checked{background-color:var(--bs-form-valid-color)}.form-check-input.is-valid:focus,.was-validated .form-check-input:valid:focus{box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:var(--bs-form-valid-color)}.form-check-inline .form-check-input~.valid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-valid,.input-group>.form-floating:not(:focus-within).is-valid,.input-group>.form-select:not(:focus).is-valid,.was-validated .input-group>.form-control:not(:focus):valid,.was-validated .input-group>.form-floating:not(:focus-within):valid,.was-validated .input-group>.form-select:not(:focus):valid{z-index:3}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:var(--bs-form-invalid-color)}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:var(--bs-danger);border-radius:var(--bs-border-radius)}.is-invalid~.invalid-feedback,.is-invalid~.invalid-tooltip,.was-validated :invalid~.invalid-feedback,.was-validated :invalid~.invalid-tooltip{display:block}.form-control.is-invalid,.was-validated .form-control:invalid{border-color:var(--bs-form-invalid-border-color);padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-invalid:focus,.was-validated .form-control:invalid:focus{border-color:var(--bs-form-invalid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-invalid,.was-validated .form-select:invalid{border-color:var(--bs-form-invalid-border-color)}.form-select.is-invalid:not([multiple]):not([size]),.form-select.is-invalid:not([multiple])[size="1"],.was-validated .form-select:invalid:not([multiple]):not([size]),.was-validated .form-select:invalid:not([multiple])[size="1"]{--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");padding-right:4.125rem;background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-invalid:focus,.was-validated .form-select:invalid:focus{border-color:var(--bs-form-invalid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.form-control-color.is-invalid,.was-validated .form-control-color:invalid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-invalid,.was-validated .form-check-input:invalid{border-color:var(--bs-form-invalid-border-color)}.form-check-input.is-invalid:checked,.was-validated .form-check-input:invalid:checked{background-color:var(--bs-form-invalid-color)}.form-check-input.is-invalid:focus,.was-validated .form-check-input:invalid:focus{box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:var(--bs-form-invalid-color)}.form-check-inline .form-check-input~.invalid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-invalid,.input-group>.form-floating:not(:focus-within).is-invalid,.input-group>.form-select:not(:focus).is-invalid,.was-validated .input-group>.form-control:not(:focus):invalid,.was-validated .input-group>.form-floating:not(:focus-within):invalid,.was-validated .input-group>.form-select:not(:focus):invalid{z-index:4}.btn{--bs-btn-padding-x:0.75rem;--bs-btn-padding-y:0.375rem;--bs-btn-font-family: ;--bs-btn-font-size:1rem;--bs-btn-font-weight:400;--bs-btn-line-height:1.5;--bs-btn-color:var(--bs-body-color);--bs-btn-bg:transparent;--bs-btn-border-width:var(--bs-border-width);--bs-btn-border-color:transparent;--bs-btn-border-radius:var(--bs-border-radius);--bs-btn-hover-border-color:transparent;--bs-btn-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.15),0 1px 1px rgba(0, 0, 0, 0.075);--bs-btn-disabled-opacity:0.65;--bs-btn-focus-box-shadow:0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;text-decoration:none;vertical-align:middle;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:hover{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn-check+.btn:hover{color:var(--bs-btn-color);background-color:var(--bs-btn-bg);border-color:var(--bs-btn-border-color)}.btn:focus-visible{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:focus-visible+.btn{border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:checked+.btn,.btn.active,.btn.show,.btn:first-child:active,:not(.btn-check)+.btn:active{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}.btn-check:checked+.btn:focus-visible,.btn.active:focus-visible,.btn.show:focus-visible,.btn:first-child:active:focus-visible,:not(.btn-check)+.btn:active:focus-visible{box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:checked:focus-visible+.btn{box-shadow:var(--bs-btn-focus-box-shadow)}.btn.disabled,.btn:disabled,fieldset:disabled .btn{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}.btn-primary{--bs-btn-color:#fff;--bs-btn-bg:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0b5ed7;--bs-btn-hover-border-color:#0a58ca;--bs-btn-focus-shadow-rgb:49,132,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0a58ca;--bs-btn-active-border-color:#0a53be;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#0d6efd;--bs-btn-disabled-border-color:#0d6efd}.btn-secondary{--bs-btn-color:#fff;--bs-btn-bg:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#5c636a;--bs-btn-hover-border-color:#565e64;--bs-btn-focus-shadow-rgb:130,138,145;--bs-btn-active-color:#fff;--bs-btn-active-bg:#565e64;--bs-btn-active-border-color:#51585e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#6c757d;--bs-btn-disabled-border-color:#6c757d}.btn-success{--bs-btn-color:#fff;--bs-btn-bg:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#157347;--bs-btn-hover-border-color:#146c43;--bs-btn-focus-shadow-rgb:60,153,110;--bs-btn-active-color:#fff;--bs-btn-active-bg:#146c43;--bs-btn-active-border-color:#13653f;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#198754;--bs-btn-disabled-border-color:#198754}.btn-info{--bs-btn-color:#000;--bs-btn-bg:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#31d2f2;--bs-btn-hover-border-color:#25cff2;--bs-btn-focus-shadow-rgb:11,172,204;--bs-btn-active-color:#000;--bs-btn-active-bg:#3dd5f3;--bs-btn-active-border-color:#25cff2;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#0dcaf0;--bs-btn-disabled-border-color:#0dcaf0}.btn-warning{--bs-btn-color:#000;--bs-btn-bg:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffca2c;--bs-btn-hover-border-color:#ffc720;--bs-btn-focus-shadow-rgb:217,164,6;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffcd39;--bs-btn-active-border-color:#ffc720;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#ffc107;--bs-btn-disabled-border-color:#ffc107}.btn-danger{--bs-btn-color:#fff;--bs-btn-bg:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#bb2d3b;--bs-btn-hover-border-color:#b02a37;--bs-btn-focus-shadow-rgb:225,83,97;--bs-btn-active-color:#fff;--bs-btn-active-bg:#b02a37;--bs-btn-active-border-color:#a52834;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#dc3545;--bs-btn-disabled-border-color:#dc3545}.btn-light{--bs-btn-color:#000;--bs-btn-bg:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#d3d4d5;--bs-btn-hover-border-color:#c6c7c8;--bs-btn-focus-shadow-rgb:211,212,213;--bs-btn-active-color:#000;--bs-btn-active-bg:#c6c7c8;--bs-btn-active-border-color:#babbbc;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#f8f9fa;--bs-btn-disabled-border-color:#f8f9fa}.btn-dark{--bs-btn-color:#fff;--bs-btn-bg:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#424649;--bs-btn-hover-border-color:#373b3e;--bs-btn-focus-shadow-rgb:66,70,73;--bs-btn-active-color:#fff;--bs-btn-active-bg:#4d5154;--bs-btn-active-border-color:#373b3e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#212529;--bs-btn-disabled-border-color:#212529}.btn-outline-primary{--bs-btn-color:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0d6efd;--bs-btn-hover-border-color:#0d6efd;--bs-btn-focus-shadow-rgb:13,110,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0d6efd;--bs-btn-active-border-color:#0d6efd;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0d6efd;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0d6efd;--bs-gradient:none}.btn-outline-secondary{--bs-btn-color:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#6c757d;--bs-btn-hover-border-color:#6c757d;--bs-btn-focus-shadow-rgb:108,117,125;--bs-btn-active-color:#fff;--bs-btn-active-bg:#6c757d;--bs-btn-active-border-color:#6c757d;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#6c757d;--bs-gradient:none}.btn-outline-success{--bs-btn-color:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#198754;--bs-btn-hover-border-color:#198754;--bs-btn-focus-shadow-rgb:25,135,84;--bs-btn-active-color:#fff;--bs-btn-active-bg:#198754;--bs-btn-active-border-color:#198754;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#198754;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#198754;--bs-gradient:none}.btn-outline-info{--bs-btn-color:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#0dcaf0;--bs-btn-hover-border-color:#0dcaf0;--bs-btn-focus-shadow-rgb:13,202,240;--bs-btn-active-color:#000;--bs-btn-active-bg:#0dcaf0;--bs-btn-active-border-color:#0dcaf0;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0dcaf0;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0dcaf0;--bs-gradient:none}.btn-outline-warning{--bs-btn-color:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffc107;--bs-btn-hover-border-color:#ffc107;--bs-btn-focus-shadow-rgb:255,193,7;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffc107;--bs-btn-active-border-color:#ffc107;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#ffc107;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#ffc107;--bs-gradient:none}.btn-outline-danger{--bs-btn-color:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#dc3545;--bs-btn-hover-border-color:#dc3545;--bs-btn-focus-shadow-rgb:220,53,69;--bs-btn-active-color:#fff;--bs-btn-active-bg:#dc3545;--bs-btn-active-border-color:#dc3545;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#dc3545;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#dc3545;--bs-gradient:none}.btn-outline-light{--bs-btn-color:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#f8f9fa;--bs-btn-hover-border-color:#f8f9fa;--bs-btn-focus-shadow-rgb:248,249,250;--bs-btn-active-color:#000;--bs-btn-active-bg:#f8f9fa;--bs-btn-active-border-color:#f8f9fa;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#f8f9fa;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#f8f9fa;--bs-gradient:none}.btn-outline-dark{--bs-btn-color:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#212529;--bs-btn-hover-border-color:#212529;--bs-btn-focus-shadow-rgb:33,37,41;--bs-btn-active-color:#fff;--bs-btn-active-bg:#212529;--bs-btn-active-border-color:#212529;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#212529;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#212529;--bs-gradient:none}.btn-link{--bs-btn-font-weight:400;--bs-btn-color:var(--bs-link-color);--bs-btn-bg:transparent;--bs-btn-border-color:transparent;--bs-btn-hover-color:var(--bs-link-hover-color);--bs-btn-hover-border-color:transparent;--bs-btn-active-color:var(--bs-link-hover-color);--bs-btn-active-border-color:transparent;--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-border-color:transparent;--bs-btn-box-shadow:0 0 0 #000;--bs-btn-focus-shadow-rgb:49,132,253;text-decoration:underline}.btn-link:focus-visible{color:var(--bs-btn-color)}.btn-link:hover{color:var(--bs-btn-hover-color)}.btn-group-lg>.btn,.btn-lg{--bs-btn-padding-y:0.5rem;--bs-btn-padding-x:1rem;--bs-btn-font-size:1.25rem;--bs-btn-border-radius:var(--bs-border-radius-lg)}.btn-group-sm>.btn,.btn-sm{--bs-btn-padding-y:0.25rem;--bs-btn-padding-x:0.5rem;--bs-btn-font-size:0.875rem;--bs-btn-border-radius:var(--bs-border-radius-sm)}.fade{transition:opacity .15s linear}@media (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{height:0;overflow:hidden;transition:height .35s ease}@media (prefers-reduced-motion:reduce){.collapsing{transition:none}}.collapsing.collapse-horizontal{width:0;height:auto;transition:width .35s ease}@media (prefers-reduced-motion:reduce){.collapsing.collapse-horizontal{transition:none}}.dropdown,.dropdown-center,.dropend,.dropstart,.dropup,.dropup-center{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{--bs-dropdown-zindex:1000;--bs-dropdown-min-width:10rem;--bs-dropdown-padding-x:0;--bs-dropdown-padding-y:0.5rem;--bs-dropdown-spacer:0.125rem;--bs-dropdown-font-size:1rem;--bs-dropdown-color:var(--bs-body-color);--bs-dropdown-bg:var(--bs-body-bg);--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-border-radius:var(--bs-border-radius);--bs-dropdown-border-width:var(--bs-border-width);--bs-dropdown-inner-border-radius:calc(var(--bs-border-radius) - var(--bs-border-width));--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-divider-margin-y:0.5rem;--bs-dropdown-box-shadow:var(--bs-box-shadow);--bs-dropdown-link-color:var(--bs-body-color);--bs-dropdown-link-hover-color:var(--bs-body-color);--bs-dropdown-link-hover-bg:var(--bs-tertiary-bg);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:var(--bs-tertiary-color);--bs-dropdown-item-padding-x:1rem;--bs-dropdown-item-padding-y:0.25rem;--bs-dropdown-header-color:#6c757d;--bs-dropdown-header-padding-x:1rem;--bs-dropdown-header-padding-y:0.5rem;position:absolute;z-index:var(--bs-dropdown-zindex);display:none;min-width:var(--bs-dropdown-min-width);padding:var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);margin:0;font-size:var(--bs-dropdown-font-size);color:var(--bs-dropdown-color);text-align:left;list-style:none;background-color:var(--bs-dropdown-bg);background-clip:padding-box;border:var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);border-radius:var(--bs-dropdown-border-radius)}.dropdown-menu[data-bs-popper]{top:100%;left:0;margin-top:var(--bs-dropdown-spacer)}.dropdown-menu-start{--bs-position:start}.dropdown-menu-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-end{--bs-position:end}.dropdown-menu-end[data-bs-popper]{right:0;left:auto}@media (min-width:576px){.dropdown-menu-sm-start{--bs-position:start}.dropdown-menu-sm-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-sm-end{--bs-position:end}.dropdown-menu-sm-end[data-bs-popper]{right:0;left:auto}}@media (min-width:768px){.dropdown-menu-md-start{--bs-position:start}.dropdown-menu-md-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-md-end{--bs-position:end}.dropdown-menu-md-end[data-bs-popper]{right:0;left:auto}}@media (min-width:992px){.dropdown-menu-lg-start{--bs-position:start}.dropdown-menu-lg-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-lg-end{--bs-position:end}.dropdown-menu-lg-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1200px){.dropdown-menu-xl-start{--bs-position:start}.dropdown-menu-xl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xl-end{--bs-position:end}.dropdown-menu-xl-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1400px){.dropdown-menu-xxl-start{--bs-position:start}.dropdown-menu-xxl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xxl-end{--bs-position:end}.dropdown-menu-xxl-end[data-bs-popper]{right:0;left:auto}}.dropup .dropdown-menu[data-bs-popper]{top:auto;bottom:100%;margin-top:0;margin-bottom:var(--bs-dropdown-spacer)}.dropup .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-menu[data-bs-popper]{top:0;right:auto;left:100%;margin-top:0;margin-left:var(--bs-dropdown-spacer)}.dropend .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropend .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-toggle::after{vertical-align:0}.dropstart .dropdown-menu[data-bs-popper]{top:0;right:100%;left:auto;margin-top:0;margin-right:var(--bs-dropdown-spacer)}.dropstart .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:""}.dropstart .dropdown-toggle::after{display:none}.dropstart .dropdown-toggle::before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropstart .dropdown-toggle:empty::after{margin-left:0}.dropstart .dropdown-toggle::before{vertical-align:0}.dropdown-divider{height:0;margin:var(--bs-dropdown-divider-margin-y) 0;overflow:hidden;border-top:1px solid var(--bs-dropdown-divider-bg);opacity:1}.dropdown-item{display:block;width:100%;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);clear:both;font-weight:400;color:var(--bs-dropdown-link-color);text-align:inherit;text-decoration:none;white-space:nowrap;background-color:transparent;border:0;border-radius:var(--bs-dropdown-item-border-radius,0)}.dropdown-item:focus,.dropdown-item:hover{color:var(--bs-dropdown-link-hover-color);background-color:var(--bs-dropdown-link-hover-bg)}.dropdown-item.active,.dropdown-item:active{color:var(--bs-dropdown-link-active-color);text-decoration:none;background-color:var(--bs-dropdown-link-active-bg)}.dropdown-item.disabled,.dropdown-item:disabled{color:var(--bs-dropdown-link-disabled-color);pointer-events:none;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);margin-bottom:0;font-size:.875rem;color:var(--bs-dropdown-header-color);white-space:nowrap}.dropdown-item-text{display:block;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);color:var(--bs-dropdown-link-color)}.dropdown-menu-dark{--bs-dropdown-color:#dee2e6;--bs-dropdown-bg:#343a40;--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-box-shadow: ;--bs-dropdown-link-color:#dee2e6;--bs-dropdown-link-hover-color:#fff;--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-link-hover-bg:rgba(255, 255, 255, 0.15);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-header-color:#adb5bd}.btn-group,.btn-group-vertical{position:relative;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;flex:1 1 auto}.btn-group-vertical>.btn-check:checked+.btn,.btn-group-vertical>.btn-check:focus+.btn,.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:hover,.btn-group>.btn-check:checked+.btn,.btn-group>.btn-check:focus+.btn,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus,.btn-group>.btn:hover{z-index:1}.btn-toolbar{display:flex;flex-wrap:wrap;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group{border-radius:var(--bs-border-radius)}.btn-group>.btn-group:not(:first-child),.btn-group>:not(.btn-check:first-child)+.btn{margin-left:calc(var(--bs-border-width) * -1)}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn.dropdown-toggle-split:first-child,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:nth-child(n+3),.btn-group>:not(.btn-check)+.btn{border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropend .dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after{margin-left:0}.dropstart .dropdown-toggle-split::before{margin-right:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{flex-direction:column;align-items:flex-start;justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn-group:not(:first-child),.btn-group-vertical>.btn:not(:first-child){margin-top:calc(var(--bs-border-width) * -1)}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn~.btn{border-top-left-radius:0;border-top-right-radius:0}.nav{--bs-nav-link-padding-x:1rem;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-link-color);--bs-nav-link-hover-color:var(--bs-link-hover-color);--bs-nav-link-disabled-color:var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);text-decoration:none;background:0 0;border:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out}@media (prefers-reduced-motion:reduce){.nav-link{transition:none}}.nav-link:focus,.nav-link:hover{color:var(--bs-nav-link-hover-color)}.nav-link:focus-visible{outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.nav-link.disabled,.nav-link:disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}.nav-tabs{--bs-nav-tabs-border-width:var(--bs-border-width);--bs-nav-tabs-border-color:var(--bs-border-color);--bs-nav-tabs-border-radius:var(--bs-border-radius);--bs-nav-tabs-link-hover-border-color:var(--bs-secondary-bg) var(--bs-secondary-bg) var(--bs-border-color);--bs-nav-tabs-link-active-color:var(--bs-emphasis-color);--bs-nav-tabs-link-active-bg:var(--bs-body-bg);--bs-nav-tabs-link-active-border-color:var(--bs-border-color) var(--bs-border-color) var(--bs-body-bg);border-bottom:var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color)}.nav-tabs .nav-link{margin-bottom:calc(-1 * var(--bs-nav-tabs-border-width));border:var(--bs-nav-tabs-border-width) solid transparent;border-top-left-radius:var(--bs-nav-tabs-border-radius);border-top-right-radius:var(--bs-nav-tabs-border-radius)}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{isolation:isolate;border-color:var(--bs-nav-tabs-link-hover-border-color)}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:var(--bs-nav-tabs-link-active-color);background-color:var(--bs-nav-tabs-link-active-bg);border-color:var(--bs-nav-tabs-link-active-border-color)}.nav-tabs .dropdown-menu{margin-top:calc(-1 * var(--bs-nav-tabs-border-width));border-top-left-radius:0;border-top-right-radius:0}.nav-pills{--bs-nav-pills-border-radius:var(--bs-border-radius);--bs-nav-pills-link-active-color:#fff;--bs-nav-pills-link-active-bg:#0d6efd}.nav-pills .nav-link{border-radius:var(--bs-nav-pills-border-radius)}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:var(--bs-nav-pills-link-active-color);background-color:var(--bs-nav-pills-link-active-bg)}.nav-underline{--bs-nav-underline-gap:1rem;--bs-nav-underline-border-width:0.125rem;--bs-nav-underline-link-active-color:var(--bs-emphasis-color);gap:var(--bs-nav-underline-gap)}.nav-underline .nav-link{padding-right:0;padding-left:0;border-bottom:var(--bs-nav-underline-border-width) solid transparent}.nav-underline .nav-link:focus,.nav-underline .nav-link:hover{border-bottom-color:currentcolor}.nav-underline .nav-link.active,.nav-underline .show>.nav-link{font-weight:700;color:var(--bs-nav-underline-link-active-color);border-bottom-color:currentcolor}.nav-fill .nav-item,.nav-fill>.nav-link{flex:1 1 auto;text-align:center}.nav-justified .nav-item,.nav-justified>.nav-link{flex-basis:0;flex-grow:1;text-align:center}.nav-fill .nav-item .nav-link,.nav-justified .nav-item .nav-link{width:100%}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{--bs-navbar-padding-x:0;--bs-navbar-padding-y:0.5rem;--bs-navbar-color:rgba(var(--bs-emphasis-color-rgb), 0.65);--bs-navbar-hover-color:rgba(var(--bs-emphasis-color-rgb), 0.8);--bs-navbar-disabled-color:rgba(var(--bs-emphasis-color-rgb), 0.3);--bs-navbar-active-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-padding-y:0.3125rem;--bs-navbar-brand-margin-end:1rem;--bs-navbar-brand-font-size:1.25rem;--bs-navbar-brand-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-hover-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-nav-link-padding-x:0.5rem;--bs-navbar-toggler-padding-y:0.25rem;--bs-navbar-toggler-padding-x:0.75rem;--bs-navbar-toggler-font-size:1.25rem;--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2833, 37, 41, 0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color:rgba(var(--bs-emphasis-color-rgb), 0.15);--bs-navbar-toggler-border-radius:var(--bs-border-radius);--bs-navbar-toggler-focus-width:0.25rem;--bs-navbar-toggler-transition:box-shadow 0.15s ease-in-out;position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg,.navbar>.container-md,.navbar>.container-sm,.navbar>.container-xl,.navbar>.container-xxl{display:flex;flex-wrap:inherit;align-items:center;justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);text-decoration:none;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{color:var(--bs-navbar-brand-hover-color)}.navbar-nav{--bs-nav-link-padding-x:0;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-navbar-color);--bs-nav-link-hover-color:var(--bs-navbar-hover-color);--bs-nav-link-disabled-color:var(--bs-navbar-disabled-color);display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link.active,.navbar-nav .nav-link.show{color:var(--bs-navbar-active-color)}.navbar-nav .dropdown-menu{position:static}.navbar-text{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-navbar-color)}.navbar-text a,.navbar-text a:focus,.navbar-text a:hover{color:var(--bs-navbar-active-color)}.navbar-collapse{flex-basis:100%;flex-grow:1;align-items:center}.navbar-toggler{padding:var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);font-size:var(--bs-navbar-toggler-font-size);line-height:1;color:var(--bs-navbar-color);background-color:transparent;border:var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);border-radius:var(--bs-navbar-toggler-border-radius);transition:var(--bs-navbar-toggler-transition)}@media (prefers-reduced-motion:reduce){.navbar-toggler{transition:none}}.navbar-toggler:hover{text-decoration:none}.navbar-toggler:focus{text-decoration:none;outline:0;box-shadow:0 0 0 var(--bs-navbar-toggler-focus-width)}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;background-image:var(--bs-navbar-toggler-icon-bg);background-repeat:no-repeat;background-position:center;background-size:100%}.navbar-nav-scroll{max-height:var(--bs-scroll-height,75vh);overflow-y:auto}@media (min-width:576px){.navbar-expand-sm{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-sm .navbar-nav-scroll{overflow:visible}.navbar-expand-sm .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-sm .offcanvas .offcanvas-header{display:none}.navbar-expand-sm .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:768px){.navbar-expand-md{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-md .navbar-nav-scroll{overflow:visible}.navbar-expand-md .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-md .offcanvas .offcanvas-header{display:none}.navbar-expand-md .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:992px){.navbar-expand-lg{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .navbar-nav-scroll{overflow:visible}.navbar-expand-lg .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1200px){.navbar-expand-xl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xl .navbar-nav-scroll{overflow:visible}.navbar-expand-xl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xl .offcanvas .offcanvas-header{display:none}.navbar-expand-xl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1400px){.navbar-expand-xxl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xxl .navbar-nav{flex-direction:row}.navbar-expand-xxl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xxl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xxl .navbar-nav-scroll{overflow:visible}.navbar-expand-xxl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xxl .navbar-toggler{display:none}.navbar-expand-xxl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xxl .offcanvas .offcanvas-header{display:none}.navbar-expand-xxl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}.navbar-expand{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand .navbar-nav{flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand .navbar-nav-scroll{overflow:visible}.navbar-expand .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-expand .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand .offcanvas .offcanvas-header{display:none}.navbar-expand .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}.navbar-dark,.navbar[data-bs-theme=dark]{--bs-navbar-color:rgba(255, 255, 255, 0.55);--bs-navbar-hover-color:rgba(255, 255, 255, 0.75);--bs-navbar-disabled-color:rgba(255, 255, 255, 0.25);--bs-navbar-active-color:#fff;--bs-navbar-brand-color:#fff;--bs-navbar-brand-hover-color:#fff;--bs-navbar-toggler-border-color:rgba(255, 255, 255, 0.1);--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}[data-bs-theme=dark] .navbar-toggler-icon{--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y:1rem;--bs-card-spacer-x:1rem;--bs-card-title-spacer-y:0.5rem;--bs-card-title-color: ;--bs-card-subtitle-color: ;--bs-card-border-width:var(--bs-border-width);--bs-card-border-color:var(--bs-border-color-translucent);--bs-card-border-radius:var(--bs-border-radius);--bs-card-box-shadow: ;--bs-card-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-card-cap-padding-y:0.5rem;--bs-card-cap-padding-x:1rem;--bs-card-cap-bg:rgba(var(--bs-body-color-rgb), 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg:var(--bs-body-bg);--bs-card-img-overlay-padding:1rem;--bs-card-group-margin:0.75rem;position:relative;display:flex;flex-direction:column;min-width:0;height:var(--bs-card-height);color:var(--bs-body-color);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}.card>hr{margin-right:0;margin-left:0}.card>.list-group{border-top:inherit;border-bottom:inherit}.card>.list-group:first-child{border-top-width:0;border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card>.list-group:last-child{border-bottom-width:0;border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card>.card-header+.list-group,.card>.list-group+.card-footer{border-top:0}.card-body{flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}.card-title{margin-bottom:var(--bs-card-title-spacer-y);color:var(--bs-card-title-color)}.card-subtitle{margin-top:calc(-.5 * var(--bs-card-title-spacer-y));margin-bottom:0;color:var(--bs-card-subtitle-color)}.card-text:last-child{margin-bottom:0}.card-link+.card-link{margin-left:var(--bs-card-spacer-x)}.card-header{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);margin-bottom:0;color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-bottom:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-header:first-child{border-radius:var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0}.card-footer{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-top:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-footer:last-child{border-radius:0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius)}.card-header-tabs{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-bottom:calc(-1 * var(--bs-card-cap-padding-y));margin-left:calc(-.5 * var(--bs-card-cap-padding-x));border-bottom:0}.card-header-tabs .nav-link.active{background-color:var(--bs-card-bg);border-bottom-color:var(--bs-card-bg)}.card-header-pills{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-left:calc(-.5 * var(--bs-card-cap-padding-x))}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:var(--bs-card-img-overlay-padding);border-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom,.card-img-top{width:100%}.card-img,.card-img-top{border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom{border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card-group>.card{margin-bottom:var(--bs-card-group-margin)}@media (min-width:576px){.card-group{display:flex;flex-flow:row wrap}.card-group>.card{flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child) .card-header,.card-group>.card:not(:last-child) .card-img-top{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-footer,.card-group>.card:not(:last-child) .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child) .card-header,.card-group>.card:not(:first-child) .card-img-top{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-footer,.card-group>.card:not(:first-child) .card-img-bottom{border-bottom-left-radius:0}}.accordion{--bs-accordion-color:var(--bs-body-color);--bs-accordion-bg:var(--bs-body-bg);--bs-accordion-transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out,border-radius 0.15s ease;--bs-accordion-border-color:var(--bs-border-color);--bs-accordion-border-width:var(--bs-border-width);--bs-accordion-border-radius:var(--bs-border-radius);--bs-accordion-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-accordion-btn-padding-x:1.25rem;--bs-accordion-btn-padding-y:1rem;--bs-accordion-btn-color:var(--bs-body-color);--bs-accordion-btn-bg:var(--bs-accordion-bg);--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='none' stroke='%23212529' stroke-linecap='round' stroke-linejoin='round'%3e%3cpath d='M2 5L8 11L14 5'/%3e%3c/svg%3e");--bs-accordion-btn-icon-width:1.25rem;--bs-accordion-btn-icon-transform:rotate(-180deg);--bs-accordion-btn-icon-transition:transform 0.2s ease-in-out;--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='none' stroke='%23052c65' stroke-linecap='round' stroke-linejoin='round'%3e%3cpath d='M2 5L8 11L14 5'/%3e%3c/svg%3e");--bs-accordion-btn-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-accordion-body-padding-x:1.25rem;--bs-accordion-body-padding-y:1rem;--bs-accordion-active-color:var(--bs-primary-text-emphasis);--bs-accordion-active-bg:var(--bs-primary-bg-subtle)}.accordion-button{position:relative;display:flex;align-items:center;width:100%;padding:var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);font-size:1rem;color:var(--bs-accordion-btn-color);text-align:left;background-color:var(--bs-accordion-btn-bg);border:0;border-radius:0;overflow-anchor:none;transition:var(--bs-accordion-transition)}@media (prefers-reduced-motion:reduce){.accordion-button{transition:none}}.accordion-button:not(.collapsed){color:var(--bs-accordion-active-color);background-color:var(--bs-accordion-active-bg);box-shadow:inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color)}.accordion-button:not(.collapsed)::after{background-image:var(--bs-accordion-btn-active-icon);transform:var(--bs-accordion-btn-icon-transform)}.accordion-button::after{flex-shrink:0;width:var(--bs-accordion-btn-icon-width);height:var(--bs-accordion-btn-icon-width);margin-left:auto;content:"";background-image:var(--bs-accordion-btn-icon);background-repeat:no-repeat;background-size:var(--bs-accordion-btn-icon-width);transition:var(--bs-accordion-btn-icon-transition)}@media (prefers-reduced-motion:reduce){.accordion-button::after{transition:none}}.accordion-button:hover{z-index:2}.accordion-button:focus{z-index:3;outline:0;box-shadow:var(--bs-accordion-btn-focus-box-shadow)}.accordion-header{margin-bottom:0}.accordion-item{color:var(--bs-accordion-color);background-color:var(--bs-accordion-bg);border:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)}.accordion-item:first-of-type{border-top-left-radius:var(--bs-accordion-border-radius);border-top-right-radius:var(--bs-accordion-border-radius)}.accordion-item:first-of-type>.accordion-header .accordion-button{border-top-left-radius:var(--bs-accordion-inner-border-radius);border-top-right-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:not(:first-of-type){border-top:0}.accordion-item:last-of-type{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-item:last-of-type>.accordion-header .accordion-button.collapsed{border-bottom-right-radius:var(--bs-accordion-inner-border-radius);border-bottom-left-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:last-of-type>.accordion-collapse{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-body{padding:var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x)}.accordion-flush>.accordion-item{border-right:0;border-left:0;border-radius:0}.accordion-flush>.accordion-item:first-child{border-top:0}.accordion-flush>.accordion-item:last-child{border-bottom:0}.accordion-flush>.accordion-item>.accordion-header .accordion-button,.accordion-flush>.accordion-item>.accordion-header .accordion-button.collapsed{border-radius:0}.accordion-flush>.accordion-item>.accordion-collapse{border-radius:0}[data-bs-theme=dark] .accordion-button::after{--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.breadcrumb{--bs-breadcrumb-padding-x:0;--bs-breadcrumb-padding-y:0;--bs-breadcrumb-margin-bottom:1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color:var(--bs-secondary-color);--bs-breadcrumb-item-padding-x:0.5rem;--bs-breadcrumb-item-active-color:var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, "/")}.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}.pagination{--bs-pagination-padding-x:0.75rem;--bs-pagination-padding-y:0.375rem;--bs-pagination-font-size:1rem;--bs-pagination-color:var(--bs-link-color);--bs-pagination-bg:var(--bs-body-bg);--bs-pagination-border-width:var(--bs-border-width);--bs-pagination-border-color:var(--bs-border-color);--bs-pagination-border-radius:var(--bs-border-radius);--bs-pagination-hover-color:var(--bs-link-hover-color);--bs-pagination-hover-bg:var(--bs-tertiary-bg);--bs-pagination-hover-border-color:var(--bs-border-color);--bs-pagination-focus-color:var(--bs-link-hover-color);--bs-pagination-focus-bg:var(--bs-secondary-bg);--bs-pagination-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-pagination-active-color:#fff;--bs-pagination-active-bg:#0d6efd;--bs-pagination-active-border-color:#0d6efd;--bs-pagination-disabled-color:var(--bs-secondary-color);--bs-pagination-disabled-bg:var(--bs-secondary-bg);--bs-pagination-disabled-border-color:var(--bs-border-color);display:flex;padding-left:0;list-style:none}.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);text-decoration:none;background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.page-link{transition:none}}.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}.active>.page-link,.page-link.active{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}.disabled>.page-link,.page-link.disabled{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}.page-item:not(:first-child) .page-link{margin-left:calc(var(--bs-border-width) * -1)}.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}.pagination-lg{--bs-pagination-padding-x:1.5rem;--bs-pagination-padding-y:0.75rem;--bs-pagination-font-size:1.25rem;--bs-pagination-border-radius:var(--bs-border-radius-lg)}.pagination-sm{--bs-pagination-padding-x:0.5rem;--bs-pagination-padding-y:0.25rem;--bs-pagination-font-size:0.875rem;--bs-pagination-border-radius:var(--bs-border-radius-sm)}.badge{--bs-badge-padding-x:0.65em;--bs-badge-padding-y:0.35em;--bs-badge-font-size:0.75em;--bs-badge-font-weight:700;--bs-badge-color:#fff;--bs-badge-border-radius:var(--bs-border-radius);display:inline-block;padding:var(--bs-badge-padding-y) var(--bs-badge-padding-x);font-size:var(--bs-badge-font-size);font-weight:var(--bs-badge-font-weight);line-height:1;color:var(--bs-badge-color);text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:var(--bs-badge-border-radius)}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.alert{--bs-alert-bg:transparent;--bs-alert-padding-x:1rem;--bs-alert-padding-y:1rem;--bs-alert-margin-bottom:1rem;--bs-alert-color:inherit;--bs-alert-border-color:transparent;--bs-alert-border:var(--bs-border-width) solid var(--bs-alert-border-color);--bs-alert-border-radius:var(--bs-border-radius);--bs-alert-link-color:inherit;position:relative;padding:var(--bs-alert-padding-y) var(--bs-alert-padding-x);margin-bottom:var(--bs-alert-margin-bottom);color:var(--bs-alert-color);background-color:var(--bs-alert-bg);border:var(--bs-alert-border);border-radius:var(--bs-alert-border-radius)}.alert-heading{color:inherit}.alert-link{font-weight:700;color:var(--bs-alert-link-color)}.alert-dismissible{padding-right:3rem}.alert-dismissible .btn-close{position:absolute;top:0;right:0;z-index:2;padding:1.25rem 1rem}.alert-primary{--bs-alert-color:var(--bs-primary-text-emphasis);--bs-alert-bg:var(--bs-primary-bg-subtle);--bs-alert-border-color:var(--bs-primary-border-subtle);--bs-alert-link-color:var(--bs-primary-text-emphasis)}.alert-secondary{--bs-alert-color:var(--bs-secondary-text-emphasis);--bs-alert-bg:var(--bs-secondary-bg-subtle);--bs-alert-border-color:var(--bs-secondary-border-subtle);--bs-alert-link-color:var(--bs-secondary-text-emphasis)}.alert-success{--bs-alert-color:var(--bs-success-text-emphasis);--bs-alert-bg:var(--bs-success-bg-subtle);--bs-alert-border-color:var(--bs-success-border-subtle);--bs-alert-link-color:var(--bs-success-text-emphasis)}.alert-info{--bs-alert-color:var(--bs-info-text-emphasis);--bs-alert-bg:var(--bs-info-bg-subtle);--bs-alert-border-color:var(--bs-info-border-subtle);--bs-alert-link-color:var(--bs-info-text-emphasis)}.alert-warning{--bs-alert-color:var(--bs-warning-text-emphasis);--bs-alert-bg:var(--bs-warning-bg-subtle);--bs-alert-border-color:var(--bs-warning-border-subtle);--bs-alert-link-color:var(--bs-warning-text-emphasis)}.alert-danger{--bs-alert-color:var(--bs-danger-text-emphasis);--bs-alert-bg:var(--bs-danger-bg-subtle);--bs-alert-border-color:var(--bs-danger-border-subtle);--bs-alert-link-color:var(--bs-danger-text-emphasis)}.alert-light{--bs-alert-color:var(--bs-light-text-emphasis);--bs-alert-bg:var(--bs-light-bg-subtle);--bs-alert-border-color:var(--bs-light-border-subtle);--bs-alert-link-color:var(--bs-light-text-emphasis)}.alert-dark{--bs-alert-color:var(--bs-dark-text-emphasis);--bs-alert-bg:var(--bs-dark-bg-subtle);--bs-alert-border-color:var(--bs-dark-border-subtle);--bs-alert-link-color:var(--bs-dark-text-emphasis)}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.progress,.progress-stacked{--bs-progress-height:1rem;--bs-progress-font-size:0.75rem;--bs-progress-bg:var(--bs-secondary-bg);--bs-progress-border-radius:var(--bs-border-radius);--bs-progress-box-shadow:var(--bs-box-shadow-inset);--bs-progress-bar-color:#fff;--bs-progress-bar-bg:#0d6efd;--bs-progress-bar-transition:width 0.6s ease;display:flex;height:var(--bs-progress-height);overflow:hidden;font-size:var(--bs-progress-font-size);background-color:var(--bs-progress-bg);border-radius:var(--bs-progress-border-radius)}.progress-bar{display:flex;flex-direction:column;justify-content:center;overflow:hidden;color:var(--bs-progress-bar-color);text-align:center;white-space:nowrap;background-color:var(--bs-progress-bar-bg);transition:var(--bs-progress-bar-transition)}@media (prefers-reduced-motion:reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:var(--bs-progress-height) var(--bs-progress-height)}.progress-stacked>.progress{overflow:visible}.progress-stacked>.progress>.progress-bar{width:100%}.progress-bar-animated{animation:1s linear infinite progress-bar-stripes}@media (prefers-reduced-motion:reduce){.progress-bar-animated{animation:none}}.list-group{--bs-list-group-color:var(--bs-body-color);--bs-list-group-bg:var(--bs-body-bg);--bs-list-group-border-color:var(--bs-border-color);--bs-list-group-border-width:var(--bs-border-width);--bs-list-group-border-radius:var(--bs-border-radius);--bs-list-group-item-padding-x:1rem;--bs-list-group-item-padding-y:0.5rem;--bs-list-group-action-color:var(--bs-secondary-color);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-tertiary-bg);--bs-list-group-action-active-color:var(--bs-body-color);--bs-list-group-action-active-bg:var(--bs-secondary-bg);--bs-list-group-disabled-color:var(--bs-secondary-color);--bs-list-group-disabled-bg:var(--bs-body-bg);--bs-list-group-active-color:#fff;--bs-list-group-active-bg:#0d6efd;--bs-list-group-active-border-color:#0d6efd;display:flex;flex-direction:column;padding-left:0;margin-bottom:0;border-radius:var(--bs-list-group-border-radius)}.list-group-numbered{list-style-type:none;counter-reset:section}.list-group-numbered>.list-group-item::before{content:counters(section, ".") ". ";counter-increment:section}.list-group-item-action{width:100%;color:var(--bs-list-group-action-color);text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{z-index:1;color:var(--bs-list-group-action-hover-color);text-decoration:none;background-color:var(--bs-list-group-action-hover-bg)}.list-group-item-action:active{color:var(--bs-list-group-action-active-color);background-color:var(--bs-list-group-action-active-bg)}.list-group-item{position:relative;display:block;padding:var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);color:var(--bs-list-group-color);text-decoration:none;background-color:var(--bs-list-group-bg);border:var(--bs-list-group-border-width) solid var(--bs-list-group-border-color)}.list-group-item:first-child{border-top-left-radius:inherit;border-top-right-radius:inherit}.list-group-item:last-child{border-bottom-right-radius:inherit;border-bottom-left-radius:inherit}.list-group-item.disabled,.list-group-item:disabled{color:var(--bs-list-group-disabled-color);pointer-events:none;background-color:var(--bs-list-group-disabled-bg)}.list-group-item.active{z-index:2;color:var(--bs-list-group-active-color);background-color:var(--bs-list-group-active-bg);border-color:var(--bs-list-group-active-border-color)}.list-group-item+.list-group-item{border-top-width:0}.list-group-item+.list-group-item.active{margin-top:calc(-1 * var(--bs-list-group-border-width));border-top-width:var(--bs-list-group-border-width)}.list-group-horizontal{flex-direction:row}.list-group-horizontal>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal>.list-group-item.active{margin-top:0}.list-group-horizontal>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}@media (min-width:576px){.list-group-horizontal-sm{flex-direction:row}.list-group-horizontal-sm>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-sm>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-sm>.list-group-item.active{margin-top:0}.list-group-horizontal-sm>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-sm>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:768px){.list-group-horizontal-md{flex-direction:row}.list-group-horizontal-md>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-md>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-md>.list-group-item.active{margin-top:0}.list-group-horizontal-md>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-md>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:992px){.list-group-horizontal-lg{flex-direction:row}.list-group-horizontal-lg>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-lg>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-lg>.list-group-item.active{margin-top:0}.list-group-horizontal-lg>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-lg>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1200px){.list-group-horizontal-xl{flex-direction:row}.list-group-horizontal-xl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xl>.list-group-item.active{margin-top:0}.list-group-horizontal-xl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1400px){.list-group-horizontal-xxl{flex-direction:row}.list-group-horizontal-xxl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xxl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xxl>.list-group-item.active{margin-top:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}.list-group-flush{border-radius:0}.list-group-flush>.list-group-item{border-width:0 0 var(--bs-list-group-border-width)}.list-group-flush>.list-group-item:last-child{border-bottom-width:0}.list-group-item-primary{--bs-list-group-color:var(--bs-primary-text-emphasis);--bs-list-group-bg:var(--bs-primary-bg-subtle);--bs-list-group-border-color:var(--bs-primary-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-primary-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-primary-border-subtle);--bs-list-group-active-color:var(--bs-primary-bg-subtle);--bs-list-group-active-bg:var(--bs-primary-text-emphasis);--bs-list-group-active-border-color:var(--bs-primary-text-emphasis)}.list-group-item-secondary{--bs-list-group-color:var(--bs-secondary-text-emphasis);--bs-list-group-bg:var(--bs-secondary-bg-subtle);--bs-list-group-border-color:var(--bs-secondary-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-secondary-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-secondary-border-subtle);--bs-list-group-active-color:var(--bs-secondary-bg-subtle);--bs-list-group-active-bg:var(--bs-secondary-text-emphasis);--bs-list-group-active-border-color:var(--bs-secondary-text-emphasis)}.list-group-item-success{--bs-list-group-color:var(--bs-success-text-emphasis);--bs-list-group-bg:var(--bs-success-bg-subtle);--bs-list-group-border-color:var(--bs-success-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-success-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-success-border-subtle);--bs-list-group-active-color:var(--bs-success-bg-subtle);--bs-list-group-active-bg:var(--bs-success-text-emphasis);--bs-list-group-active-border-color:var(--bs-success-text-emphasis)}.list-group-item-info{--bs-list-group-color:var(--bs-info-text-emphasis);--bs-list-group-bg:var(--bs-info-bg-subtle);--bs-list-group-border-color:var(--bs-info-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-info-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-info-border-subtle);--bs-list-group-active-color:var(--bs-info-bg-subtle);--bs-list-group-active-bg:var(--bs-info-text-emphasis);--bs-list-group-active-border-color:var(--bs-info-text-emphasis)}.list-group-item-warning{--bs-list-group-color:var(--bs-warning-text-emphasis);--bs-list-group-bg:var(--bs-warning-bg-subtle);--bs-list-group-border-color:var(--bs-warning-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-warning-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-warning-border-subtle);--bs-list-group-active-color:var(--bs-warning-bg-subtle);--bs-list-group-active-bg:var(--bs-warning-text-emphasis);--bs-list-group-active-border-color:var(--bs-warning-text-emphasis)}.list-group-item-danger{--bs-list-group-color:var(--bs-danger-text-emphasis);--bs-list-group-bg:var(--bs-danger-bg-subtle);--bs-list-group-border-color:var(--bs-danger-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-danger-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-danger-border-subtle);--bs-list-group-active-color:var(--bs-danger-bg-subtle);--bs-list-group-active-bg:var(--bs-danger-text-emphasis);--bs-list-group-active-border-color:var(--bs-danger-text-emphasis)}.list-group-item-light{--bs-list-group-color:var(--bs-light-text-emphasis);--bs-list-group-bg:var(--bs-light-bg-subtle);--bs-list-group-border-color:var(--bs-light-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-light-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-light-border-subtle);--bs-list-group-active-color:var(--bs-light-bg-subtle);--bs-list-group-active-bg:var(--bs-light-text-emphasis);--bs-list-group-active-border-color:var(--bs-light-text-emphasis)}.list-group-item-dark{--bs-list-group-color:var(--bs-dark-text-emphasis);--bs-list-group-bg:var(--bs-dark-bg-subtle);--bs-list-group-border-color:var(--bs-dark-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-dark-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-dark-border-subtle);--bs-list-group-active-color:var(--bs-dark-bg-subtle);--bs-list-group-active-bg:var(--bs-dark-text-emphasis);--bs-list-group-active-border-color:var(--bs-dark-text-emphasis)}.btn-close{--bs-btn-close-color:#000;--bs-btn-close-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e");--bs-btn-close-opacity:0.5;--bs-btn-close-hover-opacity:0.75;--bs-btn-close-focus-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-btn-close-focus-opacity:1;--bs-btn-close-disabled-opacity:0.25;--bs-btn-close-white-filter:invert(1) grayscale(100%) brightness(200%);box-sizing:content-box;width:1em;height:1em;padding:.25em .25em;color:var(--bs-btn-close-color);background:transparent var(--bs-btn-close-bg) center/1em auto no-repeat;border:0;border-radius:.375rem;opacity:var(--bs-btn-close-opacity)}.btn-close:hover{color:var(--bs-btn-close-color);text-decoration:none;opacity:var(--bs-btn-close-hover-opacity)}.btn-close:focus{outline:0;box-shadow:var(--bs-btn-close-focus-shadow);opacity:var(--bs-btn-close-focus-opacity)}.btn-close.disabled,.btn-close:disabled{pointer-events:none;-webkit-user-select:none;-moz-user-select:none;user-select:none;opacity:var(--bs-btn-close-disabled-opacity)}.btn-close-white{filter:var(--bs-btn-close-white-filter)}[data-bs-theme=dark] .btn-close{filter:var(--bs-btn-close-white-filter)}.toast{--bs-toast-zindex:1090;--bs-toast-padding-x:0.75rem;--bs-toast-padding-y:0.5rem;--bs-toast-spacing:1.5rem;--bs-toast-max-width:350px;--bs-toast-font-size:0.875rem;--bs-toast-color: ;--bs-toast-bg:rgba(var(--bs-body-bg-rgb), 0.85);--bs-toast-border-width:var(--bs-border-width);--bs-toast-border-color:var(--bs-border-color-translucent);--bs-toast-border-radius:var(--bs-border-radius);--bs-toast-box-shadow:var(--bs-box-shadow);--bs-toast-header-color:var(--bs-secondary-color);--bs-toast-header-bg:rgba(var(--bs-body-bg-rgb), 0.85);--bs-toast-header-border-color:var(--bs-border-color-translucent);width:var(--bs-toast-max-width);max-width:100%;font-size:var(--bs-toast-font-size);color:var(--bs-toast-color);pointer-events:auto;background-color:var(--bs-toast-bg);background-clip:padding-box;border:var(--bs-toast-border-width) solid var(--bs-toast-border-color);box-shadow:var(--bs-toast-box-shadow);border-radius:var(--bs-toast-border-radius)}.toast.showing{opacity:0}.toast:not(.show){display:none}.toast-container{--bs-toast-zindex:1090;position:absolute;z-index:var(--bs-toast-zindex);width:-webkit-max-content;width:-moz-max-content;width:max-content;max-width:100%;pointer-events:none}.toast-container>:not(:last-child){margin-bottom:var(--bs-toast-spacing)}.toast-header{display:flex;align-items:center;padding:var(--bs-toast-padding-y) var(--bs-toast-padding-x);color:var(--bs-toast-header-color);background-color:var(--bs-toast-header-bg);background-clip:padding-box;border-bottom:var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);border-top-left-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));border-top-right-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width))}.toast-header .btn-close{margin-right:calc(-.5 * var(--bs-toast-padding-x));margin-left:var(--bs-toast-padding-x)}.toast-body{padding:var(--bs-toast-padding-x);word-wrap:break-word}.modal{--bs-modal-zindex:1055;--bs-modal-width:500px;--bs-modal-padding:1rem;--bs-modal-margin:0.5rem;--bs-modal-color: ;--bs-modal-bg:var(--bs-body-bg);--bs-modal-border-color:var(--bs-border-color-translucent);--bs-modal-border-width:var(--bs-border-width);--bs-modal-border-radius:var(--bs-border-radius-lg);--bs-modal-box-shadow:var(--bs-box-shadow-sm);--bs-modal-inner-border-radius:calc(var(--bs-border-radius-lg) - (var(--bs-border-width)));--bs-modal-header-padding-x:1rem;--bs-modal-header-padding-y:1rem;--bs-modal-header-padding:1rem 1rem;--bs-modal-header-border-color:var(--bs-border-color);--bs-modal-header-border-width:var(--bs-border-width);--bs-modal-title-line-height:1.5;--bs-modal-footer-gap:0.5rem;--bs-modal-footer-bg: ;--bs-modal-footer-border-color:var(--bs-border-color);--bs-modal-footer-border-width:var(--bs-border-width);position:fixed;top:0;left:0;z-index:var(--bs-modal-zindex);display:none;width:100%;height:100%;overflow-x:hidden;overflow-y:auto;outline:0}.modal-dialog{position:relative;width:auto;margin:var(--bs-modal-margin);pointer-events:none}.modal.fade .modal-dialog{transition:transform .3s ease-out;transform:translate(0,-50px)}@media (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{transform:none}.modal.modal-static .modal-dialog{transform:scale(1.02)}.modal-dialog-scrollable{height:calc(100% - var(--bs-modal-margin) * 2)}.modal-dialog-scrollable .modal-content{max-height:100%;overflow:hidden}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{display:flex;align-items:center;min-height:calc(100% - var(--bs-modal-margin) * 2)}.modal-content{position:relative;display:flex;flex-direction:column;width:100%;color:var(--bs-modal-color);pointer-events:auto;background-color:var(--bs-modal-bg);background-clip:padding-box;border:var(--bs-modal-border-width) solid var(--bs-modal-border-color);border-radius:var(--bs-modal-border-radius);outline:0}.modal-backdrop{--bs-backdrop-zindex:1050;--bs-backdrop-bg:#000;--bs-backdrop-opacity:0.5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}.modal-header{display:flex;flex-shrink:0;align-items:center;padding:var(--bs-modal-header-padding);border-bottom:var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);border-top-left-radius:var(--bs-modal-inner-border-radius);border-top-right-radius:var(--bs-modal-inner-border-radius)}.modal-header .btn-close{padding:calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5);margin:calc(-.5 * var(--bs-modal-header-padding-y)) calc(-.5 * var(--bs-modal-header-padding-x)) calc(-.5 * var(--bs-modal-header-padding-y)) auto}.modal-title{margin-bottom:0;line-height:var(--bs-modal-title-line-height)}.modal-body{position:relative;flex:1 1 auto;padding:var(--bs-modal-padding)}.modal-footer{display:flex;flex-shrink:0;flex-wrap:wrap;align-items:center;justify-content:flex-end;padding:calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5);background-color:var(--bs-modal-footer-bg);border-top:var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);border-bottom-right-radius:var(--bs-modal-inner-border-radius);border-bottom-left-radius:var(--bs-modal-inner-border-radius)}.modal-footer>*{margin:calc(var(--bs-modal-footer-gap) * .5)}@media (min-width:576px){.modal{--bs-modal-margin:1.75rem;--bs-modal-box-shadow:var(--bs-box-shadow)}.modal-dialog{max-width:var(--bs-modal-width);margin-right:auto;margin-left:auto}.modal-sm{--bs-modal-width:300px}}@media (min-width:992px){.modal-lg,.modal-xl{--bs-modal-width:800px}}@media (min-width:1200px){.modal-xl{--bs-modal-width:1140px}}.modal-fullscreen{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen .modal-footer,.modal-fullscreen .modal-header{border-radius:0}.modal-fullscreen .modal-body{overflow-y:auto}@media (max-width:575.98px){.modal-fullscreen-sm-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-sm-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-sm-down .modal-footer,.modal-fullscreen-sm-down .modal-header{border-radius:0}.modal-fullscreen-sm-down .modal-body{overflow-y:auto}}@media (max-width:767.98px){.modal-fullscreen-md-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-md-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-md-down .modal-footer,.modal-fullscreen-md-down .modal-header{border-radius:0}.modal-fullscreen-md-down .modal-body{overflow-y:auto}}@media (max-width:991.98px){.modal-fullscreen-lg-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-lg-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-lg-down .modal-footer,.modal-fullscreen-lg-down .modal-header{border-radius:0}.modal-fullscreen-lg-down .modal-body{overflow-y:auto}}@media (max-width:1199.98px){.modal-fullscreen-xl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xl-down .modal-footer,.modal-fullscreen-xl-down .modal-header{border-radius:0}.modal-fullscreen-xl-down .modal-body{overflow-y:auto}}@media (max-width:1399.98px){.modal-fullscreen-xxl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xxl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xxl-down .modal-footer,.modal-fullscreen-xxl-down .modal-header{border-radius:0}.modal-fullscreen-xxl-down .modal-body{overflow-y:auto}}.tooltip{--bs-tooltip-zindex:1080;--bs-tooltip-max-width:200px;--bs-tooltip-padding-x:0.5rem;--bs-tooltip-padding-y:0.25rem;--bs-tooltip-margin: ;--bs-tooltip-font-size:0.875rem;--bs-tooltip-color:var(--bs-body-bg);--bs-tooltip-bg:var(--bs-emphasis-color);--bs-tooltip-border-radius:var(--bs-border-radius);--bs-tooltip-opacity:0.9;--bs-tooltip-arrow-width:0.8rem;--bs-tooltip-arrow-height:0.4rem;z-index:var(--bs-tooltip-zindex);display:block;margin:var(--bs-tooltip-margin);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-tooltip-font-size);word-wrap:break-word;opacity:0}.tooltip.show{opacity:var(--bs-tooltip-opacity)}.tooltip .tooltip-arrow{display:block;width:var(--bs-tooltip-arrow-width);height:var(--bs-tooltip-arrow-height)}.tooltip .tooltip-arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow,.bs-tooltip-top .tooltip-arrow{bottom:calc(-1 * var(--bs-tooltip-arrow-height))}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before,.bs-tooltip-top .tooltip-arrow::before{top:-1px;border-width:var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-top-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow,.bs-tooltip-end .tooltip-arrow{left:calc(-1 * var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before,.bs-tooltip-end .tooltip-arrow::before{right:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-right-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow,.bs-tooltip-bottom .tooltip-arrow{top:calc(-1 * var(--bs-tooltip-arrow-height))}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before,.bs-tooltip-bottom .tooltip-arrow::before{bottom:-1px;border-width:0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-bottom-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow,.bs-tooltip-start .tooltip-arrow{right:calc(-1 * var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before,.bs-tooltip-start .tooltip-arrow::before{left:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-left-color:var(--bs-tooltip-bg)}.tooltip-inner{max-width:var(--bs-tooltip-max-width);padding:var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);color:var(--bs-tooltip-color);text-align:center;background-color:var(--bs-tooltip-bg);border-radius:var(--bs-tooltip-border-radius)}.popover{--bs-popover-zindex:1070;--bs-popover-max-width:276px;--bs-popover-font-size:0.875rem;--bs-popover-bg:var(--bs-body-bg);--bs-popover-border-width:var(--bs-border-width);--bs-popover-border-color:var(--bs-border-color-translucent);--bs-popover-border-radius:var(--bs-border-radius-lg);--bs-popover-inner-border-radius:calc(var(--bs-border-radius-lg) - var(--bs-border-width));--bs-popover-box-shadow:var(--bs-box-shadow);--bs-popover-header-padding-x:1rem;--bs-popover-header-padding-y:0.5rem;--bs-popover-header-font-size:1rem;--bs-popover-header-color:inherit;--bs-popover-header-bg:var(--bs-secondary-bg);--bs-popover-body-padding-x:1rem;--bs-popover-body-padding-y:1rem;--bs-popover-body-color:var(--bs-body-color);--bs-popover-arrow-width:1rem;--bs-popover-arrow-height:0.5rem;--bs-popover-arrow-border:var(--bs-popover-border-color);z-index:var(--bs-popover-zindex);display:block;max-width:var(--bs-popover-max-width);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-popover-font-size);word-wrap:break-word;background-color:var(--bs-popover-bg);background-clip:padding-box;border:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-radius:var(--bs-popover-border-radius)}.popover .popover-arrow{display:block;width:var(--bs-popover-arrow-width);height:var(--bs-popover-arrow-height)}.popover .popover-arrow::after,.popover .popover-arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid;border-width:0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow,.bs-popover-top>.popover-arrow{bottom:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::after,.bs-popover-top>.popover-arrow::before{border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::before{bottom:0;border-top-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-top>.popover-arrow::after{bottom:var(--bs-popover-border-width);border-top-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow,.bs-popover-end>.popover-arrow{left:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::after,.bs-popover-end>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::before{left:0;border-right-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-end>.popover-arrow::after{left:var(--bs-popover-border-width);border-right-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow,.bs-popover-bottom>.popover-arrow{top:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::before{border-width:0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::before{top:0;border-bottom-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::after{top:var(--bs-popover-border-width);border-bottom-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:var(--bs-popover-arrow-width);margin-left:calc(-.5 * var(--bs-popover-arrow-width));content:"";border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-header-bg)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow,.bs-popover-start>.popover-arrow{right:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::after,.bs-popover-start>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::before{right:0;border-left-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-start>.popover-arrow::after{right:var(--bs-popover-border-width);border-left-color:var(--bs-popover-bg)}.popover-header{padding:var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);margin-bottom:0;font-size:var(--bs-popover-header-font-size);color:var(--bs-popover-header-color);background-color:var(--bs-popover-header-bg);border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-top-left-radius:var(--bs-popover-inner-border-radius);border-top-right-radius:var(--bs-popover-inner-border-radius)}.popover-header:empty{display:none}.popover-body{padding:var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);color:var(--bs-popover-body-color)}.carousel{position:relative}.carousel.pointer-event{touch-action:pan-y}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner::after{display:block;clear:both;content:""}.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;-webkit-backface-visibility:hidden;backface-visibility:hidden;transition:transform .6s ease-in-out}@media (prefers-reduced-motion:reduce){.carousel-item{transition:none}}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.active.carousel-item-end,.carousel-item-next:not(.carousel-item-start){transform:translateX(100%)}.active.carousel-item-start,.carousel-item-prev:not(.carousel-item-end){transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transition-property:opacity;transform:none}.carousel-fade .carousel-item-next.carousel-item-start,.carousel-fade .carousel-item-prev.carousel-item-end,.carousel-fade .carousel-item.active{z-index:1;opacity:1}.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{z-index:0;opacity:0;transition:opacity 0s .6s}@media (prefers-reduced-motion:reduce){.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{transition:none}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;z-index:1;display:flex;align-items:center;justify-content:center;width:15%;padding:0;color:#fff;text-align:center;background:0 0;border:0;opacity:.5;transition:opacity .15s ease}@media (prefers-reduced-motion:reduce){.carousel-control-next,.carousel-control-prev{transition:none}}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:2rem;height:2rem;background-repeat:no-repeat;background-position:50%;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e")}.carousel-control-next-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:2;display:flex;justify-content:center;padding:0;margin-right:15%;margin-bottom:1rem;margin-left:15%}.carousel-indicators [data-bs-target]{box-sizing:content-box;flex:0 1 auto;width:30px;height:3px;padding:0;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:#fff;background-clip:padding-box;border:0;border-top:10px solid transparent;border-bottom:10px solid transparent;opacity:.5;transition:opacity .6s ease}@media (prefers-reduced-motion:reduce){.carousel-indicators [data-bs-target]{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{position:absolute;right:15%;bottom:1.25rem;left:15%;padding-top:1.25rem;padding-bottom:1.25rem;color:#fff;text-align:center}.carousel-dark .carousel-control-next-icon,.carousel-dark .carousel-control-prev-icon{filter:invert(1) grayscale(100)}.carousel-dark .carousel-indicators [data-bs-target]{background-color:#000}.carousel-dark .carousel-caption{color:#000}[data-bs-theme=dark] .carousel .carousel-control-next-icon,[data-bs-theme=dark] .carousel .carousel-control-prev-icon,[data-bs-theme=dark].carousel .carousel-control-next-icon,[data-bs-theme=dark].carousel .carousel-control-prev-icon{filter:invert(1) grayscale(100)}[data-bs-theme=dark] .carousel .carousel-indicators [data-bs-target],[data-bs-theme=dark].carousel .carousel-indicators [data-bs-target]{background-color:#000}[data-bs-theme=dark] .carousel .carousel-caption,[data-bs-theme=dark].carousel .carousel-caption{color:#000}.spinner-border,.spinner-grow{display:inline-block;width:var(--bs-spinner-width);height:var(--bs-spinner-height);vertical-align:var(--bs-spinner-vertical-align);border-radius:50%;animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name)}@keyframes spinner-border{to{transform:rotate(360deg)}}.spinner-border{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-border-width:0.25em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-border;border:var(--bs-spinner-border-width) solid currentcolor;border-right-color:transparent}.spinner-border-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem;--bs-spinner-border-width:0.2em}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.spinner-grow{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-grow;background-color:currentcolor;opacity:0}.spinner-grow-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem}@media (prefers-reduced-motion:reduce){.spinner-border,.spinner-grow{--bs-spinner-animation-speed:1.5s}}.offcanvas,.offcanvas-lg,.offcanvas-md,.offcanvas-sm,.offcanvas-xl,.offcanvas-xxl{--bs-offcanvas-zindex:1045;--bs-offcanvas-width:400px;--bs-offcanvas-height:30vh;--bs-offcanvas-padding-x:1rem;--bs-offcanvas-padding-y:1rem;--bs-offcanvas-color:var(--bs-body-color);--bs-offcanvas-bg:var(--bs-body-bg);--bs-offcanvas-border-width:var(--bs-border-width);--bs-offcanvas-border-color:var(--bs-border-color-translucent);--bs-offcanvas-box-shadow:var(--bs-box-shadow-sm);--bs-offcanvas-transition:transform 0.3s ease-in-out;--bs-offcanvas-title-line-height:1.5}@media (max-width:575.98px){.offcanvas-sm{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:575.98px) and (prefers-reduced-motion:reduce){.offcanvas-sm{transition:none}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-sm.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-sm.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-sm.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-sm.show:not(.hiding),.offcanvas-sm.showing{transform:none}.offcanvas-sm.hiding,.offcanvas-sm.show,.offcanvas-sm.showing{visibility:visible}}@media (min-width:576px){.offcanvas-sm{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-sm .offcanvas-header{display:none}.offcanvas-sm .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:767.98px){.offcanvas-md{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:767.98px) and (prefers-reduced-motion:reduce){.offcanvas-md{transition:none}}@media (max-width:767.98px){.offcanvas-md.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-md.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-md.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-md.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-md.show:not(.hiding),.offcanvas-md.showing{transform:none}.offcanvas-md.hiding,.offcanvas-md.show,.offcanvas-md.showing{visibility:visible}}@media (min-width:768px){.offcanvas-md{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-md .offcanvas-header{display:none}.offcanvas-md .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:991.98px){.offcanvas-lg{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:991.98px) and (prefers-reduced-motion:reduce){.offcanvas-lg{transition:none}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-lg.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-lg.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-lg.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-lg.show:not(.hiding),.offcanvas-lg.showing{transform:none}.offcanvas-lg.hiding,.offcanvas-lg.show,.offcanvas-lg.showing{visibility:visible}}@media (min-width:992px){.offcanvas-lg{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-lg .offcanvas-header{display:none}.offcanvas-lg .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1199.98px){.offcanvas-xl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:1199.98px) and (prefers-reduced-motion:reduce){.offcanvas-xl{transition:none}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xl.show:not(.hiding),.offcanvas-xl.showing{transform:none}.offcanvas-xl.hiding,.offcanvas-xl.show,.offcanvas-xl.showing{visibility:visible}}@media (min-width:1200px){.offcanvas-xl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xl .offcanvas-header{display:none}.offcanvas-xl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1399.98px){.offcanvas-xxl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:1399.98px) and (prefers-reduced-motion:reduce){.offcanvas-xxl{transition:none}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xxl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xxl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xxl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xxl.show:not(.hiding),.offcanvas-xxl.showing{transform:none}.offcanvas-xxl.hiding,.offcanvas-xxl.show,.offcanvas-xxl.showing{visibility:visible}}@media (min-width:1400px){.offcanvas-xxl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xxl .offcanvas-header{display:none}.offcanvas-xxl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}.offcanvas{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}@media (prefers-reduced-motion:reduce){.offcanvas{transition:none}}.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas.show:not(.hiding),.offcanvas.showing{transform:none}.offcanvas.hiding,.offcanvas.show,.offcanvas.showing{visibility:visible}.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.offcanvas-backdrop.fade{opacity:0}.offcanvas-backdrop.show{opacity:.5}.offcanvas-header{display:flex;align-items:center;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}.offcanvas-header .btn-close{padding:calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5);margin:calc(-.5 * var(--bs-offcanvas-padding-y)) calc(-.5 * var(--bs-offcanvas-padding-x)) calc(-.5 * var(--bs-offcanvas-padding-y)) auto}.offcanvas-title{margin-bottom:0;line-height:var(--bs-offcanvas-title-line-height)}.offcanvas-body{flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}.placeholder{display:inline-block;min-height:1em;vertical-align:middle;cursor:wait;background-color:currentcolor;opacity:.5}.placeholder.btn::before{display:inline-block;content:""}.placeholder-xs{min-height:.6em}.placeholder-sm{min-height:.8em}.placeholder-lg{min-height:1.2em}.placeholder-glow .placeholder{animation:placeholder-glow 2s ease-in-out infinite}@keyframes placeholder-glow{50%{opacity:.2}}.placeholder-wave{-webkit-mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);-webkit-mask-size:200% 100%;mask-size:200% 100%;animation:placeholder-wave 2s linear infinite}@keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}.clearfix::after{display:block;clear:both;content:""}.text-bg-primary{color:#fff!important;background-color:RGBA(var(--bs-primary-rgb),var(--bs-bg-opacity,1))!important}.text-bg-secondary{color:#fff!important;background-color:RGBA(var(--bs-secondary-rgb),var(--bs-bg-opacity,1))!important}.text-bg-success{color:#fff!important;background-color:RGBA(var(--bs-success-rgb),var(--bs-bg-opacity,1))!important}.text-bg-info{color:#000!important;background-color:RGBA(var(--bs-info-rgb),var(--bs-bg-opacity,1))!important}.text-bg-warning{color:#000!important;background-color:RGBA(var(--bs-warning-rgb),var(--bs-bg-opacity,1))!important}.text-bg-danger{color:#fff!important;background-color:RGBA(var(--bs-danger-rgb),var(--bs-bg-opacity,1))!important}.text-bg-light{color:#000!important;background-color:RGBA(var(--bs-light-rgb),var(--bs-bg-opacity,1))!important}.text-bg-dark{color:#fff!important;background-color:RGBA(var(--bs-dark-rgb),var(--bs-bg-opacity,1))!important}.link-primary{color:RGBA(var(--bs-primary-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-primary-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-primary-rgb),var(--bs-link-underline-opacity,1))!important}.link-primary:focus,.link-primary:hover{color:RGBA(10,88,202,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(10,88,202,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(10,88,202,var(--bs-link-underline-opacity,1))!important}.link-secondary{color:RGBA(var(--bs-secondary-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-secondary-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-secondary-rgb),var(--bs-link-underline-opacity,1))!important}.link-secondary:focus,.link-secondary:hover{color:RGBA(86,94,100,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(86,94,100,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(86,94,100,var(--bs-link-underline-opacity,1))!important}.link-success{color:RGBA(var(--bs-success-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-success-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-success-rgb),var(--bs-link-underline-opacity,1))!important}.link-success:focus,.link-success:hover{color:RGBA(20,108,67,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(20,108,67,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(20,108,67,var(--bs-link-underline-opacity,1))!important}.link-info{color:RGBA(var(--bs-info-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-info-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-info-rgb),var(--bs-link-underline-opacity,1))!important}.link-info:focus,.link-info:hover{color:RGBA(61,213,243,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(61,213,243,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(61,213,243,var(--bs-link-underline-opacity,1))!important}.link-warning{color:RGBA(var(--bs-warning-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-warning-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-warning-rgb),var(--bs-link-underline-opacity,1))!important}.link-warning:focus,.link-warning:hover{color:RGBA(255,205,57,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(255,205,57,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(255,205,57,var(--bs-link-underline-opacity,1))!important}.link-danger{color:RGBA(var(--bs-danger-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-danger-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-danger-rgb),var(--bs-link-underline-opacity,1))!important}.link-danger:focus,.link-danger:hover{color:RGBA(176,42,55,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(176,42,55,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(176,42,55,var(--bs-link-underline-opacity,1))!important}.link-light{color:RGBA(var(--bs-light-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-light-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-light-rgb),var(--bs-link-underline-opacity,1))!important}.link-light:focus,.link-light:hover{color:RGBA(249,250,251,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(249,250,251,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(249,250,251,var(--bs-link-underline-opacity,1))!important}.link-dark{color:RGBA(var(--bs-dark-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-dark-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-dark-rgb),var(--bs-link-underline-opacity,1))!important}.link-dark:focus,.link-dark:hover{color:RGBA(26,30,33,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(26,30,33,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(26,30,33,var(--bs-link-underline-opacity,1))!important}.link-body-emphasis{color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,1))!important}.link-body-emphasis:focus,.link-body-emphasis:hover{color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-opacity,.75))!important;-webkit-text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,0.75))!important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,0.75))!important}.focus-ring:focus{outline:0;box-shadow:var(--bs-focus-ring-x,0) var(--bs-focus-ring-y,0) var(--bs-focus-ring-blur,0) var(--bs-focus-ring-width) var(--bs-focus-ring-color)}.icon-link{display:inline-flex;gap:.375rem;align-items:center;-webkit-text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,0.5));text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,0.5));text-underline-offset:0.25em;-webkit-backface-visibility:hidden;backface-visibility:hidden}.icon-link>.bi{flex-shrink:0;width:1em;height:1em;fill:currentcolor;transition:.2s ease-in-out transform}@media (prefers-reduced-motion:reduce){.icon-link>.bi{transition:none}}.icon-link-hover:focus-visible>.bi,.icon-link-hover:hover>.bi{transform:var(--bs-icon-link-transform,translate3d(.25em,0,0))}.ratio{position:relative;width:100%}.ratio::before{display:block;padding-top:var(--bs-aspect-ratio);content:""}.ratio>*{position:absolute;top:0;left:0;width:100%;height:100%}.ratio-1x1{--bs-aspect-ratio:100%}.ratio-4x3{--bs-aspect-ratio:75%}.ratio-16x9{--bs-aspect-ratio:56.25%}.ratio-21x9{--bs-aspect-ratio:42.8571428571%}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}@media (min-width:576px){.sticky-sm-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-sm-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:768px){.sticky-md-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-md-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:992px){.sticky-lg-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-lg-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1200px){.sticky-xl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1400px){.sticky-xxl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xxl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}.hstack{display:flex;flex-direction:row;align-items:center;align-self:stretch}.vstack{display:flex;flex:1 1 auto;flex-direction:column;align-self:stretch}.visually-hidden,.visually-hidden-focusable:not(:focus):not(:focus-within){width:1px!important;height:1px!important;padding:0!important;margin:-1px!important;overflow:hidden!important;clip:rect(0,0,0,0)!important;white-space:nowrap!important;border:0!important}.visually-hidden-focusable:not(:focus):not(:focus-within):not(caption),.visually-hidden:not(caption){position:absolute!important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.vr{display:inline-block;align-self:stretch;width:var(--bs-border-width);min-height:1em;background-color:currentcolor;opacity:.25}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.float-start{float:left!important}.float-end{float:right!important}.float-none{float:none!important}.object-fit-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-none{-o-object-fit:none!important;object-fit:none!important}.opacity-0{opacity:0!important}.opacity-25{opacity:.25!important}.opacity-50{opacity:.5!important}.opacity-75{opacity:.75!important}.opacity-100{opacity:1!important}.overflow-auto{overflow:auto!important}.overflow-hidden{overflow:hidden!important}.overflow-visible{overflow:visible!important}.overflow-scroll{overflow:scroll!important}.overflow-x-auto{overflow-x:auto!important}.overflow-x-hidden{overflow-x:hidden!important}.overflow-x-visible{overflow-x:visible!important}.overflow-x-scroll{overflow-x:scroll!important}.overflow-y-auto{overflow-y:auto!important}.overflow-y-hidden{overflow-y:hidden!important}.overflow-y-visible{overflow-y:visible!important}.overflow-y-scroll{overflow-y:scroll!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-grid{display:grid!important}.d-inline-grid{display:inline-grid!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:flex!important}.d-inline-flex{display:inline-flex!important}.d-none{display:none!important}.shadow{box-shadow:var(--bs-box-shadow)!important}.shadow-sm{box-shadow:var(--bs-box-shadow-sm)!important}.shadow-lg{box-shadow:var(--bs-box-shadow-lg)!important}.shadow-none{box-shadow:none!important}.focus-ring-primary{--bs-focus-ring-color:rgba(var(--bs-primary-rgb), var(--bs-focus-ring-opacity))}.focus-ring-secondary{--bs-focus-ring-color:rgba(var(--bs-secondary-rgb), var(--bs-focus-ring-opacity))}.focus-ring-success{--bs-focus-ring-color:rgba(var(--bs-success-rgb), var(--bs-focus-ring-opacity))}.focus-ring-info{--bs-focus-ring-color:rgba(var(--bs-info-rgb), var(--bs-focus-ring-opacity))}.focus-ring-warning{--bs-focus-ring-color:rgba(var(--bs-warning-rgb), var(--bs-focus-ring-opacity))}.focus-ring-danger{--bs-focus-ring-color:rgba(var(--bs-danger-rgb), var(--bs-focus-ring-opacity))}.focus-ring-light{--bs-focus-ring-color:rgba(var(--bs-light-rgb), var(--bs-focus-ring-opacity))}.focus-ring-dark{--bs-focus-ring-color:rgba(var(--bs-dark-rgb), var(--bs-focus-ring-opacity))}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.top-0{top:0!important}.top-50{top:50%!important}.top-100{top:100%!important}.bottom-0{bottom:0!important}.bottom-50{bottom:50%!important}.bottom-100{bottom:100%!important}.start-0{left:0!important}.start-50{left:50%!important}.start-100{left:100%!important}.end-0{right:0!important}.end-50{right:50%!important}.end-100{right:100%!important}.translate-middle{transform:translate(-50%,-50%)!important}.translate-middle-x{transform:translateX(-50%)!important}.translate-middle-y{transform:translateY(-50%)!important}.border{border:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-0{border:0!important}.border-top{border-top:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-top-0{border-top:0!important}.border-end{border-right:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-end-0{border-right:0!important}.border-bottom{border-bottom:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-bottom-0{border-bottom:0!important}.border-start{border-left:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-start-0{border-left:0!important}.border-primary{--bs-border-opacity:1;border-color:rgba(var(--bs-primary-rgb),var(--bs-border-opacity))!important}.border-secondary{--bs-border-opacity:1;border-color:rgba(var(--bs-secondary-rgb),var(--bs-border-opacity))!important}.border-success{--bs-border-opacity:1;border-color:rgba(var(--bs-success-rgb),var(--bs-border-opacity))!important}.border-info{--bs-border-opacity:1;border-color:rgba(var(--bs-info-rgb),var(--bs-border-opacity))!important}.border-warning{--bs-border-opacity:1;border-color:rgba(var(--bs-warning-rgb),var(--bs-border-opacity))!important}.border-danger{--bs-border-opacity:1;border-color:rgba(var(--bs-danger-rgb),var(--bs-border-opacity))!important}.border-light{--bs-border-opacity:1;border-color:rgba(var(--bs-light-rgb),var(--bs-border-opacity))!important}.border-dark{--bs-border-opacity:1;border-color:rgba(var(--bs-dark-rgb),var(--bs-border-opacity))!important}.border-black{--bs-border-opacity:1;border-color:rgba(var(--bs-black-rgb),var(--bs-border-opacity))!important}.border-white{--bs-border-opacity:1;border-color:rgba(var(--bs-white-rgb),var(--bs-border-opacity))!important}.border-primary-subtle{border-color:var(--bs-primary-border-subtle)!important}.border-secondary-subtle{border-color:var(--bs-secondary-border-subtle)!important}.border-success-subtle{border-color:var(--bs-success-border-subtle)!important}.border-info-subtle{border-color:var(--bs-info-border-subtle)!important}.border-warning-subtle{border-color:var(--bs-warning-border-subtle)!important}.border-danger-subtle{border-color:var(--bs-danger-border-subtle)!important}.border-light-subtle{border-color:var(--bs-light-border-subtle)!important}.border-dark-subtle{border-color:var(--bs-dark-border-subtle)!important}.border-1{border-width:1px!important}.border-2{border-width:2px!important}.border-3{border-width:3px!important}.border-4{border-width:4px!important}.border-5{border-width:5px!important}.border-opacity-10{--bs-border-opacity:0.1}.border-opacity-25{--bs-border-opacity:0.25}.border-opacity-50{--bs-border-opacity:0.5}.border-opacity-75{--bs-border-opacity:0.75}.border-opacity-100{--bs-border-opacity:1}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.mw-100{max-width:100%!important}.vw-100{width:100vw!important}.min-vw-100{min-width:100vw!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mh-100{max-height:100%!important}.vh-100{height:100vh!important}.min-vh-100{min-height:100vh!important}.flex-fill{flex:1 1 auto!important}.flex-row{flex-direction:row!important}.flex-column{flex-direction:column!important}.flex-row-reverse{flex-direction:row-reverse!important}.flex-column-reverse{flex-direction:column-reverse!important}.flex-grow-0{flex-grow:0!important}.flex-grow-1{flex-grow:1!important}.flex-shrink-0{flex-shrink:0!important}.flex-shrink-1{flex-shrink:1!important}.flex-wrap{flex-wrap:wrap!important}.flex-nowrap{flex-wrap:nowrap!important}.flex-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-start{justify-content:flex-start!important}.justify-content-end{justify-content:flex-end!important}.justify-content-center{justify-content:center!important}.justify-content-between{justify-content:space-between!important}.justify-content-around{justify-content:space-around!important}.justify-content-evenly{justify-content:space-evenly!important}.align-items-start{align-items:flex-start!important}.align-items-end{align-items:flex-end!important}.align-items-center{align-items:center!important}.align-items-baseline{align-items:baseline!important}.align-items-stretch{align-items:stretch!important}.align-content-start{align-content:flex-start!important}.align-content-end{align-content:flex-end!important}.align-content-center{align-content:center!important}.align-content-between{align-content:space-between!important}.align-content-around{align-content:space-around!important}.align-content-stretch{align-content:stretch!important}.align-self-auto{align-self:auto!important}.align-self-start{align-self:flex-start!important}.align-self-end{align-self:flex-end!important}.align-self-center{align-self:center!important}.align-self-baseline{align-self:baseline!important}.align-self-stretch{align-self:stretch!important}.order-first{order:-1!important}.order-0{order:0!important}.order-1{order:1!important}.order-2{order:2!important}.order-3{order:3!important}.order-4{order:4!important}.order-5{order:5!important}.order-last{order:6!important}.m-0{margin:0!important}.m-1{margin:.25rem!important}.m-2{margin:.5rem!important}.m-3{margin:1rem!important}.m-4{margin:1.5rem!important}.m-5{margin:3rem!important}.m-auto{margin:auto!important}.mx-0{margin-right:0!important;margin-left:0!important}.mx-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-3{margin-right:1rem!important;margin-left:1rem!important}.mx-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-5{margin-right:3rem!important;margin-left:3rem!important}.mx-auto{margin-right:auto!important;margin-left:auto!important}.my-0{margin-top:0!important;margin-bottom:0!important}.my-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-0{margin-top:0!important}.mt-1{margin-top:.25rem!important}.mt-2{margin-top:.5rem!important}.mt-3{margin-top:1rem!important}.mt-4{margin-top:1.5rem!important}.mt-5{margin-top:3rem!important}.mt-auto{margin-top:auto!important}.me-0{margin-right:0!important}.me-1{margin-right:.25rem!important}.me-2{margin-right:.5rem!important}.me-3{margin-right:1rem!important}.me-4{margin-right:1.5rem!important}.me-5{margin-right:3rem!important}.me-auto{margin-right:auto!important}.mb-0{margin-bottom:0!important}.mb-1{margin-bottom:.25rem!important}.mb-2{margin-bottom:.5rem!important}.mb-3{margin-bottom:1rem!important}.mb-4{margin-bottom:1.5rem!important}.mb-5{margin-bottom:3rem!important}.mb-auto{margin-bottom:auto!important}.ms-0{margin-left:0!important}.ms-1{margin-left:.25rem!important}.ms-2{margin-left:.5rem!important}.ms-3{margin-left:1rem!important}.ms-4{margin-left:1.5rem!important}.ms-5{margin-left:3rem!important}.ms-auto{margin-left:auto!important}.p-0{padding:0!important}.p-1{padding:.25rem!important}.p-2{padding:.5rem!important}.p-3{padding:1rem!important}.p-4{padding:1.5rem!important}.p-5{padding:3rem!important}.px-0{padding-right:0!important;padding-left:0!important}.px-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-3{padding-right:1rem!important;padding-left:1rem!important}.px-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-5{padding-right:3rem!important;padding-left:3rem!important}.py-0{padding-top:0!important;padding-bottom:0!important}.py-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-0{padding-top:0!important}.pt-1{padding-top:.25rem!important}.pt-2{padding-top:.5rem!important}.pt-3{padding-top:1rem!important}.pt-4{padding-top:1.5rem!important}.pt-5{padding-top:3rem!important}.pe-0{padding-right:0!important}.pe-1{padding-right:.25rem!important}.pe-2{padding-right:.5rem!important}.pe-3{padding-right:1rem!important}.pe-4{padding-right:1.5rem!important}.pe-5{padding-right:3rem!important}.pb-0{padding-bottom:0!important}.pb-1{padding-bottom:.25rem!important}.pb-2{padding-bottom:.5rem!important}.pb-3{padding-bottom:1rem!important}.pb-4{padding-bottom:1.5rem!important}.pb-5{padding-bottom:3rem!important}.ps-0{padding-left:0!important}.ps-1{padding-left:.25rem!important}.ps-2{padding-left:.5rem!important}.ps-3{padding-left:1rem!important}.ps-4{padding-left:1.5rem!important}.ps-5{padding-left:3rem!important}.gap-0{gap:0!important}.gap-1{gap:.25rem!important}.gap-2{gap:.5rem!important}.gap-3{gap:1rem!important}.gap-4{gap:1.5rem!important}.gap-5{gap:3rem!important}.row-gap-0{row-gap:0!important}.row-gap-1{row-gap:.25rem!important}.row-gap-2{row-gap:.5rem!important}.row-gap-3{row-gap:1rem!important}.row-gap-4{row-gap:1.5rem!important}.row-gap-5{row-gap:3rem!important}.column-gap-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.font-monospace{font-family:var(--bs-font-monospace)!important}.fs-1{font-size:calc(1.375rem + 1.5vw)!important}.fs-2{font-size:calc(1.325rem + .9vw)!important}.fs-3{font-size:calc(1.3rem + .6vw)!important}.fs-4{font-size:calc(1.275rem + .3vw)!important}.fs-5{font-size:1.25rem!important}.fs-6{font-size:1rem!important}.fst-italic{font-style:italic!important}.fst-normal{font-style:normal!important}.fw-lighter{font-weight:lighter!important}.fw-light{font-weight:300!important}.fw-normal{font-weight:400!important}.fw-medium{font-weight:500!important}.fw-semibold{font-weight:600!important}.fw-bold{font-weight:700!important}.fw-bolder{font-weight:bolder!important}.lh-1{line-height:1!important}.lh-sm{line-height:1.25!important}.lh-base{line-height:1.5!important}.lh-lg{line-height:2!important}.text-start{text-align:left!important}.text-end{text-align:right!important}.text-center{text-align:center!important}.text-decoration-none{text-decoration:none!important}.text-decoration-underline{text-decoration:underline!important}.text-decoration-line-through{text-decoration:line-through!important}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.text-wrap{white-space:normal!important}.text-nowrap{white-space:nowrap!important}.text-break{word-wrap:break-word!important;word-break:break-word!important}.text-primary{--bs-text-opacity:1;color:rgba(var(--bs-primary-rgb),var(--bs-text-opacity))!important}.text-secondary{--bs-text-opacity:1;color:rgba(var(--bs-secondary-rgb),var(--bs-text-opacity))!important}.text-success{--bs-text-opacity:1;color:rgba(var(--bs-success-rgb),var(--bs-text-opacity))!important}.text-info{--bs-text-opacity:1;color:rgba(var(--bs-info-rgb),var(--bs-text-opacity))!important}.text-warning{--bs-text-opacity:1;color:rgba(var(--bs-warning-rgb),var(--bs-text-opacity))!important}.text-danger{--bs-text-opacity:1;color:rgba(var(--bs-danger-rgb),var(--bs-text-opacity))!important}.text-light{--bs-text-opacity:1;color:rgba(var(--bs-light-rgb),var(--bs-text-opacity))!important}.text-dark{--bs-text-opacity:1;color:rgba(var(--bs-dark-rgb),var(--bs-text-opacity))!important}.text-black{--bs-text-opacity:1;color:rgba(var(--bs-black-rgb),var(--bs-text-opacity))!important}.text-white{--bs-text-opacity:1;color:rgba(var(--bs-white-rgb),var(--bs-text-opacity))!important}.text-body{--bs-text-opacity:1;color:rgba(var(--bs-body-color-rgb),var(--bs-text-opacity))!important}.text-muted{--bs-text-opacity:1;color:var(--bs-secondary-color)!important}.text-black-50{--bs-text-opacity:1;color:rgba(0,0,0,.5)!important}.text-white-50{--bs-text-opacity:1;color:rgba(255,255,255,.5)!important}.text-body-secondary{--bs-text-opacity:1;color:var(--bs-secondary-color)!important}.text-body-tertiary{--bs-text-opacity:1;color:var(--bs-tertiary-color)!important}.text-body-emphasis{--bs-text-opacity:1;color:var(--bs-emphasis-color)!important}.text-reset{--bs-text-opacity:1;color:inherit!important}.text-opacity-25{--bs-text-opacity:0.25}.text-opacity-50{--bs-text-opacity:0.5}.text-opacity-75{--bs-text-opacity:0.75}.text-opacity-100{--bs-text-opacity:1}.text-primary-emphasis{color:var(--bs-primary-text-emphasis)!important}.text-secondary-emphasis{color:var(--bs-secondary-text-emphasis)!important}.text-success-emphasis{color:var(--bs-success-text-emphasis)!important}.text-info-emphasis{color:var(--bs-info-text-emphasis)!important}.text-warning-emphasis{color:var(--bs-warning-text-emphasis)!important}.text-danger-emphasis{color:var(--bs-danger-text-emphasis)!important}.text-light-emphasis{color:var(--bs-light-text-emphasis)!important}.text-dark-emphasis{color:var(--bs-dark-text-emphasis)!important}.link-opacity-10{--bs-link-opacity:0.1}.link-opacity-10-hover:hover{--bs-link-opacity:0.1}.link-opacity-25{--bs-link-opacity:0.25}.link-opacity-25-hover:hover{--bs-link-opacity:0.25}.link-opacity-50{--bs-link-opacity:0.5}.link-opacity-50-hover:hover{--bs-link-opacity:0.5}.link-opacity-75{--bs-link-opacity:0.75}.link-opacity-75-hover:hover{--bs-link-opacity:0.75}.link-opacity-100{--bs-link-opacity:1}.link-opacity-100-hover:hover{--bs-link-opacity:1}.link-offset-1{text-underline-offset:0.125em!important}.link-offset-1-hover:hover{text-underline-offset:0.125em!important}.link-offset-2{text-underline-offset:0.25em!important}.link-offset-2-hover:hover{text-underline-offset:0.25em!important}.link-offset-3{text-underline-offset:0.375em!important}.link-offset-3-hover:hover{text-underline-offset:0.375em!important}.link-underline-primary{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-primary-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-primary-rgb),var(--bs-link-underline-opacity))!important}.link-underline-secondary{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-secondary-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-secondary-rgb),var(--bs-link-underline-opacity))!important}.link-underline-success{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-success-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-success-rgb),var(--bs-link-underline-opacity))!important}.link-underline-info{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-info-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-info-rgb),var(--bs-link-underline-opacity))!important}.link-underline-warning{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-warning-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-warning-rgb),var(--bs-link-underline-opacity))!important}.link-underline-danger{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-danger-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-danger-rgb),var(--bs-link-underline-opacity))!important}.link-underline-light{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-light-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-light-rgb),var(--bs-link-underline-opacity))!important}.link-underline-dark{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-dark-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-dark-rgb),var(--bs-link-underline-opacity))!important}.link-underline{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-underline-opacity,1))!important}.link-underline-opacity-0{--bs-link-underline-opacity:0}.link-underline-opacity-0-hover:hover{--bs-link-underline-opacity:0}.link-underline-opacity-10{--bs-link-underline-opacity:0.1}.link-underline-opacity-10-hover:hover{--bs-link-underline-opacity:0.1}.link-underline-opacity-25{--bs-link-underline-opacity:0.25}.link-underline-opacity-25-hover:hover{--bs-link-underline-opacity:0.25}.link-underline-opacity-50{--bs-link-underline-opacity:0.5}.link-underline-opacity-50-hover:hover{--bs-link-underline-opacity:0.5}.link-underline-opacity-75{--bs-link-underline-opacity:0.75}.link-underline-opacity-75-hover:hover{--bs-link-underline-opacity:0.75}.link-underline-opacity-100{--bs-link-underline-opacity:1}.link-underline-opacity-100-hover:hover{--bs-link-underline-opacity:1}.bg-primary{--bs-bg-opacity:1;background-color:rgba(var(--bs-primary-rgb),var(--bs-bg-opacity))!important}.bg-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-rgb),var(--bs-bg-opacity))!important}.bg-success{--bs-bg-opacity:1;background-color:rgba(var(--bs-success-rgb),var(--bs-bg-opacity))!important}.bg-info{--bs-bg-opacity:1;background-color:rgba(var(--bs-info-rgb),var(--bs-bg-opacity))!important}.bg-warning{--bs-bg-opacity:1;background-color:rgba(var(--bs-warning-rgb),var(--bs-bg-opacity))!important}.bg-danger{--bs-bg-opacity:1;background-color:rgba(var(--bs-danger-rgb),var(--bs-bg-opacity))!important}.bg-light{--bs-bg-opacity:1;background-color:rgba(var(--bs-light-rgb),var(--bs-bg-opacity))!important}.bg-dark{--bs-bg-opacity:1;background-color:rgba(var(--bs-dark-rgb),var(--bs-bg-opacity))!important}.bg-black{--bs-bg-opacity:1;background-color:rgba(var(--bs-black-rgb),var(--bs-bg-opacity))!important}.bg-white{--bs-bg-opacity:1;background-color:rgba(var(--bs-white-rgb),var(--bs-bg-opacity))!important}.bg-body{--bs-bg-opacity:1;background-color:rgba(var(--bs-body-bg-rgb),var(--bs-bg-opacity))!important}.bg-transparent{--bs-bg-opacity:1;background-color:transparent!important}.bg-body-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-bg-rgb),var(--bs-bg-opacity))!important}.bg-body-tertiary{--bs-bg-opacity:1;background-color:rgba(var(--bs-tertiary-bg-rgb),var(--bs-bg-opacity))!important}.bg-opacity-10{--bs-bg-opacity:0.1}.bg-opacity-25{--bs-bg-opacity:0.25}.bg-opacity-50{--bs-bg-opacity:0.5}.bg-opacity-75{--bs-bg-opacity:0.75}.bg-opacity-100{--bs-bg-opacity:1}.bg-primary-subtle{background-color:var(--bs-primary-bg-subtle)!important}.bg-secondary-subtle{background-color:var(--bs-secondary-bg-subtle)!important}.bg-success-subtle{background-color:var(--bs-success-bg-subtle)!important}.bg-info-subtle{background-color:var(--bs-info-bg-subtle)!important}.bg-warning-subtle{background-color:var(--bs-warning-bg-subtle)!important}.bg-danger-subtle{background-color:var(--bs-danger-bg-subtle)!important}.bg-light-subtle{background-color:var(--bs-light-bg-subtle)!important}.bg-dark-subtle{background-color:var(--bs-dark-bg-subtle)!important}.bg-gradient{background-image:var(--bs-gradient)!important}.user-select-all{-webkit-user-select:all!important;-moz-user-select:all!important;user-select:all!important}.user-select-auto{-webkit-user-select:auto!important;-moz-user-select:auto!important;user-select:auto!important}.user-select-none{-webkit-user-select:none!important;-moz-user-select:none!important;user-select:none!important}.pe-none{pointer-events:none!important}.pe-auto{pointer-events:auto!important}.rounded{border-radius:var(--bs-border-radius)!important}.rounded-0{border-radius:0!important}.rounded-1{border-radius:var(--bs-border-radius-sm)!important}.rounded-2{border-radius:var(--bs-border-radius)!important}.rounded-3{border-radius:var(--bs-border-radius-lg)!important}.rounded-4{border-radius:var(--bs-border-radius-xl)!important}.rounded-5{border-radius:var(--bs-border-radius-xxl)!important}.rounded-circle{border-radius:50%!important}.rounded-pill{border-radius:var(--bs-border-radius-pill)!important}.rounded-top{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-top-0{border-top-left-radius:0!important;border-top-right-radius:0!important}.rounded-top-1{border-top-left-radius:var(--bs-border-radius-sm)!important;border-top-right-radius:var(--bs-border-radius-sm)!important}.rounded-top-2{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-top-3{border-top-left-radius:var(--bs-border-radius-lg)!important;border-top-right-radius:var(--bs-border-radius-lg)!important}.rounded-top-4{border-top-left-radius:var(--bs-border-radius-xl)!important;border-top-right-radius:var(--bs-border-radius-xl)!important}.rounded-top-5{border-top-left-radius:var(--bs-border-radius-xxl)!important;border-top-right-radius:var(--bs-border-radius-xxl)!important}.rounded-top-circle{border-top-left-radius:50%!important;border-top-right-radius:50%!important}.rounded-top-pill{border-top-left-radius:var(--bs-border-radius-pill)!important;border-top-right-radius:var(--bs-border-radius-pill)!important}.rounded-end{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-end-0{border-top-right-radius:0!important;border-bottom-right-radius:0!important}.rounded-end-1{border-top-right-radius:var(--bs-border-radius-sm)!important;border-bottom-right-radius:var(--bs-border-radius-sm)!important}.rounded-end-2{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-end-3{border-top-right-radius:var(--bs-border-radius-lg)!important;border-bottom-right-radius:var(--bs-border-radius-lg)!important}.rounded-end-4{border-top-right-radius:var(--bs-border-radius-xl)!important;border-bottom-right-radius:var(--bs-border-radius-xl)!important}.rounded-end-5{border-top-right-radius:var(--bs-border-radius-xxl)!important;border-bottom-right-radius:var(--bs-border-radius-xxl)!important}.rounded-end-circle{border-top-right-radius:50%!important;border-bottom-right-radius:50%!important}.rounded-end-pill{border-top-right-radius:var(--bs-border-radius-pill)!important;border-bottom-right-radius:var(--bs-border-radius-pill)!important}.rounded-bottom{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-bottom-0{border-bottom-right-radius:0!important;border-bottom-left-radius:0!important}.rounded-bottom-1{border-bottom-right-radius:var(--bs-border-radius-sm)!important;border-bottom-left-radius:var(--bs-border-radius-sm)!important}.rounded-bottom-2{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-bottom-3{border-bottom-right-radius:var(--bs-border-radius-lg)!important;border-bottom-left-radius:var(--bs-border-radius-lg)!important}.rounded-bottom-4{border-bottom-right-radius:var(--bs-border-radius-xl)!important;border-bottom-left-radius:var(--bs-border-radius-xl)!important}.rounded-bottom-5{border-bottom-right-radius:var(--bs-border-radius-xxl)!important;border-bottom-left-radius:var(--bs-border-radius-xxl)!important}.rounded-bottom-circle{border-bottom-right-radius:50%!important;border-bottom-left-radius:50%!important}.rounded-bottom-pill{border-bottom-right-radius:var(--bs-border-radius-pill)!important;border-bottom-left-radius:var(--bs-border-radius-pill)!important}.rounded-start{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.rounded-start-0{border-bottom-left-radius:0!important;border-top-left-radius:0!important}.rounded-start-1{border-bottom-left-radius:var(--bs-border-radius-sm)!important;border-top-left-radius:var(--bs-border-radius-sm)!important}.rounded-start-2{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.rounded-start-3{border-bottom-left-radius:var(--bs-border-radius-lg)!important;border-top-left-radius:var(--bs-border-radius-lg)!important}.rounded-start-4{border-bottom-left-radius:var(--bs-border-radius-xl)!important;border-top-left-radius:var(--bs-border-radius-xl)!important}.rounded-start-5{border-bottom-left-radius:var(--bs-border-radius-xxl)!important;border-top-left-radius:var(--bs-border-radius-xxl)!important}.rounded-start-circle{border-bottom-left-radius:50%!important;border-top-left-radius:50%!important}.rounded-start-pill{border-bottom-left-radius:var(--bs-border-radius-pill)!important;border-top-left-radius:var(--bs-border-radius-pill)!important}.visible{visibility:visible!important}.invisible{visibility:hidden!important}.z-n1{z-index:-1!important}.z-0{z-index:0!important}.z-1{z-index:1!important}.z-2{z-index:2!important}.z-3{z-index:3!important}@media (min-width:576px){.float-sm-start{float:left!important}.float-sm-end{float:right!important}.float-sm-none{float:none!important}.object-fit-sm-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-sm-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-sm-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-sm-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-sm-none{-o-object-fit:none!important;object-fit:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-grid{display:grid!important}.d-sm-inline-grid{display:inline-grid!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:flex!important}.d-sm-inline-flex{display:inline-flex!important}.d-sm-none{display:none!important}.flex-sm-fill{flex:1 1 auto!important}.flex-sm-row{flex-direction:row!important}.flex-sm-column{flex-direction:column!important}.flex-sm-row-reverse{flex-direction:row-reverse!important}.flex-sm-column-reverse{flex-direction:column-reverse!important}.flex-sm-grow-0{flex-grow:0!important}.flex-sm-grow-1{flex-grow:1!important}.flex-sm-shrink-0{flex-shrink:0!important}.flex-sm-shrink-1{flex-shrink:1!important}.flex-sm-wrap{flex-wrap:wrap!important}.flex-sm-nowrap{flex-wrap:nowrap!important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-sm-start{justify-content:flex-start!important}.justify-content-sm-end{justify-content:flex-end!important}.justify-content-sm-center{justify-content:center!important}.justify-content-sm-between{justify-content:space-between!important}.justify-content-sm-around{justify-content:space-around!important}.justify-content-sm-evenly{justify-content:space-evenly!important}.align-items-sm-start{align-items:flex-start!important}.align-items-sm-end{align-items:flex-end!important}.align-items-sm-center{align-items:center!important}.align-items-sm-baseline{align-items:baseline!important}.align-items-sm-stretch{align-items:stretch!important}.align-content-sm-start{align-content:flex-start!important}.align-content-sm-end{align-content:flex-end!important}.align-content-sm-center{align-content:center!important}.align-content-sm-between{align-content:space-between!important}.align-content-sm-around{align-content:space-around!important}.align-content-sm-stretch{align-content:stretch!important}.align-self-sm-auto{align-self:auto!important}.align-self-sm-start{align-self:flex-start!important}.align-self-sm-end{align-self:flex-end!important}.align-self-sm-center{align-self:center!important}.align-self-sm-baseline{align-self:baseline!important}.align-self-sm-stretch{align-self:stretch!important}.order-sm-first{order:-1!important}.order-sm-0{order:0!important}.order-sm-1{order:1!important}.order-sm-2{order:2!important}.order-sm-3{order:3!important}.order-sm-4{order:4!important}.order-sm-5{order:5!important}.order-sm-last{order:6!important}.m-sm-0{margin:0!important}.m-sm-1{margin:.25rem!important}.m-sm-2{margin:.5rem!important}.m-sm-3{margin:1rem!important}.m-sm-4{margin:1.5rem!important}.m-sm-5{margin:3rem!important}.m-sm-auto{margin:auto!important}.mx-sm-0{margin-right:0!important;margin-left:0!important}.mx-sm-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-sm-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-sm-3{margin-right:1rem!important;margin-left:1rem!important}.mx-sm-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-sm-5{margin-right:3rem!important;margin-left:3rem!important}.mx-sm-auto{margin-right:auto!important;margin-left:auto!important}.my-sm-0{margin-top:0!important;margin-bottom:0!important}.my-sm-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-sm-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-sm-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-sm-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-sm-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-sm-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-sm-0{margin-top:0!important}.mt-sm-1{margin-top:.25rem!important}.mt-sm-2{margin-top:.5rem!important}.mt-sm-3{margin-top:1rem!important}.mt-sm-4{margin-top:1.5rem!important}.mt-sm-5{margin-top:3rem!important}.mt-sm-auto{margin-top:auto!important}.me-sm-0{margin-right:0!important}.me-sm-1{margin-right:.25rem!important}.me-sm-2{margin-right:.5rem!important}.me-sm-3{margin-right:1rem!important}.me-sm-4{margin-right:1.5rem!important}.me-sm-5{margin-right:3rem!important}.me-sm-auto{margin-right:auto!important}.mb-sm-0{margin-bottom:0!important}.mb-sm-1{margin-bottom:.25rem!important}.mb-sm-2{margin-bottom:.5rem!important}.mb-sm-3{margin-bottom:1rem!important}.mb-sm-4{margin-bottom:1.5rem!important}.mb-sm-5{margin-bottom:3rem!important}.mb-sm-auto{margin-bottom:auto!important}.ms-sm-0{margin-left:0!important}.ms-sm-1{margin-left:.25rem!important}.ms-sm-2{margin-left:.5rem!important}.ms-sm-3{margin-left:1rem!important}.ms-sm-4{margin-left:1.5rem!important}.ms-sm-5{margin-left:3rem!important}.ms-sm-auto{margin-left:auto!important}.p-sm-0{padding:0!important}.p-sm-1{padding:.25rem!important}.p-sm-2{padding:.5rem!important}.p-sm-3{padding:1rem!important}.p-sm-4{padding:1.5rem!important}.p-sm-5{padding:3rem!important}.px-sm-0{padding-right:0!important;padding-left:0!important}.px-sm-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-sm-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-sm-3{padding-right:1rem!important;padding-left:1rem!important}.px-sm-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-sm-5{padding-right:3rem!important;padding-left:3rem!important}.py-sm-0{padding-top:0!important;padding-bottom:0!important}.py-sm-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-sm-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-sm-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-sm-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-sm-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-sm-0{padding-top:0!important}.pt-sm-1{padding-top:.25rem!important}.pt-sm-2{padding-top:.5rem!important}.pt-sm-3{padding-top:1rem!important}.pt-sm-4{padding-top:1.5rem!important}.pt-sm-5{padding-top:3rem!important}.pe-sm-0{padding-right:0!important}.pe-sm-1{padding-right:.25rem!important}.pe-sm-2{padding-right:.5rem!important}.pe-sm-3{padding-right:1rem!important}.pe-sm-4{padding-right:1.5rem!important}.pe-sm-5{padding-right:3rem!important}.pb-sm-0{padding-bottom:0!important}.pb-sm-1{padding-bottom:.25rem!important}.pb-sm-2{padding-bottom:.5rem!important}.pb-sm-3{padding-bottom:1rem!important}.pb-sm-4{padding-bottom:1.5rem!important}.pb-sm-5{padding-bottom:3rem!important}.ps-sm-0{padding-left:0!important}.ps-sm-1{padding-left:.25rem!important}.ps-sm-2{padding-left:.5rem!important}.ps-sm-3{padding-left:1rem!important}.ps-sm-4{padding-left:1.5rem!important}.ps-sm-5{padding-left:3rem!important}.gap-sm-0{gap:0!important}.gap-sm-1{gap:.25rem!important}.gap-sm-2{gap:.5rem!important}.gap-sm-3{gap:1rem!important}.gap-sm-4{gap:1.5rem!important}.gap-sm-5{gap:3rem!important}.row-gap-sm-0{row-gap:0!important}.row-gap-sm-1{row-gap:.25rem!important}.row-gap-sm-2{row-gap:.5rem!important}.row-gap-sm-3{row-gap:1rem!important}.row-gap-sm-4{row-gap:1.5rem!important}.row-gap-sm-5{row-gap:3rem!important}.column-gap-sm-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-sm-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-sm-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-sm-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-sm-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-sm-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-sm-start{text-align:left!important}.text-sm-end{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.float-md-start{float:left!important}.float-md-end{float:right!important}.float-md-none{float:none!important}.object-fit-md-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-md-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-md-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-md-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-md-none{-o-object-fit:none!important;object-fit:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-grid{display:grid!important}.d-md-inline-grid{display:inline-grid!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:flex!important}.d-md-inline-flex{display:inline-flex!important}.d-md-none{display:none!important}.flex-md-fill{flex:1 1 auto!important}.flex-md-row{flex-direction:row!important}.flex-md-column{flex-direction:column!important}.flex-md-row-reverse{flex-direction:row-reverse!important}.flex-md-column-reverse{flex-direction:column-reverse!important}.flex-md-grow-0{flex-grow:0!important}.flex-md-grow-1{flex-grow:1!important}.flex-md-shrink-0{flex-shrink:0!important}.flex-md-shrink-1{flex-shrink:1!important}.flex-md-wrap{flex-wrap:wrap!important}.flex-md-nowrap{flex-wrap:nowrap!important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-md-start{justify-content:flex-start!important}.justify-content-md-end{justify-content:flex-end!important}.justify-content-md-center{justify-content:center!important}.justify-content-md-between{justify-content:space-between!important}.justify-content-md-around{justify-content:space-around!important}.justify-content-md-evenly{justify-content:space-evenly!important}.align-items-md-start{align-items:flex-start!important}.align-items-md-end{align-items:flex-end!important}.align-items-md-center{align-items:center!important}.align-items-md-baseline{align-items:baseline!important}.align-items-md-stretch{align-items:stretch!important}.align-content-md-start{align-content:flex-start!important}.align-content-md-end{align-content:flex-end!important}.align-content-md-center{align-content:center!important}.align-content-md-between{align-content:space-between!important}.align-content-md-around{align-content:space-around!important}.align-content-md-stretch{align-content:stretch!important}.align-self-md-auto{align-self:auto!important}.align-self-md-start{align-self:flex-start!important}.align-self-md-end{align-self:flex-end!important}.align-self-md-center{align-self:center!important}.align-self-md-baseline{align-self:baseline!important}.align-self-md-stretch{align-self:stretch!important}.order-md-first{order:-1!important}.order-md-0{order:0!important}.order-md-1{order:1!important}.order-md-2{order:2!important}.order-md-3{order:3!important}.order-md-4{order:4!important}.order-md-5{order:5!important}.order-md-last{order:6!important}.m-md-0{margin:0!important}.m-md-1{margin:.25rem!important}.m-md-2{margin:.5rem!important}.m-md-3{margin:1rem!important}.m-md-4{margin:1.5rem!important}.m-md-5{margin:3rem!important}.m-md-auto{margin:auto!important}.mx-md-0{margin-right:0!important;margin-left:0!important}.mx-md-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-md-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-md-3{margin-right:1rem!important;margin-left:1rem!important}.mx-md-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-md-5{margin-right:3rem!important;margin-left:3rem!important}.mx-md-auto{margin-right:auto!important;margin-left:auto!important}.my-md-0{margin-top:0!important;margin-bottom:0!important}.my-md-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-md-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-md-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-md-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-md-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-md-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-md-0{margin-top:0!important}.mt-md-1{margin-top:.25rem!important}.mt-md-2{margin-top:.5rem!important}.mt-md-3{margin-top:1rem!important}.mt-md-4{margin-top:1.5rem!important}.mt-md-5{margin-top:3rem!important}.mt-md-auto{margin-top:auto!important}.me-md-0{margin-right:0!important}.me-md-1{margin-right:.25rem!important}.me-md-2{margin-right:.5rem!important}.me-md-3{margin-right:1rem!important}.me-md-4{margin-right:1.5rem!important}.me-md-5{margin-right:3rem!important}.me-md-auto{margin-right:auto!important}.mb-md-0{margin-bottom:0!important}.mb-md-1{margin-bottom:.25rem!important}.mb-md-2{margin-bottom:.5rem!important}.mb-md-3{margin-bottom:1rem!important}.mb-md-4{margin-bottom:1.5rem!important}.mb-md-5{margin-bottom:3rem!important}.mb-md-auto{margin-bottom:auto!important}.ms-md-0{margin-left:0!important}.ms-md-1{margin-left:.25rem!important}.ms-md-2{margin-left:.5rem!important}.ms-md-3{margin-left:1rem!important}.ms-md-4{margin-left:1.5rem!important}.ms-md-5{margin-left:3rem!important}.ms-md-auto{margin-left:auto!important}.p-md-0{padding:0!important}.p-md-1{padding:.25rem!important}.p-md-2{padding:.5rem!important}.p-md-3{padding:1rem!important}.p-md-4{padding:1.5rem!important}.p-md-5{padding:3rem!important}.px-md-0{padding-right:0!important;padding-left:0!important}.px-md-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-md-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-md-3{padding-right:1rem!important;padding-left:1rem!important}.px-md-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-md-5{padding-right:3rem!important;padding-left:3rem!important}.py-md-0{padding-top:0!important;padding-bottom:0!important}.py-md-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-md-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-md-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-md-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-md-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-md-0{padding-top:0!important}.pt-md-1{padding-top:.25rem!important}.pt-md-2{padding-top:.5rem!important}.pt-md-3{padding-top:1rem!important}.pt-md-4{padding-top:1.5rem!important}.pt-md-5{padding-top:3rem!important}.pe-md-0{padding-right:0!important}.pe-md-1{padding-right:.25rem!important}.pe-md-2{padding-right:.5rem!important}.pe-md-3{padding-right:1rem!important}.pe-md-4{padding-right:1.5rem!important}.pe-md-5{padding-right:3rem!important}.pb-md-0{padding-bottom:0!important}.pb-md-1{padding-bottom:.25rem!important}.pb-md-2{padding-bottom:.5rem!important}.pb-md-3{padding-bottom:1rem!important}.pb-md-4{padding-bottom:1.5rem!important}.pb-md-5{padding-bottom:3rem!important}.ps-md-0{padding-left:0!important}.ps-md-1{padding-left:.25rem!important}.ps-md-2{padding-left:.5rem!important}.ps-md-3{padding-left:1rem!important}.ps-md-4{padding-left:1.5rem!important}.ps-md-5{padding-left:3rem!important}.gap-md-0{gap:0!important}.gap-md-1{gap:.25rem!important}.gap-md-2{gap:.5rem!important}.gap-md-3{gap:1rem!important}.gap-md-4{gap:1.5rem!important}.gap-md-5{gap:3rem!important}.row-gap-md-0{row-gap:0!important}.row-gap-md-1{row-gap:.25rem!important}.row-gap-md-2{row-gap:.5rem!important}.row-gap-md-3{row-gap:1rem!important}.row-gap-md-4{row-gap:1.5rem!important}.row-gap-md-5{row-gap:3rem!important}.column-gap-md-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-md-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-md-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-md-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-md-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-md-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-md-start{text-align:left!important}.text-md-end{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.float-lg-start{float:left!important}.float-lg-end{float:right!important}.float-lg-none{float:none!important}.object-fit-lg-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-lg-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-lg-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-lg-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-lg-none{-o-object-fit:none!important;object-fit:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-grid{display:grid!important}.d-lg-inline-grid{display:inline-grid!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:flex!important}.d-lg-inline-flex{display:inline-flex!important}.d-lg-none{display:none!important}.flex-lg-fill{flex:1 1 auto!important}.flex-lg-row{flex-direction:row!important}.flex-lg-column{flex-direction:column!important}.flex-lg-row-reverse{flex-direction:row-reverse!important}.flex-lg-column-reverse{flex-direction:column-reverse!important}.flex-lg-grow-0{flex-grow:0!important}.flex-lg-grow-1{flex-grow:1!important}.flex-lg-shrink-0{flex-shrink:0!important}.flex-lg-shrink-1{flex-shrink:1!important}.flex-lg-wrap{flex-wrap:wrap!important}.flex-lg-nowrap{flex-wrap:nowrap!important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-lg-start{justify-content:flex-start!important}.justify-content-lg-end{justify-content:flex-end!important}.justify-content-lg-center{justify-content:center!important}.justify-content-lg-between{justify-content:space-between!important}.justify-content-lg-around{justify-content:space-around!important}.justify-content-lg-evenly{justify-content:space-evenly!important}.align-items-lg-start{align-items:flex-start!important}.align-items-lg-end{align-items:flex-end!important}.align-items-lg-center{align-items:center!important}.align-items-lg-baseline{align-items:baseline!important}.align-items-lg-stretch{align-items:stretch!important}.align-content-lg-start{align-content:flex-start!important}.align-content-lg-end{align-content:flex-end!important}.align-content-lg-center{align-content:center!important}.align-content-lg-between{align-content:space-between!important}.align-content-lg-around{align-content:space-around!important}.align-content-lg-stretch{align-content:stretch!important}.align-self-lg-auto{align-self:auto!important}.align-self-lg-start{align-self:flex-start!important}.align-self-lg-end{align-self:flex-end!important}.align-self-lg-center{align-self:center!important}.align-self-lg-baseline{align-self:baseline!important}.align-self-lg-stretch{align-self:stretch!important}.order-lg-first{order:-1!important}.order-lg-0{order:0!important}.order-lg-1{order:1!important}.order-lg-2{order:2!important}.order-lg-3{order:3!important}.order-lg-4{order:4!important}.order-lg-5{order:5!important}.order-lg-last{order:6!important}.m-lg-0{margin:0!important}.m-lg-1{margin:.25rem!important}.m-lg-2{margin:.5rem!important}.m-lg-3{margin:1rem!important}.m-lg-4{margin:1.5rem!important}.m-lg-5{margin:3rem!important}.m-lg-auto{margin:auto!important}.mx-lg-0{margin-right:0!important;margin-left:0!important}.mx-lg-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-lg-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-lg-3{margin-right:1rem!important;margin-left:1rem!important}.mx-lg-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-lg-5{margin-right:3rem!important;margin-left:3rem!important}.mx-lg-auto{margin-right:auto!important;margin-left:auto!important}.my-lg-0{margin-top:0!important;margin-bottom:0!important}.my-lg-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-lg-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-lg-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-lg-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-lg-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-lg-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-lg-0{margin-top:0!important}.mt-lg-1{margin-top:.25rem!important}.mt-lg-2{margin-top:.5rem!important}.mt-lg-3{margin-top:1rem!important}.mt-lg-4{margin-top:1.5rem!important}.mt-lg-5{margin-top:3rem!important}.mt-lg-auto{margin-top:auto!important}.me-lg-0{margin-right:0!important}.me-lg-1{margin-right:.25rem!important}.me-lg-2{margin-right:.5rem!important}.me-lg-3{margin-right:1rem!important}.me-lg-4{margin-right:1.5rem!important}.me-lg-5{margin-right:3rem!important}.me-lg-auto{margin-right:auto!important}.mb-lg-0{margin-bottom:0!important}.mb-lg-1{margin-bottom:.25rem!important}.mb-lg-2{margin-bottom:.5rem!important}.mb-lg-3{margin-bottom:1rem!important}.mb-lg-4{margin-bottom:1.5rem!important}.mb-lg-5{margin-bottom:3rem!important}.mb-lg-auto{margin-bottom:auto!important}.ms-lg-0{margin-left:0!important}.ms-lg-1{margin-left:.25rem!important}.ms-lg-2{margin-left:.5rem!important}.ms-lg-3{margin-left:1rem!important}.ms-lg-4{margin-left:1.5rem!important}.ms-lg-5{margin-left:3rem!important}.ms-lg-auto{margin-left:auto!important}.p-lg-0{padding:0!important}.p-lg-1{padding:.25rem!important}.p-lg-2{padding:.5rem!important}.p-lg-3{padding:1rem!important}.p-lg-4{padding:1.5rem!important}.p-lg-5{padding:3rem!important}.px-lg-0{padding-right:0!important;padding-left:0!important}.px-lg-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-lg-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-lg-3{padding-right:1rem!important;padding-left:1rem!important}.px-lg-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-lg-5{padding-right:3rem!important;padding-left:3rem!important}.py-lg-0{padding-top:0!important;padding-bottom:0!important}.py-lg-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-lg-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-lg-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-lg-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-lg-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-lg-0{padding-top:0!important}.pt-lg-1{padding-top:.25rem!important}.pt-lg-2{padding-top:.5rem!important}.pt-lg-3{padding-top:1rem!important}.pt-lg-4{padding-top:1.5rem!important}.pt-lg-5{padding-top:3rem!important}.pe-lg-0{padding-right:0!important}.pe-lg-1{padding-right:.25rem!important}.pe-lg-2{padding-right:.5rem!important}.pe-lg-3{padding-right:1rem!important}.pe-lg-4{padding-right:1.5rem!important}.pe-lg-5{padding-right:3rem!important}.pb-lg-0{padding-bottom:0!important}.pb-lg-1{padding-bottom:.25rem!important}.pb-lg-2{padding-bottom:.5rem!important}.pb-lg-3{padding-bottom:1rem!important}.pb-lg-4{padding-bottom:1.5rem!important}.pb-lg-5{padding-bottom:3rem!important}.ps-lg-0{padding-left:0!important}.ps-lg-1{padding-left:.25rem!important}.ps-lg-2{padding-left:.5rem!important}.ps-lg-3{padding-left:1rem!important}.ps-lg-4{padding-left:1.5rem!important}.ps-lg-5{padding-left:3rem!important}.gap-lg-0{gap:0!important}.gap-lg-1{gap:.25rem!important}.gap-lg-2{gap:.5rem!important}.gap-lg-3{gap:1rem!important}.gap-lg-4{gap:1.5rem!important}.gap-lg-5{gap:3rem!important}.row-gap-lg-0{row-gap:0!important}.row-gap-lg-1{row-gap:.25rem!important}.row-gap-lg-2{row-gap:.5rem!important}.row-gap-lg-3{row-gap:1rem!important}.row-gap-lg-4{row-gap:1.5rem!important}.row-gap-lg-5{row-gap:3rem!important}.column-gap-lg-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-lg-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-lg-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-lg-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-lg-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-lg-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-lg-start{text-align:left!important}.text-lg-end{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.float-xl-start{float:left!important}.float-xl-end{float:right!important}.float-xl-none{float:none!important}.object-fit-xl-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-xl-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-xl-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-xl-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-xl-none{-o-object-fit:none!important;object-fit:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-grid{display:grid!important}.d-xl-inline-grid{display:inline-grid!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:flex!important}.d-xl-inline-flex{display:inline-flex!important}.d-xl-none{display:none!important}.flex-xl-fill{flex:1 1 auto!important}.flex-xl-row{flex-direction:row!important}.flex-xl-column{flex-direction:column!important}.flex-xl-row-reverse{flex-direction:row-reverse!important}.flex-xl-column-reverse{flex-direction:column-reverse!important}.flex-xl-grow-0{flex-grow:0!important}.flex-xl-grow-1{flex-grow:1!important}.flex-xl-shrink-0{flex-shrink:0!important}.flex-xl-shrink-1{flex-shrink:1!important}.flex-xl-wrap{flex-wrap:wrap!important}.flex-xl-nowrap{flex-wrap:nowrap!important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xl-start{justify-content:flex-start!important}.justify-content-xl-end{justify-content:flex-end!important}.justify-content-xl-center{justify-content:center!important}.justify-content-xl-between{justify-content:space-between!important}.justify-content-xl-around{justify-content:space-around!important}.justify-content-xl-evenly{justify-content:space-evenly!important}.align-items-xl-start{align-items:flex-start!important}.align-items-xl-end{align-items:flex-end!important}.align-items-xl-center{align-items:center!important}.align-items-xl-baseline{align-items:baseline!important}.align-items-xl-stretch{align-items:stretch!important}.align-content-xl-start{align-content:flex-start!important}.align-content-xl-end{align-content:flex-end!important}.align-content-xl-center{align-content:center!important}.align-content-xl-between{align-content:space-between!important}.align-content-xl-around{align-content:space-around!important}.align-content-xl-stretch{align-content:stretch!important}.align-self-xl-auto{align-self:auto!important}.align-self-xl-start{align-self:flex-start!important}.align-self-xl-end{align-self:flex-end!important}.align-self-xl-center{align-self:center!important}.align-self-xl-baseline{align-self:baseline!important}.align-self-xl-stretch{align-self:stretch!important}.order-xl-first{order:-1!important}.order-xl-0{order:0!important}.order-xl-1{order:1!important}.order-xl-2{order:2!important}.order-xl-3{order:3!important}.order-xl-4{order:4!important}.order-xl-5{order:5!important}.order-xl-last{order:6!important}.m-xl-0{margin:0!important}.m-xl-1{margin:.25rem!important}.m-xl-2{margin:.5rem!important}.m-xl-3{margin:1rem!important}.m-xl-4{margin:1.5rem!important}.m-xl-5{margin:3rem!important}.m-xl-auto{margin:auto!important}.mx-xl-0{margin-right:0!important;margin-left:0!important}.mx-xl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xl-auto{margin-right:auto!important;margin-left:auto!important}.my-xl-0{margin-top:0!important;margin-bottom:0!important}.my-xl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xl-0{margin-top:0!important}.mt-xl-1{margin-top:.25rem!important}.mt-xl-2{margin-top:.5rem!important}.mt-xl-3{margin-top:1rem!important}.mt-xl-4{margin-top:1.5rem!important}.mt-xl-5{margin-top:3rem!important}.mt-xl-auto{margin-top:auto!important}.me-xl-0{margin-right:0!important}.me-xl-1{margin-right:.25rem!important}.me-xl-2{margin-right:.5rem!important}.me-xl-3{margin-right:1rem!important}.me-xl-4{margin-right:1.5rem!important}.me-xl-5{margin-right:3rem!important}.me-xl-auto{margin-right:auto!important}.mb-xl-0{margin-bottom:0!important}.mb-xl-1{margin-bottom:.25rem!important}.mb-xl-2{margin-bottom:.5rem!important}.mb-xl-3{margin-bottom:1rem!important}.mb-xl-4{margin-bottom:1.5rem!important}.mb-xl-5{margin-bottom:3rem!important}.mb-xl-auto{margin-bottom:auto!important}.ms-xl-0{margin-left:0!important}.ms-xl-1{margin-left:.25rem!important}.ms-xl-2{margin-left:.5rem!important}.ms-xl-3{margin-left:1rem!important}.ms-xl-4{margin-left:1.5rem!important}.ms-xl-5{margin-left:3rem!important}.ms-xl-auto{margin-left:auto!important}.p-xl-0{padding:0!important}.p-xl-1{padding:.25rem!important}.p-xl-2{padding:.5rem!important}.p-xl-3{padding:1rem!important}.p-xl-4{padding:1.5rem!important}.p-xl-5{padding:3rem!important}.px-xl-0{padding-right:0!important;padding-left:0!important}.px-xl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xl-0{padding-top:0!important;padding-bottom:0!important}.py-xl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xl-0{padding-top:0!important}.pt-xl-1{padding-top:.25rem!important}.pt-xl-2{padding-top:.5rem!important}.pt-xl-3{padding-top:1rem!important}.pt-xl-4{padding-top:1.5rem!important}.pt-xl-5{padding-top:3rem!important}.pe-xl-0{padding-right:0!important}.pe-xl-1{padding-right:.25rem!important}.pe-xl-2{padding-right:.5rem!important}.pe-xl-3{padding-right:1rem!important}.pe-xl-4{padding-right:1.5rem!important}.pe-xl-5{padding-right:3rem!important}.pb-xl-0{padding-bottom:0!important}.pb-xl-1{padding-bottom:.25rem!important}.pb-xl-2{padding-bottom:.5rem!important}.pb-xl-3{padding-bottom:1rem!important}.pb-xl-4{padding-bottom:1.5rem!important}.pb-xl-5{padding-bottom:3rem!important}.ps-xl-0{padding-left:0!important}.ps-xl-1{padding-left:.25rem!important}.ps-xl-2{padding-left:.5rem!important}.ps-xl-3{padding-left:1rem!important}.ps-xl-4{padding-left:1.5rem!important}.ps-xl-5{padding-left:3rem!important}.gap-xl-0{gap:0!important}.gap-xl-1{gap:.25rem!important}.gap-xl-2{gap:.5rem!important}.gap-xl-3{gap:1rem!important}.gap-xl-4{gap:1.5rem!important}.gap-xl-5{gap:3rem!important}.row-gap-xl-0{row-gap:0!important}.row-gap-xl-1{row-gap:.25rem!important}.row-gap-xl-2{row-gap:.5rem!important}.row-gap-xl-3{row-gap:1rem!important}.row-gap-xl-4{row-gap:1.5rem!important}.row-gap-xl-5{row-gap:3rem!important}.column-gap-xl-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-xl-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-xl-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-xl-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-xl-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-xl-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-xl-start{text-align:left!important}.text-xl-end{text-align:right!important}.text-xl-center{text-align:center!important}}@media (min-width:1400px){.float-xxl-start{float:left!important}.float-xxl-end{float:right!important}.float-xxl-none{float:none!important}.object-fit-xxl-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-xxl-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-xxl-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-xxl-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-xxl-none{-o-object-fit:none!important;object-fit:none!important}.d-xxl-inline{display:inline!important}.d-xxl-inline-block{display:inline-block!important}.d-xxl-block{display:block!important}.d-xxl-grid{display:grid!important}.d-xxl-inline-grid{display:inline-grid!important}.d-xxl-table{display:table!important}.d-xxl-table-row{display:table-row!important}.d-xxl-table-cell{display:table-cell!important}.d-xxl-flex{display:flex!important}.d-xxl-inline-flex{display:inline-flex!important}.d-xxl-none{display:none!important}.flex-xxl-fill{flex:1 1 auto!important}.flex-xxl-row{flex-direction:row!important}.flex-xxl-column{flex-direction:column!important}.flex-xxl-row-reverse{flex-direction:row-reverse!important}.flex-xxl-column-reverse{flex-direction:column-reverse!important}.flex-xxl-grow-0{flex-grow:0!important}.flex-xxl-grow-1{flex-grow:1!important}.flex-xxl-shrink-0{flex-shrink:0!important}.flex-xxl-shrink-1{flex-shrink:1!important}.flex-xxl-wrap{flex-wrap:wrap!important}.flex-xxl-nowrap{flex-wrap:nowrap!important}.flex-xxl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xxl-start{justify-content:flex-start!important}.justify-content-xxl-end{justify-content:flex-end!important}.justify-content-xxl-center{justify-content:center!important}.justify-content-xxl-between{justify-content:space-between!important}.justify-content-xxl-around{justify-content:space-around!important}.justify-content-xxl-evenly{justify-content:space-evenly!important}.align-items-xxl-start{align-items:flex-start!important}.align-items-xxl-end{align-items:flex-end!important}.align-items-xxl-center{align-items:center!important}.align-items-xxl-baseline{align-items:baseline!important}.align-items-xxl-stretch{align-items:stretch!important}.align-content-xxl-start{align-content:flex-start!important}.align-content-xxl-end{align-content:flex-end!important}.align-content-xxl-center{align-content:center!important}.align-content-xxl-between{align-content:space-between!important}.align-content-xxl-around{align-content:space-around!important}.align-content-xxl-stretch{align-content:stretch!important}.align-self-xxl-auto{align-self:auto!important}.align-self-xxl-start{align-self:flex-start!important}.align-self-xxl-end{align-self:flex-end!important}.align-self-xxl-center{align-self:center!important}.align-self-xxl-baseline{align-self:baseline!important}.align-self-xxl-stretch{align-self:stretch!important}.order-xxl-first{order:-1!important}.order-xxl-0{order:0!important}.order-xxl-1{order:1!important}.order-xxl-2{order:2!important}.order-xxl-3{order:3!important}.order-xxl-4{order:4!important}.order-xxl-5{order:5!important}.order-xxl-last{order:6!important}.m-xxl-0{margin:0!important}.m-xxl-1{margin:.25rem!important}.m-xxl-2{margin:.5rem!important}.m-xxl-3{margin:1rem!important}.m-xxl-4{margin:1.5rem!important}.m-xxl-5{margin:3rem!important}.m-xxl-auto{margin:auto!important}.mx-xxl-0{margin-right:0!important;margin-left:0!important}.mx-xxl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xxl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xxl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xxl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xxl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xxl-auto{margin-right:auto!important;margin-left:auto!important}.my-xxl-0{margin-top:0!important;margin-bottom:0!important}.my-xxl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xxl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xxl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xxl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xxl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xxl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xxl-0{margin-top:0!important}.mt-xxl-1{margin-top:.25rem!important}.mt-xxl-2{margin-top:.5rem!important}.mt-xxl-3{margin-top:1rem!important}.mt-xxl-4{margin-top:1.5rem!important}.mt-xxl-5{margin-top:3rem!important}.mt-xxl-auto{margin-top:auto!important}.me-xxl-0{margin-right:0!important}.me-xxl-1{margin-right:.25rem!important}.me-xxl-2{margin-right:.5rem!important}.me-xxl-3{margin-right:1rem!important}.me-xxl-4{margin-right:1.5rem!important}.me-xxl-5{margin-right:3rem!important}.me-xxl-auto{margin-right:auto!important}.mb-xxl-0{margin-bottom:0!important}.mb-xxl-1{margin-bottom:.25rem!important}.mb-xxl-2{margin-bottom:.5rem!important}.mb-xxl-3{margin-bottom:1rem!important}.mb-xxl-4{margin-bottom:1.5rem!important}.mb-xxl-5{margin-bottom:3rem!important}.mb-xxl-auto{margin-bottom:auto!important}.ms-xxl-0{margin-left:0!important}.ms-xxl-1{margin-left:.25rem!important}.ms-xxl-2{margin-left:.5rem!important}.ms-xxl-3{margin-left:1rem!important}.ms-xxl-4{margin-left:1.5rem!important}.ms-xxl-5{margin-left:3rem!important}.ms-xxl-auto{margin-left:auto!important}.p-xxl-0{padding:0!important}.p-xxl-1{padding:.25rem!important}.p-xxl-2{padding:.5rem!important}.p-xxl-3{padding:1rem!important}.p-xxl-4{padding:1.5rem!important}.p-xxl-5{padding:3rem!important}.px-xxl-0{padding-right:0!important;padding-left:0!important}.px-xxl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xxl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xxl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xxl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xxl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xxl-0{padding-top:0!important;padding-bottom:0!important}.py-xxl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xxl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xxl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xxl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xxl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xxl-0{padding-top:0!important}.pt-xxl-1{padding-top:.25rem!important}.pt-xxl-2{padding-top:.5rem!important}.pt-xxl-3{padding-top:1rem!important}.pt-xxl-4{padding-top:1.5rem!important}.pt-xxl-5{padding-top:3rem!important}.pe-xxl-0{padding-right:0!important}.pe-xxl-1{padding-right:.25rem!important}.pe-xxl-2{padding-right:.5rem!important}.pe-xxl-3{padding-right:1rem!important}.pe-xxl-4{padding-right:1.5rem!important}.pe-xxl-5{padding-right:3rem!important}.pb-xxl-0{padding-bottom:0!important}.pb-xxl-1{padding-bottom:.25rem!important}.pb-xxl-2{padding-bottom:.5rem!important}.pb-xxl-3{padding-bottom:1rem!important}.pb-xxl-4{padding-bottom:1.5rem!important}.pb-xxl-5{padding-bottom:3rem!important}.ps-xxl-0{padding-left:0!important}.ps-xxl-1{padding-left:.25rem!important}.ps-xxl-2{padding-left:.5rem!important}.ps-xxl-3{padding-left:1rem!important}.ps-xxl-4{padding-left:1.5rem!important}.ps-xxl-5{padding-left:3rem!important}.gap-xxl-0{gap:0!important}.gap-xxl-1{gap:.25rem!important}.gap-xxl-2{gap:.5rem!important}.gap-xxl-3{gap:1rem!important}.gap-xxl-4{gap:1.5rem!important}.gap-xxl-5{gap:3rem!important}.row-gap-xxl-0{row-gap:0!important}.row-gap-xxl-1{row-gap:.25rem!important}.row-gap-xxl-2{row-gap:.5rem!important}.row-gap-xxl-3{row-gap:1rem!important}.row-gap-xxl-4{row-gap:1.5rem!important}.row-gap-xxl-5{row-gap:3rem!important}.column-gap-xxl-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-xxl-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-xxl-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-xxl-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-xxl-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-xxl-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-xxl-start{text-align:left!important}.text-xxl-end{text-align:right!important}.text-xxl-center{text-align:center!important}}@media (min-width:1200px){.fs-1{font-size:2.5rem!important}.fs-2{font-size:2rem!important}.fs-3{font-size:1.75rem!important}.fs-4{font-size:1.5rem!important}}@media print{.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-grid{display:grid!important}.d-print-inline-grid{display:inline-grid!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:flex!important}.d-print-inline-flex{display:inline-flex!important}.d-print-none{display:none!important}} +/*# sourceMappingURL=bootstrap.min.css.map */ \ No newline at end of file diff --git a/public/images/cloud-bg-dark.png b/public/images/cloud-bg-dark.png new file mode 100644 index 0000000..4f0a9dc Binary files /dev/null and b/public/images/cloud-bg-dark.png differ diff --git a/public/images/cloud-bg.png b/public/images/cloud-bg.png new file mode 100644 index 0000000..f5459b3 Binary files /dev/null and b/public/images/cloud-bg.png differ diff --git a/public/images/laravel-security.png b/public/images/laravel-security.png new file mode 100644 index 0000000..e191099 Binary files /dev/null and b/public/images/laravel-security.png differ diff --git a/public/js/bootstrap.bundle.min.js b/public/js/bootstrap.bundle.min.js new file mode 100644 index 0000000..04e9185 --- /dev/null +++ b/public/js/bootstrap.bundle.min.js @@ -0,0 +1,7 @@ +/*! + * Bootstrap v5.3.3 (https://getbootstrap.com/) + * Copyright 2011-2024 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */ +!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?module.exports=e():"function"==typeof define&&define.amd?define(e):(t="undefined"!=typeof globalThis?globalThis:t||self).bootstrap=e()}(this,(function(){"use strict";const t=new Map,e={set(e,i,n){t.has(e)||t.set(e,new Map);const s=t.get(e);s.has(i)||0===s.size?s.set(i,n):console.error(`Bootstrap doesn't allow more than one instance per element. Bound instance: ${Array.from(s.keys())[0]}.`)},get:(e,i)=>t.has(e)&&t.get(e).get(i)||null,remove(e,i){if(!t.has(e))return;const n=t.get(e);n.delete(i),0===n.size&&t.delete(e)}},i="transitionend",n=t=>(t&&window.CSS&&window.CSS.escape&&(t=t.replace(/#([^\s"#']+)/g,((t,e)=>`#${CSS.escape(e)}`))),t),s=t=>{t.dispatchEvent(new Event(i))},o=t=>!(!t||"object"!=typeof t)&&(void 0!==t.jquery&&(t=t[0]),void 0!==t.nodeType),r=t=>o(t)?t.jquery?t[0]:t:"string"==typeof t&&t.length>0?document.querySelector(n(t)):null,a=t=>{if(!o(t)||0===t.getClientRects().length)return!1;const e="visible"===getComputedStyle(t).getPropertyValue("visibility"),i=t.closest("details:not([open])");if(!i)return e;if(i!==t){const e=t.closest("summary");if(e&&e.parentNode!==i)return!1;if(null===e)return!1}return e},l=t=>!t||t.nodeType!==Node.ELEMENT_NODE||!!t.classList.contains("disabled")||(void 0!==t.disabled?t.disabled:t.hasAttribute("disabled")&&"false"!==t.getAttribute("disabled")),c=t=>{if(!document.documentElement.attachShadow)return null;if("function"==typeof t.getRootNode){const e=t.getRootNode();return e instanceof ShadowRoot?e:null}return t instanceof ShadowRoot?t:t.parentNode?c(t.parentNode):null},h=()=>{},d=t=>{t.offsetHeight},u=()=>window.jQuery&&!document.body.hasAttribute("data-bs-no-jquery")?window.jQuery:null,f=[],p=()=>"rtl"===document.documentElement.dir,m=t=>{var e;e=()=>{const e=u();if(e){const i=t.NAME,n=e.fn[i];e.fn[i]=t.jQueryInterface,e.fn[i].Constructor=t,e.fn[i].noConflict=()=>(e.fn[i]=n,t.jQueryInterface)}},"loading"===document.readyState?(f.length||document.addEventListener("DOMContentLoaded",(()=>{for(const t of f)t()})),f.push(e)):e()},g=(t,e=[],i=t)=>"function"==typeof t?t(...e):i,_=(t,e,n=!0)=>{if(!n)return void g(t);const o=(t=>{if(!t)return 0;let{transitionDuration:e,transitionDelay:i}=window.getComputedStyle(t);const n=Number.parseFloat(e),s=Number.parseFloat(i);return n||s?(e=e.split(",")[0],i=i.split(",")[0],1e3*(Number.parseFloat(e)+Number.parseFloat(i))):0})(e)+5;let r=!1;const a=({target:n})=>{n===e&&(r=!0,e.removeEventListener(i,a),g(t))};e.addEventListener(i,a),setTimeout((()=>{r||s(e)}),o)},b=(t,e,i,n)=>{const s=t.length;let o=t.indexOf(e);return-1===o?!i&&n?t[s-1]:t[0]:(o+=i?1:-1,n&&(o=(o+s)%s),t[Math.max(0,Math.min(o,s-1))])},v=/[^.]*(?=\..*)\.|.*/,y=/\..*/,w=/::\d+$/,A={};let E=1;const T={mouseenter:"mouseover",mouseleave:"mouseout"},C=new Set(["click","dblclick","mouseup","mousedown","contextmenu","mousewheel","DOMMouseScroll","mouseover","mouseout","mousemove","selectstart","selectend","keydown","keypress","keyup","orientationchange","touchstart","touchmove","touchend","touchcancel","pointerdown","pointermove","pointerup","pointerleave","pointercancel","gesturestart","gesturechange","gestureend","focus","blur","change","reset","select","submit","focusin","focusout","load","unload","beforeunload","resize","move","DOMContentLoaded","readystatechange","error","abort","scroll"]);function O(t,e){return e&&`${e}::${E++}`||t.uidEvent||E++}function x(t){const e=O(t);return t.uidEvent=e,A[e]=A[e]||{},A[e]}function k(t,e,i=null){return Object.values(t).find((t=>t.callable===e&&t.delegationSelector===i))}function L(t,e,i){const n="string"==typeof e,s=n?i:e||i;let o=I(t);return C.has(o)||(o=t),[n,s,o]}function S(t,e,i,n,s){if("string"!=typeof e||!t)return;let[o,r,a]=L(e,i,n);if(e in T){const t=t=>function(e){if(!e.relatedTarget||e.relatedTarget!==e.delegateTarget&&!e.delegateTarget.contains(e.relatedTarget))return t.call(this,e)};r=t(r)}const l=x(t),c=l[a]||(l[a]={}),h=k(c,r,o?i:null);if(h)return void(h.oneOff=h.oneOff&&s);const d=O(r,e.replace(v,"")),u=o?function(t,e,i){return function n(s){const o=t.querySelectorAll(e);for(let{target:r}=s;r&&r!==this;r=r.parentNode)for(const a of o)if(a===r)return P(s,{delegateTarget:r}),n.oneOff&&N.off(t,s.type,e,i),i.apply(r,[s])}}(t,i,r):function(t,e){return function i(n){return P(n,{delegateTarget:t}),i.oneOff&&N.off(t,n.type,e),e.apply(t,[n])}}(t,r);u.delegationSelector=o?i:null,u.callable=r,u.oneOff=s,u.uidEvent=d,c[d]=u,t.addEventListener(a,u,o)}function D(t,e,i,n,s){const o=k(e[i],n,s);o&&(t.removeEventListener(i,o,Boolean(s)),delete e[i][o.uidEvent])}function $(t,e,i,n){const s=e[i]||{};for(const[o,r]of Object.entries(s))o.includes(n)&&D(t,e,i,r.callable,r.delegationSelector)}function I(t){return t=t.replace(y,""),T[t]||t}const N={on(t,e,i,n){S(t,e,i,n,!1)},one(t,e,i,n){S(t,e,i,n,!0)},off(t,e,i,n){if("string"!=typeof e||!t)return;const[s,o,r]=L(e,i,n),a=r!==e,l=x(t),c=l[r]||{},h=e.startsWith(".");if(void 0===o){if(h)for(const i of Object.keys(l))$(t,l,i,e.slice(1));for(const[i,n]of Object.entries(c)){const s=i.replace(w,"");a&&!e.includes(s)||D(t,l,r,n.callable,n.delegationSelector)}}else{if(!Object.keys(c).length)return;D(t,l,r,o,s?i:null)}},trigger(t,e,i){if("string"!=typeof e||!t)return null;const n=u();let s=null,o=!0,r=!0,a=!1;e!==I(e)&&n&&(s=n.Event(e,i),n(t).trigger(s),o=!s.isPropagationStopped(),r=!s.isImmediatePropagationStopped(),a=s.isDefaultPrevented());const l=P(new Event(e,{bubbles:o,cancelable:!0}),i);return a&&l.preventDefault(),r&&t.dispatchEvent(l),l.defaultPrevented&&s&&s.preventDefault(),l}};function P(t,e={}){for(const[i,n]of Object.entries(e))try{t[i]=n}catch(e){Object.defineProperty(t,i,{configurable:!0,get:()=>n})}return t}function j(t){if("true"===t)return!0;if("false"===t)return!1;if(t===Number(t).toString())return Number(t);if(""===t||"null"===t)return null;if("string"!=typeof t)return t;try{return JSON.parse(decodeURIComponent(t))}catch(e){return t}}function M(t){return t.replace(/[A-Z]/g,(t=>`-${t.toLowerCase()}`))}const F={setDataAttribute(t,e,i){t.setAttribute(`data-bs-${M(e)}`,i)},removeDataAttribute(t,e){t.removeAttribute(`data-bs-${M(e)}`)},getDataAttributes(t){if(!t)return{};const e={},i=Object.keys(t.dataset).filter((t=>t.startsWith("bs")&&!t.startsWith("bsConfig")));for(const n of i){let i=n.replace(/^bs/,"");i=i.charAt(0).toLowerCase()+i.slice(1,i.length),e[i]=j(t.dataset[n])}return e},getDataAttribute:(t,e)=>j(t.getAttribute(`data-bs-${M(e)}`))};class H{static get Default(){return{}}static get DefaultType(){return{}}static get NAME(){throw new Error('You have to implement the static method "NAME", for each component!')}_getConfig(t){return t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t}_mergeConfigObj(t,e){const i=o(e)?F.getDataAttribute(e,"config"):{};return{...this.constructor.Default,..."object"==typeof i?i:{},...o(e)?F.getDataAttributes(e):{},..."object"==typeof t?t:{}}}_typeCheckConfig(t,e=this.constructor.DefaultType){for(const[n,s]of Object.entries(e)){const e=t[n],r=o(e)?"element":null==(i=e)?`${i}`:Object.prototype.toString.call(i).match(/\s([a-z]+)/i)[1].toLowerCase();if(!new RegExp(s).test(r))throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option "${n}" provided type "${r}" but expected type "${s}".`)}var i}}class W extends H{constructor(t,i){super(),(t=r(t))&&(this._element=t,this._config=this._getConfig(i),e.set(this._element,this.constructor.DATA_KEY,this))}dispose(){e.remove(this._element,this.constructor.DATA_KEY),N.off(this._element,this.constructor.EVENT_KEY);for(const t of Object.getOwnPropertyNames(this))this[t]=null}_queueCallback(t,e,i=!0){_(t,e,i)}_getConfig(t){return t=this._mergeConfigObj(t,this._element),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}static getInstance(t){return e.get(r(t),this.DATA_KEY)}static getOrCreateInstance(t,e={}){return this.getInstance(t)||new this(t,"object"==typeof e?e:null)}static get VERSION(){return"5.3.3"}static get DATA_KEY(){return`bs.${this.NAME}`}static get EVENT_KEY(){return`.${this.DATA_KEY}`}static eventName(t){return`${t}${this.EVENT_KEY}`}}const B=t=>{let e=t.getAttribute("data-bs-target");if(!e||"#"===e){let i=t.getAttribute("href");if(!i||!i.includes("#")&&!i.startsWith("."))return null;i.includes("#")&&!i.startsWith("#")&&(i=`#${i.split("#")[1]}`),e=i&&"#"!==i?i.trim():null}return e?e.split(",").map((t=>n(t))).join(","):null},z={find:(t,e=document.documentElement)=>[].concat(...Element.prototype.querySelectorAll.call(e,t)),findOne:(t,e=document.documentElement)=>Element.prototype.querySelector.call(e,t),children:(t,e)=>[].concat(...t.children).filter((t=>t.matches(e))),parents(t,e){const i=[];let n=t.parentNode.closest(e);for(;n;)i.push(n),n=n.parentNode.closest(e);return i},prev(t,e){let i=t.previousElementSibling;for(;i;){if(i.matches(e))return[i];i=i.previousElementSibling}return[]},next(t,e){let i=t.nextElementSibling;for(;i;){if(i.matches(e))return[i];i=i.nextElementSibling}return[]},focusableChildren(t){const e=["a","button","input","textarea","select","details","[tabindex]",'[contenteditable="true"]'].map((t=>`${t}:not([tabindex^="-"])`)).join(",");return this.find(e,t).filter((t=>!l(t)&&a(t)))},getSelectorFromElement(t){const e=B(t);return e&&z.findOne(e)?e:null},getElementFromSelector(t){const e=B(t);return e?z.findOne(e):null},getMultipleElementsFromSelector(t){const e=B(t);return e?z.find(e):[]}},R=(t,e="hide")=>{const i=`click.dismiss${t.EVENT_KEY}`,n=t.NAME;N.on(document,i,`[data-bs-dismiss="${n}"]`,(function(i){if(["A","AREA"].includes(this.tagName)&&i.preventDefault(),l(this))return;const s=z.getElementFromSelector(this)||this.closest(`.${n}`);t.getOrCreateInstance(s)[e]()}))},q=".bs.alert",V=`close${q}`,K=`closed${q}`;class Q extends W{static get NAME(){return"alert"}close(){if(N.trigger(this._element,V).defaultPrevented)return;this._element.classList.remove("show");const t=this._element.classList.contains("fade");this._queueCallback((()=>this._destroyElement()),this._element,t)}_destroyElement(){this._element.remove(),N.trigger(this._element,K),this.dispose()}static jQueryInterface(t){return this.each((function(){const e=Q.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}R(Q,"close"),m(Q);const X='[data-bs-toggle="button"]';class Y extends W{static get NAME(){return"button"}toggle(){this._element.setAttribute("aria-pressed",this._element.classList.toggle("active"))}static jQueryInterface(t){return this.each((function(){const e=Y.getOrCreateInstance(this);"toggle"===t&&e[t]()}))}}N.on(document,"click.bs.button.data-api",X,(t=>{t.preventDefault();const e=t.target.closest(X);Y.getOrCreateInstance(e).toggle()})),m(Y);const U=".bs.swipe",G=`touchstart${U}`,J=`touchmove${U}`,Z=`touchend${U}`,tt=`pointerdown${U}`,et=`pointerup${U}`,it={endCallback:null,leftCallback:null,rightCallback:null},nt={endCallback:"(function|null)",leftCallback:"(function|null)",rightCallback:"(function|null)"};class st extends H{constructor(t,e){super(),this._element=t,t&&st.isSupported()&&(this._config=this._getConfig(e),this._deltaX=0,this._supportPointerEvents=Boolean(window.PointerEvent),this._initEvents())}static get Default(){return it}static get DefaultType(){return nt}static get NAME(){return"swipe"}dispose(){N.off(this._element,U)}_start(t){this._supportPointerEvents?this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX):this._deltaX=t.touches[0].clientX}_end(t){this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX-this._deltaX),this._handleSwipe(),g(this._config.endCallback)}_move(t){this._deltaX=t.touches&&t.touches.length>1?0:t.touches[0].clientX-this._deltaX}_handleSwipe(){const t=Math.abs(this._deltaX);if(t<=40)return;const e=t/this._deltaX;this._deltaX=0,e&&g(e>0?this._config.rightCallback:this._config.leftCallback)}_initEvents(){this._supportPointerEvents?(N.on(this._element,tt,(t=>this._start(t))),N.on(this._element,et,(t=>this._end(t))),this._element.classList.add("pointer-event")):(N.on(this._element,G,(t=>this._start(t))),N.on(this._element,J,(t=>this._move(t))),N.on(this._element,Z,(t=>this._end(t))))}_eventIsPointerPenTouch(t){return this._supportPointerEvents&&("pen"===t.pointerType||"touch"===t.pointerType)}static isSupported(){return"ontouchstart"in document.documentElement||navigator.maxTouchPoints>0}}const ot=".bs.carousel",rt=".data-api",at="next",lt="prev",ct="left",ht="right",dt=`slide${ot}`,ut=`slid${ot}`,ft=`keydown${ot}`,pt=`mouseenter${ot}`,mt=`mouseleave${ot}`,gt=`dragstart${ot}`,_t=`load${ot}${rt}`,bt=`click${ot}${rt}`,vt="carousel",yt="active",wt=".active",At=".carousel-item",Et=wt+At,Tt={ArrowLeft:ht,ArrowRight:ct},Ct={interval:5e3,keyboard:!0,pause:"hover",ride:!1,touch:!0,wrap:!0},Ot={interval:"(number|boolean)",keyboard:"boolean",pause:"(string|boolean)",ride:"(boolean|string)",touch:"boolean",wrap:"boolean"};class xt extends W{constructor(t,e){super(t,e),this._interval=null,this._activeElement=null,this._isSliding=!1,this.touchTimeout=null,this._swipeHelper=null,this._indicatorsElement=z.findOne(".carousel-indicators",this._element),this._addEventListeners(),this._config.ride===vt&&this.cycle()}static get Default(){return Ct}static get DefaultType(){return Ot}static get NAME(){return"carousel"}next(){this._slide(at)}nextWhenVisible(){!document.hidden&&a(this._element)&&this.next()}prev(){this._slide(lt)}pause(){this._isSliding&&s(this._element),this._clearInterval()}cycle(){this._clearInterval(),this._updateInterval(),this._interval=setInterval((()=>this.nextWhenVisible()),this._config.interval)}_maybeEnableCycle(){this._config.ride&&(this._isSliding?N.one(this._element,ut,(()=>this.cycle())):this.cycle())}to(t){const e=this._getItems();if(t>e.length-1||t<0)return;if(this._isSliding)return void N.one(this._element,ut,(()=>this.to(t)));const i=this._getItemIndex(this._getActive());if(i===t)return;const n=t>i?at:lt;this._slide(n,e[t])}dispose(){this._swipeHelper&&this._swipeHelper.dispose(),super.dispose()}_configAfterMerge(t){return t.defaultInterval=t.interval,t}_addEventListeners(){this._config.keyboard&&N.on(this._element,ft,(t=>this._keydown(t))),"hover"===this._config.pause&&(N.on(this._element,pt,(()=>this.pause())),N.on(this._element,mt,(()=>this._maybeEnableCycle()))),this._config.touch&&st.isSupported()&&this._addTouchEventListeners()}_addTouchEventListeners(){for(const t of z.find(".carousel-item img",this._element))N.on(t,gt,(t=>t.preventDefault()));const t={leftCallback:()=>this._slide(this._directionToOrder(ct)),rightCallback:()=>this._slide(this._directionToOrder(ht)),endCallback:()=>{"hover"===this._config.pause&&(this.pause(),this.touchTimeout&&clearTimeout(this.touchTimeout),this.touchTimeout=setTimeout((()=>this._maybeEnableCycle()),500+this._config.interval))}};this._swipeHelper=new st(this._element,t)}_keydown(t){if(/input|textarea/i.test(t.target.tagName))return;const e=Tt[t.key];e&&(t.preventDefault(),this._slide(this._directionToOrder(e)))}_getItemIndex(t){return this._getItems().indexOf(t)}_setActiveIndicatorElement(t){if(!this._indicatorsElement)return;const e=z.findOne(wt,this._indicatorsElement);e.classList.remove(yt),e.removeAttribute("aria-current");const i=z.findOne(`[data-bs-slide-to="${t}"]`,this._indicatorsElement);i&&(i.classList.add(yt),i.setAttribute("aria-current","true"))}_updateInterval(){const t=this._activeElement||this._getActive();if(!t)return;const e=Number.parseInt(t.getAttribute("data-bs-interval"),10);this._config.interval=e||this._config.defaultInterval}_slide(t,e=null){if(this._isSliding)return;const i=this._getActive(),n=t===at,s=e||b(this._getItems(),i,n,this._config.wrap);if(s===i)return;const o=this._getItemIndex(s),r=e=>N.trigger(this._element,e,{relatedTarget:s,direction:this._orderToDirection(t),from:this._getItemIndex(i),to:o});if(r(dt).defaultPrevented)return;if(!i||!s)return;const a=Boolean(this._interval);this.pause(),this._isSliding=!0,this._setActiveIndicatorElement(o),this._activeElement=s;const l=n?"carousel-item-start":"carousel-item-end",c=n?"carousel-item-next":"carousel-item-prev";s.classList.add(c),d(s),i.classList.add(l),s.classList.add(l),this._queueCallback((()=>{s.classList.remove(l,c),s.classList.add(yt),i.classList.remove(yt,c,l),this._isSliding=!1,r(ut)}),i,this._isAnimated()),a&&this.cycle()}_isAnimated(){return this._element.classList.contains("slide")}_getActive(){return z.findOne(Et,this._element)}_getItems(){return z.find(At,this._element)}_clearInterval(){this._interval&&(clearInterval(this._interval),this._interval=null)}_directionToOrder(t){return p()?t===ct?lt:at:t===ct?at:lt}_orderToDirection(t){return p()?t===lt?ct:ht:t===lt?ht:ct}static jQueryInterface(t){return this.each((function(){const e=xt.getOrCreateInstance(this,t);if("number"!=typeof t){if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}else e.to(t)}))}}N.on(document,bt,"[data-bs-slide], [data-bs-slide-to]",(function(t){const e=z.getElementFromSelector(this);if(!e||!e.classList.contains(vt))return;t.preventDefault();const i=xt.getOrCreateInstance(e),n=this.getAttribute("data-bs-slide-to");return n?(i.to(n),void i._maybeEnableCycle()):"next"===F.getDataAttribute(this,"slide")?(i.next(),void i._maybeEnableCycle()):(i.prev(),void i._maybeEnableCycle())})),N.on(window,_t,(()=>{const t=z.find('[data-bs-ride="carousel"]');for(const e of t)xt.getOrCreateInstance(e)})),m(xt);const kt=".bs.collapse",Lt=`show${kt}`,St=`shown${kt}`,Dt=`hide${kt}`,$t=`hidden${kt}`,It=`click${kt}.data-api`,Nt="show",Pt="collapse",jt="collapsing",Mt=`:scope .${Pt} .${Pt}`,Ft='[data-bs-toggle="collapse"]',Ht={parent:null,toggle:!0},Wt={parent:"(null|element)",toggle:"boolean"};class Bt extends W{constructor(t,e){super(t,e),this._isTransitioning=!1,this._triggerArray=[];const i=z.find(Ft);for(const t of i){const e=z.getSelectorFromElement(t),i=z.find(e).filter((t=>t===this._element));null!==e&&i.length&&this._triggerArray.push(t)}this._initializeChildren(),this._config.parent||this._addAriaAndCollapsedClass(this._triggerArray,this._isShown()),this._config.toggle&&this.toggle()}static get Default(){return Ht}static get DefaultType(){return Wt}static get NAME(){return"collapse"}toggle(){this._isShown()?this.hide():this.show()}show(){if(this._isTransitioning||this._isShown())return;let t=[];if(this._config.parent&&(t=this._getFirstLevelChildren(".collapse.show, .collapse.collapsing").filter((t=>t!==this._element)).map((t=>Bt.getOrCreateInstance(t,{toggle:!1})))),t.length&&t[0]._isTransitioning)return;if(N.trigger(this._element,Lt).defaultPrevented)return;for(const e of t)e.hide();const e=this._getDimension();this._element.classList.remove(Pt),this._element.classList.add(jt),this._element.style[e]=0,this._addAriaAndCollapsedClass(this._triggerArray,!0),this._isTransitioning=!0;const i=`scroll${e[0].toUpperCase()+e.slice(1)}`;this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(jt),this._element.classList.add(Pt,Nt),this._element.style[e]="",N.trigger(this._element,St)}),this._element,!0),this._element.style[e]=`${this._element[i]}px`}hide(){if(this._isTransitioning||!this._isShown())return;if(N.trigger(this._element,Dt).defaultPrevented)return;const t=this._getDimension();this._element.style[t]=`${this._element.getBoundingClientRect()[t]}px`,d(this._element),this._element.classList.add(jt),this._element.classList.remove(Pt,Nt);for(const t of this._triggerArray){const e=z.getElementFromSelector(t);e&&!this._isShown(e)&&this._addAriaAndCollapsedClass([t],!1)}this._isTransitioning=!0,this._element.style[t]="",this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(jt),this._element.classList.add(Pt),N.trigger(this._element,$t)}),this._element,!0)}_isShown(t=this._element){return t.classList.contains(Nt)}_configAfterMerge(t){return t.toggle=Boolean(t.toggle),t.parent=r(t.parent),t}_getDimension(){return this._element.classList.contains("collapse-horizontal")?"width":"height"}_initializeChildren(){if(!this._config.parent)return;const t=this._getFirstLevelChildren(Ft);for(const e of t){const t=z.getElementFromSelector(e);t&&this._addAriaAndCollapsedClass([e],this._isShown(t))}}_getFirstLevelChildren(t){const e=z.find(Mt,this._config.parent);return z.find(t,this._config.parent).filter((t=>!e.includes(t)))}_addAriaAndCollapsedClass(t,e){if(t.length)for(const i of t)i.classList.toggle("collapsed",!e),i.setAttribute("aria-expanded",e)}static jQueryInterface(t){const e={};return"string"==typeof t&&/show|hide/.test(t)&&(e.toggle=!1),this.each((function(){const i=Bt.getOrCreateInstance(this,e);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t]()}}))}}N.on(document,It,Ft,(function(t){("A"===t.target.tagName||t.delegateTarget&&"A"===t.delegateTarget.tagName)&&t.preventDefault();for(const t of z.getMultipleElementsFromSelector(this))Bt.getOrCreateInstance(t,{toggle:!1}).toggle()})),m(Bt);var zt="top",Rt="bottom",qt="right",Vt="left",Kt="auto",Qt=[zt,Rt,qt,Vt],Xt="start",Yt="end",Ut="clippingParents",Gt="viewport",Jt="popper",Zt="reference",te=Qt.reduce((function(t,e){return t.concat([e+"-"+Xt,e+"-"+Yt])}),[]),ee=[].concat(Qt,[Kt]).reduce((function(t,e){return t.concat([e,e+"-"+Xt,e+"-"+Yt])}),[]),ie="beforeRead",ne="read",se="afterRead",oe="beforeMain",re="main",ae="afterMain",le="beforeWrite",ce="write",he="afterWrite",de=[ie,ne,se,oe,re,ae,le,ce,he];function ue(t){return t?(t.nodeName||"").toLowerCase():null}function fe(t){if(null==t)return window;if("[object Window]"!==t.toString()){var e=t.ownerDocument;return e&&e.defaultView||window}return t}function pe(t){return t instanceof fe(t).Element||t instanceof Element}function me(t){return t instanceof fe(t).HTMLElement||t instanceof HTMLElement}function ge(t){return"undefined"!=typeof ShadowRoot&&(t instanceof fe(t).ShadowRoot||t instanceof ShadowRoot)}const _e={name:"applyStyles",enabled:!0,phase:"write",fn:function(t){var e=t.state;Object.keys(e.elements).forEach((function(t){var i=e.styles[t]||{},n=e.attributes[t]||{},s=e.elements[t];me(s)&&ue(s)&&(Object.assign(s.style,i),Object.keys(n).forEach((function(t){var e=n[t];!1===e?s.removeAttribute(t):s.setAttribute(t,!0===e?"":e)})))}))},effect:function(t){var e=t.state,i={popper:{position:e.options.strategy,left:"0",top:"0",margin:"0"},arrow:{position:"absolute"},reference:{}};return Object.assign(e.elements.popper.style,i.popper),e.styles=i,e.elements.arrow&&Object.assign(e.elements.arrow.style,i.arrow),function(){Object.keys(e.elements).forEach((function(t){var n=e.elements[t],s=e.attributes[t]||{},o=Object.keys(e.styles.hasOwnProperty(t)?e.styles[t]:i[t]).reduce((function(t,e){return t[e]="",t}),{});me(n)&&ue(n)&&(Object.assign(n.style,o),Object.keys(s).forEach((function(t){n.removeAttribute(t)})))}))}},requires:["computeStyles"]};function be(t){return t.split("-")[0]}var ve=Math.max,ye=Math.min,we=Math.round;function Ae(){var t=navigator.userAgentData;return null!=t&&t.brands&&Array.isArray(t.brands)?t.brands.map((function(t){return t.brand+"/"+t.version})).join(" "):navigator.userAgent}function Ee(){return!/^((?!chrome|android).)*safari/i.test(Ae())}function Te(t,e,i){void 0===e&&(e=!1),void 0===i&&(i=!1);var n=t.getBoundingClientRect(),s=1,o=1;e&&me(t)&&(s=t.offsetWidth>0&&we(n.width)/t.offsetWidth||1,o=t.offsetHeight>0&&we(n.height)/t.offsetHeight||1);var r=(pe(t)?fe(t):window).visualViewport,a=!Ee()&&i,l=(n.left+(a&&r?r.offsetLeft:0))/s,c=(n.top+(a&&r?r.offsetTop:0))/o,h=n.width/s,d=n.height/o;return{width:h,height:d,top:c,right:l+h,bottom:c+d,left:l,x:l,y:c}}function Ce(t){var e=Te(t),i=t.offsetWidth,n=t.offsetHeight;return Math.abs(e.width-i)<=1&&(i=e.width),Math.abs(e.height-n)<=1&&(n=e.height),{x:t.offsetLeft,y:t.offsetTop,width:i,height:n}}function Oe(t,e){var i=e.getRootNode&&e.getRootNode();if(t.contains(e))return!0;if(i&&ge(i)){var n=e;do{if(n&&t.isSameNode(n))return!0;n=n.parentNode||n.host}while(n)}return!1}function xe(t){return fe(t).getComputedStyle(t)}function ke(t){return["table","td","th"].indexOf(ue(t))>=0}function Le(t){return((pe(t)?t.ownerDocument:t.document)||window.document).documentElement}function Se(t){return"html"===ue(t)?t:t.assignedSlot||t.parentNode||(ge(t)?t.host:null)||Le(t)}function De(t){return me(t)&&"fixed"!==xe(t).position?t.offsetParent:null}function $e(t){for(var e=fe(t),i=De(t);i&&ke(i)&&"static"===xe(i).position;)i=De(i);return i&&("html"===ue(i)||"body"===ue(i)&&"static"===xe(i).position)?e:i||function(t){var e=/firefox/i.test(Ae());if(/Trident/i.test(Ae())&&me(t)&&"fixed"===xe(t).position)return null;var i=Se(t);for(ge(i)&&(i=i.host);me(i)&&["html","body"].indexOf(ue(i))<0;){var n=xe(i);if("none"!==n.transform||"none"!==n.perspective||"paint"===n.contain||-1!==["transform","perspective"].indexOf(n.willChange)||e&&"filter"===n.willChange||e&&n.filter&&"none"!==n.filter)return i;i=i.parentNode}return null}(t)||e}function Ie(t){return["top","bottom"].indexOf(t)>=0?"x":"y"}function Ne(t,e,i){return ve(t,ye(e,i))}function Pe(t){return Object.assign({},{top:0,right:0,bottom:0,left:0},t)}function je(t,e){return e.reduce((function(e,i){return e[i]=t,e}),{})}const Me={name:"arrow",enabled:!0,phase:"main",fn:function(t){var e,i=t.state,n=t.name,s=t.options,o=i.elements.arrow,r=i.modifiersData.popperOffsets,a=be(i.placement),l=Ie(a),c=[Vt,qt].indexOf(a)>=0?"height":"width";if(o&&r){var h=function(t,e){return Pe("number"!=typeof(t="function"==typeof t?t(Object.assign({},e.rects,{placement:e.placement})):t)?t:je(t,Qt))}(s.padding,i),d=Ce(o),u="y"===l?zt:Vt,f="y"===l?Rt:qt,p=i.rects.reference[c]+i.rects.reference[l]-r[l]-i.rects.popper[c],m=r[l]-i.rects.reference[l],g=$e(o),_=g?"y"===l?g.clientHeight||0:g.clientWidth||0:0,b=p/2-m/2,v=h[u],y=_-d[c]-h[f],w=_/2-d[c]/2+b,A=Ne(v,w,y),E=l;i.modifiersData[n]=((e={})[E]=A,e.centerOffset=A-w,e)}},effect:function(t){var e=t.state,i=t.options.element,n=void 0===i?"[data-popper-arrow]":i;null!=n&&("string"!=typeof n||(n=e.elements.popper.querySelector(n)))&&Oe(e.elements.popper,n)&&(e.elements.arrow=n)},requires:["popperOffsets"],requiresIfExists:["preventOverflow"]};function Fe(t){return t.split("-")[1]}var He={top:"auto",right:"auto",bottom:"auto",left:"auto"};function We(t){var e,i=t.popper,n=t.popperRect,s=t.placement,o=t.variation,r=t.offsets,a=t.position,l=t.gpuAcceleration,c=t.adaptive,h=t.roundOffsets,d=t.isFixed,u=r.x,f=void 0===u?0:u,p=r.y,m=void 0===p?0:p,g="function"==typeof h?h({x:f,y:m}):{x:f,y:m};f=g.x,m=g.y;var _=r.hasOwnProperty("x"),b=r.hasOwnProperty("y"),v=Vt,y=zt,w=window;if(c){var A=$e(i),E="clientHeight",T="clientWidth";A===fe(i)&&"static"!==xe(A=Le(i)).position&&"absolute"===a&&(E="scrollHeight",T="scrollWidth"),(s===zt||(s===Vt||s===qt)&&o===Yt)&&(y=Rt,m-=(d&&A===w&&w.visualViewport?w.visualViewport.height:A[E])-n.height,m*=l?1:-1),s!==Vt&&(s!==zt&&s!==Rt||o!==Yt)||(v=qt,f-=(d&&A===w&&w.visualViewport?w.visualViewport.width:A[T])-n.width,f*=l?1:-1)}var C,O=Object.assign({position:a},c&&He),x=!0===h?function(t,e){var i=t.x,n=t.y,s=e.devicePixelRatio||1;return{x:we(i*s)/s||0,y:we(n*s)/s||0}}({x:f,y:m},fe(i)):{x:f,y:m};return f=x.x,m=x.y,l?Object.assign({},O,((C={})[y]=b?"0":"",C[v]=_?"0":"",C.transform=(w.devicePixelRatio||1)<=1?"translate("+f+"px, "+m+"px)":"translate3d("+f+"px, "+m+"px, 0)",C)):Object.assign({},O,((e={})[y]=b?m+"px":"",e[v]=_?f+"px":"",e.transform="",e))}const Be={name:"computeStyles",enabled:!0,phase:"beforeWrite",fn:function(t){var e=t.state,i=t.options,n=i.gpuAcceleration,s=void 0===n||n,o=i.adaptive,r=void 0===o||o,a=i.roundOffsets,l=void 0===a||a,c={placement:be(e.placement),variation:Fe(e.placement),popper:e.elements.popper,popperRect:e.rects.popper,gpuAcceleration:s,isFixed:"fixed"===e.options.strategy};null!=e.modifiersData.popperOffsets&&(e.styles.popper=Object.assign({},e.styles.popper,We(Object.assign({},c,{offsets:e.modifiersData.popperOffsets,position:e.options.strategy,adaptive:r,roundOffsets:l})))),null!=e.modifiersData.arrow&&(e.styles.arrow=Object.assign({},e.styles.arrow,We(Object.assign({},c,{offsets:e.modifiersData.arrow,position:"absolute",adaptive:!1,roundOffsets:l})))),e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-placement":e.placement})},data:{}};var ze={passive:!0};const Re={name:"eventListeners",enabled:!0,phase:"write",fn:function(){},effect:function(t){var e=t.state,i=t.instance,n=t.options,s=n.scroll,o=void 0===s||s,r=n.resize,a=void 0===r||r,l=fe(e.elements.popper),c=[].concat(e.scrollParents.reference,e.scrollParents.popper);return o&&c.forEach((function(t){t.addEventListener("scroll",i.update,ze)})),a&&l.addEventListener("resize",i.update,ze),function(){o&&c.forEach((function(t){t.removeEventListener("scroll",i.update,ze)})),a&&l.removeEventListener("resize",i.update,ze)}},data:{}};var qe={left:"right",right:"left",bottom:"top",top:"bottom"};function Ve(t){return t.replace(/left|right|bottom|top/g,(function(t){return qe[t]}))}var Ke={start:"end",end:"start"};function Qe(t){return t.replace(/start|end/g,(function(t){return Ke[t]}))}function Xe(t){var e=fe(t);return{scrollLeft:e.pageXOffset,scrollTop:e.pageYOffset}}function Ye(t){return Te(Le(t)).left+Xe(t).scrollLeft}function Ue(t){var e=xe(t),i=e.overflow,n=e.overflowX,s=e.overflowY;return/auto|scroll|overlay|hidden/.test(i+s+n)}function Ge(t){return["html","body","#document"].indexOf(ue(t))>=0?t.ownerDocument.body:me(t)&&Ue(t)?t:Ge(Se(t))}function Je(t,e){var i;void 0===e&&(e=[]);var n=Ge(t),s=n===(null==(i=t.ownerDocument)?void 0:i.body),o=fe(n),r=s?[o].concat(o.visualViewport||[],Ue(n)?n:[]):n,a=e.concat(r);return s?a:a.concat(Je(Se(r)))}function Ze(t){return Object.assign({},t,{left:t.x,top:t.y,right:t.x+t.width,bottom:t.y+t.height})}function ti(t,e,i){return e===Gt?Ze(function(t,e){var i=fe(t),n=Le(t),s=i.visualViewport,o=n.clientWidth,r=n.clientHeight,a=0,l=0;if(s){o=s.width,r=s.height;var c=Ee();(c||!c&&"fixed"===e)&&(a=s.offsetLeft,l=s.offsetTop)}return{width:o,height:r,x:a+Ye(t),y:l}}(t,i)):pe(e)?function(t,e){var i=Te(t,!1,"fixed"===e);return i.top=i.top+t.clientTop,i.left=i.left+t.clientLeft,i.bottom=i.top+t.clientHeight,i.right=i.left+t.clientWidth,i.width=t.clientWidth,i.height=t.clientHeight,i.x=i.left,i.y=i.top,i}(e,i):Ze(function(t){var e,i=Le(t),n=Xe(t),s=null==(e=t.ownerDocument)?void 0:e.body,o=ve(i.scrollWidth,i.clientWidth,s?s.scrollWidth:0,s?s.clientWidth:0),r=ve(i.scrollHeight,i.clientHeight,s?s.scrollHeight:0,s?s.clientHeight:0),a=-n.scrollLeft+Ye(t),l=-n.scrollTop;return"rtl"===xe(s||i).direction&&(a+=ve(i.clientWidth,s?s.clientWidth:0)-o),{width:o,height:r,x:a,y:l}}(Le(t)))}function ei(t){var e,i=t.reference,n=t.element,s=t.placement,o=s?be(s):null,r=s?Fe(s):null,a=i.x+i.width/2-n.width/2,l=i.y+i.height/2-n.height/2;switch(o){case zt:e={x:a,y:i.y-n.height};break;case Rt:e={x:a,y:i.y+i.height};break;case qt:e={x:i.x+i.width,y:l};break;case Vt:e={x:i.x-n.width,y:l};break;default:e={x:i.x,y:i.y}}var c=o?Ie(o):null;if(null!=c){var h="y"===c?"height":"width";switch(r){case Xt:e[c]=e[c]-(i[h]/2-n[h]/2);break;case Yt:e[c]=e[c]+(i[h]/2-n[h]/2)}}return e}function ii(t,e){void 0===e&&(e={});var i=e,n=i.placement,s=void 0===n?t.placement:n,o=i.strategy,r=void 0===o?t.strategy:o,a=i.boundary,l=void 0===a?Ut:a,c=i.rootBoundary,h=void 0===c?Gt:c,d=i.elementContext,u=void 0===d?Jt:d,f=i.altBoundary,p=void 0!==f&&f,m=i.padding,g=void 0===m?0:m,_=Pe("number"!=typeof g?g:je(g,Qt)),b=u===Jt?Zt:Jt,v=t.rects.popper,y=t.elements[p?b:u],w=function(t,e,i,n){var s="clippingParents"===e?function(t){var e=Je(Se(t)),i=["absolute","fixed"].indexOf(xe(t).position)>=0&&me(t)?$e(t):t;return pe(i)?e.filter((function(t){return pe(t)&&Oe(t,i)&&"body"!==ue(t)})):[]}(t):[].concat(e),o=[].concat(s,[i]),r=o[0],a=o.reduce((function(e,i){var s=ti(t,i,n);return e.top=ve(s.top,e.top),e.right=ye(s.right,e.right),e.bottom=ye(s.bottom,e.bottom),e.left=ve(s.left,e.left),e}),ti(t,r,n));return a.width=a.right-a.left,a.height=a.bottom-a.top,a.x=a.left,a.y=a.top,a}(pe(y)?y:y.contextElement||Le(t.elements.popper),l,h,r),A=Te(t.elements.reference),E=ei({reference:A,element:v,strategy:"absolute",placement:s}),T=Ze(Object.assign({},v,E)),C=u===Jt?T:A,O={top:w.top-C.top+_.top,bottom:C.bottom-w.bottom+_.bottom,left:w.left-C.left+_.left,right:C.right-w.right+_.right},x=t.modifiersData.offset;if(u===Jt&&x){var k=x[s];Object.keys(O).forEach((function(t){var e=[qt,Rt].indexOf(t)>=0?1:-1,i=[zt,Rt].indexOf(t)>=0?"y":"x";O[t]+=k[i]*e}))}return O}function ni(t,e){void 0===e&&(e={});var i=e,n=i.placement,s=i.boundary,o=i.rootBoundary,r=i.padding,a=i.flipVariations,l=i.allowedAutoPlacements,c=void 0===l?ee:l,h=Fe(n),d=h?a?te:te.filter((function(t){return Fe(t)===h})):Qt,u=d.filter((function(t){return c.indexOf(t)>=0}));0===u.length&&(u=d);var f=u.reduce((function(e,i){return e[i]=ii(t,{placement:i,boundary:s,rootBoundary:o,padding:r})[be(i)],e}),{});return Object.keys(f).sort((function(t,e){return f[t]-f[e]}))}const si={name:"flip",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,n=t.name;if(!e.modifiersData[n]._skip){for(var s=i.mainAxis,o=void 0===s||s,r=i.altAxis,a=void 0===r||r,l=i.fallbackPlacements,c=i.padding,h=i.boundary,d=i.rootBoundary,u=i.altBoundary,f=i.flipVariations,p=void 0===f||f,m=i.allowedAutoPlacements,g=e.options.placement,_=be(g),b=l||(_!==g&&p?function(t){if(be(t)===Kt)return[];var e=Ve(t);return[Qe(t),e,Qe(e)]}(g):[Ve(g)]),v=[g].concat(b).reduce((function(t,i){return t.concat(be(i)===Kt?ni(e,{placement:i,boundary:h,rootBoundary:d,padding:c,flipVariations:p,allowedAutoPlacements:m}):i)}),[]),y=e.rects.reference,w=e.rects.popper,A=new Map,E=!0,T=v[0],C=0;C=0,S=L?"width":"height",D=ii(e,{placement:O,boundary:h,rootBoundary:d,altBoundary:u,padding:c}),$=L?k?qt:Vt:k?Rt:zt;y[S]>w[S]&&($=Ve($));var I=Ve($),N=[];if(o&&N.push(D[x]<=0),a&&N.push(D[$]<=0,D[I]<=0),N.every((function(t){return t}))){T=O,E=!1;break}A.set(O,N)}if(E)for(var P=function(t){var e=v.find((function(e){var i=A.get(e);if(i)return i.slice(0,t).every((function(t){return t}))}));if(e)return T=e,"break"},j=p?3:1;j>0&&"break"!==P(j);j--);e.placement!==T&&(e.modifiersData[n]._skip=!0,e.placement=T,e.reset=!0)}},requiresIfExists:["offset"],data:{_skip:!1}};function oi(t,e,i){return void 0===i&&(i={x:0,y:0}),{top:t.top-e.height-i.y,right:t.right-e.width+i.x,bottom:t.bottom-e.height+i.y,left:t.left-e.width-i.x}}function ri(t){return[zt,qt,Rt,Vt].some((function(e){return t[e]>=0}))}const ai={name:"hide",enabled:!0,phase:"main",requiresIfExists:["preventOverflow"],fn:function(t){var e=t.state,i=t.name,n=e.rects.reference,s=e.rects.popper,o=e.modifiersData.preventOverflow,r=ii(e,{elementContext:"reference"}),a=ii(e,{altBoundary:!0}),l=oi(r,n),c=oi(a,s,o),h=ri(l),d=ri(c);e.modifiersData[i]={referenceClippingOffsets:l,popperEscapeOffsets:c,isReferenceHidden:h,hasPopperEscaped:d},e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-reference-hidden":h,"data-popper-escaped":d})}},li={name:"offset",enabled:!0,phase:"main",requires:["popperOffsets"],fn:function(t){var e=t.state,i=t.options,n=t.name,s=i.offset,o=void 0===s?[0,0]:s,r=ee.reduce((function(t,i){return t[i]=function(t,e,i){var n=be(t),s=[Vt,zt].indexOf(n)>=0?-1:1,o="function"==typeof i?i(Object.assign({},e,{placement:t})):i,r=o[0],a=o[1];return r=r||0,a=(a||0)*s,[Vt,qt].indexOf(n)>=0?{x:a,y:r}:{x:r,y:a}}(i,e.rects,o),t}),{}),a=r[e.placement],l=a.x,c=a.y;null!=e.modifiersData.popperOffsets&&(e.modifiersData.popperOffsets.x+=l,e.modifiersData.popperOffsets.y+=c),e.modifiersData[n]=r}},ci={name:"popperOffsets",enabled:!0,phase:"read",fn:function(t){var e=t.state,i=t.name;e.modifiersData[i]=ei({reference:e.rects.reference,element:e.rects.popper,strategy:"absolute",placement:e.placement})},data:{}},hi={name:"preventOverflow",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,n=t.name,s=i.mainAxis,o=void 0===s||s,r=i.altAxis,a=void 0!==r&&r,l=i.boundary,c=i.rootBoundary,h=i.altBoundary,d=i.padding,u=i.tether,f=void 0===u||u,p=i.tetherOffset,m=void 0===p?0:p,g=ii(e,{boundary:l,rootBoundary:c,padding:d,altBoundary:h}),_=be(e.placement),b=Fe(e.placement),v=!b,y=Ie(_),w="x"===y?"y":"x",A=e.modifiersData.popperOffsets,E=e.rects.reference,T=e.rects.popper,C="function"==typeof m?m(Object.assign({},e.rects,{placement:e.placement})):m,O="number"==typeof C?{mainAxis:C,altAxis:C}:Object.assign({mainAxis:0,altAxis:0},C),x=e.modifiersData.offset?e.modifiersData.offset[e.placement]:null,k={x:0,y:0};if(A){if(o){var L,S="y"===y?zt:Vt,D="y"===y?Rt:qt,$="y"===y?"height":"width",I=A[y],N=I+g[S],P=I-g[D],j=f?-T[$]/2:0,M=b===Xt?E[$]:T[$],F=b===Xt?-T[$]:-E[$],H=e.elements.arrow,W=f&&H?Ce(H):{width:0,height:0},B=e.modifiersData["arrow#persistent"]?e.modifiersData["arrow#persistent"].padding:{top:0,right:0,bottom:0,left:0},z=B[S],R=B[D],q=Ne(0,E[$],W[$]),V=v?E[$]/2-j-q-z-O.mainAxis:M-q-z-O.mainAxis,K=v?-E[$]/2+j+q+R+O.mainAxis:F+q+R+O.mainAxis,Q=e.elements.arrow&&$e(e.elements.arrow),X=Q?"y"===y?Q.clientTop||0:Q.clientLeft||0:0,Y=null!=(L=null==x?void 0:x[y])?L:0,U=I+K-Y,G=Ne(f?ye(N,I+V-Y-X):N,I,f?ve(P,U):P);A[y]=G,k[y]=G-I}if(a){var J,Z="x"===y?zt:Vt,tt="x"===y?Rt:qt,et=A[w],it="y"===w?"height":"width",nt=et+g[Z],st=et-g[tt],ot=-1!==[zt,Vt].indexOf(_),rt=null!=(J=null==x?void 0:x[w])?J:0,at=ot?nt:et-E[it]-T[it]-rt+O.altAxis,lt=ot?et+E[it]+T[it]-rt-O.altAxis:st,ct=f&&ot?function(t,e,i){var n=Ne(t,e,i);return n>i?i:n}(at,et,lt):Ne(f?at:nt,et,f?lt:st);A[w]=ct,k[w]=ct-et}e.modifiersData[n]=k}},requiresIfExists:["offset"]};function di(t,e,i){void 0===i&&(i=!1);var n,s,o=me(e),r=me(e)&&function(t){var e=t.getBoundingClientRect(),i=we(e.width)/t.offsetWidth||1,n=we(e.height)/t.offsetHeight||1;return 1!==i||1!==n}(e),a=Le(e),l=Te(t,r,i),c={scrollLeft:0,scrollTop:0},h={x:0,y:0};return(o||!o&&!i)&&(("body"!==ue(e)||Ue(a))&&(c=(n=e)!==fe(n)&&me(n)?{scrollLeft:(s=n).scrollLeft,scrollTop:s.scrollTop}:Xe(n)),me(e)?((h=Te(e,!0)).x+=e.clientLeft,h.y+=e.clientTop):a&&(h.x=Ye(a))),{x:l.left+c.scrollLeft-h.x,y:l.top+c.scrollTop-h.y,width:l.width,height:l.height}}function ui(t){var e=new Map,i=new Set,n=[];function s(t){i.add(t.name),[].concat(t.requires||[],t.requiresIfExists||[]).forEach((function(t){if(!i.has(t)){var n=e.get(t);n&&s(n)}})),n.push(t)}return t.forEach((function(t){e.set(t.name,t)})),t.forEach((function(t){i.has(t.name)||s(t)})),n}var fi={placement:"bottom",modifiers:[],strategy:"absolute"};function pi(){for(var t=arguments.length,e=new Array(t),i=0;iNumber.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_getPopperConfig(){const t={placement:this._getPlacement(),modifiers:[{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"offset",options:{offset:this._getOffset()}}]};return(this._inNavbar||"static"===this._config.display)&&(F.setDataAttribute(this._menu,"popper","static"),t.modifiers=[{name:"applyStyles",enabled:!1}]),{...t,...g(this._config.popperConfig,[t])}}_selectMenuItem({key:t,target:e}){const i=z.find(".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",this._menu).filter((t=>a(t)));i.length&&b(i,e,t===Ti,!i.includes(e)).focus()}static jQueryInterface(t){return this.each((function(){const e=qi.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}static clearMenus(t){if(2===t.button||"keyup"===t.type&&"Tab"!==t.key)return;const e=z.find(Ni);for(const i of e){const e=qi.getInstance(i);if(!e||!1===e._config.autoClose)continue;const n=t.composedPath(),s=n.includes(e._menu);if(n.includes(e._element)||"inside"===e._config.autoClose&&!s||"outside"===e._config.autoClose&&s)continue;if(e._menu.contains(t.target)&&("keyup"===t.type&&"Tab"===t.key||/input|select|option|textarea|form/i.test(t.target.tagName)))continue;const o={relatedTarget:e._element};"click"===t.type&&(o.clickEvent=t),e._completeHide(o)}}static dataApiKeydownHandler(t){const e=/input|textarea/i.test(t.target.tagName),i="Escape"===t.key,n=[Ei,Ti].includes(t.key);if(!n&&!i)return;if(e&&!i)return;t.preventDefault();const s=this.matches(Ii)?this:z.prev(this,Ii)[0]||z.next(this,Ii)[0]||z.findOne(Ii,t.delegateTarget.parentNode),o=qi.getOrCreateInstance(s);if(n)return t.stopPropagation(),o.show(),void o._selectMenuItem(t);o._isShown()&&(t.stopPropagation(),o.hide(),s.focus())}}N.on(document,Si,Ii,qi.dataApiKeydownHandler),N.on(document,Si,Pi,qi.dataApiKeydownHandler),N.on(document,Li,qi.clearMenus),N.on(document,Di,qi.clearMenus),N.on(document,Li,Ii,(function(t){t.preventDefault(),qi.getOrCreateInstance(this).toggle()})),m(qi);const Vi="backdrop",Ki="show",Qi=`mousedown.bs.${Vi}`,Xi={className:"modal-backdrop",clickCallback:null,isAnimated:!1,isVisible:!0,rootElement:"body"},Yi={className:"string",clickCallback:"(function|null)",isAnimated:"boolean",isVisible:"boolean",rootElement:"(element|string)"};class Ui extends H{constructor(t){super(),this._config=this._getConfig(t),this._isAppended=!1,this._element=null}static get Default(){return Xi}static get DefaultType(){return Yi}static get NAME(){return Vi}show(t){if(!this._config.isVisible)return void g(t);this._append();const e=this._getElement();this._config.isAnimated&&d(e),e.classList.add(Ki),this._emulateAnimation((()=>{g(t)}))}hide(t){this._config.isVisible?(this._getElement().classList.remove(Ki),this._emulateAnimation((()=>{this.dispose(),g(t)}))):g(t)}dispose(){this._isAppended&&(N.off(this._element,Qi),this._element.remove(),this._isAppended=!1)}_getElement(){if(!this._element){const t=document.createElement("div");t.className=this._config.className,this._config.isAnimated&&t.classList.add("fade"),this._element=t}return this._element}_configAfterMerge(t){return t.rootElement=r(t.rootElement),t}_append(){if(this._isAppended)return;const t=this._getElement();this._config.rootElement.append(t),N.on(t,Qi,(()=>{g(this._config.clickCallback)})),this._isAppended=!0}_emulateAnimation(t){_(t,this._getElement(),this._config.isAnimated)}}const Gi=".bs.focustrap",Ji=`focusin${Gi}`,Zi=`keydown.tab${Gi}`,tn="backward",en={autofocus:!0,trapElement:null},nn={autofocus:"boolean",trapElement:"element"};class sn extends H{constructor(t){super(),this._config=this._getConfig(t),this._isActive=!1,this._lastTabNavDirection=null}static get Default(){return en}static get DefaultType(){return nn}static get NAME(){return"focustrap"}activate(){this._isActive||(this._config.autofocus&&this._config.trapElement.focus(),N.off(document,Gi),N.on(document,Ji,(t=>this._handleFocusin(t))),N.on(document,Zi,(t=>this._handleKeydown(t))),this._isActive=!0)}deactivate(){this._isActive&&(this._isActive=!1,N.off(document,Gi))}_handleFocusin(t){const{trapElement:e}=this._config;if(t.target===document||t.target===e||e.contains(t.target))return;const i=z.focusableChildren(e);0===i.length?e.focus():this._lastTabNavDirection===tn?i[i.length-1].focus():i[0].focus()}_handleKeydown(t){"Tab"===t.key&&(this._lastTabNavDirection=t.shiftKey?tn:"forward")}}const on=".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",rn=".sticky-top",an="padding-right",ln="margin-right";class cn{constructor(){this._element=document.body}getWidth(){const t=document.documentElement.clientWidth;return Math.abs(window.innerWidth-t)}hide(){const t=this.getWidth();this._disableOverFlow(),this._setElementAttributes(this._element,an,(e=>e+t)),this._setElementAttributes(on,an,(e=>e+t)),this._setElementAttributes(rn,ln,(e=>e-t))}reset(){this._resetElementAttributes(this._element,"overflow"),this._resetElementAttributes(this._element,an),this._resetElementAttributes(on,an),this._resetElementAttributes(rn,ln)}isOverflowing(){return this.getWidth()>0}_disableOverFlow(){this._saveInitialAttribute(this._element,"overflow"),this._element.style.overflow="hidden"}_setElementAttributes(t,e,i){const n=this.getWidth();this._applyManipulationCallback(t,(t=>{if(t!==this._element&&window.innerWidth>t.clientWidth+n)return;this._saveInitialAttribute(t,e);const s=window.getComputedStyle(t).getPropertyValue(e);t.style.setProperty(e,`${i(Number.parseFloat(s))}px`)}))}_saveInitialAttribute(t,e){const i=t.style.getPropertyValue(e);i&&F.setDataAttribute(t,e,i)}_resetElementAttributes(t,e){this._applyManipulationCallback(t,(t=>{const i=F.getDataAttribute(t,e);null!==i?(F.removeDataAttribute(t,e),t.style.setProperty(e,i)):t.style.removeProperty(e)}))}_applyManipulationCallback(t,e){if(o(t))e(t);else for(const i of z.find(t,this._element))e(i)}}const hn=".bs.modal",dn=`hide${hn}`,un=`hidePrevented${hn}`,fn=`hidden${hn}`,pn=`show${hn}`,mn=`shown${hn}`,gn=`resize${hn}`,_n=`click.dismiss${hn}`,bn=`mousedown.dismiss${hn}`,vn=`keydown.dismiss${hn}`,yn=`click${hn}.data-api`,wn="modal-open",An="show",En="modal-static",Tn={backdrop:!0,focus:!0,keyboard:!0},Cn={backdrop:"(boolean|string)",focus:"boolean",keyboard:"boolean"};class On extends W{constructor(t,e){super(t,e),this._dialog=z.findOne(".modal-dialog",this._element),this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._isShown=!1,this._isTransitioning=!1,this._scrollBar=new cn,this._addEventListeners()}static get Default(){return Tn}static get DefaultType(){return Cn}static get NAME(){return"modal"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||this._isTransitioning||N.trigger(this._element,pn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._isTransitioning=!0,this._scrollBar.hide(),document.body.classList.add(wn),this._adjustDialog(),this._backdrop.show((()=>this._showElement(t))))}hide(){this._isShown&&!this._isTransitioning&&(N.trigger(this._element,dn).defaultPrevented||(this._isShown=!1,this._isTransitioning=!0,this._focustrap.deactivate(),this._element.classList.remove(An),this._queueCallback((()=>this._hideModal()),this._element,this._isAnimated())))}dispose(){N.off(window,hn),N.off(this._dialog,hn),this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}handleUpdate(){this._adjustDialog()}_initializeBackDrop(){return new Ui({isVisible:Boolean(this._config.backdrop),isAnimated:this._isAnimated()})}_initializeFocusTrap(){return new sn({trapElement:this._element})}_showElement(t){document.body.contains(this._element)||document.body.append(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.scrollTop=0;const e=z.findOne(".modal-body",this._dialog);e&&(e.scrollTop=0),d(this._element),this._element.classList.add(An),this._queueCallback((()=>{this._config.focus&&this._focustrap.activate(),this._isTransitioning=!1,N.trigger(this._element,mn,{relatedTarget:t})}),this._dialog,this._isAnimated())}_addEventListeners(){N.on(this._element,vn,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():this._triggerBackdropTransition())})),N.on(window,gn,(()=>{this._isShown&&!this._isTransitioning&&this._adjustDialog()})),N.on(this._element,bn,(t=>{N.one(this._element,_n,(e=>{this._element===t.target&&this._element===e.target&&("static"!==this._config.backdrop?this._config.backdrop&&this.hide():this._triggerBackdropTransition())}))}))}_hideModal(){this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._isTransitioning=!1,this._backdrop.hide((()=>{document.body.classList.remove(wn),this._resetAdjustments(),this._scrollBar.reset(),N.trigger(this._element,fn)}))}_isAnimated(){return this._element.classList.contains("fade")}_triggerBackdropTransition(){if(N.trigger(this._element,un).defaultPrevented)return;const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._element.style.overflowY;"hidden"===e||this._element.classList.contains(En)||(t||(this._element.style.overflowY="hidden"),this._element.classList.add(En),this._queueCallback((()=>{this._element.classList.remove(En),this._queueCallback((()=>{this._element.style.overflowY=e}),this._dialog)}),this._dialog),this._element.focus())}_adjustDialog(){const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._scrollBar.getWidth(),i=e>0;if(i&&!t){const t=p()?"paddingLeft":"paddingRight";this._element.style[t]=`${e}px`}if(!i&&t){const t=p()?"paddingRight":"paddingLeft";this._element.style[t]=`${e}px`}}_resetAdjustments(){this._element.style.paddingLeft="",this._element.style.paddingRight=""}static jQueryInterface(t,e){return this.each((function(){const i=On.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t](e)}}))}}N.on(document,yn,'[data-bs-toggle="modal"]',(function(t){const e=z.getElementFromSelector(this);["A","AREA"].includes(this.tagName)&&t.preventDefault(),N.one(e,pn,(t=>{t.defaultPrevented||N.one(e,fn,(()=>{a(this)&&this.focus()}))}));const i=z.findOne(".modal.show");i&&On.getInstance(i).hide(),On.getOrCreateInstance(e).toggle(this)})),R(On),m(On);const xn=".bs.offcanvas",kn=".data-api",Ln=`load${xn}${kn}`,Sn="show",Dn="showing",$n="hiding",In=".offcanvas.show",Nn=`show${xn}`,Pn=`shown${xn}`,jn=`hide${xn}`,Mn=`hidePrevented${xn}`,Fn=`hidden${xn}`,Hn=`resize${xn}`,Wn=`click${xn}${kn}`,Bn=`keydown.dismiss${xn}`,zn={backdrop:!0,keyboard:!0,scroll:!1},Rn={backdrop:"(boolean|string)",keyboard:"boolean",scroll:"boolean"};class qn extends W{constructor(t,e){super(t,e),this._isShown=!1,this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._addEventListeners()}static get Default(){return zn}static get DefaultType(){return Rn}static get NAME(){return"offcanvas"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||N.trigger(this._element,Nn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._backdrop.show(),this._config.scroll||(new cn).hide(),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.classList.add(Dn),this._queueCallback((()=>{this._config.scroll&&!this._config.backdrop||this._focustrap.activate(),this._element.classList.add(Sn),this._element.classList.remove(Dn),N.trigger(this._element,Pn,{relatedTarget:t})}),this._element,!0))}hide(){this._isShown&&(N.trigger(this._element,jn).defaultPrevented||(this._focustrap.deactivate(),this._element.blur(),this._isShown=!1,this._element.classList.add($n),this._backdrop.hide(),this._queueCallback((()=>{this._element.classList.remove(Sn,$n),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._config.scroll||(new cn).reset(),N.trigger(this._element,Fn)}),this._element,!0)))}dispose(){this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}_initializeBackDrop(){const t=Boolean(this._config.backdrop);return new Ui({className:"offcanvas-backdrop",isVisible:t,isAnimated:!0,rootElement:this._element.parentNode,clickCallback:t?()=>{"static"!==this._config.backdrop?this.hide():N.trigger(this._element,Mn)}:null})}_initializeFocusTrap(){return new sn({trapElement:this._element})}_addEventListeners(){N.on(this._element,Bn,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():N.trigger(this._element,Mn))}))}static jQueryInterface(t){return this.each((function(){const e=qn.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}N.on(document,Wn,'[data-bs-toggle="offcanvas"]',(function(t){const e=z.getElementFromSelector(this);if(["A","AREA"].includes(this.tagName)&&t.preventDefault(),l(this))return;N.one(e,Fn,(()=>{a(this)&&this.focus()}));const i=z.findOne(In);i&&i!==e&&qn.getInstance(i).hide(),qn.getOrCreateInstance(e).toggle(this)})),N.on(window,Ln,(()=>{for(const t of z.find(In))qn.getOrCreateInstance(t).show()})),N.on(window,Hn,(()=>{for(const t of z.find("[aria-modal][class*=show][class*=offcanvas-]"))"fixed"!==getComputedStyle(t).position&&qn.getOrCreateInstance(t).hide()})),R(qn),m(qn);const Vn={"*":["class","dir","id","lang","role",/^aria-[\w-]*$/i],a:["target","href","title","rel"],area:[],b:[],br:[],col:[],code:[],dd:[],div:[],dl:[],dt:[],em:[],hr:[],h1:[],h2:[],h3:[],h4:[],h5:[],h6:[],i:[],img:["src","srcset","alt","title","width","height"],li:[],ol:[],p:[],pre:[],s:[],small:[],span:[],sub:[],sup:[],strong:[],u:[],ul:[]},Kn=new Set(["background","cite","href","itemtype","longdesc","poster","src","xlink:href"]),Qn=/^(?!javascript:)(?:[a-z0-9+.-]+:|[^&:/?#]*(?:[/?#]|$))/i,Xn=(t,e)=>{const i=t.nodeName.toLowerCase();return e.includes(i)?!Kn.has(i)||Boolean(Qn.test(t.nodeValue)):e.filter((t=>t instanceof RegExp)).some((t=>t.test(i)))},Yn={allowList:Vn,content:{},extraClass:"",html:!1,sanitize:!0,sanitizeFn:null,template:"
"},Un={allowList:"object",content:"object",extraClass:"(string|function)",html:"boolean",sanitize:"boolean",sanitizeFn:"(null|function)",template:"string"},Gn={entry:"(string|element|function|null)",selector:"(string|element)"};class Jn extends H{constructor(t){super(),this._config=this._getConfig(t)}static get Default(){return Yn}static get DefaultType(){return Un}static get NAME(){return"TemplateFactory"}getContent(){return Object.values(this._config.content).map((t=>this._resolvePossibleFunction(t))).filter(Boolean)}hasContent(){return this.getContent().length>0}changeContent(t){return this._checkContent(t),this._config.content={...this._config.content,...t},this}toHtml(){const t=document.createElement("div");t.innerHTML=this._maybeSanitize(this._config.template);for(const[e,i]of Object.entries(this._config.content))this._setContent(t,i,e);const e=t.children[0],i=this._resolvePossibleFunction(this._config.extraClass);return i&&e.classList.add(...i.split(" ")),e}_typeCheckConfig(t){super._typeCheckConfig(t),this._checkContent(t.content)}_checkContent(t){for(const[e,i]of Object.entries(t))super._typeCheckConfig({selector:e,entry:i},Gn)}_setContent(t,e,i){const n=z.findOne(i,t);n&&((e=this._resolvePossibleFunction(e))?o(e)?this._putElementInTemplate(r(e),n):this._config.html?n.innerHTML=this._maybeSanitize(e):n.textContent=e:n.remove())}_maybeSanitize(t){return this._config.sanitize?function(t,e,i){if(!t.length)return t;if(i&&"function"==typeof i)return i(t);const n=(new window.DOMParser).parseFromString(t,"text/html"),s=[].concat(...n.body.querySelectorAll("*"));for(const t of s){const i=t.nodeName.toLowerCase();if(!Object.keys(e).includes(i)){t.remove();continue}const n=[].concat(...t.attributes),s=[].concat(e["*"]||[],e[i]||[]);for(const e of n)Xn(e,s)||t.removeAttribute(e.nodeName)}return n.body.innerHTML}(t,this._config.allowList,this._config.sanitizeFn):t}_resolvePossibleFunction(t){return g(t,[this])}_putElementInTemplate(t,e){if(this._config.html)return e.innerHTML="",void e.append(t);e.textContent=t.textContent}}const Zn=new Set(["sanitize","allowList","sanitizeFn"]),ts="fade",es="show",is=".modal",ns="hide.bs.modal",ss="hover",os="focus",rs={AUTO:"auto",TOP:"top",RIGHT:p()?"left":"right",BOTTOM:"bottom",LEFT:p()?"right":"left"},as={allowList:Vn,animation:!0,boundary:"clippingParents",container:!1,customClass:"",delay:0,fallbackPlacements:["top","right","bottom","left"],html:!1,offset:[0,6],placement:"top",popperConfig:null,sanitize:!0,sanitizeFn:null,selector:!1,template:'',title:"",trigger:"hover focus"},ls={allowList:"object",animation:"boolean",boundary:"(string|element)",container:"(string|element|boolean)",customClass:"(string|function)",delay:"(number|object)",fallbackPlacements:"array",html:"boolean",offset:"(array|string|function)",placement:"(string|function)",popperConfig:"(null|object|function)",sanitize:"boolean",sanitizeFn:"(null|function)",selector:"(string|boolean)",template:"string",title:"(string|element|function)",trigger:"string"};class cs extends W{constructor(t,e){if(void 0===vi)throw new TypeError("Bootstrap's tooltips require Popper (https://popper.js.org)");super(t,e),this._isEnabled=!0,this._timeout=0,this._isHovered=null,this._activeTrigger={},this._popper=null,this._templateFactory=null,this._newContent=null,this.tip=null,this._setListeners(),this._config.selector||this._fixTitle()}static get Default(){return as}static get DefaultType(){return ls}static get NAME(){return"tooltip"}enable(){this._isEnabled=!0}disable(){this._isEnabled=!1}toggleEnabled(){this._isEnabled=!this._isEnabled}toggle(){this._isEnabled&&(this._activeTrigger.click=!this._activeTrigger.click,this._isShown()?this._leave():this._enter())}dispose(){clearTimeout(this._timeout),N.off(this._element.closest(is),ns,this._hideModalHandler),this._element.getAttribute("data-bs-original-title")&&this._element.setAttribute("title",this._element.getAttribute("data-bs-original-title")),this._disposePopper(),super.dispose()}show(){if("none"===this._element.style.display)throw new Error("Please use show on visible elements");if(!this._isWithContent()||!this._isEnabled)return;const t=N.trigger(this._element,this.constructor.eventName("show")),e=(c(this._element)||this._element.ownerDocument.documentElement).contains(this._element);if(t.defaultPrevented||!e)return;this._disposePopper();const i=this._getTipElement();this._element.setAttribute("aria-describedby",i.getAttribute("id"));const{container:n}=this._config;if(this._element.ownerDocument.documentElement.contains(this.tip)||(n.append(i),N.trigger(this._element,this.constructor.eventName("inserted"))),this._popper=this._createPopper(i),i.classList.add(es),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))N.on(t,"mouseover",h);this._queueCallback((()=>{N.trigger(this._element,this.constructor.eventName("shown")),!1===this._isHovered&&this._leave(),this._isHovered=!1}),this.tip,this._isAnimated())}hide(){if(this._isShown()&&!N.trigger(this._element,this.constructor.eventName("hide")).defaultPrevented){if(this._getTipElement().classList.remove(es),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))N.off(t,"mouseover",h);this._activeTrigger.click=!1,this._activeTrigger[os]=!1,this._activeTrigger[ss]=!1,this._isHovered=null,this._queueCallback((()=>{this._isWithActiveTrigger()||(this._isHovered||this._disposePopper(),this._element.removeAttribute("aria-describedby"),N.trigger(this._element,this.constructor.eventName("hidden")))}),this.tip,this._isAnimated())}}update(){this._popper&&this._popper.update()}_isWithContent(){return Boolean(this._getTitle())}_getTipElement(){return this.tip||(this.tip=this._createTipElement(this._newContent||this._getContentForTemplate())),this.tip}_createTipElement(t){const e=this._getTemplateFactory(t).toHtml();if(!e)return null;e.classList.remove(ts,es),e.classList.add(`bs-${this.constructor.NAME}-auto`);const i=(t=>{do{t+=Math.floor(1e6*Math.random())}while(document.getElementById(t));return t})(this.constructor.NAME).toString();return e.setAttribute("id",i),this._isAnimated()&&e.classList.add(ts),e}setContent(t){this._newContent=t,this._isShown()&&(this._disposePopper(),this.show())}_getTemplateFactory(t){return this._templateFactory?this._templateFactory.changeContent(t):this._templateFactory=new Jn({...this._config,content:t,extraClass:this._resolvePossibleFunction(this._config.customClass)}),this._templateFactory}_getContentForTemplate(){return{".tooltip-inner":this._getTitle()}}_getTitle(){return this._resolvePossibleFunction(this._config.title)||this._element.getAttribute("data-bs-original-title")}_initializeOnDelegatedTarget(t){return this.constructor.getOrCreateInstance(t.delegateTarget,this._getDelegateConfig())}_isAnimated(){return this._config.animation||this.tip&&this.tip.classList.contains(ts)}_isShown(){return this.tip&&this.tip.classList.contains(es)}_createPopper(t){const e=g(this._config.placement,[this,t,this._element]),i=rs[e.toUpperCase()];return bi(this._element,t,this._getPopperConfig(i))}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_resolvePossibleFunction(t){return g(t,[this._element])}_getPopperConfig(t){const e={placement:t,modifiers:[{name:"flip",options:{fallbackPlacements:this._config.fallbackPlacements}},{name:"offset",options:{offset:this._getOffset()}},{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"arrow",options:{element:`.${this.constructor.NAME}-arrow`}},{name:"preSetPlacement",enabled:!0,phase:"beforeMain",fn:t=>{this._getTipElement().setAttribute("data-popper-placement",t.state.placement)}}]};return{...e,...g(this._config.popperConfig,[e])}}_setListeners(){const t=this._config.trigger.split(" ");for(const e of t)if("click"===e)N.on(this._element,this.constructor.eventName("click"),this._config.selector,(t=>{this._initializeOnDelegatedTarget(t).toggle()}));else if("manual"!==e){const t=e===ss?this.constructor.eventName("mouseenter"):this.constructor.eventName("focusin"),i=e===ss?this.constructor.eventName("mouseleave"):this.constructor.eventName("focusout");N.on(this._element,t,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusin"===t.type?os:ss]=!0,e._enter()})),N.on(this._element,i,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusout"===t.type?os:ss]=e._element.contains(t.relatedTarget),e._leave()}))}this._hideModalHandler=()=>{this._element&&this.hide()},N.on(this._element.closest(is),ns,this._hideModalHandler)}_fixTitle(){const t=this._element.getAttribute("title");t&&(this._element.getAttribute("aria-label")||this._element.textContent.trim()||this._element.setAttribute("aria-label",t),this._element.setAttribute("data-bs-original-title",t),this._element.removeAttribute("title"))}_enter(){this._isShown()||this._isHovered?this._isHovered=!0:(this._isHovered=!0,this._setTimeout((()=>{this._isHovered&&this.show()}),this._config.delay.show))}_leave(){this._isWithActiveTrigger()||(this._isHovered=!1,this._setTimeout((()=>{this._isHovered||this.hide()}),this._config.delay.hide))}_setTimeout(t,e){clearTimeout(this._timeout),this._timeout=setTimeout(t,e)}_isWithActiveTrigger(){return Object.values(this._activeTrigger).includes(!0)}_getConfig(t){const e=F.getDataAttributes(this._element);for(const t of Object.keys(e))Zn.has(t)&&delete e[t];return t={...e,..."object"==typeof t&&t?t:{}},t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t.container=!1===t.container?document.body:r(t.container),"number"==typeof t.delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),t}_getDelegateConfig(){const t={};for(const[e,i]of Object.entries(this._config))this.constructor.Default[e]!==i&&(t[e]=i);return t.selector=!1,t.trigger="manual",t}_disposePopper(){this._popper&&(this._popper.destroy(),this._popper=null),this.tip&&(this.tip.remove(),this.tip=null)}static jQueryInterface(t){return this.each((function(){const e=cs.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}m(cs);const hs={...cs.Default,content:"",offset:[0,8],placement:"right",template:'',trigger:"click"},ds={...cs.DefaultType,content:"(null|string|element|function)"};class us extends cs{static get Default(){return hs}static get DefaultType(){return ds}static get NAME(){return"popover"}_isWithContent(){return this._getTitle()||this._getContent()}_getContentForTemplate(){return{".popover-header":this._getTitle(),".popover-body":this._getContent()}}_getContent(){return this._resolvePossibleFunction(this._config.content)}static jQueryInterface(t){return this.each((function(){const e=us.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}m(us);const fs=".bs.scrollspy",ps=`activate${fs}`,ms=`click${fs}`,gs=`load${fs}.data-api`,_s="active",bs="[href]",vs=".nav-link",ys=`${vs}, .nav-item > ${vs}, .list-group-item`,ws={offset:null,rootMargin:"0px 0px -25%",smoothScroll:!1,target:null,threshold:[.1,.5,1]},As={offset:"(number|null)",rootMargin:"string",smoothScroll:"boolean",target:"element",threshold:"array"};class Es extends W{constructor(t,e){super(t,e),this._targetLinks=new Map,this._observableSections=new Map,this._rootElement="visible"===getComputedStyle(this._element).overflowY?null:this._element,this._activeTarget=null,this._observer=null,this._previousScrollData={visibleEntryTop:0,parentScrollTop:0},this.refresh()}static get Default(){return ws}static get DefaultType(){return As}static get NAME(){return"scrollspy"}refresh(){this._initializeTargetsAndObservables(),this._maybeEnableSmoothScroll(),this._observer?this._observer.disconnect():this._observer=this._getNewObserver();for(const t of this._observableSections.values())this._observer.observe(t)}dispose(){this._observer.disconnect(),super.dispose()}_configAfterMerge(t){return t.target=r(t.target)||document.body,t.rootMargin=t.offset?`${t.offset}px 0px -30%`:t.rootMargin,"string"==typeof t.threshold&&(t.threshold=t.threshold.split(",").map((t=>Number.parseFloat(t)))),t}_maybeEnableSmoothScroll(){this._config.smoothScroll&&(N.off(this._config.target,ms),N.on(this._config.target,ms,bs,(t=>{const e=this._observableSections.get(t.target.hash);if(e){t.preventDefault();const i=this._rootElement||window,n=e.offsetTop-this._element.offsetTop;if(i.scrollTo)return void i.scrollTo({top:n,behavior:"smooth"});i.scrollTop=n}})))}_getNewObserver(){const t={root:this._rootElement,threshold:this._config.threshold,rootMargin:this._config.rootMargin};return new IntersectionObserver((t=>this._observerCallback(t)),t)}_observerCallback(t){const e=t=>this._targetLinks.get(`#${t.target.id}`),i=t=>{this._previousScrollData.visibleEntryTop=t.target.offsetTop,this._process(e(t))},n=(this._rootElement||document.documentElement).scrollTop,s=n>=this._previousScrollData.parentScrollTop;this._previousScrollData.parentScrollTop=n;for(const o of t){if(!o.isIntersecting){this._activeTarget=null,this._clearActiveClass(e(o));continue}const t=o.target.offsetTop>=this._previousScrollData.visibleEntryTop;if(s&&t){if(i(o),!n)return}else s||t||i(o)}}_initializeTargetsAndObservables(){this._targetLinks=new Map,this._observableSections=new Map;const t=z.find(bs,this._config.target);for(const e of t){if(!e.hash||l(e))continue;const t=z.findOne(decodeURI(e.hash),this._element);a(t)&&(this._targetLinks.set(decodeURI(e.hash),e),this._observableSections.set(e.hash,t))}}_process(t){this._activeTarget!==t&&(this._clearActiveClass(this._config.target),this._activeTarget=t,t.classList.add(_s),this._activateParents(t),N.trigger(this._element,ps,{relatedTarget:t}))}_activateParents(t){if(t.classList.contains("dropdown-item"))z.findOne(".dropdown-toggle",t.closest(".dropdown")).classList.add(_s);else for(const e of z.parents(t,".nav, .list-group"))for(const t of z.prev(e,ys))t.classList.add(_s)}_clearActiveClass(t){t.classList.remove(_s);const e=z.find(`${bs}.${_s}`,t);for(const t of e)t.classList.remove(_s)}static jQueryInterface(t){return this.each((function(){const e=Es.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}N.on(window,gs,(()=>{for(const t of z.find('[data-bs-spy="scroll"]'))Es.getOrCreateInstance(t)})),m(Es);const Ts=".bs.tab",Cs=`hide${Ts}`,Os=`hidden${Ts}`,xs=`show${Ts}`,ks=`shown${Ts}`,Ls=`click${Ts}`,Ss=`keydown${Ts}`,Ds=`load${Ts}`,$s="ArrowLeft",Is="ArrowRight",Ns="ArrowUp",Ps="ArrowDown",js="Home",Ms="End",Fs="active",Hs="fade",Ws="show",Bs=".dropdown-toggle",zs=`:not(${Bs})`,Rs='[data-bs-toggle="tab"], [data-bs-toggle="pill"], [data-bs-toggle="list"]',qs=`.nav-link${zs}, .list-group-item${zs}, [role="tab"]${zs}, ${Rs}`,Vs=`.${Fs}[data-bs-toggle="tab"], .${Fs}[data-bs-toggle="pill"], .${Fs}[data-bs-toggle="list"]`;class Ks extends W{constructor(t){super(t),this._parent=this._element.closest('.list-group, .nav, [role="tablist"]'),this._parent&&(this._setInitialAttributes(this._parent,this._getChildren()),N.on(this._element,Ss,(t=>this._keydown(t))))}static get NAME(){return"tab"}show(){const t=this._element;if(this._elemIsActive(t))return;const e=this._getActiveElem(),i=e?N.trigger(e,Cs,{relatedTarget:t}):null;N.trigger(t,xs,{relatedTarget:e}).defaultPrevented||i&&i.defaultPrevented||(this._deactivate(e,t),this._activate(t,e))}_activate(t,e){t&&(t.classList.add(Fs),this._activate(z.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.removeAttribute("tabindex"),t.setAttribute("aria-selected",!0),this._toggleDropDown(t,!0),N.trigger(t,ks,{relatedTarget:e})):t.classList.add(Ws)}),t,t.classList.contains(Hs)))}_deactivate(t,e){t&&(t.classList.remove(Fs),t.blur(),this._deactivate(z.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.setAttribute("aria-selected",!1),t.setAttribute("tabindex","-1"),this._toggleDropDown(t,!1),N.trigger(t,Os,{relatedTarget:e})):t.classList.remove(Ws)}),t,t.classList.contains(Hs)))}_keydown(t){if(![$s,Is,Ns,Ps,js,Ms].includes(t.key))return;t.stopPropagation(),t.preventDefault();const e=this._getChildren().filter((t=>!l(t)));let i;if([js,Ms].includes(t.key))i=e[t.key===js?0:e.length-1];else{const n=[Is,Ps].includes(t.key);i=b(e,t.target,n,!0)}i&&(i.focus({preventScroll:!0}),Ks.getOrCreateInstance(i).show())}_getChildren(){return z.find(qs,this._parent)}_getActiveElem(){return this._getChildren().find((t=>this._elemIsActive(t)))||null}_setInitialAttributes(t,e){this._setAttributeIfNotExists(t,"role","tablist");for(const t of e)this._setInitialAttributesOnChild(t)}_setInitialAttributesOnChild(t){t=this._getInnerElement(t);const e=this._elemIsActive(t),i=this._getOuterElement(t);t.setAttribute("aria-selected",e),i!==t&&this._setAttributeIfNotExists(i,"role","presentation"),e||t.setAttribute("tabindex","-1"),this._setAttributeIfNotExists(t,"role","tab"),this._setInitialAttributesOnTargetPanel(t)}_setInitialAttributesOnTargetPanel(t){const e=z.getElementFromSelector(t);e&&(this._setAttributeIfNotExists(e,"role","tabpanel"),t.id&&this._setAttributeIfNotExists(e,"aria-labelledby",`${t.id}`))}_toggleDropDown(t,e){const i=this._getOuterElement(t);if(!i.classList.contains("dropdown"))return;const n=(t,n)=>{const s=z.findOne(t,i);s&&s.classList.toggle(n,e)};n(Bs,Fs),n(".dropdown-menu",Ws),i.setAttribute("aria-expanded",e)}_setAttributeIfNotExists(t,e,i){t.hasAttribute(e)||t.setAttribute(e,i)}_elemIsActive(t){return t.classList.contains(Fs)}_getInnerElement(t){return t.matches(qs)?t:z.findOne(qs,t)}_getOuterElement(t){return t.closest(".nav-item, .list-group-item")||t}static jQueryInterface(t){return this.each((function(){const e=Ks.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}N.on(document,Ls,Rs,(function(t){["A","AREA"].includes(this.tagName)&&t.preventDefault(),l(this)||Ks.getOrCreateInstance(this).show()})),N.on(window,Ds,(()=>{for(const t of z.find(Vs))Ks.getOrCreateInstance(t)})),m(Ks);const Qs=".bs.toast",Xs=`mouseover${Qs}`,Ys=`mouseout${Qs}`,Us=`focusin${Qs}`,Gs=`focusout${Qs}`,Js=`hide${Qs}`,Zs=`hidden${Qs}`,to=`show${Qs}`,eo=`shown${Qs}`,io="hide",no="show",so="showing",oo={animation:"boolean",autohide:"boolean",delay:"number"},ro={animation:!0,autohide:!0,delay:5e3};class ao extends W{constructor(t,e){super(t,e),this._timeout=null,this._hasMouseInteraction=!1,this._hasKeyboardInteraction=!1,this._setListeners()}static get Default(){return ro}static get DefaultType(){return oo}static get NAME(){return"toast"}show(){N.trigger(this._element,to).defaultPrevented||(this._clearTimeout(),this._config.animation&&this._element.classList.add("fade"),this._element.classList.remove(io),d(this._element),this._element.classList.add(no,so),this._queueCallback((()=>{this._element.classList.remove(so),N.trigger(this._element,eo),this._maybeScheduleHide()}),this._element,this._config.animation))}hide(){this.isShown()&&(N.trigger(this._element,Js).defaultPrevented||(this._element.classList.add(so),this._queueCallback((()=>{this._element.classList.add(io),this._element.classList.remove(so,no),N.trigger(this._element,Zs)}),this._element,this._config.animation)))}dispose(){this._clearTimeout(),this.isShown()&&this._element.classList.remove(no),super.dispose()}isShown(){return this._element.classList.contains(no)}_maybeScheduleHide(){this._config.autohide&&(this._hasMouseInteraction||this._hasKeyboardInteraction||(this._timeout=setTimeout((()=>{this.hide()}),this._config.delay)))}_onInteraction(t,e){switch(t.type){case"mouseover":case"mouseout":this._hasMouseInteraction=e;break;case"focusin":case"focusout":this._hasKeyboardInteraction=e}if(e)return void this._clearTimeout();const i=t.relatedTarget;this._element===i||this._element.contains(i)||this._maybeScheduleHide()}_setListeners(){N.on(this._element,Xs,(t=>this._onInteraction(t,!0))),N.on(this._element,Ys,(t=>this._onInteraction(t,!1))),N.on(this._element,Us,(t=>this._onInteraction(t,!0))),N.on(this._element,Gs,(t=>this._onInteraction(t,!1)))}_clearTimeout(){clearTimeout(this._timeout),this._timeout=null}static jQueryInterface(t){return this.each((function(){const e=ao.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}return R(ao),m(ao),{Alert:Q,Button:Y,Carousel:xt,Collapse:Bt,Dropdown:qi,Modal:On,Offcanvas:qn,Popover:us,ScrollSpy:Es,Tab:Ks,Toast:ao,Tooltip:cs}})); +//# sourceMappingURL=bootstrap.bundle.min.js.map \ No newline at end of file diff --git a/public/manifest.json b/public/manifest.json new file mode 100644 index 0000000..3c29341 --- /dev/null +++ b/public/manifest.json @@ -0,0 +1 @@ +{"version": "1.0.0"} diff --git a/public/plugins/DataTables/datatables.css b/public/plugins/DataTables/datatables.css new file mode 100644 index 0000000..4dc1047 --- /dev/null +++ b/public/plugins/DataTables/datatables.css @@ -0,0 +1,1106 @@ +/* + * This combined file was created by the DataTables downloader builder: + * https://datatables.net/download + * + * To rebuild or modify this file with the latest versions of the included + * software please visit: + * https://datatables.net/download/#bs5/jq-3.7.0/dt-2.0.2/b-3.0.1/b-colvis-3.0.1/r-3.0.0 + * + * Included libraries: + * jQuery 3 3.7.0, DataTables 2.0.2, Buttons 3.0.1, Column visibility 3.0.1, Responsive 3.0.0 + */ + +@charset "UTF-8"; +:root { + --dt-row-selected: 13, 110, 253; + --dt-row-selected-text: 255, 255, 255; + --dt-row-selected-link: 9, 10, 11; + --dt-row-stripe: 0, 0, 0; + --dt-row-hover: 0, 0, 0; + --dt-column-ordering: 0, 0, 0; + --dt-html-background: white; +} +:root.dark { + --dt-html-background: rgb(33, 37, 41); +} + +table.dataTable td.dt-control { + text-align: center; + cursor: pointer; +} +table.dataTable td.dt-control:before { + display: inline-block; + box-sizing: border-box; + content: ""; + border-top: 5px solid transparent; + border-left: 10px solid rgba(0, 0, 0, 0.5); + border-bottom: 5px solid transparent; + border-right: 0px solid transparent; +} +table.dataTable tr.dt-hasChild td.dt-control:before { + border-top: 10px solid rgba(0, 0, 0, 0.5); + border-left: 5px solid transparent; + border-bottom: 0px solid transparent; + border-right: 5px solid transparent; +} + +html.dark table.dataTable td.dt-control:before, +:root[data-bs-theme=dark] table.dataTable td.dt-control:before { + border-left-color: rgba(255, 255, 255, 0.5); +} +html.dark table.dataTable tr.dt-hasChild td.dt-control:before, +:root[data-bs-theme=dark] table.dataTable tr.dt-hasChild td.dt-control:before { + border-top-color: rgba(255, 255, 255, 0.5); + border-left-color: transparent; +} + +div.dt-scroll-body thead tr, +div.dt-scroll-body tfoot tr { + height: 0; +} +div.dt-scroll-body thead tr th, div.dt-scroll-body thead tr td, +div.dt-scroll-body tfoot tr th, +div.dt-scroll-body tfoot tr td { + height: 0 !important; + padding-top: 0px !important; + padding-bottom: 0px !important; + border-top-width: 0px !important; + border-bottom-width: 0px !important; +} +div.dt-scroll-body thead tr th div.dt-scroll-sizing, div.dt-scroll-body thead tr td div.dt-scroll-sizing, +div.dt-scroll-body tfoot tr th div.dt-scroll-sizing, +div.dt-scroll-body tfoot tr td div.dt-scroll-sizing { + height: 0 !important; + overflow: hidden !important; +} + +table.dataTable thead > tr > th:active, +table.dataTable thead > tr > td:active { + outline: none; +} +table.dataTable thead > tr > th.dt-orderable-asc span.dt-column-order:before, table.dataTable thead > tr > th.dt-ordering-asc span.dt-column-order:before, +table.dataTable thead > tr > td.dt-orderable-asc span.dt-column-order:before, +table.dataTable thead > tr > td.dt-ordering-asc span.dt-column-order:before { + position: absolute; + display: block; + bottom: 50%; + content: "▲"; + content: "▲"/""; +} +table.dataTable thead > tr > th.dt-orderable-desc span.dt-column-order:after, table.dataTable thead > tr > th.dt-ordering-desc span.dt-column-order:after, +table.dataTable thead > tr > td.dt-orderable-desc span.dt-column-order:after, +table.dataTable thead > tr > td.dt-ordering-desc span.dt-column-order:after { + position: absolute; + display: block; + top: 50%; + content: "▼"; + content: "▼"/""; +} +table.dataTable thead > tr > th.dt-orderable-asc, table.dataTable thead > tr > th.dt-orderable-desc, table.dataTable thead > tr > th.dt-ordering-asc, table.dataTable thead > tr > th.dt-ordering-desc, +table.dataTable thead > tr > td.dt-orderable-asc, +table.dataTable thead > tr > td.dt-orderable-desc, +table.dataTable thead > tr > td.dt-ordering-asc, +table.dataTable thead > tr > td.dt-ordering-desc { + position: relative; + padding-right: 30px; +} +table.dataTable thead > tr > th.dt-orderable-asc span.dt-column-order, table.dataTable thead > tr > th.dt-orderable-desc span.dt-column-order, table.dataTable thead > tr > th.dt-ordering-asc span.dt-column-order, table.dataTable thead > tr > th.dt-ordering-desc span.dt-column-order, +table.dataTable thead > tr > td.dt-orderable-asc span.dt-column-order, +table.dataTable thead > tr > td.dt-orderable-desc span.dt-column-order, +table.dataTable thead > tr > td.dt-ordering-asc span.dt-column-order, +table.dataTable thead > tr > td.dt-ordering-desc span.dt-column-order { + position: absolute; + right: 12px; + top: 0; + bottom: 0; + width: 12px; +} +table.dataTable thead > tr > th.dt-orderable-asc span.dt-column-order:before, table.dataTable thead > tr > th.dt-orderable-asc span.dt-column-order:after, table.dataTable thead > tr > th.dt-orderable-desc span.dt-column-order:before, table.dataTable thead > tr > th.dt-orderable-desc span.dt-column-order:after, table.dataTable thead > tr > th.dt-ordering-asc span.dt-column-order:before, table.dataTable thead > tr > th.dt-ordering-asc span.dt-column-order:after, table.dataTable thead > tr > th.dt-ordering-desc span.dt-column-order:before, table.dataTable thead > tr > th.dt-ordering-desc span.dt-column-order:after, +table.dataTable thead > tr > td.dt-orderable-asc span.dt-column-order:before, +table.dataTable thead > tr > td.dt-orderable-asc span.dt-column-order:after, +table.dataTable thead > tr > td.dt-orderable-desc span.dt-column-order:before, +table.dataTable thead > tr > td.dt-orderable-desc span.dt-column-order:after, +table.dataTable thead > tr > td.dt-ordering-asc span.dt-column-order:before, +table.dataTable thead > tr > td.dt-ordering-asc span.dt-column-order:after, +table.dataTable thead > tr > td.dt-ordering-desc span.dt-column-order:before, +table.dataTable thead > tr > td.dt-ordering-desc span.dt-column-order:after { + left: 0; + opacity: 0.125; + line-height: 9px; + font-size: 0.8em; +} +table.dataTable thead > tr > th.dt-orderable-asc, table.dataTable thead > tr > th.dt-orderable-desc, +table.dataTable thead > tr > td.dt-orderable-asc, +table.dataTable thead > tr > td.dt-orderable-desc { + cursor: pointer; +} +table.dataTable thead > tr > th.dt-orderable-asc:hover, table.dataTable thead > tr > th.dt-orderable-desc:hover, +table.dataTable thead > tr > td.dt-orderable-asc:hover, +table.dataTable thead > tr > td.dt-orderable-desc:hover { + outline: 2px solid rgba(0, 0, 0, 0.05); + outline-offset: -2px; +} +table.dataTable thead > tr > th.dt-ordering-asc span.dt-column-order:before, table.dataTable thead > tr > th.dt-ordering-desc span.dt-column-order:after, +table.dataTable thead > tr > td.dt-ordering-asc span.dt-column-order:before, +table.dataTable thead > tr > td.dt-ordering-desc span.dt-column-order:after { + opacity: 0.6; +} +table.dataTable thead > tr > th.sorting_desc_disabled span.dt-column-order:after, table.dataTable thead > tr > th.sorting_asc_disabled span.dt-column-order:before, +table.dataTable thead > tr > td.sorting_desc_disabled span.dt-column-order:after, +table.dataTable thead > tr > td.sorting_asc_disabled span.dt-column-order:before { + display: none; +} +table.dataTable thead > tr > th:active, +table.dataTable thead > tr > td:active { + outline: none; +} + +div.dt-scroll-body > table.dataTable > thead > tr > th, +div.dt-scroll-body > table.dataTable > thead > tr > td { + overflow: hidden; +} + +:root.dark table.dataTable thead > tr > th.dt-orderable-asc:hover, :root.dark table.dataTable thead > tr > th.dt-orderable-desc:hover, +:root.dark table.dataTable thead > tr > td.dt-orderable-asc:hover, +:root.dark table.dataTable thead > tr > td.dt-orderable-desc:hover, +:root[data-bs-theme=dark] table.dataTable thead > tr > th.dt-orderable-asc:hover, +:root[data-bs-theme=dark] table.dataTable thead > tr > th.dt-orderable-desc:hover, +:root[data-bs-theme=dark] table.dataTable thead > tr > td.dt-orderable-asc:hover, +:root[data-bs-theme=dark] table.dataTable thead > tr > td.dt-orderable-desc:hover { + outline: 2px solid rgba(255, 255, 255, 0.05); +} + +div.dt-processing { + position: absolute; + top: 50%; + left: 50%; + width: 200px; + margin-left: -100px; + margin-top: -22px; + text-align: center; + padding: 2px; + z-index: 10; +} +div.dt-processing > div:last-child { + position: relative; + width: 80px; + height: 15px; + margin: 1em auto; +} +div.dt-processing > div:last-child > div { + position: absolute; + top: 0; + width: 13px; + height: 13px; + border-radius: 50%; + background: rgb(13, 110, 253); + background: rgb(var(--dt-row-selected)); + animation-timing-function: cubic-bezier(0, 1, 1, 0); +} +div.dt-processing > div:last-child > div:nth-child(1) { + left: 8px; + animation: datatables-loader-1 0.6s infinite; +} +div.dt-processing > div:last-child > div:nth-child(2) { + left: 8px; + animation: datatables-loader-2 0.6s infinite; +} +div.dt-processing > div:last-child > div:nth-child(3) { + left: 32px; + animation: datatables-loader-2 0.6s infinite; +} +div.dt-processing > div:last-child > div:nth-child(4) { + left: 56px; + animation: datatables-loader-3 0.6s infinite; +} + +@keyframes datatables-loader-1 { + 0% { + transform: scale(0); + } + 100% { + transform: scale(1); + } +} +@keyframes datatables-loader-3 { + 0% { + transform: scale(1); + } + 100% { + transform: scale(0); + } +} +@keyframes datatables-loader-2 { + 0% { + transform: translate(0, 0); + } + 100% { + transform: translate(24px, 0); + } +} +table.dataTable.nowrap th, table.dataTable.nowrap td { + white-space: nowrap; +} +table.dataTable th, +table.dataTable td { + box-sizing: border-box; +} +table.dataTable th.dt-left, +table.dataTable td.dt-left { + text-align: left; +} +table.dataTable th.dt-center, +table.dataTable td.dt-center { + text-align: center; +} +table.dataTable th.dt-right, +table.dataTable td.dt-right { + text-align: right; +} +table.dataTable th.dt-justify, +table.dataTable td.dt-justify { + text-align: justify; +} +table.dataTable th.dt-nowrap, +table.dataTable td.dt-nowrap { + white-space: nowrap; +} +table.dataTable th.dt-empty, +table.dataTable td.dt-empty { + text-align: center; + vertical-align: top; +} +table.dataTable th.dt-type-numeric, table.dataTable th.dt-type-date, +table.dataTable td.dt-type-numeric, +table.dataTable td.dt-type-date { + text-align: right; +} +table.dataTable thead th, +table.dataTable thead td, +table.dataTable tfoot th, +table.dataTable tfoot td { + text-align: left; +} +table.dataTable thead th.dt-head-left, +table.dataTable thead td.dt-head-left, +table.dataTable tfoot th.dt-head-left, +table.dataTable tfoot td.dt-head-left { + text-align: left; +} +table.dataTable thead th.dt-head-center, +table.dataTable thead td.dt-head-center, +table.dataTable tfoot th.dt-head-center, +table.dataTable tfoot td.dt-head-center { + text-align: center; +} +table.dataTable thead th.dt-head-right, +table.dataTable thead td.dt-head-right, +table.dataTable tfoot th.dt-head-right, +table.dataTable tfoot td.dt-head-right { + text-align: right; +} +table.dataTable thead th.dt-head-justify, +table.dataTable thead td.dt-head-justify, +table.dataTable tfoot th.dt-head-justify, +table.dataTable tfoot td.dt-head-justify { + text-align: justify; +} +table.dataTable thead th.dt-head-nowrap, +table.dataTable thead td.dt-head-nowrap, +table.dataTable tfoot th.dt-head-nowrap, +table.dataTable tfoot td.dt-head-nowrap { + white-space: nowrap; +} +table.dataTable tbody th.dt-body-left, +table.dataTable tbody td.dt-body-left { + text-align: left; +} +table.dataTable tbody th.dt-body-center, +table.dataTable tbody td.dt-body-center { + text-align: center; +} +table.dataTable tbody th.dt-body-right, +table.dataTable tbody td.dt-body-right { + text-align: right; +} +table.dataTable tbody th.dt-body-justify, +table.dataTable tbody td.dt-body-justify { + text-align: justify; +} +table.dataTable tbody th.dt-body-nowrap, +table.dataTable tbody td.dt-body-nowrap { + white-space: nowrap; +} + +/*! Bootstrap 5 integration for DataTables + * + * ©2020 SpryMedia Ltd, all rights reserved. + * License: MIT datatables.net/license/mit + */ +table.table.dataTable { + clear: both; + margin-bottom: 0; + max-width: none; + border-spacing: 0; +} +table.table.dataTable.table-striped > tbody > tr:nth-of-type(2n+1) > * { + box-shadow: none; +} +table.table.dataTable > :not(caption) > * > * { + background-color: transparent; +} +table.table.dataTable > tbody > tr { + background-color: transparent; +} +table.table.dataTable > tbody > tr.selected > * { + box-shadow: inset 0 0 0 9999px rgb(13, 110, 253); + box-shadow: inset 0 0 0 9999px rgb(var(--dt-row-selected)); + color: rgb(255, 255, 255); + color: rgb(var(--dt-row-selected-text)); +} +table.table.dataTable > tbody > tr.selected a { + color: rgb(9, 10, 11); + color: rgb(var(--dt-row-selected-link)); +} +table.table.dataTable.table-striped > tbody > tr:nth-of-type(2n+1) > * { + box-shadow: inset 0 0 0 9999px rgba(var(--dt-row-stripe), 0.05); +} +table.table.dataTable.table-striped > tbody > tr:nth-of-type(2n+1).selected > * { + box-shadow: inset 0 0 0 9999px rgba(13, 110, 253, 0.95); + box-shadow: inset 0 0 0 9999px rgba(var(--dt-row-selected), 0.95); +} +table.table.dataTable.table-hover > tbody > tr:hover > * { + box-shadow: inset 0 0 0 9999px rgba(var(--dt-row-hover), 0.075); +} +table.table.dataTable.table-hover > tbody > tr.selected:hover > * { + box-shadow: inset 0 0 0 9999px rgba(13, 110, 253, 0.975); + box-shadow: inset 0 0 0 9999px rgba(var(--dt-row-selected), 0.975); +} + +div.dt-container div.dt-length label { + font-weight: normal; + text-align: left; + white-space: nowrap; +} +div.dt-container div.dt-length select { + width: auto; + display: inline-block; + margin-right: 0.5em; +} +div.dt-container div.dt-search { + text-align: right; +} +div.dt-container div.dt-search label { + font-weight: normal; + white-space: nowrap; + text-align: left; +} +div.dt-container div.dt-search input { + margin-left: 0.5em; + display: inline-block; + width: auto; +} +div.dt-container div.dt-info { + padding-top: 0.85em; +} +div.dt-container div.dt-paging { + margin: 0; +} +div.dt-container div.dt-paging ul.pagination { + margin: 2px 0; + flex-wrap: wrap; +} +div.dt-container div.dt-row { + position: relative; +} + +div.dt-scroll-head table.dataTable { + margin-bottom: 0 !important; +} + +div.dt-scroll-body { + border-bottom-color: var(--bs-border-color); + border-bottom-width: var(--bs-border-width); + border-bottom-style: solid; +} +div.dt-scroll-body > table { + border-top: none; + margin-top: 0 !important; + margin-bottom: 0 !important; +} +div.dt-scroll-body > table > tbody > tr:first-child { + border-top-width: 0; +} +div.dt-scroll-body > table > thead > tr { + border-width: 0 !important; +} +div.dt-scroll-body > table > tbody > tr:last-child > * { + border-bottom: none; +} + +div.dt-scroll-foot > .dt-scroll-footInner { + box-sizing: content-box; +} +div.dt-scroll-foot > .dt-scroll-footInner > table { + margin-top: 0 !important; + border-top: none; +} +div.dt-scroll-foot > .dt-scroll-footInner > table > tfoot > tr:first-child { + border-top-width: 0 !important; +} + +@media screen and (max-width: 767px) { + div.dt-container div.dt-length, + div.dt-container div.dt-search, + div.dt-container div.dt-info, + div.dt-container div.dt-paging { + text-align: center; + } + div.dt-container .row { + --bs-gutter-y: 0.5rem; + } + div.dt-container div.dt-paging ul.pagination { + justify-content: center !important; + } +} +table.dataTable.table-sm > thead > tr th.dt-orderable-asc, table.dataTable.table-sm > thead > tr th.dt-orderable-desc, table.dataTable.table-sm > thead > tr th.dt-ordering-asc, table.dataTable.table-sm > thead > tr th.dt-ordering-desc, +table.dataTable.table-sm > thead > tr td.dt-orderable-asc, +table.dataTable.table-sm > thead > tr td.dt-orderable-desc, +table.dataTable.table-sm > thead > tr td.dt-ordering-asc, +table.dataTable.table-sm > thead > tr td.dt-ordering-desc { + padding-right: 20px; +} +table.dataTable.table-sm > thead > tr th.dt-orderable-asc span.dt-column-order, table.dataTable.table-sm > thead > tr th.dt-orderable-desc span.dt-column-order, table.dataTable.table-sm > thead > tr th.dt-ordering-asc span.dt-column-order, table.dataTable.table-sm > thead > tr th.dt-ordering-desc span.dt-column-order, +table.dataTable.table-sm > thead > tr td.dt-orderable-asc span.dt-column-order, +table.dataTable.table-sm > thead > tr td.dt-orderable-desc span.dt-column-order, +table.dataTable.table-sm > thead > tr td.dt-ordering-asc span.dt-column-order, +table.dataTable.table-sm > thead > tr td.dt-ordering-desc span.dt-column-order { + right: 5px; +} + +div.dt-scroll-head table.table-bordered { + border-bottom-width: 0; +} + +div.table-responsive > div.dt-container > div.row { + margin: 0; +} +div.table-responsive > div.dt-container > div.row > div[class^=col-]:first-child { + padding-left: 0; +} +div.table-responsive > div.dt-container > div.row > div[class^=col-]:last-child { + padding-right: 0; +} + +:root[data-bs-theme=dark] { + --dt-row-hover: 255, 255, 255; + --dt-row-stripe: 255, 255, 255; + --dt-column-ordering: 255, 255, 255; +} + + +@keyframes dtb-spinner { + 100% { + transform: rotate(360deg); + } +} +@-o-keyframes dtb-spinner { + 100% { + -o-transform: rotate(360deg); + transform: rotate(360deg); + } +} +@-ms-keyframes dtb-spinner { + 100% { + -ms-transform: rotate(360deg); + transform: rotate(360deg); + } +} +@-webkit-keyframes dtb-spinner { + 100% { + -webkit-transform: rotate(360deg); + transform: rotate(360deg); + } +} +@-moz-keyframes dtb-spinner { + 100% { + -moz-transform: rotate(360deg); + transform: rotate(360deg); + } +} +div.dataTables_wrapper { + position: relative; +} + +div.dt-buttons { + position: initial; +} +div.dt-buttons .dt-button { + overflow: hidden; + text-overflow: ellipsis; + white-space: nowrap; +} + +div.dt-button-info { + position: fixed; + top: 50%; + left: 50%; + width: 400px; + margin-top: -100px; + margin-left: -200px; + background-color: white; + border-radius: 0.75em; + box-shadow: 3px 4px 10px 1px rgba(0, 0, 0, 0.8); + text-align: center; + z-index: 2003; + overflow: hidden; +} +div.dt-button-info h2 { + padding: 2rem 2rem 1rem 2rem; + margin: 0; + font-weight: normal; +} +div.dt-button-info > div { + padding: 1em 2em 2em 2em; +} + +div.dtb-popover-close { + position: absolute; + top: 6px; + right: 6px; + width: 22px; + height: 22px; + text-align: center; + border-radius: 3px; + cursor: pointer; + z-index: 2003; +} + +button.dtb-hide-drop { + display: none !important; +} + +div.dt-button-collection-title { + text-align: center; + padding: 0.3em 0.5em 0.5em; + margin-left: 0.5em; + margin-right: 0.5em; + font-size: 0.9em; + white-space: nowrap; + overflow: hidden; + text-overflow: ellipsis; +} + +div.dt-button-collection-title:empty { + display: none; +} + +span.dt-button-spacer { + display: inline-block; + margin: 0.5em; + white-space: nowrap; +} +span.dt-button-spacer.bar { + border-left: 1px solid rgba(0, 0, 0, 0.3); + vertical-align: middle; + padding-left: 0.5em; +} +span.dt-button-spacer.bar:empty { + height: 1em; + width: 1px; + padding-left: 0; +} + +div.dt-button-collection .dt-button-active { + padding-right: 3em; +} +div.dt-button-collection .dt-button-active:after { + position: absolute; + top: 50%; + margin-top: -10px; + right: 1em; + display: inline-block; + content: "✓"; + color: inherit; +} +div.dt-button-collection .dt-button-active.dt-button-split { + padding-right: 0; +} +div.dt-button-collection .dt-button-active.dt-button-split:after { + display: none; +} +div.dt-button-collection .dt-button-active.dt-button-split > *:first-child { + padding-right: 3em; +} +div.dt-button-collection .dt-button-active.dt-button-split > *:first-child:after { + position: absolute; + top: 50%; + margin-top: -10px; + right: 1em; + display: inline-block; + content: "✓"; + color: inherit; +} +div.dt-button-collection .dt-button-active-a a { + padding-right: 3em; +} +div.dt-button-collection .dt-button-active-a a:after { + position: absolute; + right: 1em; + display: inline-block; + content: "✓"; + color: inherit; +} +div.dt-button-collection span.dt-button-spacer { + width: 100%; + font-size: 0.9em; + text-align: center; + margin: 0.5em 0; +} +div.dt-button-collection span.dt-button-spacer:empty { + height: 0; + width: 100%; +} +div.dt-button-collection span.dt-button-spacer.bar { + border-left: none; + border-bottom: 1px solid rgba(0, 0, 0, 0.1); + padding-left: 0; +} + +@media print { + table.dataTable tr > * { + box-shadow: none !important; + } +} +html.dark div.dt-button-info { + background-color: var(--dt-html-background); + border: 1px solid rgba(255, 255, 255, 0.15); +} + +div.dt-buttons div.btn-group { + position: initial; +} +div.dt-buttons div.dropdown-menu { + margin-top: 4px; + width: 200px; +} +div.dt-buttons div.dropdown-menu .dt-button { + position: relative; +} +div.dt-buttons div.dropdown-menu div.dt-button-split { + display: flex; + flex-direction: row; + flex-wrap: wrap; + justify-content: flex-start; + align-content: flex-start; + align-items: stretch; +} +div.dt-buttons div.dropdown-menu div.dt-button-split a:first-child { + min-width: auto; + flex: 1 0 50px; + padding-right: 0; +} +div.dt-buttons div.dropdown-menu div.dt-button-split button:last-child { + min-width: 33px; + flex: 0; + background: transparent; + border: none; + line-height: 1rem; + color: var(--bs-dropdown-link-color); + padding: var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x); + overflow: visible; +} +div.dt-buttons div.dropdown-menu div.dt-button-split button:last-child:hover { + color: var(--bs-dropdown-link-hover-color); + background-color: var(--bs-dropdown-link-hover-bg); +} +div.dt-buttons div.dropdown-menu div.dt-button-split button:last-child:after { + position: relative; + left: -3px; +} +div.dt-buttons div.dropdown-menu.fixed { + position: fixed; + display: block; + top: 50%; + left: 50%; + margin-left: -75px; + border-radius: 5px; + background-color: white; + padding: 0.5em; +} +div.dt-buttons div.dropdown-menu.fixed.two-column { + margin-left: -200px; +} +div.dt-buttons div.dropdown-menu.fixed.three-column { + margin-left: -225px; +} +div.dt-buttons div.dropdown-menu.fixed.four-column { + margin-left: -300px; +} +div.dt-buttons div.dropdown-menu.fixed.columns { + margin-left: -409px; +} +@media screen and (max-width: 1024px) { + div.dt-buttons div.dropdown-menu.fixed.columns { + margin-left: -308px; + } +} +@media screen and (max-width: 640px) { + div.dt-buttons div.dropdown-menu.fixed.columns { + margin-left: -203px; + } +} +@media screen and (max-width: 460px) { + div.dt-buttons div.dropdown-menu.fixed.columns { + margin-left: -100px; + } +} +div.dt-buttons div.dropdown-menu.fixed > :last-child { + max-height: 100vh; + overflow: auto; +} +div.dt-buttons div.dropdown-menu.two-column > :last-child, div.dt-buttons div.dropdown-menu.three-column > :last-child, div.dt-buttons div.dropdown-menu.four-column > :last-child { + display: block !important; + -webkit-column-gap: 8px; + -moz-column-gap: 8px; + -ms-column-gap: 8px; + -o-column-gap: 8px; + column-gap: 8px; +} +div.dt-buttons div.dropdown-menu.two-column > :last-child > *, div.dt-buttons div.dropdown-menu.three-column > :last-child > *, div.dt-buttons div.dropdown-menu.four-column > :last-child > * { + -webkit-column-break-inside: avoid; + break-inside: avoid; +} +div.dt-buttons div.dropdown-menu.two-column { + width: 400px; +} +div.dt-buttons div.dropdown-menu.two-column > :last-child { + padding-bottom: 1px; + column-count: 2; +} +div.dt-buttons div.dropdown-menu.three-column { + width: 450px; +} +div.dt-buttons div.dropdown-menu.three-column > :last-child { + padding-bottom: 1px; + column-count: 3; +} +div.dt-buttons div.dropdown-menu.four-column { + width: 600px; +} +div.dt-buttons div.dropdown-menu.four-column > :last-child { + padding-bottom: 1px; + column-count: 4; +} +div.dt-buttons div.dropdown-menu .dt-button { + border-radius: 0; +} +div.dt-buttons div.dropdown-menu.columns { + width: auto; +} +div.dt-buttons div.dropdown-menu.columns > :last-child { + display: flex; + flex-wrap: wrap; + justify-content: flex-start; + align-items: center; + gap: 6px; + width: 818px; + padding-bottom: 1px; +} +div.dt-buttons div.dropdown-menu.columns > :last-child .dt-button { + min-width: 200px; + flex: 0 1; + margin: 0; +} +div.dt-buttons div.dropdown-menu.columns.dtb-b3 > :last-child, div.dt-buttons div.dropdown-menu.columns.dtb-b2 > :last-child, div.dt-buttons div.dropdown-menu.columns.dtb-b1 > :last-child { + justify-content: space-between; +} +div.dt-buttons div.dropdown-menu.columns.dtb-b3 .dt-button { + flex: 1 1 32%; +} +div.dt-buttons div.dropdown-menu.columns.dtb-b2 .dt-button { + flex: 1 1 48%; +} +div.dt-buttons div.dropdown-menu.columns.dtb-b1 .dt-button { + flex: 1 1 100%; +} +@media screen and (max-width: 1024px) { + div.dt-buttons div.dropdown-menu.columns > :last-child { + width: 612px; + } +} +@media screen and (max-width: 640px) { + div.dt-buttons div.dropdown-menu.columns > :last-child { + width: 406px; + } + div.dt-buttons div.dropdown-menu.columns.dtb-b3 .dt-button { + flex: 0 1 32%; + } +} +@media screen and (max-width: 460px) { + div.dt-buttons div.dropdown-menu.columns > :last-child { + width: 200px; + } +} +div.dt-buttons span.dt-button-spacer.empty { + margin: 1px; +} +div.dt-buttons span.dt-button-spacer.bar:empty { + height: inherit; +} +div.dt-buttons .btn.processing { + color: rgba(0, 0, 0, 0.2); +} +div.dt-buttons .btn.processing:after { + position: absolute; + top: 50%; + left: 50%; + width: 16px; + height: 16px; + margin: -8px 0 0 -8px; + box-sizing: border-box; + display: block; + content: " "; + border: 2px solid rgb(40, 40, 40); + border-radius: 50%; + border-left-color: transparent; + border-right-color: transparent; + animation: dtb-spinner 1500ms infinite linear; + -o-animation: dtb-spinner 1500ms infinite linear; + -ms-animation: dtb-spinner 1500ms infinite linear; + -webkit-animation: dtb-spinner 1500ms infinite linear; + -moz-animation: dtb-spinner 1500ms infinite linear; +} + +div.dt-button-background { + position: fixed; + top: 0; + left: 0; + width: 100%; + height: 100%; + z-index: 999; +} + +@media screen and (max-width: 767px) { + div.dt-buttons { + float: none; + width: 100%; + text-align: center; + margin-bottom: 0.5em; + } + div.dt-buttons a.btn { + float: none; + } +} +:root[data-bs-theme=dark] div.dropdown-menu.dt-button-collection.fixed { + background-color: rgb(33, 37, 41); + border: 1px solid rgba(255, 255, 255, 0.15); + border-radius: 8px; +} + + +table.dataTable.dtr-inline.collapsed > tbody > tr > td.child, +table.dataTable.dtr-inline.collapsed > tbody > tr > th.child, +table.dataTable.dtr-inline.collapsed > tbody > tr > td.dataTables_empty { + cursor: default !important; +} +table.dataTable.dtr-inline.collapsed > tbody > tr > td.child:before, +table.dataTable.dtr-inline.collapsed > tbody > tr > th.child:before, +table.dataTable.dtr-inline.collapsed > tbody > tr > td.dataTables_empty:before { + display: none !important; +} +table.dataTable.dtr-inline.collapsed > tbody > tr > td.dtr-control, +table.dataTable.dtr-inline.collapsed > tbody > tr > th.dtr-control { + cursor: pointer; +} +table.dataTable.dtr-inline.collapsed > tbody > tr > td.dtr-control:before, +table.dataTable.dtr-inline.collapsed > tbody > tr > th.dtr-control:before { + margin-right: 0.5em; + display: inline-block; + box-sizing: border-box; + content: ""; + border-top: 5px solid transparent; + border-left: 10px solid rgba(0, 0, 0, 0.5); + border-bottom: 5px solid transparent; + border-right: 0px solid transparent; +} +table.dataTable.dtr-inline.collapsed > tbody > tr > td.dtr-control.arrow-right::before, +table.dataTable.dtr-inline.collapsed > tbody > tr > th.dtr-control.arrow-right::before { + border-top: 5px solid transparent; + border-left: 0px solid transparent; + border-bottom: 5px solid transparent; + border-right: 10px solid rgba(0, 0, 0, 0.5); +} +table.dataTable.dtr-inline.collapsed > tbody > tr.dtr-expanded > td.dtr-control:before, +table.dataTable.dtr-inline.collapsed > tbody > tr.dtr-expanded > th.dtr-control:before { + border-top: 10px solid rgba(0, 0, 0, 0.5); + border-left: 5px solid transparent; + border-bottom: 0px solid transparent; + border-right: 5px solid transparent; +} +table.dataTable.dtr-inline.collapsed.compact > tbody > tr > td.dtr-control, +table.dataTable.dtr-inline.collapsed.compact > tbody > tr > th.dtr-control { + padding-left: 0.333em; +} +table.dataTable.dtr-column > tbody > tr > td.dtr-control, +table.dataTable.dtr-column > tbody > tr > th.dtr-control, +table.dataTable.dtr-column > tbody > tr > td.control, +table.dataTable.dtr-column > tbody > tr > th.control { + cursor: pointer; +} +table.dataTable.dtr-column > tbody > tr > td.dtr-control:before, +table.dataTable.dtr-column > tbody > tr > th.dtr-control:before, +table.dataTable.dtr-column > tbody > tr > td.control:before, +table.dataTable.dtr-column > tbody > tr > th.control:before { + display: inline-block; + box-sizing: border-box; + content: ""; + border-top: 5px solid transparent; + border-left: 10px solid rgba(0, 0, 0, 0.5); + border-bottom: 5px solid transparent; + border-right: 0px solid transparent; +} +table.dataTable.dtr-column > tbody > tr > td.dtr-control.arrow-right::before, +table.dataTable.dtr-column > tbody > tr > th.dtr-control.arrow-right::before, +table.dataTable.dtr-column > tbody > tr > td.control.arrow-right::before, +table.dataTable.dtr-column > tbody > tr > th.control.arrow-right::before { + border-top: 5px solid transparent; + border-left: 0px solid transparent; + border-bottom: 5px solid transparent; + border-right: 10px solid rgba(0, 0, 0, 0.5); +} +table.dataTable.dtr-column > tbody > tr.dtr-expanded td.dtr-control:before, +table.dataTable.dtr-column > tbody > tr.dtr-expanded th.dtr-control:before, +table.dataTable.dtr-column > tbody > tr.dtr-expanded td.control:before, +table.dataTable.dtr-column > tbody > tr.dtr-expanded th.control:before { + border-top: 10px solid rgba(0, 0, 0, 0.5); + border-left: 5px solid transparent; + border-bottom: 0px solid transparent; + border-right: 5px solid transparent; +} +table.dataTable > tbody > tr.child { + padding: 0.5em 1em; +} +table.dataTable > tbody > tr.child:hover { + background: transparent !important; +} +table.dataTable > tbody > tr.child ul.dtr-details { + display: inline-block; + list-style-type: none; + margin: 0; + padding: 0; +} +table.dataTable > tbody > tr.child ul.dtr-details > li { + border-bottom: 1px solid #efefef; + padding: 0.5em 0; +} +table.dataTable > tbody > tr.child ul.dtr-details > li:first-child { + padding-top: 0; +} +table.dataTable > tbody > tr.child ul.dtr-details > li:last-child { + padding-bottom: 0; + border-bottom: none; +} +table.dataTable > tbody > tr.child span.dtr-title { + display: inline-block; + min-width: 75px; + font-weight: bold; +} + +div.dtr-modal { + position: fixed; + box-sizing: border-box; + top: 0; + left: 0; + height: 100%; + width: 100%; + z-index: 100; + padding: 10em 1em; +} +div.dtr-modal div.dtr-modal-display { + position: absolute; + top: 0; + left: 0; + bottom: 0; + right: 0; + width: 50%; + height: fit-content; + max-height: 75%; + overflow: auto; + margin: auto; + z-index: 102; + overflow: auto; + background-color: #f5f5f7; + border: 1px solid black; + border-radius: 0.5em; + box-shadow: 0 12px 30px rgba(0, 0, 0, 0.6); +} +div.dtr-modal div.dtr-modal-content { + position: relative; + padding: 2.5em; +} +div.dtr-modal div.dtr-modal-content h2 { + margin-top: 0; +} +div.dtr-modal div.dtr-modal-close { + position: absolute; + top: 6px; + right: 6px; + width: 22px; + height: 22px; + text-align: center; + border-radius: 3px; + cursor: pointer; + z-index: 12; +} +div.dtr-modal div.dtr-modal-background { + position: fixed; + top: 0; + left: 0; + right: 0; + bottom: 0; + z-index: 101; + background: rgba(0, 0, 0, 0.6); +} + +@media screen and (max-width: 767px) { + div.dtr-modal div.dtr-modal-display { + width: 95%; + } +} +html.dark table.dataTable > tbody > tr > td.dtr-control:before, +html[data-bs-theme=dark] table.dataTable > tbody > tr > td.dtr-control:before { + border-left-color: rgba(255, 255, 255, 0.5) !important; +} +html.dark table.dataTable > tbody > tr > td.dtr-control.arrow-right::before, +html[data-bs-theme=dark] table.dataTable > tbody > tr > td.dtr-control.arrow-right::before { + border-right-color: rgba(255, 255, 255, 0.5) !important; +} +html.dark table.dataTable > tbody > tr.dtr-expanded > td.dtr-control:before, +html.dark table.dataTable > tbody > tr.dtr-expanded > th.dtr-control:before, +html[data-bs-theme=dark] table.dataTable > tbody > tr.dtr-expanded > td.dtr-control:before, +html[data-bs-theme=dark] table.dataTable > tbody > tr.dtr-expanded > th.dtr-control:before { + border-top-color: rgba(255, 255, 255, 0.5) !important; + border-left-color: transparent !important; + border-right-color: transparent !important; +} +html.dark table.dataTable > tbody > tr.child ul.dtr-details > li, +html[data-bs-theme=dark] table.dataTable > tbody > tr.child ul.dtr-details > li { + border-bottom-color: rgb(64, 67, 70); +} +html.dark div.dtr-modal div.dtr-modal-display, +html[data-bs-theme=dark] div.dtr-modal div.dtr-modal-display { + background-color: rgb(33, 37, 41); + border: 1px solid rgba(255, 255, 255, 0.15); +} + +div.dtr-bs-modal table.table tr:first-child td { + border-top: none; +} + +table.dataTable.table-bordered th.dtr-control.dtr-hidden + *, +table.dataTable.table-bordered td.dtr-control.dtr-hidden + * { + border-left-width: 1px; +} + + diff --git a/public/plugins/DataTables/datatables.js b/public/plugins/DataTables/datatables.js new file mode 100644 index 0000000..b71f74a --- /dev/null +++ b/public/plugins/DataTables/datatables.js @@ -0,0 +1,29604 @@ +/* + * This combined file was created by the DataTables downloader builder: + * https://datatables.net/download + * + * To rebuild or modify this file with the latest versions of the included + * software please visit: + * https://datatables.net/download/#bs5/jq-3.7.0/dt-2.0.2/b-3.0.1/b-colvis-3.0.1/r-3.0.0 + * + * Included libraries: + * jQuery 3 3.7.0, DataTables 2.0.2, Buttons 3.0.1, Column visibility 3.0.1, Responsive 3.0.0 + */ + +/*! + * jQuery JavaScript Library v3.7.0 + * https://jquery.com/ + * + * Copyright OpenJS Foundation and other contributors + * Released under the MIT license + * https://jquery.org/license + * + * Date: 2023-05-11T18:29Z + */ +( function( global, factory ) { + + "use strict"; + + if ( typeof module === "object" && typeof module.exports === "object" ) { + + // For CommonJS and CommonJS-like environments where a proper `window` + // is present, execute the factory and get jQuery. + // For environments that do not have a `window` with a `document` + // (such as Node.js), expose a factory as module.exports. + // This accentuates the need for the creation of a real `window`. + // e.g. var jQuery = require("jquery")(window); + // See ticket trac-14549 for more info. + module.exports = global.document ? + factory( global, true ) : + function( w ) { + if ( !w.document ) { + throw new Error( "jQuery requires a window with a document" ); + } + return factory( w ); + }; + } else { + factory( global ); + } + +// Pass this if window is not defined yet +} )( typeof window !== "undefined" ? window : this, function( window, noGlobal ) { + +// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1 +// throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode +// arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common +// enough that all such attempts are guarded in a try block. +"use strict"; + +var arr = []; + +var getProto = Object.getPrototypeOf; + +var slice = arr.slice; + +var flat = arr.flat ? function( array ) { + return arr.flat.call( array ); +} : function( array ) { + return arr.concat.apply( [], array ); +}; + + +var push = arr.push; + +var indexOf = arr.indexOf; + +var class2type = {}; + +var toString = class2type.toString; + +var hasOwn = class2type.hasOwnProperty; + +var fnToString = hasOwn.toString; + +var ObjectFunctionString = fnToString.call( Object ); + +var support = {}; + +var isFunction = function isFunction( obj ) { + + // Support: Chrome <=57, Firefox <=52 + // In some browsers, typeof returns "function" for HTML elements + // (i.e., `typeof document.createElement( "object" ) === "function"`). + // We don't want to classify *any* DOM node as a function. + // Support: QtWeb <=3.8.5, WebKit <=534.34, wkhtmltopdf tool <=0.12.5 + // Plus for old WebKit, typeof returns "function" for HTML collections + // (e.g., `typeof document.getElementsByTagName("div") === "function"`). (gh-4756) + return typeof obj === "function" && typeof obj.nodeType !== "number" && + typeof obj.item !== "function"; + }; + + +var isWindow = function isWindow( obj ) { + return obj != null && obj === obj.window; + }; + + +var document = window.document; + + + + var preservedScriptAttributes = { + type: true, + src: true, + nonce: true, + noModule: true + }; + + function DOMEval( code, node, doc ) { + doc = doc || document; + + var i, val, + script = doc.createElement( "script" ); + + script.text = code; + if ( node ) { + for ( i in preservedScriptAttributes ) { + + // Support: Firefox 64+, Edge 18+ + // Some browsers don't support the "nonce" property on scripts. + // On the other hand, just using `getAttribute` is not enough as + // the `nonce` attribute is reset to an empty string whenever it + // becomes browsing-context connected. + // See https://github.com/whatwg/html/issues/2369 + // See https://html.spec.whatwg.org/#nonce-attributes + // The `node.getAttribute` check was added for the sake of + // `jQuery.globalEval` so that it can fake a nonce-containing node + // via an object. + val = node[ i ] || node.getAttribute && node.getAttribute( i ); + if ( val ) { + script.setAttribute( i, val ); + } + } + } + doc.head.appendChild( script ).parentNode.removeChild( script ); + } + + +function toType( obj ) { + if ( obj == null ) { + return obj + ""; + } + + // Support: Android <=2.3 only (functionish RegExp) + return typeof obj === "object" || typeof obj === "function" ? + class2type[ toString.call( obj ) ] || "object" : + typeof obj; +} +/* global Symbol */ +// Defining this global in .eslintrc.json would create a danger of using the global +// unguarded in another place, it seems safer to define global only for this module + + + +var version = "3.7.0", + + rhtmlSuffix = /HTML$/i, + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + + // The jQuery object is actually just the init constructor 'enhanced' + // Need init if jQuery is called (just allow error to be thrown if not included) + return new jQuery.fn.init( selector, context ); + }; + +jQuery.fn = jQuery.prototype = { + + // The current version of jQuery being used + jquery: version, + + constructor: jQuery, + + // The default length of a jQuery object is 0 + length: 0, + + toArray: function() { + return slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + + // Return all the elements in a clean array + if ( num == null ) { + return slice.call( this ); + } + + // Return just the one element from the set + return num < 0 ? this[ num + this.length ] : this[ num ]; + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + each: function( callback ) { + return jQuery.each( this, callback ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map( this, function( elem, i ) { + return callback.call( elem, i, elem ); + } ) ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ) ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + even: function() { + return this.pushStack( jQuery.grep( this, function( _elem, i ) { + return ( i + 1 ) % 2; + } ) ); + }, + + odd: function() { + return this.pushStack( jQuery.grep( this, function( _elem, i ) { + return i % 2; + } ) ); + }, + + eq: function( i ) { + var len = this.length, + j = +i + ( i < 0 ? len : 0 ); + return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] ); + }, + + end: function() { + return this.prevObject || this.constructor(); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: arr.sort, + splice: arr.splice +}; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[ 0 ] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + + // Skip the boolean and the target + target = arguments[ i ] || {}; + i++; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !isFunction( target ) ) { + target = {}; + } + + // Extend jQuery itself if only one argument is passed + if ( i === length ) { + target = this; + i--; + } + + for ( ; i < length; i++ ) { + + // Only deal with non-null/undefined values + if ( ( options = arguments[ i ] ) != null ) { + + // Extend the base object + for ( name in options ) { + copy = options[ name ]; + + // Prevent Object.prototype pollution + // Prevent never-ending loop + if ( name === "__proto__" || target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject( copy ) || + ( copyIsArray = Array.isArray( copy ) ) ) ) { + src = target[ name ]; + + // Ensure proper type for the source value + if ( copyIsArray && !Array.isArray( src ) ) { + clone = []; + } else if ( !copyIsArray && !jQuery.isPlainObject( src ) ) { + clone = {}; + } else { + clone = src; + } + copyIsArray = false; + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend( { + + // Unique for each copy of jQuery on the page + expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ), + + // Assume jQuery is ready without the ready module + isReady: true, + + error: function( msg ) { + throw new Error( msg ); + }, + + noop: function() {}, + + isPlainObject: function( obj ) { + var proto, Ctor; + + // Detect obvious negatives + // Use toString instead of jQuery.type to catch host objects + if ( !obj || toString.call( obj ) !== "[object Object]" ) { + return false; + } + + proto = getProto( obj ); + + // Objects with no prototype (e.g., `Object.create( null )`) are plain + if ( !proto ) { + return true; + } + + // Objects with prototype are plain iff they were constructed by a global Object function + Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor; + return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString; + }, + + isEmptyObject: function( obj ) { + var name; + + for ( name in obj ) { + return false; + } + return true; + }, + + // Evaluates a script in a provided context; falls back to the global one + // if not specified. + globalEval: function( code, options, doc ) { + DOMEval( code, { nonce: options && options.nonce }, doc ); + }, + + each: function( obj, callback ) { + var length, i = 0; + + if ( isArrayLike( obj ) ) { + length = obj.length; + for ( ; i < length; i++ ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } else { + for ( i in obj ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } + + return obj; + }, + + + // Retrieve the text value of an array of DOM nodes + text: function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if ( !nodeType ) { + + // If no nodeType, this is expected to be an array + while ( ( node = elem[ i++ ] ) ) { + + // Do not traverse comment nodes + ret += jQuery.text( node ); + } + } else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { + return elem.textContent; + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + + // Do not include comment or processing instruction nodes + + return ret; + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var ret = results || []; + + if ( arr != null ) { + if ( isArrayLike( Object( arr ) ) ) { + jQuery.merge( ret, + typeof arr === "string" ? + [ arr ] : arr + ); + } else { + push.call( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + return arr == null ? -1 : indexOf.call( arr, elem, i ); + }, + + isXMLDoc: function( elem ) { + var namespace = elem && elem.namespaceURI, + docElem = elem && ( elem.ownerDocument || elem ).documentElement; + + // Assume HTML when documentElement doesn't yet exist, such as inside + // document fragments. + return !rhtmlSuffix.test( namespace || docElem && docElem.nodeName || "HTML" ); + }, + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + merge: function( first, second ) { + var len = +second.length, + j = 0, + i = first.length; + + for ( ; j < len; j++ ) { + first[ i++ ] = second[ j ]; + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, invert ) { + var callbackInverse, + matches = [], + i = 0, + length = elems.length, + callbackExpect = !invert; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + callbackInverse = !callback( elems[ i ], i ); + if ( callbackInverse !== callbackExpect ) { + matches.push( elems[ i ] ); + } + } + + return matches; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var length, value, + i = 0, + ret = []; + + // Go through the array, translating each of the items to their new values + if ( isArrayLike( elems ) ) { + length = elems.length; + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + + // Go through every key on the object, + } else { + for ( i in elems ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + } + + // Flatten any nested arrays + return flat( ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // jQuery.support is not used in Core but other projects attach their + // properties to it so it needs to exist. + support: support +} ); + +if ( typeof Symbol === "function" ) { + jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ]; +} + +// Populate the class2type map +jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ), + function( _i, name ) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); + } ); + +function isArrayLike( obj ) { + + // Support: real iOS 8.2 only (not reproducible in simulator) + // `in` check used to prevent JIT error (gh-2145) + // hasOwn isn't used here due to false negatives + // regarding Nodelist length in IE + var length = !!obj && "length" in obj && obj.length, + type = toType( obj ); + + if ( isFunction( obj ) || isWindow( obj ) ) { + return false; + } + + return type === "array" || length === 0 || + typeof length === "number" && length > 0 && ( length - 1 ) in obj; +} + + +function nodeName( elem, name ) { + + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); + +} +var pop = arr.pop; + + +var sort = arr.sort; + + +var splice = arr.splice; + + +var whitespace = "[\\x20\\t\\r\\n\\f]"; + + +var rtrimCSS = new RegExp( + "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", + "g" +); + + + + +// Note: an element does not contain itself +jQuery.contains = function( a, b ) { + var bup = b && b.parentNode; + + return a === bup || !!( bup && bup.nodeType === 1 && ( + + // Support: IE 9 - 11+ + // IE doesn't have `contains` on SVG. + a.contains ? + a.contains( bup ) : + a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16 + ) ); +}; + + + + +// CSS string/identifier serialization +// https://drafts.csswg.org/cssom/#common-serializing-idioms +var rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\x80-\uFFFF\w-]/g; + +function fcssescape( ch, asCodePoint ) { + if ( asCodePoint ) { + + // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER + if ( ch === "\0" ) { + return "\uFFFD"; + } + + // Control characters and (dependent upon position) numbers get escaped as code points + return ch.slice( 0, -1 ) + "\\" + ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " "; + } + + // Other potentially-special ASCII characters get backslash-escaped + return "\\" + ch; +} + +jQuery.escapeSelector = function( sel ) { + return ( sel + "" ).replace( rcssescape, fcssescape ); +}; + + + + +var preferredDoc = document, + pushNative = push; + +( function() { + +var i, + Expr, + outermostContext, + sortInput, + hasDuplicate, + push = pushNative, + + // Local document vars + document, + documentElement, + documentIsHTML, + rbuggyQSA, + matches, + + // Instance-specific data + expando = jQuery.expando, + dirruns = 0, + done = 0, + classCache = createCache(), + tokenCache = createCache(), + compilerCache = createCache(), + nonnativeSelectorCache = createCache(), + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + } + return 0; + }, + + booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|" + + "loop|multiple|open|readonly|required|scoped", + + // Regular expressions + + // https://www.w3.org/TR/css-syntax-3/#ident-token-diagram + identifier = "(?:\\\\[\\da-fA-F]{1,6}" + whitespace + + "?|\\\\[^\\r\\n\\f]|[\\w-]|[^\0-\\x7f])+", + + // Attribute selectors: https://www.w3.org/TR/selectors/#attribute-selectors + attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace + + + // Operator (capture 2) + "*([*^$|!~]?=)" + whitespace + + + // "Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]" + "*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + + whitespace + "*\\]", + + pseudos = ":(" + identifier + ")(?:\\((" + + + // To reduce the number of selectors needing tokenize in the preFilter, prefer arguments: + // 1. quoted (capture 3; capture 4 or capture 5) + "('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" + + + // 2. simple (capture 6) + "((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" + + + // 3. anything else (capture 2) + ".*" + + ")\\)|)", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rwhitespace = new RegExp( whitespace + "+", "g" ), + + rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ), + rleadingCombinator = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" + + whitespace + "*" ), + rdescend = new RegExp( whitespace + "|>" ), + + rpseudo = new RegExp( pseudos ), + ridentifier = new RegExp( "^" + identifier + "$" ), + + matchExpr = { + ID: new RegExp( "^#(" + identifier + ")" ), + CLASS: new RegExp( "^\\.(" + identifier + ")" ), + TAG: new RegExp( "^(" + identifier + "|[*])" ), + ATTR: new RegExp( "^" + attributes ), + PSEUDO: new RegExp( "^" + pseudos ), + CHILD: new RegExp( + "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + + whitespace + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + + whitespace + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ), + bool: new RegExp( "^(?:" + booleans + ")$", "i" ), + + // For use in libraries implementing .is() + // We use this for POS matching in `select` + needsContext: new RegExp( "^" + whitespace + + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + whitespace + + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" ) + }, + + rinputs = /^(?:input|select|textarea|button)$/i, + rheader = /^h\d$/i, + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, + + rsibling = /[+~]/, + + // CSS escapes + // https://www.w3.org/TR/CSS21/syndata.html#escaped-characters + runescape = new RegExp( "\\\\[\\da-fA-F]{1,6}" + whitespace + + "?|\\\\([^\\r\\n\\f])", "g" ), + funescape = function( escape, nonHex ) { + var high = "0x" + escape.slice( 1 ) - 0x10000; + + if ( nonHex ) { + + // Strip the backslash prefix from a non-hex escape sequence + return nonHex; + } + + // Replace a hexadecimal escape sequence with the encoded Unicode code point + // Support: IE <=11+ + // For values outside the Basic Multilingual Plane (BMP), manually construct a + // surrogate pair + return high < 0 ? + String.fromCharCode( high + 0x10000 ) : + String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 ); + }, + + // Used for iframes; see `setDocument`. + // Support: IE 9 - 11+, Edge 12 - 18+ + // Removing the function wrapper causes a "Permission Denied" + // error in IE/Edge. + unloadHandler = function() { + setDocument(); + }, + + inDisabledFieldset = addCombinator( + function( elem ) { + return elem.disabled === true && nodeName( elem, "fieldset" ); + }, + { dir: "parentNode", next: "legend" } + ); + +// Support: IE <=9 only +// Accessing document.activeElement can throw unexpectedly +// https://bugs.jquery.com/ticket/13393 +function safeActiveElement() { + try { + return document.activeElement; + } catch ( err ) { } +} + +// Optimize for push.apply( _, NodeList ) +try { + push.apply( + ( arr = slice.call( preferredDoc.childNodes ) ), + preferredDoc.childNodes + ); + + // Support: Android <=4.0 + // Detect silently failing push.apply + // eslint-disable-next-line no-unused-expressions + arr[ preferredDoc.childNodes.length ].nodeType; +} catch ( e ) { + push = { + apply: function( target, els ) { + pushNative.apply( target, slice.call( els ) ); + }, + call: function( target ) { + pushNative.apply( target, slice.call( arguments, 1 ) ); + } + }; +} + +function find( selector, context, results, seed ) { + var m, i, elem, nid, match, groups, newSelector, + newContext = context && context.ownerDocument, + + // nodeType defaults to 9, since context defaults to document + nodeType = context ? context.nodeType : 9; + + results = results || []; + + // Return early from calls with invalid selector or context + if ( typeof selector !== "string" || !selector || + nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) { + + return results; + } + + // Try to shortcut find operations (as opposed to filters) in HTML documents + if ( !seed ) { + setDocument( context ); + context = context || document; + + if ( documentIsHTML ) { + + // If the selector is sufficiently simple, try using a "get*By*" DOM method + // (excepting DocumentFragment context, where the methods don't exist) + if ( nodeType !== 11 && ( match = rquickExpr.exec( selector ) ) ) { + + // ID selector + if ( ( m = match[ 1 ] ) ) { + + // Document context + if ( nodeType === 9 ) { + if ( ( elem = context.getElementById( m ) ) ) { + + // Support: IE 9 only + // getElementById can match elements by name instead of ID + if ( elem.id === m ) { + push.call( results, elem ); + return results; + } + } else { + return results; + } + + // Element context + } else { + + // Support: IE 9 only + // getElementById can match elements by name instead of ID + if ( newContext && ( elem = newContext.getElementById( m ) ) && + find.contains( context, elem ) && + elem.id === m ) { + + push.call( results, elem ); + return results; + } + } + + // Type selector + } else if ( match[ 2 ] ) { + push.apply( results, context.getElementsByTagName( selector ) ); + return results; + + // Class selector + } else if ( ( m = match[ 3 ] ) && context.getElementsByClassName ) { + push.apply( results, context.getElementsByClassName( m ) ); + return results; + } + } + + // Take advantage of querySelectorAll + if ( !nonnativeSelectorCache[ selector + " " ] && + ( !rbuggyQSA || !rbuggyQSA.test( selector ) ) ) { + + newSelector = selector; + newContext = context; + + // qSA considers elements outside a scoping root when evaluating child or + // descendant combinators, which is not what we want. + // In such cases, we work around the behavior by prefixing every selector in the + // list with an ID selector referencing the scope context. + // The technique has to be used as well when a leading combinator is used + // as such selectors are not recognized by querySelectorAll. + // Thanks to Andrew Dupont for this technique. + if ( nodeType === 1 && + ( rdescend.test( selector ) || rleadingCombinator.test( selector ) ) ) { + + // Expand context for sibling selectors + newContext = rsibling.test( selector ) && testContext( context.parentNode ) || + context; + + // We can use :scope instead of the ID hack if the browser + // supports it & if we're not changing the context. + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when + // strict-comparing two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( newContext != context || !support.scope ) { + + // Capture the context ID, setting it first if necessary + if ( ( nid = context.getAttribute( "id" ) ) ) { + nid = jQuery.escapeSelector( nid ); + } else { + context.setAttribute( "id", ( nid = expando ) ); + } + } + + // Prefix every selector in the list + groups = tokenize( selector ); + i = groups.length; + while ( i-- ) { + groups[ i ] = ( nid ? "#" + nid : ":scope" ) + " " + + toSelector( groups[ i ] ); + } + newSelector = groups.join( "," ); + } + + try { + push.apply( results, + newContext.querySelectorAll( newSelector ) + ); + return results; + } catch ( qsaError ) { + nonnativeSelectorCache( selector, true ); + } finally { + if ( nid === expando ) { + context.removeAttribute( "id" ); + } + } + } + } + } + + // All others + return select( selector.replace( rtrimCSS, "$1" ), context, results, seed ); +} + +/** + * Create key-value caches of limited size + * @returns {function(string, object)} Returns the Object data after storing it on itself with + * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength) + * deleting the oldest entry + */ +function createCache() { + var keys = []; + + function cache( key, value ) { + + // Use (key + " ") to avoid collision with native prototype properties + // (see https://github.com/jquery/sizzle/issues/157) + if ( keys.push( key + " " ) > Expr.cacheLength ) { + + // Only keep the most recent entries + delete cache[ keys.shift() ]; + } + return ( cache[ key + " " ] = value ); + } + return cache; +} + +/** + * Mark a function for special use by jQuery selector module + * @param {Function} fn The function to mark + */ +function markFunction( fn ) { + fn[ expando ] = true; + return fn; +} + +/** + * Support testing using an element + * @param {Function} fn Passed the created element and returns a boolean result + */ +function assert( fn ) { + var el = document.createElement( "fieldset" ); + + try { + return !!fn( el ); + } catch ( e ) { + return false; + } finally { + + // Remove from its parent by default + if ( el.parentNode ) { + el.parentNode.removeChild( el ); + } + + // release memory in IE + el = null; + } +} + +/** + * Returns a function to use in pseudos for input types + * @param {String} type + */ +function createInputPseudo( type ) { + return function( elem ) { + return nodeName( elem, "input" ) && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for buttons + * @param {String} type + */ +function createButtonPseudo( type ) { + return function( elem ) { + return ( nodeName( elem, "input" ) || nodeName( elem, "button" ) ) && + elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for :enabled/:disabled + * @param {Boolean} disabled true for :disabled; false for :enabled + */ +function createDisabledPseudo( disabled ) { + + // Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable + return function( elem ) { + + // Only certain elements can match :enabled or :disabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled + if ( "form" in elem ) { + + // Check for inherited disabledness on relevant non-disabled elements: + // * listed form-associated elements in a disabled fieldset + // https://html.spec.whatwg.org/multipage/forms.html#category-listed + // https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled + // * option elements in a disabled optgroup + // https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled + // All such elements have a "form" property. + if ( elem.parentNode && elem.disabled === false ) { + + // Option elements defer to a parent optgroup if present + if ( "label" in elem ) { + if ( "label" in elem.parentNode ) { + return elem.parentNode.disabled === disabled; + } else { + return elem.disabled === disabled; + } + } + + // Support: IE 6 - 11+ + // Use the isDisabled shortcut property to check for disabled fieldset ancestors + return elem.isDisabled === disabled || + + // Where there is no isDisabled, check manually + elem.isDisabled !== !disabled && + inDisabledFieldset( elem ) === disabled; + } + + return elem.disabled === disabled; + + // Try to winnow out elements that can't be disabled before trusting the disabled property. + // Some victims get caught in our net (label, legend, menu, track), but it shouldn't + // even exist on them, let alone have a boolean value. + } else if ( "label" in elem ) { + return elem.disabled === disabled; + } + + // Remaining elements are neither :enabled nor :disabled + return false; + }; +} + +/** + * Returns a function to use in pseudos for positionals + * @param {Function} fn + */ +function createPositionalPseudo( fn ) { + return markFunction( function( argument ) { + argument = +argument; + return markFunction( function( seed, matches ) { + var j, + matchIndexes = fn( [], seed.length, argument ), + i = matchIndexes.length; + + // Match elements found at the specified indexes + while ( i-- ) { + if ( seed[ ( j = matchIndexes[ i ] ) ] ) { + seed[ j ] = !( matches[ j ] = seed[ j ] ); + } + } + } ); + } ); +} + +/** + * Checks a node for validity as a jQuery selector context + * @param {Element|Object=} context + * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value + */ +function testContext( context ) { + return context && typeof context.getElementsByTagName !== "undefined" && context; +} + +/** + * Sets document-related variables once based on the current document + * @param {Element|Object} [node] An element or document object to use to set the document + * @returns {Object} Returns the current document + */ +function setDocument( node ) { + var subWindow, + doc = node ? node.ownerDocument || node : preferredDoc; + + // Return early if doc is invalid or already selected + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( doc == document || doc.nodeType !== 9 || !doc.documentElement ) { + return document; + } + + // Update global variables + document = doc; + documentElement = document.documentElement; + documentIsHTML = !jQuery.isXMLDoc( document ); + + // Support: iOS 7 only, IE 9 - 11+ + // Older browsers didn't support unprefixed `matches`. + matches = documentElement.matches || + documentElement.webkitMatchesSelector || + documentElement.msMatchesSelector; + + // Support: IE 9 - 11+, Edge 12 - 18+ + // Accessing iframe documents after unload throws "permission denied" errors (see trac-13936) + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( preferredDoc != document && + ( subWindow = document.defaultView ) && subWindow.top !== subWindow ) { + + // Support: IE 9 - 11+, Edge 12 - 18+ + subWindow.addEventListener( "unload", unloadHandler ); + } + + // Support: IE <10 + // Check if getElementById returns elements by name + // The broken getElementById methods don't pick up programmatically-set names, + // so use a roundabout getElementsByName test + support.getById = assert( function( el ) { + documentElement.appendChild( el ).id = jQuery.expando; + return !document.getElementsByName || + !document.getElementsByName( jQuery.expando ).length; + } ); + + // Support: IE 9 only + // Check to see if it's possible to do matchesSelector + // on a disconnected node. + support.disconnectedMatch = assert( function( el ) { + return matches.call( el, "*" ); + } ); + + // Support: IE 9 - 11+, Edge 12 - 18+ + // IE/Edge don't support the :scope pseudo-class. + support.scope = assert( function() { + return document.querySelectorAll( ":scope" ); + } ); + + // Support: Chrome 105 - 111 only, Safari 15.4 - 16.3 only + // Make sure the `:has()` argument is parsed unforgivingly. + // We include `*` in the test to detect buggy implementations that are + // _selectively_ forgiving (specifically when the list includes at least + // one valid selector). + // Note that we treat complete lack of support for `:has()` as if it were + // spec-compliant support, which is fine because use of `:has()` in such + // environments will fail in the qSA path and fall back to jQuery traversal + // anyway. + support.cssHas = assert( function() { + try { + document.querySelector( ":has(*,:jqfake)" ); + return false; + } catch ( e ) { + return true; + } + } ); + + // ID filter and find + if ( support.getById ) { + Expr.filter.ID = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + return elem.getAttribute( "id" ) === attrId; + }; + }; + Expr.find.ID = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var elem = context.getElementById( id ); + return elem ? [ elem ] : []; + } + }; + } else { + Expr.filter.ID = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== "undefined" && + elem.getAttributeNode( "id" ); + return node && node.value === attrId; + }; + }; + + // Support: IE 6 - 7 only + // getElementById is not reliable as a find shortcut + Expr.find.ID = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var node, i, elems, + elem = context.getElementById( id ); + + if ( elem ) { + + // Verify the id attribute + node = elem.getAttributeNode( "id" ); + if ( node && node.value === id ) { + return [ elem ]; + } + + // Fall back on getElementsByName + elems = context.getElementsByName( id ); + i = 0; + while ( ( elem = elems[ i++ ] ) ) { + node = elem.getAttributeNode( "id" ); + if ( node && node.value === id ) { + return [ elem ]; + } + } + } + + return []; + } + }; + } + + // Tag + Expr.find.TAG = function( tag, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( tag ); + + // DocumentFragment nodes don't have gEBTN + } else { + return context.querySelectorAll( tag ); + } + }; + + // Class + Expr.find.CLASS = function( className, context ) { + if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) { + return context.getElementsByClassName( className ); + } + }; + + /* QSA/matchesSelector + ---------------------------------------------------------------------- */ + + // QSA and matchesSelector support + + rbuggyQSA = []; + + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert( function( el ) { + + var input; + + documentElement.appendChild( el ).innerHTML = + "" + + ""; + + // Support: iOS <=7 - 8 only + // Boolean attributes and "value" are not treated correctly in some XML documents + if ( !el.querySelectorAll( "[selected]" ).length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" ); + } + + // Support: iOS <=7 - 8 only + if ( !el.querySelectorAll( "[id~=" + expando + "-]" ).length ) { + rbuggyQSA.push( "~=" ); + } + + // Support: iOS 8 only + // https://bugs.webkit.org/show_bug.cgi?id=136851 + // In-page `selector#id sibling-combinator selector` fails + if ( !el.querySelectorAll( "a#" + expando + "+*" ).length ) { + rbuggyQSA.push( ".#.+[+~]" ); + } + + // Support: Chrome <=105+, Firefox <=104+, Safari <=15.4+ + // In some of the document kinds, these selectors wouldn't work natively. + // This is probably OK but for backwards compatibility we want to maintain + // handling them through jQuery traversal in jQuery 3.x. + if ( !el.querySelectorAll( ":checked" ).length ) { + rbuggyQSA.push( ":checked" ); + } + + // Support: Windows 8 Native Apps + // The type and name attributes are restricted during .innerHTML assignment + input = document.createElement( "input" ); + input.setAttribute( "type", "hidden" ); + el.appendChild( input ).setAttribute( "name", "D" ); + + // Support: IE 9 - 11+ + // IE's :disabled selector does not pick up the children of disabled fieldsets + // Support: Chrome <=105+, Firefox <=104+, Safari <=15.4+ + // In some of the document kinds, these selectors wouldn't work natively. + // This is probably OK but for backwards compatibility we want to maintain + // handling them through jQuery traversal in jQuery 3.x. + documentElement.appendChild( el ).disabled = true; + if ( el.querySelectorAll( ":disabled" ).length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Support: IE 11+, Edge 15 - 18+ + // IE 11/Edge don't find elements on a `[name='']` query in some cases. + // Adding a temporary attribute to the document before the selection works + // around the issue. + // Interestingly, IE 10 & older don't seem to have the issue. + input = document.createElement( "input" ); + input.setAttribute( "name", "" ); + el.appendChild( input ); + if ( !el.querySelectorAll( "[name='']" ).length ) { + rbuggyQSA.push( "\\[" + whitespace + "*name" + whitespace + "*=" + + whitespace + "*(?:''|\"\")" ); + } + } ); + + if ( !support.cssHas ) { + + // Support: Chrome 105 - 110+, Safari 15.4 - 16.3+ + // Our regular `try-catch` mechanism fails to detect natively-unsupported + // pseudo-classes inside `:has()` (such as `:has(:contains("Foo"))`) + // in browsers that parse the `:has()` argument as a forgiving selector list. + // https://drafts.csswg.org/selectors/#relational now requires the argument + // to be parsed unforgivingly, but browsers have not yet fully adjusted. + rbuggyQSA.push( ":has" ); + } + + rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join( "|" ) ); + + /* Sorting + ---------------------------------------------------------------------- */ + + // Document order sorting + sortOrder = function( a, b ) { + + // Flag for duplicate removal + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + // Sort on method existence if only one input has compareDocumentPosition + var compare = !a.compareDocumentPosition - !b.compareDocumentPosition; + if ( compare ) { + return compare; + } + + // Calculate position if both inputs belong to the same document + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + compare = ( a.ownerDocument || a ) == ( b.ownerDocument || b ) ? + a.compareDocumentPosition( b ) : + + // Otherwise we know they are disconnected + 1; + + // Disconnected nodes + if ( compare & 1 || + ( !support.sortDetached && b.compareDocumentPosition( a ) === compare ) ) { + + // Choose the first element that is related to our preferred document + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( a === document || a.ownerDocument == preferredDoc && + find.contains( preferredDoc, a ) ) { + return -1; + } + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( b === document || b.ownerDocument == preferredDoc && + find.contains( preferredDoc, b ) ) { + return 1; + } + + // Maintain original order + return sortInput ? + ( indexOf.call( sortInput, a ) - indexOf.call( sortInput, b ) ) : + 0; + } + + return compare & 4 ? -1 : 1; + }; + + return document; +} + +find.matches = function( expr, elements ) { + return find( expr, null, null, elements ); +}; + +find.matchesSelector = function( elem, expr ) { + setDocument( elem ); + + if ( documentIsHTML && + !nonnativeSelectorCache[ expr + " " ] && + ( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) { + + try { + var ret = matches.call( elem, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || support.disconnectedMatch || + + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch ( e ) { + nonnativeSelectorCache( expr, true ); + } + } + + return find( expr, document, null, [ elem ] ).length > 0; +}; + +find.contains = function( context, elem ) { + + // Set document vars if needed + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( ( context.ownerDocument || context ) != document ) { + setDocument( context ); + } + return jQuery.contains( context, elem ); +}; + + +find.attr = function( elem, name ) { + + // Set document vars if needed + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( ( elem.ownerDocument || elem ) != document ) { + setDocument( elem ); + } + + var fn = Expr.attrHandle[ name.toLowerCase() ], + + // Don't get fooled by Object.prototype properties (see trac-13807) + val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ? + fn( elem, name, !documentIsHTML ) : + undefined; + + if ( val !== undefined ) { + return val; + } + + return elem.getAttribute( name ); +}; + +find.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +/** + * Document sorting and removing duplicates + * @param {ArrayLike} results + */ +jQuery.uniqueSort = function( results ) { + var elem, + duplicates = [], + j = 0, + i = 0; + + // Unless we *know* we can detect duplicates, assume their presence + // + // Support: Android <=4.0+ + // Testing for detecting duplicates is unpredictable so instead assume we can't + // depend on duplicate detection in all browsers without a stable sort. + hasDuplicate = !support.sortStable; + sortInput = !support.sortStable && slice.call( results, 0 ); + sort.call( results, sortOrder ); + + if ( hasDuplicate ) { + while ( ( elem = results[ i++ ] ) ) { + if ( elem === results[ i ] ) { + j = duplicates.push( i ); + } + } + while ( j-- ) { + splice.call( results, duplicates[ j ], 1 ); + } + } + + // Clear input after sorting to release objects + // See https://github.com/jquery/sizzle/pull/225 + sortInput = null; + + return results; +}; + +jQuery.fn.uniqueSort = function() { + return this.pushStack( jQuery.uniqueSort( slice.apply( this ) ) ); +}; + +Expr = jQuery.expr = { + + // Can be adjusted by the user + cacheLength: 50, + + createPseudo: markFunction, + + match: matchExpr, + + attrHandle: {}, + + find: {}, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, + + preFilter: { + ATTR: function( match ) { + match[ 1 ] = match[ 1 ].replace( runescape, funescape ); + + // Move the given value to match[3] whether quoted or unquoted + match[ 3 ] = ( match[ 3 ] || match[ 4 ] || match[ 5 ] || "" ) + .replace( runescape, funescape ); + + if ( match[ 2 ] === "~=" ) { + match[ 3 ] = " " + match[ 3 ] + " "; + } + + return match.slice( 0, 4 ); + }, + + CHILD: function( match ) { + + /* matches from matchExpr["CHILD"] + 1 type (only|nth|...) + 2 what (child|of-type) + 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 4 xn-component of xn+y argument ([+-]?\d*n|) + 5 sign of xn-component + 6 x of xn-component + 7 sign of y-component + 8 y of y-component + */ + match[ 1 ] = match[ 1 ].toLowerCase(); + + if ( match[ 1 ].slice( 0, 3 ) === "nth" ) { + + // nth-* requires argument + if ( !match[ 3 ] ) { + find.error( match[ 0 ] ); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[ 4 ] = +( match[ 4 ] ? + match[ 5 ] + ( match[ 6 ] || 1 ) : + 2 * ( match[ 3 ] === "even" || match[ 3 ] === "odd" ) + ); + match[ 5 ] = +( ( match[ 7 ] + match[ 8 ] ) || match[ 3 ] === "odd" ); + + // other types prohibit arguments + } else if ( match[ 3 ] ) { + find.error( match[ 0 ] ); + } + + return match; + }, + + PSEUDO: function( match ) { + var excess, + unquoted = !match[ 6 ] && match[ 2 ]; + + if ( matchExpr.CHILD.test( match[ 0 ] ) ) { + return null; + } + + // Accept quoted arguments as-is + if ( match[ 3 ] ) { + match[ 2 ] = match[ 4 ] || match[ 5 ] || ""; + + // Strip excess characters from unquoted arguments + } else if ( unquoted && rpseudo.test( unquoted ) && + + // Get excess from tokenize (recursively) + ( excess = tokenize( unquoted, true ) ) && + + // advance to the next closing parenthesis + ( excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length ) ) { + + // excess is a negative index + match[ 0 ] = match[ 0 ].slice( 0, excess ); + match[ 2 ] = unquoted.slice( 0, excess ); + } + + // Return only captures needed by the pseudo filter method (type and argument) + return match.slice( 0, 3 ); + } + }, + + filter: { + + TAG: function( nodeNameSelector ) { + var expectedNodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase(); + return nodeNameSelector === "*" ? + function() { + return true; + } : + function( elem ) { + return nodeName( elem, expectedNodeName ); + }; + }, + + CLASS: function( className ) { + var pattern = classCache[ className + " " ]; + + return pattern || + ( pattern = new RegExp( "(^|" + whitespace + ")" + className + + "(" + whitespace + "|$)" ) ) && + classCache( className, function( elem ) { + return pattern.test( + typeof elem.className === "string" && elem.className || + typeof elem.getAttribute !== "undefined" && + elem.getAttribute( "class" ) || + "" + ); + } ); + }, + + ATTR: function( name, operator, check ) { + return function( elem ) { + var result = find.attr( elem, name ); + + if ( result == null ) { + return operator === "!="; + } + if ( !operator ) { + return true; + } + + result += ""; + + if ( operator === "=" ) { + return result === check; + } + if ( operator === "!=" ) { + return result !== check; + } + if ( operator === "^=" ) { + return check && result.indexOf( check ) === 0; + } + if ( operator === "*=" ) { + return check && result.indexOf( check ) > -1; + } + if ( operator === "$=" ) { + return check && result.slice( -check.length ) === check; + } + if ( operator === "~=" ) { + return ( " " + result.replace( rwhitespace, " " ) + " " ) + .indexOf( check ) > -1; + } + if ( operator === "|=" ) { + return result === check || result.slice( 0, check.length + 1 ) === check + "-"; + } + + return false; + }; + }, + + CHILD: function( type, what, _argument, first, last ) { + var simple = type.slice( 0, 3 ) !== "nth", + forward = type.slice( -4 ) !== "last", + ofType = what === "of-type"; + + return first === 1 && last === 0 ? + + // Shortcut for :nth-*(n) + function( elem ) { + return !!elem.parentNode; + } : + + function( elem, _context, xml ) { + var cache, outerCache, node, nodeIndex, start, + dir = simple !== forward ? "nextSibling" : "previousSibling", + parent = elem.parentNode, + name = ofType && elem.nodeName.toLowerCase(), + useCache = !xml && !ofType, + diff = false; + + if ( parent ) { + + // :(first|last|only)-(child|of-type) + if ( simple ) { + while ( dir ) { + node = elem; + while ( ( node = node[ dir ] ) ) { + if ( ofType ? + nodeName( node, name ) : + node.nodeType === 1 ) { + + return false; + } + } + + // Reverse direction for :only-* (if we haven't yet done so) + start = dir = type === "only" && !start && "nextSibling"; + } + return true; + } + + start = [ forward ? parent.firstChild : parent.lastChild ]; + + // non-xml :nth-child(...) stores cache data on `parent` + if ( forward && useCache ) { + + // Seek `elem` from a previously-cached index + outerCache = parent[ expando ] || ( parent[ expando ] = {} ); + cache = outerCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex && cache[ 2 ]; + node = nodeIndex && parent.childNodes[ nodeIndex ]; + + while ( ( node = ++nodeIndex && node && node[ dir ] || + + // Fallback to seeking `elem` from the start + ( diff = nodeIndex = 0 ) || start.pop() ) ) { + + // When found, cache indexes on `parent` and break + if ( node.nodeType === 1 && ++diff && node === elem ) { + outerCache[ type ] = [ dirruns, nodeIndex, diff ]; + break; + } + } + + } else { + + // Use previously-cached element index if available + if ( useCache ) { + outerCache = elem[ expando ] || ( elem[ expando ] = {} ); + cache = outerCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex; + } + + // xml :nth-child(...) + // or :nth-last-child(...) or :nth(-last)?-of-type(...) + if ( diff === false ) { + + // Use the same loop as above to seek `elem` from the start + while ( ( node = ++nodeIndex && node && node[ dir ] || + ( diff = nodeIndex = 0 ) || start.pop() ) ) { + + if ( ( ofType ? + nodeName( node, name ) : + node.nodeType === 1 ) && + ++diff ) { + + // Cache the index of each encountered element + if ( useCache ) { + outerCache = node[ expando ] || + ( node[ expando ] = {} ); + outerCache[ type ] = [ dirruns, diff ]; + } + + if ( node === elem ) { + break; + } + } + } + } + } + + // Incorporate the offset, then check against cycle size + diff -= last; + return diff === first || ( diff % first === 0 && diff / first >= 0 ); + } + }; + }, + + PSEUDO: function( pseudo, argument ) { + + // pseudo-class names are case-insensitive + // https://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + // Remember that setFilters inherits from pseudos + var args, + fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] || + find.error( "unsupported pseudo: " + pseudo ); + + // The user may use createPseudo to indicate that + // arguments are needed to create the filter function + // just as jQuery does + if ( fn[ expando ] ) { + return fn( argument ); + } + + // But maintain support for old signatures + if ( fn.length > 1 ) { + args = [ pseudo, pseudo, "", argument ]; + return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ? + markFunction( function( seed, matches ) { + var idx, + matched = fn( seed, argument ), + i = matched.length; + while ( i-- ) { + idx = indexOf.call( seed, matched[ i ] ); + seed[ idx ] = !( matches[ idx ] = matched[ i ] ); + } + } ) : + function( elem ) { + return fn( elem, 0, args ); + }; + } + + return fn; + } + }, + + pseudos: { + + // Potentially complex pseudos + not: markFunction( function( selector ) { + + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var input = [], + results = [], + matcher = compile( selector.replace( rtrimCSS, "$1" ) ); + + return matcher[ expando ] ? + markFunction( function( seed, matches, _context, xml ) { + var elem, + unmatched = matcher( seed, null, xml, [] ), + i = seed.length; + + // Match elements unmatched by `matcher` + while ( i-- ) { + if ( ( elem = unmatched[ i ] ) ) { + seed[ i ] = !( matches[ i ] = elem ); + } + } + } ) : + function( elem, _context, xml ) { + input[ 0 ] = elem; + matcher( input, null, xml, results ); + + // Don't keep the element + // (see https://github.com/jquery/sizzle/issues/299) + input[ 0 ] = null; + return !results.pop(); + }; + } ), + + has: markFunction( function( selector ) { + return function( elem ) { + return find( selector, elem ).length > 0; + }; + } ), + + contains: markFunction( function( text ) { + text = text.replace( runescape, funescape ); + return function( elem ) { + return ( elem.textContent || jQuery.text( elem ) ).indexOf( text ) > -1; + }; + } ), + + // "Whether an element is represented by a :lang() selector + // is based solely on the element's language value + // being equal to the identifier C, + // or beginning with the identifier C immediately followed by "-". + // The matching of C against the element's language value is performed case-insensitively. + // The identifier C does not have to be a valid language name." + // https://www.w3.org/TR/selectors/#lang-pseudo + lang: markFunction( function( lang ) { + + // lang value must be a valid identifier + if ( !ridentifier.test( lang || "" ) ) { + find.error( "unsupported lang: " + lang ); + } + lang = lang.replace( runescape, funescape ).toLowerCase(); + return function( elem ) { + var elemLang; + do { + if ( ( elemLang = documentIsHTML ? + elem.lang : + elem.getAttribute( "xml:lang" ) || elem.getAttribute( "lang" ) ) ) { + + elemLang = elemLang.toLowerCase(); + return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0; + } + } while ( ( elem = elem.parentNode ) && elem.nodeType === 1 ); + return false; + }; + } ), + + // Miscellaneous + target: function( elem ) { + var hash = window.location && window.location.hash; + return hash && hash.slice( 1 ) === elem.id; + }, + + root: function( elem ) { + return elem === documentElement; + }, + + focus: function( elem ) { + return elem === safeActiveElement() && + document.hasFocus() && + !!( elem.type || elem.href || ~elem.tabIndex ); + }, + + // Boolean properties + enabled: createDisabledPseudo( false ), + disabled: createDisabledPseudo( true ), + + checked: function( elem ) { + + // In CSS3, :checked should return both checked and selected elements + // https://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + return ( nodeName( elem, "input" ) && !!elem.checked ) || + ( nodeName( elem, "option" ) && !!elem.selected ); + }, + + selected: function( elem ) { + + // Support: IE <=11+ + // Accessing the selectedIndex property + // forces the browser to treat the default option as + // selected when in an optgroup. + if ( elem.parentNode ) { + // eslint-disable-next-line no-unused-expressions + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + // Contents + empty: function( elem ) { + + // https://www.w3.org/TR/selectors/#empty-pseudo + // :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5), + // but not by others (comment: 8; processing instruction: 7; etc.) + // nodeType < 6 works because attributes (2) do not appear as children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + if ( elem.nodeType < 6 ) { + return false; + } + } + return true; + }, + + parent: function( elem ) { + return !Expr.pseudos.empty( elem ); + }, + + // Element/input types + header: function( elem ) { + return rheader.test( elem.nodeName ); + }, + + input: function( elem ) { + return rinputs.test( elem.nodeName ); + }, + + button: function( elem ) { + return nodeName( elem, "input" ) && elem.type === "button" || + nodeName( elem, "button" ); + }, + + text: function( elem ) { + var attr; + return nodeName( elem, "input" ) && elem.type === "text" && + + // Support: IE <10 only + // New HTML5 attribute values (e.g., "search") appear + // with elem.type === "text" + ( ( attr = elem.getAttribute( "type" ) ) == null || + attr.toLowerCase() === "text" ); + }, + + // Position-in-collection + first: createPositionalPseudo( function() { + return [ 0 ]; + } ), + + last: createPositionalPseudo( function( _matchIndexes, length ) { + return [ length - 1 ]; + } ), + + eq: createPositionalPseudo( function( _matchIndexes, length, argument ) { + return [ argument < 0 ? argument + length : argument ]; + } ), + + even: createPositionalPseudo( function( matchIndexes, length ) { + var i = 0; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + odd: createPositionalPseudo( function( matchIndexes, length ) { + var i = 1; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + lt: createPositionalPseudo( function( matchIndexes, length, argument ) { + var i; + + if ( argument < 0 ) { + i = argument + length; + } else if ( argument > length ) { + i = length; + } else { + i = argument; + } + + for ( ; --i >= 0; ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ), + + gt: createPositionalPseudo( function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; ++i < length; ) { + matchIndexes.push( i ); + } + return matchIndexes; + } ) + } +}; + +Expr.pseudos.nth = Expr.pseudos.eq; + +// Add button/input type pseudos +for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) { + Expr.pseudos[ i ] = createInputPseudo( i ); +} +for ( i in { submit: true, reset: true } ) { + Expr.pseudos[ i ] = createButtonPseudo( i ); +} + +// Easy API for creating new setFilters +function setFilters() {} +setFilters.prototype = Expr.filters = Expr.pseudos; +Expr.setFilters = new setFilters(); + +function tokenize( selector, parseOnly ) { + var matched, match, tokens, type, + soFar, groups, preFilters, + cached = tokenCache[ selector + " " ]; + + if ( cached ) { + return parseOnly ? 0 : cached.slice( 0 ); + } + + soFar = selector; + groups = []; + preFilters = Expr.preFilter; + + while ( soFar ) { + + // Comma and first run + if ( !matched || ( match = rcomma.exec( soFar ) ) ) { + if ( match ) { + + // Don't consume trailing commas as valid + soFar = soFar.slice( match[ 0 ].length ) || soFar; + } + groups.push( ( tokens = [] ) ); + } + + matched = false; + + // Combinators + if ( ( match = rleadingCombinator.exec( soFar ) ) ) { + matched = match.shift(); + tokens.push( { + value: matched, + + // Cast descendant combinators to space + type: match[ 0 ].replace( rtrimCSS, " " ) + } ); + soFar = soFar.slice( matched.length ); + } + + // Filters + for ( type in Expr.filter ) { + if ( ( match = matchExpr[ type ].exec( soFar ) ) && ( !preFilters[ type ] || + ( match = preFilters[ type ]( match ) ) ) ) { + matched = match.shift(); + tokens.push( { + value: matched, + type: type, + matches: match + } ); + soFar = soFar.slice( matched.length ); + } + } + + if ( !matched ) { + break; + } + } + + // Return the length of the invalid excess + // if we're just parsing + // Otherwise, throw an error or return tokens + if ( parseOnly ) { + return soFar.length; + } + + return soFar ? + find.error( selector ) : + + // Cache the tokens + tokenCache( selector, groups ).slice( 0 ); +} + +function toSelector( tokens ) { + var i = 0, + len = tokens.length, + selector = ""; + for ( ; i < len; i++ ) { + selector += tokens[ i ].value; + } + return selector; +} + +function addCombinator( matcher, combinator, base ) { + var dir = combinator.dir, + skip = combinator.next, + key = skip || dir, + checkNonElements = base && key === "parentNode", + doneName = done++; + + return combinator.first ? + + // Check against closest ancestor/preceding element + function( elem, context, xml ) { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + return matcher( elem, context, xml ); + } + } + return false; + } : + + // Check against all ancestor/preceding elements + function( elem, context, xml ) { + var oldCache, outerCache, + newCache = [ dirruns, doneName ]; + + // We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching + if ( xml ) { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + if ( matcher( elem, context, xml ) ) { + return true; + } + } + } + } else { + while ( ( elem = elem[ dir ] ) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + outerCache = elem[ expando ] || ( elem[ expando ] = {} ); + + if ( skip && nodeName( elem, skip ) ) { + elem = elem[ dir ] || elem; + } else if ( ( oldCache = outerCache[ key ] ) && + oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) { + + // Assign to newCache so results back-propagate to previous elements + return ( newCache[ 2 ] = oldCache[ 2 ] ); + } else { + + // Reuse newcache so results back-propagate to previous elements + outerCache[ key ] = newCache; + + // A match means we're done; a fail means we have to keep checking + if ( ( newCache[ 2 ] = matcher( elem, context, xml ) ) ) { + return true; + } + } + } + } + } + return false; + }; +} + +function elementMatcher( matchers ) { + return matchers.length > 1 ? + function( elem, context, xml ) { + var i = matchers.length; + while ( i-- ) { + if ( !matchers[ i ]( elem, context, xml ) ) { + return false; + } + } + return true; + } : + matchers[ 0 ]; +} + +function multipleContexts( selector, contexts, results ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + find( selector, contexts[ i ], results ); + } + return results; +} + +function condense( unmatched, map, filter, context, xml ) { + var elem, + newUnmatched = [], + i = 0, + len = unmatched.length, + mapped = map != null; + + for ( ; i < len; i++ ) { + if ( ( elem = unmatched[ i ] ) ) { + if ( !filter || filter( elem, context, xml ) ) { + newUnmatched.push( elem ); + if ( mapped ) { + map.push( i ); + } + } + } + } + + return newUnmatched; +} + +function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) { + if ( postFilter && !postFilter[ expando ] ) { + postFilter = setMatcher( postFilter ); + } + if ( postFinder && !postFinder[ expando ] ) { + postFinder = setMatcher( postFinder, postSelector ); + } + return markFunction( function( seed, results, context, xml ) { + var temp, i, elem, matcherOut, + preMap = [], + postMap = [], + preexisting = results.length, + + // Get initial elements from seed or context + elems = seed || + multipleContexts( selector || "*", + context.nodeType ? [ context ] : context, [] ), + + // Prefilter to get matcher input, preserving a map for seed-results synchronization + matcherIn = preFilter && ( seed || !selector ) ? + condense( elems, preMap, preFilter, context, xml ) : + elems; + + if ( matcher ) { + + // If we have a postFinder, or filtered seed, or non-seed postFilter + // or preexisting results, + matcherOut = postFinder || ( seed ? preFilter : preexisting || postFilter ) ? + + // ...intermediate processing is necessary + [] : + + // ...otherwise use results directly + results; + + // Find primary matches + matcher( matcherIn, matcherOut, context, xml ); + } else { + matcherOut = matcherIn; + } + + // Apply postFilter + if ( postFilter ) { + temp = condense( matcherOut, postMap ); + postFilter( temp, [], context, xml ); + + // Un-match failing elements by moving them back to matcherIn + i = temp.length; + while ( i-- ) { + if ( ( elem = temp[ i ] ) ) { + matcherOut[ postMap[ i ] ] = !( matcherIn[ postMap[ i ] ] = elem ); + } + } + } + + if ( seed ) { + if ( postFinder || preFilter ) { + if ( postFinder ) { + + // Get the final matcherOut by condensing this intermediate into postFinder contexts + temp = []; + i = matcherOut.length; + while ( i-- ) { + if ( ( elem = matcherOut[ i ] ) ) { + + // Restore matcherIn since elem is not yet a final match + temp.push( ( matcherIn[ i ] = elem ) ); + } + } + postFinder( null, ( matcherOut = [] ), temp, xml ); + } + + // Move matched elements from seed to results to keep them synchronized + i = matcherOut.length; + while ( i-- ) { + if ( ( elem = matcherOut[ i ] ) && + ( temp = postFinder ? indexOf.call( seed, elem ) : preMap[ i ] ) > -1 ) { + + seed[ temp ] = !( results[ temp ] = elem ); + } + } + } + + // Add elements to results, through postFinder if defined + } else { + matcherOut = condense( + matcherOut === results ? + matcherOut.splice( preexisting, matcherOut.length ) : + matcherOut + ); + if ( postFinder ) { + postFinder( null, results, matcherOut, xml ); + } else { + push.apply( results, matcherOut ); + } + } + } ); +} + +function matcherFromTokens( tokens ) { + var checkContext, matcher, j, + len = tokens.length, + leadingRelative = Expr.relative[ tokens[ 0 ].type ], + implicitRelative = leadingRelative || Expr.relative[ " " ], + i = leadingRelative ? 1 : 0, + + // The foundational matcher ensures that elements are reachable from top-level context(s) + matchContext = addCombinator( function( elem ) { + return elem === checkContext; + }, implicitRelative, true ), + matchAnyContext = addCombinator( function( elem ) { + return indexOf.call( checkContext, elem ) > -1; + }, implicitRelative, true ), + matchers = [ function( elem, context, xml ) { + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + var ret = ( !leadingRelative && ( xml || context != outermostContext ) ) || ( + ( checkContext = context ).nodeType ? + matchContext( elem, context, xml ) : + matchAnyContext( elem, context, xml ) ); + + // Avoid hanging onto element + // (see https://github.com/jquery/sizzle/issues/299) + checkContext = null; + return ret; + } ]; + + for ( ; i < len; i++ ) { + if ( ( matcher = Expr.relative[ tokens[ i ].type ] ) ) { + matchers = [ addCombinator( elementMatcher( matchers ), matcher ) ]; + } else { + matcher = Expr.filter[ tokens[ i ].type ].apply( null, tokens[ i ].matches ); + + // Return special upon seeing a positional matcher + if ( matcher[ expando ] ) { + + // Find the next relative operator (if any) for proper handling + j = ++i; + for ( ; j < len; j++ ) { + if ( Expr.relative[ tokens[ j ].type ] ) { + break; + } + } + return setMatcher( + i > 1 && elementMatcher( matchers ), + i > 1 && toSelector( + + // If the preceding token was a descendant combinator, insert an implicit any-element `*` + tokens.slice( 0, i - 1 ) + .concat( { value: tokens[ i - 2 ].type === " " ? "*" : "" } ) + ).replace( rtrimCSS, "$1" ), + matcher, + i < j && matcherFromTokens( tokens.slice( i, j ) ), + j < len && matcherFromTokens( ( tokens = tokens.slice( j ) ) ), + j < len && toSelector( tokens ) + ); + } + matchers.push( matcher ); + } + } + + return elementMatcher( matchers ); +} + +function matcherFromGroupMatchers( elementMatchers, setMatchers ) { + var bySet = setMatchers.length > 0, + byElement = elementMatchers.length > 0, + superMatcher = function( seed, context, xml, results, outermost ) { + var elem, j, matcher, + matchedCount = 0, + i = "0", + unmatched = seed && [], + setMatched = [], + contextBackup = outermostContext, + + // We must always have either seed elements or outermost context + elems = seed || byElement && Expr.find.TAG( "*", outermost ), + + // Use integer dirruns iff this is the outermost matcher + dirrunsUnique = ( dirruns += contextBackup == null ? 1 : Math.random() || 0.1 ), + len = elems.length; + + if ( outermost ) { + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + outermostContext = context == document || context || outermost; + } + + // Add elements passing elementMatchers directly to results + // Support: iOS <=7 - 9 only + // Tolerate NodeList properties (IE: "length"; Safari: ) matching + // elements by id. (see trac-14142) + for ( ; i !== len && ( elem = elems[ i ] ) != null; i++ ) { + if ( byElement && elem ) { + j = 0; + + // Support: IE 11+, Edge 17 - 18+ + // IE/Edge sometimes throw a "Permission denied" error when strict-comparing + // two documents; shallow comparisons work. + // eslint-disable-next-line eqeqeq + if ( !context && elem.ownerDocument != document ) { + setDocument( elem ); + xml = !documentIsHTML; + } + while ( ( matcher = elementMatchers[ j++ ] ) ) { + if ( matcher( elem, context || document, xml ) ) { + push.call( results, elem ); + break; + } + } + if ( outermost ) { + dirruns = dirrunsUnique; + } + } + + // Track unmatched elements for set filters + if ( bySet ) { + + // They will have gone through all possible matchers + if ( ( elem = !matcher && elem ) ) { + matchedCount--; + } + + // Lengthen the array for every element, matched or not + if ( seed ) { + unmatched.push( elem ); + } + } + } + + // `i` is now the count of elements visited above, and adding it to `matchedCount` + // makes the latter nonnegative. + matchedCount += i; + + // Apply set filters to unmatched elements + // NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount` + // equals `i`), unless we didn't visit _any_ elements in the above loop because we have + // no element matchers and no seed. + // Incrementing an initially-string "0" `i` allows `i` to remain a string only in that + // case, which will result in a "00" `matchedCount` that differs from `i` but is also + // numerically zero. + if ( bySet && i !== matchedCount ) { + j = 0; + while ( ( matcher = setMatchers[ j++ ] ) ) { + matcher( unmatched, setMatched, context, xml ); + } + + if ( seed ) { + + // Reintegrate element matches to eliminate the need for sorting + if ( matchedCount > 0 ) { + while ( i-- ) { + if ( !( unmatched[ i ] || setMatched[ i ] ) ) { + setMatched[ i ] = pop.call( results ); + } + } + } + + // Discard index placeholder values to get only actual matches + setMatched = condense( setMatched ); + } + + // Add matches to results + push.apply( results, setMatched ); + + // Seedless set matches succeeding multiple successful matchers stipulate sorting + if ( outermost && !seed && setMatched.length > 0 && + ( matchedCount + setMatchers.length ) > 1 ) { + + jQuery.uniqueSort( results ); + } + } + + // Override manipulation of globals by nested matchers + if ( outermost ) { + dirruns = dirrunsUnique; + outermostContext = contextBackup; + } + + return unmatched; + }; + + return bySet ? + markFunction( superMatcher ) : + superMatcher; +} + +function compile( selector, match /* Internal Use Only */ ) { + var i, + setMatchers = [], + elementMatchers = [], + cached = compilerCache[ selector + " " ]; + + if ( !cached ) { + + // Generate a function of recursive functions that can be used to check each element + if ( !match ) { + match = tokenize( selector ); + } + i = match.length; + while ( i-- ) { + cached = matcherFromTokens( match[ i ] ); + if ( cached[ expando ] ) { + setMatchers.push( cached ); + } else { + elementMatchers.push( cached ); + } + } + + // Cache the compiled function + cached = compilerCache( selector, + matcherFromGroupMatchers( elementMatchers, setMatchers ) ); + + // Save selector and tokenization + cached.selector = selector; + } + return cached; +} + +/** + * A low-level selection function that works with jQuery's compiled + * selector functions + * @param {String|Function} selector A selector or a pre-compiled + * selector function built with jQuery selector compile + * @param {Element} context + * @param {Array} [results] + * @param {Array} [seed] A set of elements to match against + */ +function select( selector, context, results, seed ) { + var i, tokens, token, type, find, + compiled = typeof selector === "function" && selector, + match = !seed && tokenize( ( selector = compiled.selector || selector ) ); + + results = results || []; + + // Try to minimize operations if there is only one selector in the list and no seed + // (the latter of which guarantees us context) + if ( match.length === 1 ) { + + // Reduce context if the leading compound selector is an ID + tokens = match[ 0 ] = match[ 0 ].slice( 0 ); + if ( tokens.length > 2 && ( token = tokens[ 0 ] ).type === "ID" && + context.nodeType === 9 && documentIsHTML && Expr.relative[ tokens[ 1 ].type ] ) { + + context = ( Expr.find.ID( + token.matches[ 0 ].replace( runescape, funescape ), + context + ) || [] )[ 0 ]; + if ( !context ) { + return results; + + // Precompiled matchers will still verify ancestry, so step up a level + } else if ( compiled ) { + context = context.parentNode; + } + + selector = selector.slice( tokens.shift().value.length ); + } + + // Fetch a seed set for right-to-left matching + i = matchExpr.needsContext.test( selector ) ? 0 : tokens.length; + while ( i-- ) { + token = tokens[ i ]; + + // Abort if we hit a combinator + if ( Expr.relative[ ( type = token.type ) ] ) { + break; + } + if ( ( find = Expr.find[ type ] ) ) { + + // Search, expanding context for leading sibling combinators + if ( ( seed = find( + token.matches[ 0 ].replace( runescape, funescape ), + rsibling.test( tokens[ 0 ].type ) && + testContext( context.parentNode ) || context + ) ) ) { + + // If seed is empty or no tokens remain, we can return early + tokens.splice( i, 1 ); + selector = seed.length && toSelector( tokens ); + if ( !selector ) { + push.apply( results, seed ); + return results; + } + + break; + } + } + } + } + + // Compile and execute a filtering function if one is not provided + // Provide `match` to avoid retokenization if we modified the selector above + ( compiled || compile( selector, match ) )( + seed, + context, + !documentIsHTML, + results, + !context || rsibling.test( selector ) && testContext( context.parentNode ) || context + ); + return results; +} + +// One-time assignments + +// Support: Android <=4.0 - 4.1+ +// Sort stability +support.sortStable = expando.split( "" ).sort( sortOrder ).join( "" ) === expando; + +// Initialize against the default document +setDocument(); + +// Support: Android <=4.0 - 4.1+ +// Detached nodes confoundingly follow *each other* +support.sortDetached = assert( function( el ) { + + // Should return 1, but returns 4 (following) + return el.compareDocumentPosition( document.createElement( "fieldset" ) ) & 1; +} ); + +jQuery.find = find; + +// Deprecated +jQuery.expr[ ":" ] = jQuery.expr.pseudos; +jQuery.unique = jQuery.uniqueSort; + +// These have always been private, but they used to be documented +// as part of Sizzle so let's maintain them in the 3.x line +// for backwards compatibility purposes. +find.compile = compile; +find.select = select; +find.setDocument = setDocument; + +find.escape = jQuery.escapeSelector; +find.getText = jQuery.text; +find.isXML = jQuery.isXMLDoc; +find.selectors = jQuery.expr; +find.support = jQuery.support; +find.uniqueSort = jQuery.uniqueSort; + + /* eslint-enable */ + +} )(); + + +var dir = function( elem, dir, until ) { + var matched = [], + truncate = until !== undefined; + + while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) { + if ( elem.nodeType === 1 ) { + if ( truncate && jQuery( elem ).is( until ) ) { + break; + } + matched.push( elem ); + } + } + return matched; +}; + + +var siblings = function( n, elem ) { + var matched = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + matched.push( n ); + } + } + + return matched; +}; + + +var rneedsContext = jQuery.expr.match.needsContext; + +var rsingleTag = ( /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i ); + + + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, not ) { + if ( isFunction( qualifier ) ) { + return jQuery.grep( elements, function( elem, i ) { + return !!qualifier.call( elem, i, elem ) !== not; + } ); + } + + // Single element + if ( qualifier.nodeType ) { + return jQuery.grep( elements, function( elem ) { + return ( elem === qualifier ) !== not; + } ); + } + + // Arraylike of elements (jQuery, arguments, Array) + if ( typeof qualifier !== "string" ) { + return jQuery.grep( elements, function( elem ) { + return ( indexOf.call( qualifier, elem ) > -1 ) !== not; + } ); + } + + // Filtered directly for both simple and complex selectors + return jQuery.filter( qualifier, elements, not ); +} + +jQuery.filter = function( expr, elems, not ) { + var elem = elems[ 0 ]; + + if ( not ) { + expr = ":not(" + expr + ")"; + } + + if ( elems.length === 1 && elem.nodeType === 1 ) { + return jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : []; + } + + return jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) { + return elem.nodeType === 1; + } ) ); +}; + +jQuery.fn.extend( { + find: function( selector ) { + var i, ret, + len = this.length, + self = this; + + if ( typeof selector !== "string" ) { + return this.pushStack( jQuery( selector ).filter( function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + } ) ); + } + + ret = this.pushStack( [] ); + + for ( i = 0; i < len; i++ ) { + jQuery.find( selector, self[ i ], ret ); + } + + return len > 1 ? jQuery.uniqueSort( ret ) : ret; + }, + filter: function( selector ) { + return this.pushStack( winnow( this, selector || [], false ) ); + }, + not: function( selector ) { + return this.pushStack( winnow( this, selector || [], true ) ); + }, + is: function( selector ) { + return !!winnow( + this, + + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + typeof selector === "string" && rneedsContext.test( selector ) ? + jQuery( selector ) : + selector || [], + false + ).length; + } +} ); + + +// Initialize a jQuery object + + +// A central reference to the root jQuery(document) +var rootjQuery, + + // A simple way to check for HTML strings + // Prioritize #id over to avoid XSS via location.hash (trac-9521) + // Strict HTML recognition (trac-11290: must start with <) + // Shortcut simple #id case for speed + rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/, + + init = jQuery.fn.init = function( selector, context, root ) { + var match, elem; + + // HANDLE: $(""), $(null), $(undefined), $(false) + if ( !selector ) { + return this; + } + + // Method init() accepts an alternate rootjQuery + // so migrate can support jQuery.sub (gh-2101) + root = root || rootjQuery; + + // Handle HTML strings + if ( typeof selector === "string" ) { + if ( selector[ 0 ] === "<" && + selector[ selector.length - 1 ] === ">" && + selector.length >= 3 ) { + + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = rquickExpr.exec( selector ); + } + + // Match html or make sure no context is specified for #id + if ( match && ( match[ 1 ] || !context ) ) { + + // HANDLE: $(html) -> $(array) + if ( match[ 1 ] ) { + context = context instanceof jQuery ? context[ 0 ] : context; + + // Option to run scripts is true for back-compat + // Intentionally let the error be thrown if parseHTML is not present + jQuery.merge( this, jQuery.parseHTML( + match[ 1 ], + context && context.nodeType ? context.ownerDocument || context : document, + true + ) ); + + // HANDLE: $(html, props) + if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) { + for ( match in context ) { + + // Properties of context are called as methods if possible + if ( isFunction( this[ match ] ) ) { + this[ match ]( context[ match ] ); + + // ...and otherwise set as attributes + } else { + this.attr( match, context[ match ] ); + } + } + } + + return this; + + // HANDLE: $(#id) + } else { + elem = document.getElementById( match[ 2 ] ); + + if ( elem ) { + + // Inject the element directly into the jQuery object + this[ 0 ] = elem; + this.length = 1; + } + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || root ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(DOMElement) + } else if ( selector.nodeType ) { + this[ 0 ] = selector; + this.length = 1; + return this; + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( isFunction( selector ) ) { + return root.ready !== undefined ? + root.ready( selector ) : + + // Execute immediately if ready is not present + selector( jQuery ); + } + + return jQuery.makeArray( selector, this ); + }; + +// Give the init function the jQuery prototype for later instantiation +init.prototype = jQuery.fn; + +// Initialize central reference +rootjQuery = jQuery( document ); + + +var rparentsprev = /^(?:parents|prev(?:Until|All))/, + + // Methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend( { + has: function( target ) { + var targets = jQuery( target, this ), + l = targets.length; + + return this.filter( function() { + var i = 0; + for ( ; i < l; i++ ) { + if ( jQuery.contains( this, targets[ i ] ) ) { + return true; + } + } + } ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + matched = [], + targets = typeof selectors !== "string" && jQuery( selectors ); + + // Positional selectors never match, since there's no _selection_ context + if ( !rneedsContext.test( selectors ) ) { + for ( ; i < l; i++ ) { + for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) { + + // Always skip document fragments + if ( cur.nodeType < 11 && ( targets ? + targets.index( cur ) > -1 : + + // Don't pass non-elements to jQuery#find + cur.nodeType === 1 && + jQuery.find.matchesSelector( cur, selectors ) ) ) { + + matched.push( cur ); + break; + } + } + } + } + + return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched ); + }, + + // Determine the position of an element within the set + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1; + } + + // Index in selector + if ( typeof elem === "string" ) { + return indexOf.call( jQuery( elem ), this[ 0 ] ); + } + + // Locate the position of the desired element + return indexOf.call( this, + + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[ 0 ] : elem + ); + }, + + add: function( selector, context ) { + return this.pushStack( + jQuery.uniqueSort( + jQuery.merge( this.get(), jQuery( selector, context ) ) + ) + ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + } +} ); + +function sibling( cur, dir ) { + while ( ( cur = cur[ dir ] ) && cur.nodeType !== 1 ) {} + return cur; +} + +jQuery.each( { + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, _i, until ) { + return dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return sibling( elem, "nextSibling" ); + }, + prev: function( elem ) { + return sibling( elem, "previousSibling" ); + }, + nextAll: function( elem ) { + return dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, _i, until ) { + return dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, _i, until ) { + return dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return siblings( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + return siblings( elem.firstChild ); + }, + contents: function( elem ) { + if ( elem.contentDocument != null && + + // Support: IE 11+ + // elements with no `data` attribute has an object + // `contentDocument` with a `null` prototype. + getProto( elem.contentDocument ) ) { + + return elem.contentDocument; + } + + // Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only + // Treat the template element as a regular one in browsers that + // don't support it. + if ( nodeName( elem, "template" ) ) { + elem = elem.content || elem; + } + + return jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var matched = jQuery.map( this, fn, until ); + + if ( name.slice( -5 ) !== "Until" ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + matched = jQuery.filter( selector, matched ); + } + + if ( this.length > 1 ) { + + // Remove duplicates + if ( !guaranteedUnique[ name ] ) { + jQuery.uniqueSort( matched ); + } + + // Reverse order for parents* and prev-derivatives + if ( rparentsprev.test( name ) ) { + matched.reverse(); + } + } + + return this.pushStack( matched ); + }; +} ); +var rnothtmlwhite = ( /[^\x20\t\r\n\f]+/g ); + + + +// Convert String-formatted options into Object-formatted ones +function createOptions( options ) { + var object = {}; + jQuery.each( options.match( rnothtmlwhite ) || [], function( _, flag ) { + object[ flag ] = true; + } ); + return object; +} + +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + createOptions( options ) : + jQuery.extend( {}, options ); + + var // Flag to know if list is currently firing + firing, + + // Last fire value for non-forgettable lists + memory, + + // Flag to know if list was already fired + fired, + + // Flag to prevent firing + locked, + + // Actual callback list + list = [], + + // Queue of execution data for repeatable lists + queue = [], + + // Index of currently firing callback (modified by add/remove as needed) + firingIndex = -1, + + // Fire callbacks + fire = function() { + + // Enforce single-firing + locked = locked || options.once; + + // Execute callbacks for all pending executions, + // respecting firingIndex overrides and runtime changes + fired = firing = true; + for ( ; queue.length; firingIndex = -1 ) { + memory = queue.shift(); + while ( ++firingIndex < list.length ) { + + // Run callback and check for early termination + if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false && + options.stopOnFalse ) { + + // Jump to end and forget the data so .add doesn't re-fire + firingIndex = list.length; + memory = false; + } + } + } + + // Forget the data if we're done with it + if ( !options.memory ) { + memory = false; + } + + firing = false; + + // Clean up if we're done firing for good + if ( locked ) { + + // Keep an empty list if we have data for future add calls + if ( memory ) { + list = []; + + // Otherwise, this object is spent + } else { + list = ""; + } + } + }, + + // Actual Callbacks object + self = { + + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + + // If we have memory from a past run, we should fire after adding + if ( memory && !firing ) { + firingIndex = list.length - 1; + queue.push( memory ); + } + + ( function add( args ) { + jQuery.each( args, function( _, arg ) { + if ( isFunction( arg ) ) { + if ( !options.unique || !self.has( arg ) ) { + list.push( arg ); + } + } else if ( arg && arg.length && toType( arg ) !== "string" ) { + + // Inspect recursively + add( arg ); + } + } ); + } )( arguments ); + + if ( memory && !firing ) { + fire(); + } + } + return this; + }, + + // Remove a callback from the list + remove: function() { + jQuery.each( arguments, function( _, arg ) { + var index; + while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + + // Handle firing indexes + if ( index <= firingIndex ) { + firingIndex--; + } + } + } ); + return this; + }, + + // Check if a given callback is in the list. + // If no argument is given, return whether or not list has callbacks attached. + has: function( fn ) { + return fn ? + jQuery.inArray( fn, list ) > -1 : + list.length > 0; + }, + + // Remove all callbacks from the list + empty: function() { + if ( list ) { + list = []; + } + return this; + }, + + // Disable .fire and .add + // Abort any current/pending executions + // Clear all callbacks and values + disable: function() { + locked = queue = []; + list = memory = ""; + return this; + }, + disabled: function() { + return !list; + }, + + // Disable .fire + // Also disable .add unless we have memory (since it would have no effect) + // Abort any pending executions + lock: function() { + locked = queue = []; + if ( !memory && !firing ) { + list = memory = ""; + } + return this; + }, + locked: function() { + return !!locked; + }, + + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + if ( !locked ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + queue.push( args ); + if ( !firing ) { + fire(); + } + } + return this; + }, + + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; + } + }; + + return self; +}; + + +function Identity( v ) { + return v; +} +function Thrower( ex ) { + throw ex; +} + +function adoptValue( value, resolve, reject, noValue ) { + var method; + + try { + + // Check for promise aspect first to privilege synchronous behavior + if ( value && isFunction( ( method = value.promise ) ) ) { + method.call( value ).done( resolve ).fail( reject ); + + // Other thenables + } else if ( value && isFunction( ( method = value.then ) ) ) { + method.call( value, resolve, reject ); + + // Other non-thenables + } else { + + // Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer: + // * false: [ value ].slice( 0 ) => resolve( value ) + // * true: [ value ].slice( 1 ) => resolve() + resolve.apply( undefined, [ value ].slice( noValue ) ); + } + + // For Promises/A+, convert exceptions into rejections + // Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in + // Deferred#then to conditionally suppress rejection. + } catch ( value ) { + + // Support: Android 4.0 only + // Strict mode functions invoked without .call/.apply get global-object context + reject.apply( undefined, [ value ] ); + } +} + +jQuery.extend( { + + Deferred: function( func ) { + var tuples = [ + + // action, add listener, callbacks, + // ... .then handlers, argument index, [final state] + [ "notify", "progress", jQuery.Callbacks( "memory" ), + jQuery.Callbacks( "memory" ), 2 ], + [ "resolve", "done", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 0, "resolved" ], + [ "reject", "fail", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 1, "rejected" ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + "catch": function( fn ) { + return promise.then( null, fn ); + }, + + // Keep pipe for back-compat + pipe: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + + return jQuery.Deferred( function( newDefer ) { + jQuery.each( tuples, function( _i, tuple ) { + + // Map tuples (progress, done, fail) to arguments (done, fail, progress) + var fn = isFunction( fns[ tuple[ 4 ] ] ) && fns[ tuple[ 4 ] ]; + + // deferred.progress(function() { bind to newDefer or newDefer.notify }) + // deferred.done(function() { bind to newDefer or newDefer.resolve }) + // deferred.fail(function() { bind to newDefer or newDefer.reject }) + deferred[ tuple[ 1 ] ]( function() { + var returned = fn && fn.apply( this, arguments ); + if ( returned && isFunction( returned.promise ) ) { + returned.promise() + .progress( newDefer.notify ) + .done( newDefer.resolve ) + .fail( newDefer.reject ); + } else { + newDefer[ tuple[ 0 ] + "With" ]( + this, + fn ? [ returned ] : arguments + ); + } + } ); + } ); + fns = null; + } ).promise(); + }, + then: function( onFulfilled, onRejected, onProgress ) { + var maxDepth = 0; + function resolve( depth, deferred, handler, special ) { + return function() { + var that = this, + args = arguments, + mightThrow = function() { + var returned, then; + + // Support: Promises/A+ section 2.3.3.3.3 + // https://promisesaplus.com/#point-59 + // Ignore double-resolution attempts + if ( depth < maxDepth ) { + return; + } + + returned = handler.apply( that, args ); + + // Support: Promises/A+ section 2.3.1 + // https://promisesaplus.com/#point-48 + if ( returned === deferred.promise() ) { + throw new TypeError( "Thenable self-resolution" ); + } + + // Support: Promises/A+ sections 2.3.3.1, 3.5 + // https://promisesaplus.com/#point-54 + // https://promisesaplus.com/#point-75 + // Retrieve `then` only once + then = returned && + + // Support: Promises/A+ section 2.3.4 + // https://promisesaplus.com/#point-64 + // Only check objects and functions for thenability + ( typeof returned === "object" || + typeof returned === "function" ) && + returned.then; + + // Handle a returned thenable + if ( isFunction( then ) ) { + + // Special processors (notify) just wait for resolution + if ( special ) { + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ) + ); + + // Normal processors (resolve) also hook into progress + } else { + + // ...and disregard older resolution values + maxDepth++; + + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ), + resolve( maxDepth, deferred, Identity, + deferred.notifyWith ) + ); + } + + // Handle all other returned values + } else { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Identity ) { + that = undefined; + args = [ returned ]; + } + + // Process the value(s) + // Default process is resolve + ( special || deferred.resolveWith )( that, args ); + } + }, + + // Only normal processors (resolve) catch and reject exceptions + process = special ? + mightThrow : + function() { + try { + mightThrow(); + } catch ( e ) { + + if ( jQuery.Deferred.exceptionHook ) { + jQuery.Deferred.exceptionHook( e, + process.error ); + } + + // Support: Promises/A+ section 2.3.3.3.4.1 + // https://promisesaplus.com/#point-61 + // Ignore post-resolution exceptions + if ( depth + 1 >= maxDepth ) { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Thrower ) { + that = undefined; + args = [ e ]; + } + + deferred.rejectWith( that, args ); + } + } + }; + + // Support: Promises/A+ section 2.3.3.3.1 + // https://promisesaplus.com/#point-57 + // Re-resolve promises immediately to dodge false rejection from + // subsequent errors + if ( depth ) { + process(); + } else { + + // Call an optional hook to record the error, in case of exception + // since it's otherwise lost when execution goes async + if ( jQuery.Deferred.getErrorHook ) { + process.error = jQuery.Deferred.getErrorHook(); + + // The deprecated alias of the above. While the name suggests + // returning the stack, not an error instance, jQuery just passes + // it directly to `console.warn` so both will work; an instance + // just better cooperates with source maps. + } else if ( jQuery.Deferred.getStackHook ) { + process.error = jQuery.Deferred.getStackHook(); + } + window.setTimeout( process ); + } + }; + } + + return jQuery.Deferred( function( newDefer ) { + + // progress_handlers.add( ... ) + tuples[ 0 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onProgress ) ? + onProgress : + Identity, + newDefer.notifyWith + ) + ); + + // fulfilled_handlers.add( ... ) + tuples[ 1 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onFulfilled ) ? + onFulfilled : + Identity + ) + ); + + // rejected_handlers.add( ... ) + tuples[ 2 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onRejected ) ? + onRejected : + Thrower + ) + ); + } ).promise(); + }, + + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return obj != null ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 5 ]; + + // promise.progress = list.add + // promise.done = list.add + // promise.fail = list.add + promise[ tuple[ 1 ] ] = list.add; + + // Handle state + if ( stateString ) { + list.add( + function() { + + // state = "resolved" (i.e., fulfilled) + // state = "rejected" + state = stateString; + }, + + // rejected_callbacks.disable + // fulfilled_callbacks.disable + tuples[ 3 - i ][ 2 ].disable, + + // rejected_handlers.disable + // fulfilled_handlers.disable + tuples[ 3 - i ][ 3 ].disable, + + // progress_callbacks.lock + tuples[ 0 ][ 2 ].lock, + + // progress_handlers.lock + tuples[ 0 ][ 3 ].lock + ); + } + + // progress_handlers.fire + // fulfilled_handlers.fire + // rejected_handlers.fire + list.add( tuple[ 3 ].fire ); + + // deferred.notify = function() { deferred.notifyWith(...) } + // deferred.resolve = function() { deferred.resolveWith(...) } + // deferred.reject = function() { deferred.rejectWith(...) } + deferred[ tuple[ 0 ] ] = function() { + deferred[ tuple[ 0 ] + "With" ]( this === deferred ? undefined : this, arguments ); + return this; + }; + + // deferred.notifyWith = list.fireWith + // deferred.resolveWith = list.fireWith + // deferred.rejectWith = list.fireWith + deferred[ tuple[ 0 ] + "With" ] = list.fireWith; + } ); + + // Make the deferred a promise + promise.promise( deferred ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( singleValue ) { + var + + // count of uncompleted subordinates + remaining = arguments.length, + + // count of unprocessed arguments + i = remaining, + + // subordinate fulfillment data + resolveContexts = Array( i ), + resolveValues = slice.call( arguments ), + + // the primary Deferred + primary = jQuery.Deferred(), + + // subordinate callback factory + updateFunc = function( i ) { + return function( value ) { + resolveContexts[ i ] = this; + resolveValues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value; + if ( !( --remaining ) ) { + primary.resolveWith( resolveContexts, resolveValues ); + } + }; + }; + + // Single- and empty arguments are adopted like Promise.resolve + if ( remaining <= 1 ) { + adoptValue( singleValue, primary.done( updateFunc( i ) ).resolve, primary.reject, + !remaining ); + + // Use .then() to unwrap secondary thenables (cf. gh-3000) + if ( primary.state() === "pending" || + isFunction( resolveValues[ i ] && resolveValues[ i ].then ) ) { + + return primary.then(); + } + } + + // Multiple arguments are aggregated like Promise.all array elements + while ( i-- ) { + adoptValue( resolveValues[ i ], updateFunc( i ), primary.reject ); + } + + return primary.promise(); + } +} ); + + +// These usually indicate a programmer mistake during development, +// warn about them ASAP rather than swallowing them by default. +var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/; + +// If `jQuery.Deferred.getErrorHook` is defined, `asyncError` is an error +// captured before the async barrier to get the original error cause +// which may otherwise be hidden. +jQuery.Deferred.exceptionHook = function( error, asyncError ) { + + // Support: IE 8 - 9 only + // Console exists when dev tools are open, which can happen at any time + if ( window.console && window.console.warn && error && rerrorNames.test( error.name ) ) { + window.console.warn( "jQuery.Deferred exception: " + error.message, + error.stack, asyncError ); + } +}; + + + + +jQuery.readyException = function( error ) { + window.setTimeout( function() { + throw error; + } ); +}; + + + + +// The deferred used on DOM ready +var readyList = jQuery.Deferred(); + +jQuery.fn.ready = function( fn ) { + + readyList + .then( fn ) + + // Wrap jQuery.readyException in a function so that the lookup + // happens at the time of error handling instead of callback + // registration. + .catch( function( error ) { + jQuery.readyException( error ); + } ); + + return this; +}; + +jQuery.extend( { + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See trac-6781 + readyWait: 1, + + // Handle when the DOM is ready + ready: function( wait ) { + + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { + return; + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + } +} ); + +jQuery.ready.then = readyList.then; + +// The ready event handler and self cleanup method +function completed() { + document.removeEventListener( "DOMContentLoaded", completed ); + window.removeEventListener( "load", completed ); + jQuery.ready(); +} + +// Catch cases where $(document).ready() is called +// after the browser event has already occurred. +// Support: IE <=9 - 10 only +// Older IE sometimes signals "interactive" too soon +if ( document.readyState === "complete" || + ( document.readyState !== "loading" && !document.documentElement.doScroll ) ) { + + // Handle it asynchronously to allow scripts the opportunity to delay ready + window.setTimeout( jQuery.ready ); + +} else { + + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", completed ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", completed ); +} + + + + +// Multifunctional method to get and set values of a collection +// The value/s can optionally be executed if it's a function +var access = function( elems, fn, key, value, chainable, emptyGet, raw ) { + var i = 0, + len = elems.length, + bulk = key == null; + + // Sets many values + if ( toType( key ) === "object" ) { + chainable = true; + for ( i in key ) { + access( elems, fn, i, key[ i ], true, emptyGet, raw ); + } + + // Sets one value + } else if ( value !== undefined ) { + chainable = true; + + if ( !isFunction( value ) ) { + raw = true; + } + + if ( bulk ) { + + // Bulk operations run against the entire set + if ( raw ) { + fn.call( elems, value ); + fn = null; + + // ...except when executing function values + } else { + bulk = fn; + fn = function( elem, _key, value ) { + return bulk.call( jQuery( elem ), value ); + }; + } + } + + if ( fn ) { + for ( ; i < len; i++ ) { + fn( + elems[ i ], key, raw ? + value : + value.call( elems[ i ], i, fn( elems[ i ], key ) ) + ); + } + } + } + + if ( chainable ) { + return elems; + } + + // Gets + if ( bulk ) { + return fn.call( elems ); + } + + return len ? fn( elems[ 0 ], key ) : emptyGet; +}; + + +// Matches dashed string for camelizing +var rmsPrefix = /^-ms-/, + rdashAlpha = /-([a-z])/g; + +// Used by camelCase as callback to replace() +function fcamelCase( _all, letter ) { + return letter.toUpperCase(); +} + +// Convert dashed to camelCase; used by the css and data modules +// Support: IE <=9 - 11, Edge 12 - 15 +// Microsoft forgot to hump their vendor prefix (trac-9572) +function camelCase( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); +} +var acceptData = function( owner ) { + + // Accepts only: + // - Node + // - Node.ELEMENT_NODE + // - Node.DOCUMENT_NODE + // - Object + // - Any + return owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType ); +}; + + + + +function Data() { + this.expando = jQuery.expando + Data.uid++; +} + +Data.uid = 1; + +Data.prototype = { + + cache: function( owner ) { + + // Check if the owner object already has a cache + var value = owner[ this.expando ]; + + // If not, create one + if ( !value ) { + value = {}; + + // We can accept data for non-element nodes in modern browsers, + // but we should not, see trac-8335. + // Always return an empty object. + if ( acceptData( owner ) ) { + + // If it is a node unlikely to be stringify-ed or looped over + // use plain assignment + if ( owner.nodeType ) { + owner[ this.expando ] = value; + + // Otherwise secure it in a non-enumerable property + // configurable must be true to allow the property to be + // deleted when data is removed + } else { + Object.defineProperty( owner, this.expando, { + value: value, + configurable: true + } ); + } + } + } + + return value; + }, + set: function( owner, data, value ) { + var prop, + cache = this.cache( owner ); + + // Handle: [ owner, key, value ] args + // Always use camelCase key (gh-2257) + if ( typeof data === "string" ) { + cache[ camelCase( data ) ] = value; + + // Handle: [ owner, { properties } ] args + } else { + + // Copy the properties one-by-one to the cache object + for ( prop in data ) { + cache[ camelCase( prop ) ] = data[ prop ]; + } + } + return cache; + }, + get: function( owner, key ) { + return key === undefined ? + this.cache( owner ) : + + // Always use camelCase key (gh-2257) + owner[ this.expando ] && owner[ this.expando ][ camelCase( key ) ]; + }, + access: function( owner, key, value ) { + + // In cases where either: + // + // 1. No key was specified + // 2. A string key was specified, but no value provided + // + // Take the "read" path and allow the get method to determine + // which value to return, respectively either: + // + // 1. The entire cache object + // 2. The data stored at the key + // + if ( key === undefined || + ( ( key && typeof key === "string" ) && value === undefined ) ) { + + return this.get( owner, key ); + } + + // When the key is not a string, or both a key and value + // are specified, set or extend (existing objects) with either: + // + // 1. An object of properties + // 2. A key and value + // + this.set( owner, key, value ); + + // Since the "set" path can have two possible entry points + // return the expected data based on which path was taken[*] + return value !== undefined ? value : key; + }, + remove: function( owner, key ) { + var i, + cache = owner[ this.expando ]; + + if ( cache === undefined ) { + return; + } + + if ( key !== undefined ) { + + // Support array or space separated string of keys + if ( Array.isArray( key ) ) { + + // If key is an array of keys... + // We always set camelCase keys, so remove that. + key = key.map( camelCase ); + } else { + key = camelCase( key ); + + // If a key with the spaces exists, use it. + // Otherwise, create an array by matching non-whitespace + key = key in cache ? + [ key ] : + ( key.match( rnothtmlwhite ) || [] ); + } + + i = key.length; + + while ( i-- ) { + delete cache[ key[ i ] ]; + } + } + + // Remove the expando if there's no more data + if ( key === undefined || jQuery.isEmptyObject( cache ) ) { + + // Support: Chrome <=35 - 45 + // Webkit & Blink performance suffers when deleting properties + // from DOM nodes, so set to undefined instead + // https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted) + if ( owner.nodeType ) { + owner[ this.expando ] = undefined; + } else { + delete owner[ this.expando ]; + } + } + }, + hasData: function( owner ) { + var cache = owner[ this.expando ]; + return cache !== undefined && !jQuery.isEmptyObject( cache ); + } +}; +var dataPriv = new Data(); + +var dataUser = new Data(); + + + +// Implementation Summary +// +// 1. Enforce API surface and semantic compatibility with 1.9.x branch +// 2. Improve the module's maintainability by reducing the storage +// paths to a single mechanism. +// 3. Use the same single mechanism to support "private" and "user" data. +// 4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData) +// 5. Avoid exposing implementation details on user objects (eg. expando properties) +// 6. Provide a clear path for implementation upgrade to WeakMap in 2014 + +var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/, + rmultiDash = /[A-Z]/g; + +function getData( data ) { + if ( data === "true" ) { + return true; + } + + if ( data === "false" ) { + return false; + } + + if ( data === "null" ) { + return null; + } + + // Only convert to a number if it doesn't change the string + if ( data === +data + "" ) { + return +data; + } + + if ( rbrace.test( data ) ) { + return JSON.parse( data ); + } + + return data; +} + +function dataAttr( elem, key, data ) { + var name; + + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + name = "data-" + key.replace( rmultiDash, "-$&" ).toLowerCase(); + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = getData( data ); + } catch ( e ) {} + + // Make sure we set the data so it isn't changed later + dataUser.set( elem, key, data ); + } else { + data = undefined; + } + } + return data; +} + +jQuery.extend( { + hasData: function( elem ) { + return dataUser.hasData( elem ) || dataPriv.hasData( elem ); + }, + + data: function( elem, name, data ) { + return dataUser.access( elem, name, data ); + }, + + removeData: function( elem, name ) { + dataUser.remove( elem, name ); + }, + + // TODO: Now that all calls to _data and _removeData have been replaced + // with direct calls to dataPriv methods, these can be deprecated. + _data: function( elem, name, data ) { + return dataPriv.access( elem, name, data ); + }, + + _removeData: function( elem, name ) { + dataPriv.remove( elem, name ); + } +} ); + +jQuery.fn.extend( { + data: function( key, value ) { + var i, name, data, + elem = this[ 0 ], + attrs = elem && elem.attributes; + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = dataUser.get( elem ); + + if ( elem.nodeType === 1 && !dataPriv.get( elem, "hasDataAttrs" ) ) { + i = attrs.length; + while ( i-- ) { + + // Support: IE 11 only + // The attrs elements can be null (trac-14894) + if ( attrs[ i ] ) { + name = attrs[ i ].name; + if ( name.indexOf( "data-" ) === 0 ) { + name = camelCase( name.slice( 5 ) ); + dataAttr( elem, name, data[ name ] ); + } + } + } + dataPriv.set( elem, "hasDataAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each( function() { + dataUser.set( this, key ); + } ); + } + + return access( this, function( value ) { + var data; + + // The calling jQuery object (element matches) is not empty + // (and therefore has an element appears at this[ 0 ]) and the + // `value` parameter was not undefined. An empty jQuery object + // will result in `undefined` for elem = this[ 0 ] which will + // throw an exception if an attempt to read a data cache is made. + if ( elem && value === undefined ) { + + // Attempt to get data from the cache + // The key will always be camelCased in Data + data = dataUser.get( elem, key ); + if ( data !== undefined ) { + return data; + } + + // Attempt to "discover" the data in + // HTML5 custom data-* attrs + data = dataAttr( elem, key ); + if ( data !== undefined ) { + return data; + } + + // We tried really hard, but the data doesn't exist. + return; + } + + // Set the data... + this.each( function() { + + // We always store the camelCased key + dataUser.set( this, key, value ); + } ); + }, null, value, arguments.length > 1, null, true ); + }, + + removeData: function( key ) { + return this.each( function() { + dataUser.remove( this, key ); + } ); + } +} ); + + +jQuery.extend( { + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = dataPriv.get( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || Array.isArray( data ) ) { + queue = dataPriv.access( elem, type, jQuery.makeArray( data ) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + startLength = queue.length, + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + startLength--; + } + + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // Clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + + if ( !startLength && hooks ) { + hooks.empty.fire(); + } + }, + + // Not public - generate a queueHooks object, or return the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return dataPriv.get( elem, key ) || dataPriv.access( elem, key, { + empty: jQuery.Callbacks( "once memory" ).add( function() { + dataPriv.remove( elem, [ type + "queue", key ] ); + } ) + } ); + } +} ); + +jQuery.fn.extend( { + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[ 0 ], type ); + } + + return data === undefined ? + this : + this.each( function() { + var queue = jQuery.queue( this, type, data ); + + // Ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[ 0 ] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + } ); + }, + dequeue: function( type ) { + return this.each( function() { + jQuery.dequeue( this, type ); + } ); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while ( i-- ) { + tmp = dataPriv.get( elements[ i ], type + "queueHooks" ); + if ( tmp && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +} ); +var pnum = ( /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/ ).source; + +var rcssNum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" ); + + +var cssExpand = [ "Top", "Right", "Bottom", "Left" ]; + +var documentElement = document.documentElement; + + + + var isAttached = function( elem ) { + return jQuery.contains( elem.ownerDocument, elem ); + }, + composed = { composed: true }; + + // Support: IE 9 - 11+, Edge 12 - 18+, iOS 10.0 - 10.2 only + // Check attachment across shadow DOM boundaries when possible (gh-3504) + // Support: iOS 10.0-10.2 only + // Early iOS 10 versions support `attachShadow` but not `getRootNode`, + // leading to errors. We need to check for `getRootNode`. + if ( documentElement.getRootNode ) { + isAttached = function( elem ) { + return jQuery.contains( elem.ownerDocument, elem ) || + elem.getRootNode( composed ) === elem.ownerDocument; + }; + } +var isHiddenWithinTree = function( elem, el ) { + + // isHiddenWithinTree might be called from jQuery#filter function; + // in that case, element will be second argument + elem = el || elem; + + // Inline style trumps all + return elem.style.display === "none" || + elem.style.display === "" && + + // Otherwise, check computed style + // Support: Firefox <=43 - 45 + // Disconnected elements can have computed display: none, so first confirm that elem is + // in the document. + isAttached( elem ) && + + jQuery.css( elem, "display" ) === "none"; + }; + + + +function adjustCSS( elem, prop, valueParts, tween ) { + var adjusted, scale, + maxIterations = 20, + currentValue = tween ? + function() { + return tween.cur(); + } : + function() { + return jQuery.css( elem, prop, "" ); + }, + initial = currentValue(), + unit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ), + + // Starting value computation is required for potential unit mismatches + initialInUnit = elem.nodeType && + ( jQuery.cssNumber[ prop ] || unit !== "px" && +initial ) && + rcssNum.exec( jQuery.css( elem, prop ) ); + + if ( initialInUnit && initialInUnit[ 3 ] !== unit ) { + + // Support: Firefox <=54 + // Halve the iteration target value to prevent interference from CSS upper bounds (gh-2144) + initial = initial / 2; + + // Trust units reported by jQuery.css + unit = unit || initialInUnit[ 3 ]; + + // Iteratively approximate from a nonzero starting point + initialInUnit = +initial || 1; + + while ( maxIterations-- ) { + + // Evaluate and update our best guess (doubling guesses that zero out). + // Finish if the scale equals or crosses 1 (making the old*new product non-positive). + jQuery.style( elem, prop, initialInUnit + unit ); + if ( ( 1 - scale ) * ( 1 - ( scale = currentValue() / initial || 0.5 ) ) <= 0 ) { + maxIterations = 0; + } + initialInUnit = initialInUnit / scale; + + } + + initialInUnit = initialInUnit * 2; + jQuery.style( elem, prop, initialInUnit + unit ); + + // Make sure we update the tween properties later on + valueParts = valueParts || []; + } + + if ( valueParts ) { + initialInUnit = +initialInUnit || +initial || 0; + + // Apply relative offset (+=/-=) if specified + adjusted = valueParts[ 1 ] ? + initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] : + +valueParts[ 2 ]; + if ( tween ) { + tween.unit = unit; + tween.start = initialInUnit; + tween.end = adjusted; + } + } + return adjusted; +} + + +var defaultDisplayMap = {}; + +function getDefaultDisplay( elem ) { + var temp, + doc = elem.ownerDocument, + nodeName = elem.nodeName, + display = defaultDisplayMap[ nodeName ]; + + if ( display ) { + return display; + } + + temp = doc.body.appendChild( doc.createElement( nodeName ) ); + display = jQuery.css( temp, "display" ); + + temp.parentNode.removeChild( temp ); + + if ( display === "none" ) { + display = "block"; + } + defaultDisplayMap[ nodeName ] = display; + + return display; +} + +function showHide( elements, show ) { + var display, elem, + values = [], + index = 0, + length = elements.length; + + // Determine new display value for elements that need to change + for ( ; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + + display = elem.style.display; + if ( show ) { + + // Since we force visibility upon cascade-hidden elements, an immediate (and slow) + // check is required in this first loop unless we have a nonempty display value (either + // inline or about-to-be-restored) + if ( display === "none" ) { + values[ index ] = dataPriv.get( elem, "display" ) || null; + if ( !values[ index ] ) { + elem.style.display = ""; + } + } + if ( elem.style.display === "" && isHiddenWithinTree( elem ) ) { + values[ index ] = getDefaultDisplay( elem ); + } + } else { + if ( display !== "none" ) { + values[ index ] = "none"; + + // Remember what we're overwriting + dataPriv.set( elem, "display", display ); + } + } + } + + // Set the display of the elements in a second loop to avoid constant reflow + for ( index = 0; index < length; index++ ) { + if ( values[ index ] != null ) { + elements[ index ].style.display = values[ index ]; + } + } + + return elements; +} + +jQuery.fn.extend( { + show: function() { + return showHide( this, true ); + }, + hide: function() { + return showHide( this ); + }, + toggle: function( state ) { + if ( typeof state === "boolean" ) { + return state ? this.show() : this.hide(); + } + + return this.each( function() { + if ( isHiddenWithinTree( this ) ) { + jQuery( this ).show(); + } else { + jQuery( this ).hide(); + } + } ); + } +} ); +var rcheckableType = ( /^(?:checkbox|radio)$/i ); + +var rtagName = ( /<([a-z][^\/\0>\x20\t\r\n\f]*)/i ); + +var rscriptType = ( /^$|^module$|\/(?:java|ecma)script/i ); + + + +( function() { + var fragment = document.createDocumentFragment(), + div = fragment.appendChild( document.createElement( "div" ) ), + input = document.createElement( "input" ); + + // Support: Android 4.0 - 4.3 only + // Check state lost if the name is set (trac-11217) + // Support: Windows Web Apps (WWA) + // `name` and `type` must use .setAttribute for WWA (trac-14901) + input.setAttribute( "type", "radio" ); + input.setAttribute( "checked", "checked" ); + input.setAttribute( "name", "t" ); + + div.appendChild( input ); + + // Support: Android <=4.1 only + // Older WebKit doesn't clone checked state correctly in fragments + support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Support: IE <=11 only + // Make sure textarea (and checkbox) defaultValue is properly cloned + div.innerHTML = ""; + support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue; + + // Support: IE <=9 only + // IE <=9 replaces "; + support.option = !!div.lastChild; +} )(); + + +// We have to close these tags to support XHTML (trac-13200) +var wrapMap = { + + // XHTML parsers do not magically insert elements in the + // same way that tag soup parsers do. So we cannot shorten + // this by omitting or other required elements. + thead: [ 1, "", "
" ], + col: [ 2, "", "
" ], + tr: [ 2, "", "
" ], + td: [ 3, "", "
" ], + + _default: [ 0, "", "" ] +}; + +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + +// Support: IE <=9 only +if ( !support.option ) { + wrapMap.optgroup = wrapMap.option = [ 1, "" ]; +} + + +function getAll( context, tag ) { + + // Support: IE <=9 - 11 only + // Use typeof to avoid zero-argument method invocation on host objects (trac-15151) + var ret; + + if ( typeof context.getElementsByTagName !== "undefined" ) { + ret = context.getElementsByTagName( tag || "*" ); + + } else if ( typeof context.querySelectorAll !== "undefined" ) { + ret = context.querySelectorAll( tag || "*" ); + + } else { + ret = []; + } + + if ( tag === undefined || tag && nodeName( context, tag ) ) { + return jQuery.merge( [ context ], ret ); + } + + return ret; +} + + +// Mark scripts as having already been evaluated +function setGlobalEval( elems, refElements ) { + var i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + dataPriv.set( + elems[ i ], + "globalEval", + !refElements || dataPriv.get( refElements[ i ], "globalEval" ) + ); + } +} + + +var rhtml = /<|&#?\w+;/; + +function buildFragment( elems, context, scripts, selection, ignored ) { + var elem, tmp, tag, wrap, attached, j, + fragment = context.createDocumentFragment(), + nodes = [], + i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + elem = elems[ i ]; + + if ( elem || elem === 0 ) { + + // Add nodes directly + if ( toType( elem ) === "object" ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem ); + + // Convert non-html into a text node + } else if ( !rhtml.test( elem ) ) { + nodes.push( context.createTextNode( elem ) ); + + // Convert html into DOM nodes + } else { + tmp = tmp || fragment.appendChild( context.createElement( "div" ) ); + + // Deserialize a standard representation + tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase(); + wrap = wrapMap[ tag ] || wrapMap._default; + tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ]; + + // Descend through wrappers to the right content + j = wrap[ 0 ]; + while ( j-- ) { + tmp = tmp.lastChild; + } + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, tmp.childNodes ); + + // Remember the top-level container + tmp = fragment.firstChild; + + // Ensure the created nodes are orphaned (trac-12392) + tmp.textContent = ""; + } + } + } + + // Remove wrapper from fragment + fragment.textContent = ""; + + i = 0; + while ( ( elem = nodes[ i++ ] ) ) { + + // Skip elements already in the context collection (trac-4087) + if ( selection && jQuery.inArray( elem, selection ) > -1 ) { + if ( ignored ) { + ignored.push( elem ); + } + continue; + } + + attached = isAttached( elem ); + + // Append to fragment + tmp = getAll( fragment.appendChild( elem ), "script" ); + + // Preserve script evaluation history + if ( attached ) { + setGlobalEval( tmp ); + } + + // Capture executables + if ( scripts ) { + j = 0; + while ( ( elem = tmp[ j++ ] ) ) { + if ( rscriptType.test( elem.type || "" ) ) { + scripts.push( elem ); + } + } + } + } + + return fragment; +} + + +var rtypenamespace = /^([^.]*)(?:\.(.+)|)/; + +function returnTrue() { + return true; +} + +function returnFalse() { + return false; +} + +function on( elem, types, selector, data, fn, one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { + + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + on( elem, type, selector, data, types[ type ], one ); + } + return elem; + } + + if ( data == null && fn == null ) { + + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return elem; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return elem.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + } ); +} + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + global: {}, + + add: function( elem, types, handler, data, selector ) { + + var handleObjIn, eventHandle, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.get( elem ); + + // Only attach events to objects that accept data + if ( !acceptData( elem ) ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Ensure that invalid selectors throw exceptions at attach time + // Evaluate against documentElement in case elem is a non-element node (e.g., document) + if ( selector ) { + jQuery.find.matchesSelector( documentElement, selector ); + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + if ( !( events = elemData.events ) ) { + events = elemData.events = Object.create( null ); + } + if ( !( eventHandle = elemData.handle ) ) { + eventHandle = elemData.handle = function( e ) { + + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ? + jQuery.event.dispatch.apply( elem, arguments ) : undefined; + }; + } + + // Handle multiple events separated by a space + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // There *must* be a type, no attaching namespace-only handlers + if ( !type ) { + continue; + } + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend( { + type: type, + origType: origType, + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + needsContext: selector && jQuery.expr.match.needsContext.test( selector ), + namespace: namespaces.join( "." ) + }, handleObjIn ); + + // Init the event handler queue if we're the first + if ( !( handlers = events[ type ] ) ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener if the special events handler returns false + if ( !special.setup || + special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + }, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var j, origCount, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.hasData( elem ) && dataPriv.get( elem ); + + if ( !elemData || !( events = elemData.events ) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector ? special.delegateType : special.bindType ) || type; + handlers = events[ type ] || []; + tmp = tmp[ 2 ] && + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ); + + // Remove matching events + origCount = j = handlers.length; + while ( j-- ) { + handleObj = handlers[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !tmp || tmp.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || + selector === "**" && handleObj.selector ) ) { + handlers.splice( j, 1 ); + + if ( handleObj.selector ) { + handlers.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( origCount && !handlers.length ) { + if ( !special.teardown || + special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove data and the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + dataPriv.remove( elem, "handle events" ); + } + }, + + dispatch: function( nativeEvent ) { + + var i, j, ret, matched, handleObj, handlerQueue, + args = new Array( arguments.length ), + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( nativeEvent ), + + handlers = ( + dataPriv.get( this, "events" ) || Object.create( null ) + )[ event.type ] || [], + special = jQuery.event.special[ event.type ] || {}; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[ 0 ] = event; + + for ( i = 1; i < arguments.length; i++ ) { + args[ i ] = arguments[ i ]; + } + + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } + + // Determine handlers + handlerQueue = jQuery.event.handlers.call( this, event, handlers ); + + // Run delegates first; they may want to stop propagation beneath us + i = 0; + while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) { + event.currentTarget = matched.elem; + + j = 0; + while ( ( handleObj = matched.handlers[ j++ ] ) && + !event.isImmediatePropagationStopped() ) { + + // If the event is namespaced, then each handler is only invoked if it is + // specially universal or its namespaces are a superset of the event's. + if ( !event.rnamespace || handleObj.namespace === false || + event.rnamespace.test( handleObj.namespace ) ) { + + event.handleObj = handleObj; + event.data = handleObj.data; + + ret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle || + handleObj.handler ).apply( matched.elem, args ); + + if ( ret !== undefined ) { + if ( ( event.result = ret ) === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + + return event.result; + }, + + handlers: function( event, handlers ) { + var i, handleObj, sel, matchedHandlers, matchedSelectors, + handlerQueue = [], + delegateCount = handlers.delegateCount, + cur = event.target; + + // Find delegate handlers + if ( delegateCount && + + // Support: IE <=9 + // Black-hole SVG instance trees (trac-13180) + cur.nodeType && + + // Support: Firefox <=42 + // Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861) + // https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click + // Support: IE 11 only + // ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343) + !( event.type === "click" && event.button >= 1 ) ) { + + for ( ; cur !== this; cur = cur.parentNode || this ) { + + // Don't check non-elements (trac-13208) + // Don't process clicks on disabled elements (trac-6911, trac-8165, trac-11382, trac-11764) + if ( cur.nodeType === 1 && !( event.type === "click" && cur.disabled === true ) ) { + matchedHandlers = []; + matchedSelectors = {}; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + + // Don't conflict with Object.prototype properties (trac-13203) + sel = handleObj.selector + " "; + + if ( matchedSelectors[ sel ] === undefined ) { + matchedSelectors[ sel ] = handleObj.needsContext ? + jQuery( sel, this ).index( cur ) > -1 : + jQuery.find( sel, this, null, [ cur ] ).length; + } + if ( matchedSelectors[ sel ] ) { + matchedHandlers.push( handleObj ); + } + } + if ( matchedHandlers.length ) { + handlerQueue.push( { elem: cur, handlers: matchedHandlers } ); + } + } + } + } + + // Add the remaining (directly-bound) handlers + cur = this; + if ( delegateCount < handlers.length ) { + handlerQueue.push( { elem: cur, handlers: handlers.slice( delegateCount ) } ); + } + + return handlerQueue; + }, + + addProp: function( name, hook ) { + Object.defineProperty( jQuery.Event.prototype, name, { + enumerable: true, + configurable: true, + + get: isFunction( hook ) ? + function() { + if ( this.originalEvent ) { + return hook( this.originalEvent ); + } + } : + function() { + if ( this.originalEvent ) { + return this.originalEvent[ name ]; + } + }, + + set: function( value ) { + Object.defineProperty( this, name, { + enumerable: true, + configurable: true, + writable: true, + value: value + } ); + } + } ); + }, + + fix: function( originalEvent ) { + return originalEvent[ jQuery.expando ] ? + originalEvent : + new jQuery.Event( originalEvent ); + }, + + special: { + load: { + + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + click: { + + // Utilize native event to ensure correct state for checkable inputs + setup: function( data ) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Claim the first handler + if ( rcheckableType.test( el.type ) && + el.click && nodeName( el, "input" ) ) { + + // dataPriv.set( el, "click", ... ) + leverageNative( el, "click", true ); + } + + // Return false to allow normal processing in the caller + return false; + }, + trigger: function( data ) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Force setup before triggering a click + if ( rcheckableType.test( el.type ) && + el.click && nodeName( el, "input" ) ) { + + leverageNative( el, "click" ); + } + + // Return non-false to allow normal event-path propagation + return true; + }, + + // For cross-browser consistency, suppress native .click() on links + // Also prevent it if we're currently inside a leveraged native-event stack + _default: function( event ) { + var target = event.target; + return rcheckableType.test( target.type ) && + target.click && nodeName( target, "input" ) && + dataPriv.get( target, "click" ) || + nodeName( target, "a" ); + } + }, + + beforeunload: { + postDispatch: function( event ) { + + // Support: Firefox 20+ + // Firefox doesn't alert if the returnValue field is not set. + if ( event.result !== undefined && event.originalEvent ) { + event.originalEvent.returnValue = event.result; + } + } + } + } +}; + +// Ensure the presence of an event listener that handles manually-triggered +// synthetic events by interrupting progress until reinvoked in response to +// *native* events that it fires directly, ensuring that state changes have +// already occurred before other listeners are invoked. +function leverageNative( el, type, isSetup ) { + + // Missing `isSetup` indicates a trigger call, which must force setup through jQuery.event.add + if ( !isSetup ) { + if ( dataPriv.get( el, type ) === undefined ) { + jQuery.event.add( el, type, returnTrue ); + } + return; + } + + // Register the controller as a special universal handler for all event namespaces + dataPriv.set( el, type, false ); + jQuery.event.add( el, type, { + namespace: false, + handler: function( event ) { + var result, + saved = dataPriv.get( this, type ); + + if ( ( event.isTrigger & 1 ) && this[ type ] ) { + + // Interrupt processing of the outer synthetic .trigger()ed event + if ( !saved ) { + + // Store arguments for use when handling the inner native event + // There will always be at least one argument (an event object), so this array + // will not be confused with a leftover capture object. + saved = slice.call( arguments ); + dataPriv.set( this, type, saved ); + + // Trigger the native event and capture its result + this[ type ](); + result = dataPriv.get( this, type ); + dataPriv.set( this, type, false ); + + if ( saved !== result ) { + + // Cancel the outer synthetic event + event.stopImmediatePropagation(); + event.preventDefault(); + + return result; + } + + // If this is an inner synthetic event for an event with a bubbling surrogate + // (focus or blur), assume that the surrogate already propagated from triggering + // the native event and prevent that from happening again here. + // This technically gets the ordering wrong w.r.t. to `.trigger()` (in which the + // bubbling surrogate propagates *after* the non-bubbling base), but that seems + // less bad than duplication. + } else if ( ( jQuery.event.special[ type ] || {} ).delegateType ) { + event.stopPropagation(); + } + + // If this is a native event triggered above, everything is now in order + // Fire an inner synthetic event with the original arguments + } else if ( saved ) { + + // ...and capture the result + dataPriv.set( this, type, jQuery.event.trigger( + saved[ 0 ], + saved.slice( 1 ), + this + ) ); + + // Abort handling of the native event by all jQuery handlers while allowing + // native handlers on the same element to run. On target, this is achieved + // by stopping immediate propagation just on the jQuery event. However, + // the native event is re-wrapped by a jQuery one on each level of the + // propagation so the only way to stop it for jQuery is to stop it for + // everyone via native `stopPropagation()`. This is not a problem for + // focus/blur which don't bubble, but it does also stop click on checkboxes + // and radios. We accept this limitation. + event.stopPropagation(); + event.isImmediatePropagationStopped = returnTrue; + } + } + } ); +} + +jQuery.removeEvent = function( elem, type, handle ) { + + // This "if" is needed for plain objects + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle ); + } +}; + +jQuery.Event = function( src, props ) { + + // Allow instantiation without the 'new' keyword + if ( !( this instanceof jQuery.Event ) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = src.defaultPrevented || + src.defaultPrevented === undefined && + + // Support: Android <=2.3 only + src.returnValue === false ? + returnTrue : + returnFalse; + + // Create target properties + // Support: Safari <=6 - 7 only + // Target should not be a text node (trac-504, trac-13143) + this.target = ( src.target && src.target.nodeType === 3 ) ? + src.target.parentNode : + src.target; + + this.currentTarget = src.currentTarget; + this.relatedTarget = src.relatedTarget; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || Date.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + constructor: jQuery.Event, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse, + isSimulated: false, + + preventDefault: function() { + var e = this.originalEvent; + + this.isDefaultPrevented = returnTrue; + + if ( e && !this.isSimulated ) { + e.preventDefault(); + } + }, + stopPropagation: function() { + var e = this.originalEvent; + + this.isPropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopPropagation(); + } + }, + stopImmediatePropagation: function() { + var e = this.originalEvent; + + this.isImmediatePropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopImmediatePropagation(); + } + + this.stopPropagation(); + } +}; + +// Includes all common event props including KeyEvent and MouseEvent specific props +jQuery.each( { + altKey: true, + bubbles: true, + cancelable: true, + changedTouches: true, + ctrlKey: true, + detail: true, + eventPhase: true, + metaKey: true, + pageX: true, + pageY: true, + shiftKey: true, + view: true, + "char": true, + code: true, + charCode: true, + key: true, + keyCode: true, + button: true, + buttons: true, + clientX: true, + clientY: true, + offsetX: true, + offsetY: true, + pointerId: true, + pointerType: true, + screenX: true, + screenY: true, + targetTouches: true, + toElement: true, + touches: true, + which: true +}, jQuery.event.addProp ); + +jQuery.each( { focus: "focusin", blur: "focusout" }, function( type, delegateType ) { + + function focusMappedHandler( nativeEvent ) { + if ( document.documentMode ) { + + // Support: IE 11+ + // Attach a single focusin/focusout handler on the document while someone wants + // focus/blur. This is because the former are synchronous in IE while the latter + // are async. In other browsers, all those handlers are invoked synchronously. + + // `handle` from private data would already wrap the event, but we need + // to change the `type` here. + var handle = dataPriv.get( this, "handle" ), + event = jQuery.event.fix( nativeEvent ); + event.type = nativeEvent.type === "focusin" ? "focus" : "blur"; + event.isSimulated = true; + + // First, handle focusin/focusout + handle( nativeEvent ); + + // ...then, handle focus/blur + // + // focus/blur don't bubble while focusin/focusout do; simulate the former by only + // invoking the handler at the lower level. + if ( event.target === event.currentTarget ) { + + // The setup part calls `leverageNative`, which, in turn, calls + // `jQuery.event.add`, so event handle will already have been set + // by this point. + handle( event ); + } + } else { + + // For non-IE browsers, attach a single capturing handler on the document + // while someone wants focusin/focusout. + jQuery.event.simulate( delegateType, nativeEvent.target, + jQuery.event.fix( nativeEvent ) ); + } + } + + jQuery.event.special[ type ] = { + + // Utilize native event if possible so blur/focus sequence is correct + setup: function() { + + var attaches; + + // Claim the first handler + // dataPriv.set( this, "focus", ... ) + // dataPriv.set( this, "blur", ... ) + leverageNative( this, type, true ); + + if ( document.documentMode ) { + + // Support: IE 9 - 11+ + // We use the same native handler for focusin & focus (and focusout & blur) + // so we need to coordinate setup & teardown parts between those events. + // Use `delegateType` as the key as `type` is already used by `leverageNative`. + attaches = dataPriv.get( this, delegateType ); + if ( !attaches ) { + this.addEventListener( delegateType, focusMappedHandler ); + } + dataPriv.set( this, delegateType, ( attaches || 0 ) + 1 ); + } else { + + // Return false to allow normal processing in the caller + return false; + } + }, + trigger: function() { + + // Force setup before trigger + leverageNative( this, type ); + + // Return non-false to allow normal event-path propagation + return true; + }, + + teardown: function() { + var attaches; + + if ( document.documentMode ) { + attaches = dataPriv.get( this, delegateType ) - 1; + if ( !attaches ) { + this.removeEventListener( delegateType, focusMappedHandler ); + dataPriv.remove( this, delegateType ); + } else { + dataPriv.set( this, delegateType, attaches ); + } + } else { + + // Return false to indicate standard teardown should be applied + return false; + } + }, + + // Suppress native focus or blur if we're currently inside + // a leveraged native-event stack + _default: function( event ) { + return dataPriv.get( event.target, type ); + }, + + delegateType: delegateType + }; + + // Support: Firefox <=44 + // Firefox doesn't have focus(in | out) events + // Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787 + // + // Support: Chrome <=48 - 49, Safari <=9.0 - 9.1 + // focus(in | out) events fire after focus & blur events, + // which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order + // Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857 + // + // Support: IE 9 - 11+ + // To preserve relative focusin/focus & focusout/blur event order guaranteed on the 3.x branch, + // attach a single handler for both events in IE. + jQuery.event.special[ delegateType ] = { + setup: function() { + + // Handle: regular nodes (via `this.ownerDocument`), window + // (via `this.document`) & document (via `this`). + var doc = this.ownerDocument || this.document || this, + dataHolder = document.documentMode ? this : doc, + attaches = dataPriv.get( dataHolder, delegateType ); + + // Support: IE 9 - 11+ + // We use the same native handler for focusin & focus (and focusout & blur) + // so we need to coordinate setup & teardown parts between those events. + // Use `delegateType` as the key as `type` is already used by `leverageNative`. + if ( !attaches ) { + if ( document.documentMode ) { + this.addEventListener( delegateType, focusMappedHandler ); + } else { + doc.addEventListener( type, focusMappedHandler, true ); + } + } + dataPriv.set( dataHolder, delegateType, ( attaches || 0 ) + 1 ); + }, + teardown: function() { + var doc = this.ownerDocument || this.document || this, + dataHolder = document.documentMode ? this : doc, + attaches = dataPriv.get( dataHolder, delegateType ) - 1; + + if ( !attaches ) { + if ( document.documentMode ) { + this.removeEventListener( delegateType, focusMappedHandler ); + } else { + doc.removeEventListener( type, focusMappedHandler, true ); + } + dataPriv.remove( dataHolder, delegateType ); + } else { + dataPriv.set( dataHolder, delegateType, attaches ); + } + } + }; +} ); + +// Create mouseenter/leave events using mouseover/out and event-time checks +// so that event delegation works in jQuery. +// Do the same for pointerenter/pointerleave and pointerover/pointerout +// +// Support: Safari 7 only +// Safari sends mouseenter too often; see: +// https://bugs.chromium.org/p/chromium/issues/detail?id=470258 +// for the description of the bug (it existed in older Chrome versions as well). +jQuery.each( { + mouseenter: "mouseover", + mouseleave: "mouseout", + pointerenter: "pointerover", + pointerleave: "pointerout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj; + + // For mouseenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +} ); + +jQuery.fn.extend( { + + on: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn ); + }, + one: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? + handleObj.origType + "." + handleObj.namespace : + handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each( function() { + jQuery.event.remove( this, types, fn, selector ); + } ); + } +} ); + + +var + + // Support: IE <=10 - 11, Edge 12 - 13 only + // In IE/Edge using regex groups here causes severe slowdowns. + // See https://connect.microsoft.com/IE/feedback/details/1736512/ + rnoInnerhtml = /\s*$/g; + +// Prefer a tbody over its parent table for containing new rows +function manipulationTarget( elem, content ) { + if ( nodeName( elem, "table" ) && + nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ) { + + return jQuery( elem ).children( "tbody" )[ 0 ] || elem; + } + + return elem; +} + +// Replace/restore the type attribute of script elements for safe DOM manipulation +function disableScript( elem ) { + elem.type = ( elem.getAttribute( "type" ) !== null ) + "/" + elem.type; + return elem; +} +function restoreScript( elem ) { + if ( ( elem.type || "" ).slice( 0, 5 ) === "true/" ) { + elem.type = elem.type.slice( 5 ); + } else { + elem.removeAttribute( "type" ); + } + + return elem; +} + +function cloneCopyEvent( src, dest ) { + var i, l, type, pdataOld, udataOld, udataCur, events; + + if ( dest.nodeType !== 1 ) { + return; + } + + // 1. Copy private data: events, handlers, etc. + if ( dataPriv.hasData( src ) ) { + pdataOld = dataPriv.get( src ); + events = pdataOld.events; + + if ( events ) { + dataPriv.remove( dest, "handle events" ); + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type, events[ type ][ i ] ); + } + } + } + } + + // 2. Copy user data + if ( dataUser.hasData( src ) ) { + udataOld = dataUser.access( src ); + udataCur = jQuery.extend( {}, udataOld ); + + dataUser.set( dest, udataCur ); + } +} + +// Fix IE bugs, see support tests +function fixInput( src, dest ) { + var nodeName = dest.nodeName.toLowerCase(); + + // Fails to persist the checked state of a cloned checkbox or radio button. + if ( nodeName === "input" && rcheckableType.test( src.type ) ) { + dest.checked = src.checked; + + // Fails to return the selected option to the default selected state when cloning options + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } +} + +function domManip( collection, args, callback, ignored ) { + + // Flatten any nested arrays + args = flat( args ); + + var fragment, first, scripts, hasScripts, node, doc, + i = 0, + l = collection.length, + iNoClone = l - 1, + value = args[ 0 ], + valueIsFunction = isFunction( value ); + + // We can't cloneNode fragments that contain checked, in WebKit + if ( valueIsFunction || + ( l > 1 && typeof value === "string" && + !support.checkClone && rchecked.test( value ) ) ) { + return collection.each( function( index ) { + var self = collection.eq( index ); + if ( valueIsFunction ) { + args[ 0 ] = value.call( this, index, self.html() ); + } + domManip( self, args, callback, ignored ); + } ); + } + + if ( l ) { + fragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored ); + first = fragment.firstChild; + + if ( fragment.childNodes.length === 1 ) { + fragment = first; + } + + // Require either new content or an interest in ignored elements to invoke the callback + if ( first || ignored ) { + scripts = jQuery.map( getAll( fragment, "script" ), disableScript ); + hasScripts = scripts.length; + + // Use the original fragment for the last item + // instead of the first because it can end up + // being emptied incorrectly in certain situations (trac-8070). + for ( ; i < l; i++ ) { + node = fragment; + + if ( i !== iNoClone ) { + node = jQuery.clone( node, true, true ); + + // Keep references to cloned scripts for later restoration + if ( hasScripts ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( scripts, getAll( node, "script" ) ); + } + } + + callback.call( collection[ i ], node, i ); + } + + if ( hasScripts ) { + doc = scripts[ scripts.length - 1 ].ownerDocument; + + // Reenable scripts + jQuery.map( scripts, restoreScript ); + + // Evaluate executable scripts on first document insertion + for ( i = 0; i < hasScripts; i++ ) { + node = scripts[ i ]; + if ( rscriptType.test( node.type || "" ) && + !dataPriv.access( node, "globalEval" ) && + jQuery.contains( doc, node ) ) { + + if ( node.src && ( node.type || "" ).toLowerCase() !== "module" ) { + + // Optional AJAX dependency, but won't run scripts if not present + if ( jQuery._evalUrl && !node.noModule ) { + jQuery._evalUrl( node.src, { + nonce: node.nonce || node.getAttribute( "nonce" ) + }, doc ); + } + } else { + + // Unwrap a CDATA section containing script contents. This shouldn't be + // needed as in XML documents they're already not visible when + // inspecting element contents and in HTML documents they have no + // meaning but we're preserving that logic for backwards compatibility. + // This will be removed completely in 4.0. See gh-4904. + DOMEval( node.textContent.replace( rcleanScript, "" ), node, doc ); + } + } + } + } + } + } + + return collection; +} + +function remove( elem, selector, keepData ) { + var node, + nodes = selector ? jQuery.filter( selector, elem ) : elem, + i = 0; + + for ( ; ( node = nodes[ i ] ) != null; i++ ) { + if ( !keepData && node.nodeType === 1 ) { + jQuery.cleanData( getAll( node ) ); + } + + if ( node.parentNode ) { + if ( keepData && isAttached( node ) ) { + setGlobalEval( getAll( node, "script" ) ); + } + node.parentNode.removeChild( node ); + } + } + + return elem; +} + +jQuery.extend( { + htmlPrefilter: function( html ) { + return html; + }, + + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var i, l, srcElements, destElements, + clone = elem.cloneNode( true ), + inPage = isAttached( elem ); + + // Fix IE cloning issues + if ( !support.noCloneChecked && ( elem.nodeType === 1 || elem.nodeType === 11 ) && + !jQuery.isXMLDoc( elem ) ) { + + // We eschew jQuery#find here for performance reasons: + // https://jsperf.com/getall-vs-sizzle/2 + destElements = getAll( clone ); + srcElements = getAll( elem ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + fixInput( srcElements[ i ], destElements[ i ] ); + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + if ( deepDataAndEvents ) { + srcElements = srcElements || getAll( elem ); + destElements = destElements || getAll( clone ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + cloneCopyEvent( srcElements[ i ], destElements[ i ] ); + } + } else { + cloneCopyEvent( elem, clone ); + } + } + + // Preserve script evaluation history + destElements = getAll( clone, "script" ); + if ( destElements.length > 0 ) { + setGlobalEval( destElements, !inPage && getAll( elem, "script" ) ); + } + + // Return the cloned set + return clone; + }, + + cleanData: function( elems ) { + var data, elem, type, + special = jQuery.event.special, + i = 0; + + for ( ; ( elem = elems[ i ] ) !== undefined; i++ ) { + if ( acceptData( elem ) ) { + if ( ( data = elem[ dataPriv.expando ] ) ) { + if ( data.events ) { + for ( type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataPriv.expando ] = undefined; + } + if ( elem[ dataUser.expando ] ) { + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataUser.expando ] = undefined; + } + } + } + } +} ); + +jQuery.fn.extend( { + detach: function( selector ) { + return remove( this, selector, true ); + }, + + remove: function( selector ) { + return remove( this, selector ); + }, + + text: function( value ) { + return access( this, function( value ) { + return value === undefined ? + jQuery.text( this ) : + this.empty().each( function() { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + this.textContent = value; + } + } ); + }, null, value, arguments.length ); + }, + + append: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.appendChild( elem ); + } + } ); + }, + + prepend: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.insertBefore( elem, target.firstChild ); + } + } ); + }, + + before: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this ); + } + } ); + }, + + after: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + } + } ); + }, + + empty: function() { + var elem, + i = 0; + + for ( ; ( elem = this[ i ] ) != null; i++ ) { + if ( elem.nodeType === 1 ) { + + // Prevent memory leaks + jQuery.cleanData( getAll( elem, false ) ); + + // Remove any remaining nodes + elem.textContent = ""; + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function() { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + } ); + }, + + html: function( value ) { + return access( this, function( value ) { + var elem = this[ 0 ] || {}, + i = 0, + l = this.length; + + if ( value === undefined && elem.nodeType === 1 ) { + return elem.innerHTML; + } + + // See if we can take a shortcut and just use innerHTML + if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + !wrapMap[ ( rtagName.exec( value ) || [ "", "" ] )[ 1 ].toLowerCase() ] ) { + + value = jQuery.htmlPrefilter( value ); + + try { + for ( ; i < l; i++ ) { + elem = this[ i ] || {}; + + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( getAll( elem, false ) ); + elem.innerHTML = value; + } + } + + elem = 0; + + // If using innerHTML throws an exception, use the fallback method + } catch ( e ) {} + } + + if ( elem ) { + this.empty().append( value ); + } + }, null, value, arguments.length ); + }, + + replaceWith: function() { + var ignored = []; + + // Make the changes, replacing each non-ignored context element with the new content + return domManip( this, arguments, function( elem ) { + var parent = this.parentNode; + + if ( jQuery.inArray( this, ignored ) < 0 ) { + jQuery.cleanData( getAll( this ) ); + if ( parent ) { + parent.replaceChild( elem, this ); + } + } + + // Force callback invocation + }, ignored ); + } +} ); + +jQuery.each( { + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var elems, + ret = [], + insert = jQuery( selector ), + last = insert.length - 1, + i = 0; + + for ( ; i <= last; i++ ) { + elems = i === last ? this : this.clone( true ); + jQuery( insert[ i ] )[ original ]( elems ); + + // Support: Android <=4.0 only, PhantomJS 1 only + // .get() because push.apply(_, arraylike) throws on ancient WebKit + push.apply( ret, elems.get() ); + } + + return this.pushStack( ret ); + }; +} ); +var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" ); + +var rcustomProp = /^--/; + + +var getStyles = function( elem ) { + + // Support: IE <=11 only, Firefox <=30 (trac-15098, trac-14150) + // IE throws on elements created in popups + // FF meanwhile throws on frame elements through "defaultView.getComputedStyle" + var view = elem.ownerDocument.defaultView; + + if ( !view || !view.opener ) { + view = window; + } + + return view.getComputedStyle( elem ); + }; + +var swap = function( elem, options, callback ) { + var ret, name, + old = {}; + + // Remember the old values, and insert the new ones + for ( name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + ret = callback.call( elem ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + + return ret; +}; + + +var rboxStyle = new RegExp( cssExpand.join( "|" ), "i" ); + + + +( function() { + + // Executing both pixelPosition & boxSizingReliable tests require only one layout + // so they're executed at the same time to save the second computation. + function computeStyleTests() { + + // This is a singleton, we need to execute it only once + if ( !div ) { + return; + } + + container.style.cssText = "position:absolute;left:-11111px;width:60px;" + + "margin-top:1px;padding:0;border:0"; + div.style.cssText = + "position:relative;display:block;box-sizing:border-box;overflow:scroll;" + + "margin:auto;border:1px;padding:1px;" + + "width:60%;top:1%"; + documentElement.appendChild( container ).appendChild( div ); + + var divStyle = window.getComputedStyle( div ); + pixelPositionVal = divStyle.top !== "1%"; + + // Support: Android 4.0 - 4.3 only, Firefox <=3 - 44 + reliableMarginLeftVal = roundPixelMeasures( divStyle.marginLeft ) === 12; + + // Support: Android 4.0 - 4.3 only, Safari <=9.1 - 10.1, iOS <=7.0 - 9.3 + // Some styles come back with percentage values, even though they shouldn't + div.style.right = "60%"; + pixelBoxStylesVal = roundPixelMeasures( divStyle.right ) === 36; + + // Support: IE 9 - 11 only + // Detect misreporting of content dimensions for box-sizing:border-box elements + boxSizingReliableVal = roundPixelMeasures( divStyle.width ) === 36; + + // Support: IE 9 only + // Detect overflow:scroll screwiness (gh-3699) + // Support: Chrome <=64 + // Don't get tricked when zoom affects offsetWidth (gh-4029) + div.style.position = "absolute"; + scrollboxSizeVal = roundPixelMeasures( div.offsetWidth / 3 ) === 12; + + documentElement.removeChild( container ); + + // Nullify the div so it wouldn't be stored in the memory and + // it will also be a sign that checks already performed + div = null; + } + + function roundPixelMeasures( measure ) { + return Math.round( parseFloat( measure ) ); + } + + var pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal, + reliableTrDimensionsVal, reliableMarginLeftVal, + container = document.createElement( "div" ), + div = document.createElement( "div" ); + + // Finish early in limited (non-browser) environments + if ( !div.style ) { + return; + } + + // Support: IE <=9 - 11 only + // Style of cloned element affects source element cloned (trac-8908) + div.style.backgroundClip = "content-box"; + div.cloneNode( true ).style.backgroundClip = ""; + support.clearCloneStyle = div.style.backgroundClip === "content-box"; + + jQuery.extend( support, { + boxSizingReliable: function() { + computeStyleTests(); + return boxSizingReliableVal; + }, + pixelBoxStyles: function() { + computeStyleTests(); + return pixelBoxStylesVal; + }, + pixelPosition: function() { + computeStyleTests(); + return pixelPositionVal; + }, + reliableMarginLeft: function() { + computeStyleTests(); + return reliableMarginLeftVal; + }, + scrollboxSize: function() { + computeStyleTests(); + return scrollboxSizeVal; + }, + + // Support: IE 9 - 11+, Edge 15 - 18+ + // IE/Edge misreport `getComputedStyle` of table rows with width/height + // set in CSS while `offset*` properties report correct values. + // Behavior in IE 9 is more subtle than in newer versions & it passes + // some versions of this test; make sure not to make it pass there! + // + // Support: Firefox 70+ + // Only Firefox includes border widths + // in computed dimensions. (gh-4529) + reliableTrDimensions: function() { + var table, tr, trChild, trStyle; + if ( reliableTrDimensionsVal == null ) { + table = document.createElement( "table" ); + tr = document.createElement( "tr" ); + trChild = document.createElement( "div" ); + + table.style.cssText = "position:absolute;left:-11111px;border-collapse:separate"; + tr.style.cssText = "border:1px solid"; + + // Support: Chrome 86+ + // Height set through cssText does not get applied. + // Computed height then comes back as 0. + tr.style.height = "1px"; + trChild.style.height = "9px"; + + // Support: Android 8 Chrome 86+ + // In our bodyBackground.html iframe, + // display for all div elements is set to "inline", + // which causes a problem only in Android 8 Chrome 86. + // Ensuring the div is display: block + // gets around this issue. + trChild.style.display = "block"; + + documentElement + .appendChild( table ) + .appendChild( tr ) + .appendChild( trChild ); + + trStyle = window.getComputedStyle( tr ); + reliableTrDimensionsVal = ( parseInt( trStyle.height, 10 ) + + parseInt( trStyle.borderTopWidth, 10 ) + + parseInt( trStyle.borderBottomWidth, 10 ) ) === tr.offsetHeight; + + documentElement.removeChild( table ); + } + return reliableTrDimensionsVal; + } + } ); +} )(); + + +function curCSS( elem, name, computed ) { + var width, minWidth, maxWidth, ret, + isCustomProp = rcustomProp.test( name ), + + // Support: Firefox 51+ + // Retrieving style before computed somehow + // fixes an issue with getting wrong values + // on detached elements + style = elem.style; + + computed = computed || getStyles( elem ); + + // getPropertyValue is needed for: + // .css('filter') (IE 9 only, trac-12537) + // .css('--customProperty) (gh-3144) + if ( computed ) { + + // Support: IE <=9 - 11+ + // IE only supports `"float"` in `getPropertyValue`; in computed styles + // it's only available as `"cssFloat"`. We no longer modify properties + // sent to `.css()` apart from camelCasing, so we need to check both. + // Normally, this would create difference in behavior: if + // `getPropertyValue` returns an empty string, the value returned + // by `.css()` would be `undefined`. This is usually the case for + // disconnected elements. However, in IE even disconnected elements + // with no styles return `"none"` for `getPropertyValue( "float" )` + ret = computed.getPropertyValue( name ) || computed[ name ]; + + if ( isCustomProp && ret ) { + + // Support: Firefox 105+, Chrome <=105+ + // Spec requires trimming whitespace for custom properties (gh-4926). + // Firefox only trims leading whitespace. Chrome just collapses + // both leading & trailing whitespace to a single space. + // + // Fall back to `undefined` if empty string returned. + // This collapses a missing definition with property defined + // and set to an empty string but there's no standard API + // allowing us to differentiate them without a performance penalty + // and returning `undefined` aligns with older jQuery. + // + // rtrimCSS treats U+000D CARRIAGE RETURN and U+000C FORM FEED + // as whitespace while CSS does not, but this is not a problem + // because CSS preprocessing replaces them with U+000A LINE FEED + // (which *is* CSS whitespace) + // https://www.w3.org/TR/css-syntax-3/#input-preprocessing + ret = ret.replace( rtrimCSS, "$1" ) || undefined; + } + + if ( ret === "" && !isAttached( elem ) ) { + ret = jQuery.style( elem, name ); + } + + // A tribute to the "awesome hack by Dean Edwards" + // Android Browser returns percentage for some values, + // but width seems to be reliably pixels. + // This is against the CSSOM draft spec: + // https://drafts.csswg.org/cssom/#resolved-values + if ( !support.pixelBoxStyles() && rnumnonpx.test( ret ) && rboxStyle.test( name ) ) { + + // Remember the original values + width = style.width; + minWidth = style.minWidth; + maxWidth = style.maxWidth; + + // Put in the new values to get a computed value out + style.minWidth = style.maxWidth = style.width = ret; + ret = computed.width; + + // Revert the changed values + style.width = width; + style.minWidth = minWidth; + style.maxWidth = maxWidth; + } + } + + return ret !== undefined ? + + // Support: IE <=9 - 11 only + // IE returns zIndex value as an integer. + ret + "" : + ret; +} + + +function addGetHookIf( conditionFn, hookFn ) { + + // Define the hook, we'll check on the first run if it's really needed. + return { + get: function() { + if ( conditionFn() ) { + + // Hook not needed (or it's not possible to use it due + // to missing dependency), remove it. + delete this.get; + return; + } + + // Hook needed; redefine it so that the support test is not executed again. + return ( this.get = hookFn ).apply( this, arguments ); + } + }; +} + + +var cssPrefixes = [ "Webkit", "Moz", "ms" ], + emptyStyle = document.createElement( "div" ).style, + vendorProps = {}; + +// Return a vendor-prefixed property or undefined +function vendorPropName( name ) { + + // Check for vendor prefixed names + var capName = name[ 0 ].toUpperCase() + name.slice( 1 ), + i = cssPrefixes.length; + + while ( i-- ) { + name = cssPrefixes[ i ] + capName; + if ( name in emptyStyle ) { + return name; + } + } +} + +// Return a potentially-mapped jQuery.cssProps or vendor prefixed property +function finalPropName( name ) { + var final = jQuery.cssProps[ name ] || vendorProps[ name ]; + + if ( final ) { + return final; + } + if ( name in emptyStyle ) { + return name; + } + return vendorProps[ name ] = vendorPropName( name ) || name; +} + + +var + + // Swappable if display is none or starts with table + // except "table", "table-cell", or "table-caption" + // See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display + rdisplayswap = /^(none|table(?!-c[ea]).+)/, + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssNormalTransform = { + letterSpacing: "0", + fontWeight: "400" + }; + +function setPositiveNumber( _elem, value, subtract ) { + + // Any relative (+/-) values have already been + // normalized at this point + var matches = rcssNum.exec( value ); + return matches ? + + // Guard against undefined "subtract", e.g., when used as in cssHooks + Math.max( 0, matches[ 2 ] - ( subtract || 0 ) ) + ( matches[ 3 ] || "px" ) : + value; +} + +function boxModelAdjustment( elem, dimension, box, isBorderBox, styles, computedVal ) { + var i = dimension === "width" ? 1 : 0, + extra = 0, + delta = 0, + marginDelta = 0; + + // Adjustment may not be necessary + if ( box === ( isBorderBox ? "border" : "content" ) ) { + return 0; + } + + for ( ; i < 4; i += 2 ) { + + // Both box models exclude margin + // Count margin delta separately to only add it after scroll gutter adjustment. + // This is needed to make negative margins work with `outerHeight( true )` (gh-3982). + if ( box === "margin" ) { + marginDelta += jQuery.css( elem, box + cssExpand[ i ], true, styles ); + } + + // If we get here with a content-box, we're seeking "padding" or "border" or "margin" + if ( !isBorderBox ) { + + // Add padding + delta += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + + // For "border" or "margin", add border + if ( box !== "padding" ) { + delta += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + + // But still keep track of it otherwise + } else { + extra += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + + // If we get here with a border-box (content + padding + border), we're seeking "content" or + // "padding" or "margin" + } else { + + // For "content", subtract padding + if ( box === "content" ) { + delta -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + } + + // For "content" or "padding", subtract border + if ( box !== "margin" ) { + delta -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + } + } + + // Account for positive content-box scroll gutter when requested by providing computedVal + if ( !isBorderBox && computedVal >= 0 ) { + + // offsetWidth/offsetHeight is a rounded sum of content, padding, scroll gutter, and border + // Assuming integer scroll gutter, subtract the rest and round down + delta += Math.max( 0, Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + computedVal - + delta - + extra - + 0.5 + + // If offsetWidth/offsetHeight is unknown, then we can't determine content-box scroll gutter + // Use an explicit zero to avoid NaN (gh-3964) + ) ) || 0; + } + + return delta + marginDelta; +} + +function getWidthOrHeight( elem, dimension, extra ) { + + // Start with computed style + var styles = getStyles( elem ), + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-4322). + // Fake content-box until we know it's needed to know the true value. + boxSizingNeeded = !support.boxSizingReliable() || extra, + isBorderBox = boxSizingNeeded && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + valueIsBorderBox = isBorderBox, + + val = curCSS( elem, dimension, styles ), + offsetProp = "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ); + + // Support: Firefox <=54 + // Return a confounding non-pixel value or feign ignorance, as appropriate. + if ( rnumnonpx.test( val ) ) { + if ( !extra ) { + return val; + } + val = "auto"; + } + + + // Support: IE 9 - 11 only + // Use offsetWidth/offsetHeight for when box sizing is unreliable. + // In those cases, the computed value can be trusted to be border-box. + if ( ( !support.boxSizingReliable() && isBorderBox || + + // Support: IE 10 - 11+, Edge 15 - 18+ + // IE/Edge misreport `getComputedStyle` of table rows with width/height + // set in CSS while `offset*` properties report correct values. + // Interestingly, in some cases IE 9 doesn't suffer from this issue. + !support.reliableTrDimensions() && nodeName( elem, "tr" ) || + + // Fall back to offsetWidth/offsetHeight when value is "auto" + // This happens for inline elements with no explicit setting (gh-3571) + val === "auto" || + + // Support: Android <=4.1 - 4.3 only + // Also use offsetWidth/offsetHeight for misreported inline dimensions (gh-3602) + !parseFloat( val ) && jQuery.css( elem, "display", false, styles ) === "inline" ) && + + // Make sure the element is visible & connected + elem.getClientRects().length ) { + + isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box"; + + // Where available, offsetWidth/offsetHeight approximate border box dimensions. + // Where not available (e.g., SVG), assume unreliable box-sizing and interpret the + // retrieved value as a content box dimension. + valueIsBorderBox = offsetProp in elem; + if ( valueIsBorderBox ) { + val = elem[ offsetProp ]; + } + } + + // Normalize "" and auto + val = parseFloat( val ) || 0; + + // Adjust for the element's box model + return ( val + + boxModelAdjustment( + elem, + dimension, + extra || ( isBorderBox ? "border" : "content" ), + valueIsBorderBox, + styles, + + // Provide the current computed size to request scroll gutter calculation (gh-3589) + val + ) + ) + "px"; +} + +jQuery.extend( { + + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity" ); + return ret === "" ? "1" : ret; + } + } + } + }, + + // Don't automatically add "px" to these possibly-unitless properties + cssNumber: { + animationIterationCount: true, + aspectRatio: true, + borderImageSlice: true, + columnCount: true, + flexGrow: true, + flexShrink: true, + fontWeight: true, + gridArea: true, + gridColumn: true, + gridColumnEnd: true, + gridColumnStart: true, + gridRow: true, + gridRowEnd: true, + gridRowStart: true, + lineHeight: true, + opacity: true, + order: true, + orphans: true, + scale: true, + widows: true, + zIndex: true, + zoom: true, + + // SVG-related + fillOpacity: true, + floodOpacity: true, + stopOpacity: true, + strokeMiterlimit: true, + strokeOpacity: true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: {}, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ), + style = elem.style; + + // Make sure that we're working with the right name. We don't + // want to query the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Gets hook for the prefixed version, then unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // Convert "+=" or "-=" to relative numbers (trac-7345) + if ( type === "string" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) { + value = adjustCSS( elem, name, ret ); + + // Fixes bug trac-9237 + type = "number"; + } + + // Make sure that null and NaN values aren't set (trac-7116) + if ( value == null || value !== value ) { + return; + } + + // If a number was passed in, add the unit (except for certain CSS properties) + // The isCustomProp check can be removed in jQuery 4.0 when we only auto-append + // "px" to a few hardcoded values. + if ( type === "number" && !isCustomProp ) { + value += ret && ret[ 3 ] || ( jQuery.cssNumber[ origName ] ? "" : "px" ); + } + + // background-* props affect original clone's values + if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) { + style[ name ] = "inherit"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !( "set" in hooks ) || + ( value = hooks.set( elem, value, extra ) ) !== undefined ) { + + if ( isCustomProp ) { + style.setProperty( name, value ); + } else { + style[ name ] = value; + } + } + + } else { + + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && + ( ret = hooks.get( elem, false, extra ) ) !== undefined ) { + + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra, styles ) { + var val, num, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ); + + // Make sure that we're working with the right name. We don't + // want to modify the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Try prefixed name followed by the unprefixed name + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks ) { + val = hooks.get( elem, true, extra ); + } + + // Otherwise, if a way to get the computed value exists, use that + if ( val === undefined ) { + val = curCSS( elem, name, styles ); + } + + // Convert "normal" to computed value + if ( val === "normal" && name in cssNormalTransform ) { + val = cssNormalTransform[ name ]; + } + + // Make numeric if forced or a qualifier was provided and val looks numeric + if ( extra === "" || extra ) { + num = parseFloat( val ); + return extra === true || isFinite( num ) ? num || 0 : val; + } + + return val; + } +} ); + +jQuery.each( [ "height", "width" ], function( _i, dimension ) { + jQuery.cssHooks[ dimension ] = { + get: function( elem, computed, extra ) { + if ( computed ) { + + // Certain elements can have dimension info if we invisibly show them + // but it must have a current display style that would benefit + return rdisplayswap.test( jQuery.css( elem, "display" ) ) && + + // Support: Safari 8+ + // Table columns in Safari have non-zero offsetWidth & zero + // getBoundingClientRect().width unless display is changed. + // Support: IE <=11 only + // Running getBoundingClientRect on a disconnected node + // in IE throws an error. + ( !elem.getClientRects().length || !elem.getBoundingClientRect().width ) ? + swap( elem, cssShow, function() { + return getWidthOrHeight( elem, dimension, extra ); + } ) : + getWidthOrHeight( elem, dimension, extra ); + } + }, + + set: function( elem, value, extra ) { + var matches, + styles = getStyles( elem ), + + // Only read styles.position if the test has a chance to fail + // to avoid forcing a reflow. + scrollboxSizeBuggy = !support.scrollboxSize() && + styles.position === "absolute", + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-3991) + boxSizingNeeded = scrollboxSizeBuggy || extra, + isBorderBox = boxSizingNeeded && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + subtract = extra ? + boxModelAdjustment( + elem, + dimension, + extra, + isBorderBox, + styles + ) : + 0; + + // Account for unreliable border-box dimensions by comparing offset* to computed and + // faking a content-box to get border and padding (gh-3699) + if ( isBorderBox && scrollboxSizeBuggy ) { + subtract -= Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + parseFloat( styles[ dimension ] ) - + boxModelAdjustment( elem, dimension, "border", false, styles ) - + 0.5 + ); + } + + // Convert to pixels if value adjustment is needed + if ( subtract && ( matches = rcssNum.exec( value ) ) && + ( matches[ 3 ] || "px" ) !== "px" ) { + + elem.style[ dimension ] = value; + value = jQuery.css( elem, dimension ); + } + + return setPositiveNumber( elem, value, subtract ); + } + }; +} ); + +jQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft, + function( elem, computed ) { + if ( computed ) { + return ( parseFloat( curCSS( elem, "marginLeft" ) ) || + elem.getBoundingClientRect().left - + swap( elem, { marginLeft: 0 }, function() { + return elem.getBoundingClientRect().left; + } ) + ) + "px"; + } + } +); + +// These hooks are used by animate to expand properties +jQuery.each( { + margin: "", + padding: "", + border: "Width" +}, function( prefix, suffix ) { + jQuery.cssHooks[ prefix + suffix ] = { + expand: function( value ) { + var i = 0, + expanded = {}, + + // Assumes a single number if not a string + parts = typeof value === "string" ? value.split( " " ) : [ value ]; + + for ( ; i < 4; i++ ) { + expanded[ prefix + cssExpand[ i ] + suffix ] = + parts[ i ] || parts[ i - 2 ] || parts[ 0 ]; + } + + return expanded; + } + }; + + if ( prefix !== "margin" ) { + jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber; + } +} ); + +jQuery.fn.extend( { + css: function( name, value ) { + return access( this, function( elem, name, value ) { + var styles, len, + map = {}, + i = 0; + + if ( Array.isArray( name ) ) { + styles = getStyles( elem ); + len = name.length; + + for ( ; i < len; i++ ) { + map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles ); + } + + return map; + } + + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }, name, value, arguments.length > 1 ); + } +} ); + + +function Tween( elem, options, prop, end, easing ) { + return new Tween.prototype.init( elem, options, prop, end, easing ); +} +jQuery.Tween = Tween; + +Tween.prototype = { + constructor: Tween, + init: function( elem, options, prop, end, easing, unit ) { + this.elem = elem; + this.prop = prop; + this.easing = easing || jQuery.easing._default; + this.options = options; + this.start = this.now = this.cur(); + this.end = end; + this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + }, + cur: function() { + var hooks = Tween.propHooks[ this.prop ]; + + return hooks && hooks.get ? + hooks.get( this ) : + Tween.propHooks._default.get( this ); + }, + run: function( percent ) { + var eased, + hooks = Tween.propHooks[ this.prop ]; + + if ( this.options.duration ) { + this.pos = eased = jQuery.easing[ this.easing ]( + percent, this.options.duration * percent, 0, 1, this.options.duration + ); + } else { + this.pos = eased = percent; + } + this.now = ( this.end - this.start ) * eased + this.start; + + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + if ( hooks && hooks.set ) { + hooks.set( this ); + } else { + Tween.propHooks._default.set( this ); + } + return this; + } +}; + +Tween.prototype.init.prototype = Tween.prototype; + +Tween.propHooks = { + _default: { + get: function( tween ) { + var result; + + // Use a property on the element directly when it is not a DOM element, + // or when there is no matching style property that exists. + if ( tween.elem.nodeType !== 1 || + tween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) { + return tween.elem[ tween.prop ]; + } + + // Passing an empty string as a 3rd parameter to .css will automatically + // attempt a parseFloat and fallback to a string if the parse fails. + // Simple values such as "10px" are parsed to Float; + // complex values such as "rotate(1rad)" are returned as-is. + result = jQuery.css( tween.elem, tween.prop, "" ); + + // Empty strings, null, undefined and "auto" are converted to 0. + return !result || result === "auto" ? 0 : result; + }, + set: function( tween ) { + + // Use step hook for back compat. + // Use cssHook if its there. + // Use .style if available and use plain properties where available. + if ( jQuery.fx.step[ tween.prop ] ) { + jQuery.fx.step[ tween.prop ]( tween ); + } else if ( tween.elem.nodeType === 1 && ( + jQuery.cssHooks[ tween.prop ] || + tween.elem.style[ finalPropName( tween.prop ) ] != null ) ) { + jQuery.style( tween.elem, tween.prop, tween.now + tween.unit ); + } else { + tween.elem[ tween.prop ] = tween.now; + } + } + } +}; + +// Support: IE <=9 only +// Panic based approach to setting things on disconnected nodes +Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = { + set: function( tween ) { + if ( tween.elem.nodeType && tween.elem.parentNode ) { + tween.elem[ tween.prop ] = tween.now; + } + } +}; + +jQuery.easing = { + linear: function( p ) { + return p; + }, + swing: function( p ) { + return 0.5 - Math.cos( p * Math.PI ) / 2; + }, + _default: "swing" +}; + +jQuery.fx = Tween.prototype.init; + +// Back compat <1.8 extension point +jQuery.fx.step = {}; + + + + +var + fxNow, inProgress, + rfxtypes = /^(?:toggle|show|hide)$/, + rrun = /queueHooks$/; + +function schedule() { + if ( inProgress ) { + if ( document.hidden === false && window.requestAnimationFrame ) { + window.requestAnimationFrame( schedule ); + } else { + window.setTimeout( schedule, jQuery.fx.interval ); + } + + jQuery.fx.tick(); + } +} + +// Animations created synchronously will run synchronously +function createFxNow() { + window.setTimeout( function() { + fxNow = undefined; + } ); + return ( fxNow = Date.now() ); +} + +// Generate parameters to create a standard animation +function genFx( type, includeWidth ) { + var which, + i = 0, + attrs = { height: type }; + + // If we include width, step value is 1 to do all cssExpand values, + // otherwise step value is 2 to skip over Left and Right + includeWidth = includeWidth ? 1 : 0; + for ( ; i < 4; i += 2 - includeWidth ) { + which = cssExpand[ i ]; + attrs[ "margin" + which ] = attrs[ "padding" + which ] = type; + } + + if ( includeWidth ) { + attrs.opacity = attrs.width = type; + } + + return attrs; +} + +function createTween( value, prop, animation ) { + var tween, + collection = ( Animation.tweeners[ prop ] || [] ).concat( Animation.tweeners[ "*" ] ), + index = 0, + length = collection.length; + for ( ; index < length; index++ ) { + if ( ( tween = collection[ index ].call( animation, prop, value ) ) ) { + + // We're done with this property + return tween; + } + } +} + +function defaultPrefilter( elem, props, opts ) { + var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display, + isBox = "width" in props || "height" in props, + anim = this, + orig = {}, + style = elem.style, + hidden = elem.nodeType && isHiddenWithinTree( elem ), + dataShow = dataPriv.get( elem, "fxshow" ); + + // Queue-skipping animations hijack the fx hooks + if ( !opts.queue ) { + hooks = jQuery._queueHooks( elem, "fx" ); + if ( hooks.unqueued == null ) { + hooks.unqueued = 0; + oldfire = hooks.empty.fire; + hooks.empty.fire = function() { + if ( !hooks.unqueued ) { + oldfire(); + } + }; + } + hooks.unqueued++; + + anim.always( function() { + + // Ensure the complete handler is called before this completes + anim.always( function() { + hooks.unqueued--; + if ( !jQuery.queue( elem, "fx" ).length ) { + hooks.empty.fire(); + } + } ); + } ); + } + + // Detect show/hide animations + for ( prop in props ) { + value = props[ prop ]; + if ( rfxtypes.test( value ) ) { + delete props[ prop ]; + toggle = toggle || value === "toggle"; + if ( value === ( hidden ? "hide" : "show" ) ) { + + // Pretend to be hidden if this is a "show" and + // there is still data from a stopped show/hide + if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) { + hidden = true; + + // Ignore all other no-op show/hide data + } else { + continue; + } + } + orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop ); + } + } + + // Bail out if this is a no-op like .hide().hide() + propTween = !jQuery.isEmptyObject( props ); + if ( !propTween && jQuery.isEmptyObject( orig ) ) { + return; + } + + // Restrict "overflow" and "display" styles during box animations + if ( isBox && elem.nodeType === 1 ) { + + // Support: IE <=9 - 11, Edge 12 - 15 + // Record all 3 overflow attributes because IE does not infer the shorthand + // from identically-valued overflowX and overflowY and Edge just mirrors + // the overflowX value there. + opts.overflow = [ style.overflow, style.overflowX, style.overflowY ]; + + // Identify a display type, preferring old show/hide data over the CSS cascade + restoreDisplay = dataShow && dataShow.display; + if ( restoreDisplay == null ) { + restoreDisplay = dataPriv.get( elem, "display" ); + } + display = jQuery.css( elem, "display" ); + if ( display === "none" ) { + if ( restoreDisplay ) { + display = restoreDisplay; + } else { + + // Get nonempty value(s) by temporarily forcing visibility + showHide( [ elem ], true ); + restoreDisplay = elem.style.display || restoreDisplay; + display = jQuery.css( elem, "display" ); + showHide( [ elem ] ); + } + } + + // Animate inline elements as inline-block + if ( display === "inline" || display === "inline-block" && restoreDisplay != null ) { + if ( jQuery.css( elem, "float" ) === "none" ) { + + // Restore the original display value at the end of pure show/hide animations + if ( !propTween ) { + anim.done( function() { + style.display = restoreDisplay; + } ); + if ( restoreDisplay == null ) { + display = style.display; + restoreDisplay = display === "none" ? "" : display; + } + } + style.display = "inline-block"; + } + } + } + + if ( opts.overflow ) { + style.overflow = "hidden"; + anim.always( function() { + style.overflow = opts.overflow[ 0 ]; + style.overflowX = opts.overflow[ 1 ]; + style.overflowY = opts.overflow[ 2 ]; + } ); + } + + // Implement show/hide animations + propTween = false; + for ( prop in orig ) { + + // General show/hide setup for this element animation + if ( !propTween ) { + if ( dataShow ) { + if ( "hidden" in dataShow ) { + hidden = dataShow.hidden; + } + } else { + dataShow = dataPriv.access( elem, "fxshow", { display: restoreDisplay } ); + } + + // Store hidden/visible for toggle so `.stop().toggle()` "reverses" + if ( toggle ) { + dataShow.hidden = !hidden; + } + + // Show elements before animating them + if ( hidden ) { + showHide( [ elem ], true ); + } + + /* eslint-disable no-loop-func */ + + anim.done( function() { + + /* eslint-enable no-loop-func */ + + // The final step of a "hide" animation is actually hiding the element + if ( !hidden ) { + showHide( [ elem ] ); + } + dataPriv.remove( elem, "fxshow" ); + for ( prop in orig ) { + jQuery.style( elem, prop, orig[ prop ] ); + } + } ); + } + + // Per-property setup + propTween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim ); + if ( !( prop in dataShow ) ) { + dataShow[ prop ] = propTween.start; + if ( hidden ) { + propTween.end = propTween.start; + propTween.start = 0; + } + } + } +} + +function propFilter( props, specialEasing ) { + var index, name, easing, value, hooks; + + // camelCase, specialEasing and expand cssHook pass + for ( index in props ) { + name = camelCase( index ); + easing = specialEasing[ name ]; + value = props[ index ]; + if ( Array.isArray( value ) ) { + easing = value[ 1 ]; + value = props[ index ] = value[ 0 ]; + } + + if ( index !== name ) { + props[ name ] = value; + delete props[ index ]; + } + + hooks = jQuery.cssHooks[ name ]; + if ( hooks && "expand" in hooks ) { + value = hooks.expand( value ); + delete props[ name ]; + + // Not quite $.extend, this won't overwrite existing keys. + // Reusing 'index' because we have the correct "name" + for ( index in value ) { + if ( !( index in props ) ) { + props[ index ] = value[ index ]; + specialEasing[ index ] = easing; + } + } + } else { + specialEasing[ name ] = easing; + } + } +} + +function Animation( elem, properties, options ) { + var result, + stopped, + index = 0, + length = Animation.prefilters.length, + deferred = jQuery.Deferred().always( function() { + + // Don't match elem in the :animated selector + delete tick.elem; + } ), + tick = function() { + if ( stopped ) { + return false; + } + var currentTime = fxNow || createFxNow(), + remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ), + + // Support: Android 2.3 only + // Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (trac-12497) + temp = remaining / animation.duration || 0, + percent = 1 - temp, + index = 0, + length = animation.tweens.length; + + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( percent ); + } + + deferred.notifyWith( elem, [ animation, percent, remaining ] ); + + // If there's more to do, yield + if ( percent < 1 && length ) { + return remaining; + } + + // If this was an empty animation, synthesize a final progress notification + if ( !length ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + } + + // Resolve the animation and report its conclusion + deferred.resolveWith( elem, [ animation ] ); + return false; + }, + animation = deferred.promise( { + elem: elem, + props: jQuery.extend( {}, properties ), + opts: jQuery.extend( true, { + specialEasing: {}, + easing: jQuery.easing._default + }, options ), + originalProperties: properties, + originalOptions: options, + startTime: fxNow || createFxNow(), + duration: options.duration, + tweens: [], + createTween: function( prop, end ) { + var tween = jQuery.Tween( elem, animation.opts, prop, end, + animation.opts.specialEasing[ prop ] || animation.opts.easing ); + animation.tweens.push( tween ); + return tween; + }, + stop: function( gotoEnd ) { + var index = 0, + + // If we are going to the end, we want to run all the tweens + // otherwise we skip this part + length = gotoEnd ? animation.tweens.length : 0; + if ( stopped ) { + return this; + } + stopped = true; + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( 1 ); + } + + // Resolve when we played the last frame; otherwise, reject + if ( gotoEnd ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + deferred.resolveWith( elem, [ animation, gotoEnd ] ); + } else { + deferred.rejectWith( elem, [ animation, gotoEnd ] ); + } + return this; + } + } ), + props = animation.props; + + propFilter( props, animation.opts.specialEasing ); + + for ( ; index < length; index++ ) { + result = Animation.prefilters[ index ].call( animation, elem, props, animation.opts ); + if ( result ) { + if ( isFunction( result.stop ) ) { + jQuery._queueHooks( animation.elem, animation.opts.queue ).stop = + result.stop.bind( result ); + } + return result; + } + } + + jQuery.map( props, createTween, animation ); + + if ( isFunction( animation.opts.start ) ) { + animation.opts.start.call( elem, animation ); + } + + // Attach callbacks from options + animation + .progress( animation.opts.progress ) + .done( animation.opts.done, animation.opts.complete ) + .fail( animation.opts.fail ) + .always( animation.opts.always ); + + jQuery.fx.timer( + jQuery.extend( tick, { + elem: elem, + anim: animation, + queue: animation.opts.queue + } ) + ); + + return animation; +} + +jQuery.Animation = jQuery.extend( Animation, { + + tweeners: { + "*": [ function( prop, value ) { + var tween = this.createTween( prop, value ); + adjustCSS( tween.elem, prop, rcssNum.exec( value ), tween ); + return tween; + } ] + }, + + tweener: function( props, callback ) { + if ( isFunction( props ) ) { + callback = props; + props = [ "*" ]; + } else { + props = props.match( rnothtmlwhite ); + } + + var prop, + index = 0, + length = props.length; + + for ( ; index < length; index++ ) { + prop = props[ index ]; + Animation.tweeners[ prop ] = Animation.tweeners[ prop ] || []; + Animation.tweeners[ prop ].unshift( callback ); + } + }, + + prefilters: [ defaultPrefilter ], + + prefilter: function( callback, prepend ) { + if ( prepend ) { + Animation.prefilters.unshift( callback ); + } else { + Animation.prefilters.push( callback ); + } + } +} ); + +jQuery.speed = function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !isFunction( easing ) && easing + }; + + // Go to the end state if fx are off + if ( jQuery.fx.off ) { + opt.duration = 0; + + } else { + if ( typeof opt.duration !== "number" ) { + if ( opt.duration in jQuery.fx.speeds ) { + opt.duration = jQuery.fx.speeds[ opt.duration ]; + + } else { + opt.duration = jQuery.fx.speeds._default; + } + } + } + + // Normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function() { + if ( isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); + } + }; + + return opt; +}; + +jQuery.fn.extend( { + fadeTo: function( speed, to, easing, callback ) { + + // Show any hidden elements after setting opacity to 0 + return this.filter( isHiddenWithinTree ).css( "opacity", 0 ).show() + + // Animate to the value specified + .end().animate( { opacity: to }, speed, easing, callback ); + }, + animate: function( prop, speed, easing, callback ) { + var empty = jQuery.isEmptyObject( prop ), + optall = jQuery.speed( speed, easing, callback ), + doAnimation = function() { + + // Operate on a copy of prop so per-property easing won't be lost + var anim = Animation( this, jQuery.extend( {}, prop ), optall ); + + // Empty animations, or finishing resolves immediately + if ( empty || dataPriv.get( this, "finish" ) ) { + anim.stop( true ); + } + }; + + doAnimation.finish = doAnimation; + + return empty || optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); + }, + stop: function( type, clearQueue, gotoEnd ) { + var stopQueue = function( hooks ) { + var stop = hooks.stop; + delete hooks.stop; + stop( gotoEnd ); + }; + + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue ) { + this.queue( type || "fx", [] ); + } + + return this.each( function() { + var dequeue = true, + index = type != null && type + "queueHooks", + timers = jQuery.timers, + data = dataPriv.get( this ); + + if ( index ) { + if ( data[ index ] && data[ index ].stop ) { + stopQueue( data[ index ] ); + } + } else { + for ( index in data ) { + if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) { + stopQueue( data[ index ] ); + } + } + } + + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && + ( type == null || timers[ index ].queue === type ) ) { + + timers[ index ].anim.stop( gotoEnd ); + dequeue = false; + timers.splice( index, 1 ); + } + } + + // Start the next in the queue if the last step wasn't forced. + // Timers currently will call their complete callbacks, which + // will dequeue but only if they were gotoEnd. + if ( dequeue || !gotoEnd ) { + jQuery.dequeue( this, type ); + } + } ); + }, + finish: function( type ) { + if ( type !== false ) { + type = type || "fx"; + } + return this.each( function() { + var index, + data = dataPriv.get( this ), + queue = data[ type + "queue" ], + hooks = data[ type + "queueHooks" ], + timers = jQuery.timers, + length = queue ? queue.length : 0; + + // Enable finishing flag on private data + data.finish = true; + + // Empty the queue first + jQuery.queue( this, type, [] ); + + if ( hooks && hooks.stop ) { + hooks.stop.call( this, true ); + } + + // Look for any active animations, and finish them + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && timers[ index ].queue === type ) { + timers[ index ].anim.stop( true ); + timers.splice( index, 1 ); + } + } + + // Look for any animations in the old queue and finish them + for ( index = 0; index < length; index++ ) { + if ( queue[ index ] && queue[ index ].finish ) { + queue[ index ].finish.call( this ); + } + } + + // Turn off finishing flag + delete data.finish; + } ); + } +} ); + +jQuery.each( [ "toggle", "show", "hide" ], function( _i, name ) { + var cssFn = jQuery.fn[ name ]; + jQuery.fn[ name ] = function( speed, easing, callback ) { + return speed == null || typeof speed === "boolean" ? + cssFn.apply( this, arguments ) : + this.animate( genFx( name, true ), speed, easing, callback ); + }; +} ); + +// Generate shortcuts for custom animations +jQuery.each( { + slideDown: genFx( "show" ), + slideUp: genFx( "hide" ), + slideToggle: genFx( "toggle" ), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +} ); + +jQuery.timers = []; +jQuery.fx.tick = function() { + var timer, + i = 0, + timers = jQuery.timers; + + fxNow = Date.now(); + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + + // Run the timer and safely remove it when done (allowing for external removal) + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + fxNow = undefined; +}; + +jQuery.fx.timer = function( timer ) { + jQuery.timers.push( timer ); + jQuery.fx.start(); +}; + +jQuery.fx.interval = 13; +jQuery.fx.start = function() { + if ( inProgress ) { + return; + } + + inProgress = true; + schedule(); +}; + +jQuery.fx.stop = function() { + inProgress = null; +}; + +jQuery.fx.speeds = { + slow: 600, + fast: 200, + + // Default speed + _default: 400 +}; + + +// Based off of the plugin by Clint Helfers, with permission. +jQuery.fn.delay = function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = window.setTimeout( next, time ); + hooks.stop = function() { + window.clearTimeout( timeout ); + }; + } ); +}; + + +( function() { + var input = document.createElement( "input" ), + select = document.createElement( "select" ), + opt = select.appendChild( document.createElement( "option" ) ); + + input.type = "checkbox"; + + // Support: Android <=4.3 only + // Default value for a checkbox should be "on" + support.checkOn = input.value !== ""; + + // Support: IE <=11 only + // Must access selectedIndex to make default options select + support.optSelected = opt.selected; + + // Support: IE <=11 only + // An input loses its value after becoming a radio + input = document.createElement( "input" ); + input.value = "t"; + input.type = "radio"; + support.radioValue = input.value === "t"; +} )(); + + +var boolHook, + attrHandle = jQuery.expr.attrHandle; + +jQuery.fn.extend( { + attr: function( name, value ) { + return access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, + + removeAttr: function( name ) { + return this.each( function() { + jQuery.removeAttr( this, name ); + } ); + } +} ); + +jQuery.extend( { + attr: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set attributes on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + // Attribute hooks are determined by the lowercase version + // Grab necessary hook if one is defined + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + hooks = jQuery.attrHooks[ name.toLowerCase() ] || + ( jQuery.expr.match.bool.test( name ) ? boolHook : undefined ); + } + + if ( value !== undefined ) { + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + } + + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + elem.setAttribute( name, value + "" ); + return value; + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + ret = jQuery.find.attr( elem, name ); + + // Non-existent attributes return null, we normalize to undefined + return ret == null ? undefined : ret; + }, + + attrHooks: { + type: { + set: function( elem, value ) { + if ( !support.radioValue && value === "radio" && + nodeName( elem, "input" ) ) { + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + } + }, + + removeAttr: function( elem, value ) { + var name, + i = 0, + + // Attribute names can contain non-HTML whitespace characters + // https://html.spec.whatwg.org/multipage/syntax.html#attributes-2 + attrNames = value && value.match( rnothtmlwhite ); + + if ( attrNames && elem.nodeType === 1 ) { + while ( ( name = attrNames[ i++ ] ) ) { + elem.removeAttribute( name ); + } + } + } +} ); + +// Hooks for boolean attributes +boolHook = { + set: function( elem, value, name ) { + if ( value === false ) { + + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + elem.setAttribute( name, name ); + } + return name; + } +}; + +jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( _i, name ) { + var getter = attrHandle[ name ] || jQuery.find.attr; + + attrHandle[ name ] = function( elem, name, isXML ) { + var ret, handle, + lowercaseName = name.toLowerCase(); + + if ( !isXML ) { + + // Avoid an infinite loop by temporarily removing this function from the getter + handle = attrHandle[ lowercaseName ]; + attrHandle[ lowercaseName ] = ret; + ret = getter( elem, name, isXML ) != null ? + lowercaseName : + null; + attrHandle[ lowercaseName ] = handle; + } + return ret; + }; +} ); + + + + +var rfocusable = /^(?:input|select|textarea|button)$/i, + rclickable = /^(?:a|area)$/i; + +jQuery.fn.extend( { + prop: function( name, value ) { + return access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, + + removeProp: function( name ) { + return this.each( function() { + delete this[ jQuery.propFix[ name ] || name ]; + } ); + } +} ); + +jQuery.extend( { + prop: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set properties on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + return ( elem[ name ] = value ); + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + return elem[ name ]; + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + + // Support: IE <=9 - 11 only + // elem.tabIndex doesn't always return the + // correct value when it hasn't been explicitly set + // Use proper attribute retrieval (trac-12072) + var tabindex = jQuery.find.attr( elem, "tabindex" ); + + if ( tabindex ) { + return parseInt( tabindex, 10 ); + } + + if ( + rfocusable.test( elem.nodeName ) || + rclickable.test( elem.nodeName ) && + elem.href + ) { + return 0; + } + + return -1; + } + } + }, + + propFix: { + "for": "htmlFor", + "class": "className" + } +} ); + +// Support: IE <=11 only +// Accessing the selectedIndex property +// forces the browser to respect setting selected +// on the option +// The getter ensures a default option is selected +// when in an optgroup +// eslint rule "no-unused-expressions" is disabled for this code +// since it considers such accessions noop +if ( !support.optSelected ) { + jQuery.propHooks.selected = { + get: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent && parent.parentNode ) { + parent.parentNode.selectedIndex; + } + return null; + }, + set: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent ) { + parent.selectedIndex; + + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + } + }; +} + +jQuery.each( [ + "tabIndex", + "readOnly", + "maxLength", + "cellSpacing", + "cellPadding", + "rowSpan", + "colSpan", + "useMap", + "frameBorder", + "contentEditable" +], function() { + jQuery.propFix[ this.toLowerCase() ] = this; +} ); + + + + + // Strip and collapse whitespace according to HTML spec + // https://infra.spec.whatwg.org/#strip-and-collapse-ascii-whitespace + function stripAndCollapse( value ) { + var tokens = value.match( rnothtmlwhite ) || []; + return tokens.join( " " ); + } + + +function getClass( elem ) { + return elem.getAttribute && elem.getAttribute( "class" ) || ""; +} + +function classesToArray( value ) { + if ( Array.isArray( value ) ) { + return value; + } + if ( typeof value === "string" ) { + return value.match( rnothtmlwhite ) || []; + } + return []; +} + +jQuery.fn.extend( { + addClass: function( value ) { + var classNames, cur, curValue, className, i, finalValue; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).addClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + classNames = classesToArray( value ); + + if ( classNames.length ) { + return this.each( function() { + curValue = getClass( this ); + cur = this.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + for ( i = 0; i < classNames.length; i++ ) { + className = classNames[ i ]; + if ( cur.indexOf( " " + className + " " ) < 0 ) { + cur += className + " "; + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + this.setAttribute( "class", finalValue ); + } + } + } ); + } + + return this; + }, + + removeClass: function( value ) { + var classNames, cur, curValue, className, i, finalValue; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).removeClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + if ( !arguments.length ) { + return this.attr( "class", "" ); + } + + classNames = classesToArray( value ); + + if ( classNames.length ) { + return this.each( function() { + curValue = getClass( this ); + + // This expression is here for better compressibility (see addClass) + cur = this.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + for ( i = 0; i < classNames.length; i++ ) { + className = classNames[ i ]; + + // Remove *all* instances + while ( cur.indexOf( " " + className + " " ) > -1 ) { + cur = cur.replace( " " + className + " ", " " ); + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + this.setAttribute( "class", finalValue ); + } + } + } ); + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var classNames, className, i, self, + type = typeof value, + isValidValue = type === "string" || Array.isArray( value ); + + if ( isFunction( value ) ) { + return this.each( function( i ) { + jQuery( this ).toggleClass( + value.call( this, i, getClass( this ), stateVal ), + stateVal + ); + } ); + } + + if ( typeof stateVal === "boolean" && isValidValue ) { + return stateVal ? this.addClass( value ) : this.removeClass( value ); + } + + classNames = classesToArray( value ); + + return this.each( function() { + if ( isValidValue ) { + + // Toggle individual class names + self = jQuery( this ); + + for ( i = 0; i < classNames.length; i++ ) { + className = classNames[ i ]; + + // Check each className given, space separated list + if ( self.hasClass( className ) ) { + self.removeClass( className ); + } else { + self.addClass( className ); + } + } + + // Toggle whole class name + } else if ( value === undefined || type === "boolean" ) { + className = getClass( this ); + if ( className ) { + + // Store className if set + dataPriv.set( this, "__className__", className ); + } + + // If the element has a class name or if we're passed `false`, + // then remove the whole classname (if there was one, the above saved it). + // Otherwise bring back whatever was previously saved (if anything), + // falling back to the empty string if nothing was stored. + if ( this.setAttribute ) { + this.setAttribute( "class", + className || value === false ? + "" : + dataPriv.get( this, "__className__" ) || "" + ); + } + } + } ); + }, + + hasClass: function( selector ) { + var className, elem, + i = 0; + + className = " " + selector + " "; + while ( ( elem = this[ i++ ] ) ) { + if ( elem.nodeType === 1 && + ( " " + stripAndCollapse( getClass( elem ) ) + " " ).indexOf( className ) > -1 ) { + return true; + } + } + + return false; + } +} ); + + + + +var rreturn = /\r/g; + +jQuery.fn.extend( { + val: function( value ) { + var hooks, ret, valueIsFunction, + elem = this[ 0 ]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || + jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( hooks && + "get" in hooks && + ( ret = hooks.get( elem, "value" ) ) !== undefined + ) { + return ret; + } + + ret = elem.value; + + // Handle most common string cases + if ( typeof ret === "string" ) { + return ret.replace( rreturn, "" ); + } + + // Handle cases where value is null/undef or number + return ret == null ? "" : ret; + } + + return; + } + + valueIsFunction = isFunction( value ); + + return this.each( function( i ) { + var val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( valueIsFunction ) { + val = value.call( this, i, jQuery( this ).val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + + } else if ( typeof val === "number" ) { + val += ""; + + } else if ( Array.isArray( val ) ) { + val = jQuery.map( val, function( value ) { + return value == null ? "" : value + ""; + } ); + } + + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !( "set" in hooks ) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + } ); + } +} ); + +jQuery.extend( { + valHooks: { + option: { + get: function( elem ) { + + var val = jQuery.find.attr( elem, "value" ); + return val != null ? + val : + + // Support: IE <=10 - 11 only + // option.text throws exceptions (trac-14686, trac-14858) + // Strip and collapse whitespace + // https://html.spec.whatwg.org/#strip-and-collapse-whitespace + stripAndCollapse( jQuery.text( elem ) ); + } + }, + select: { + get: function( elem ) { + var value, option, i, + options = elem.options, + index = elem.selectedIndex, + one = elem.type === "select-one", + values = one ? null : [], + max = one ? index + 1 : options.length; + + if ( index < 0 ) { + i = max; + + } else { + i = one ? index : 0; + } + + // Loop through all the selected options + for ( ; i < max; i++ ) { + option = options[ i ]; + + // Support: IE <=9 only + // IE8-9 doesn't update selected after form reset (trac-2551) + if ( ( option.selected || i === index ) && + + // Don't return options that are disabled or in a disabled optgroup + !option.disabled && + ( !option.parentNode.disabled || + !nodeName( option.parentNode, "optgroup" ) ) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + }, + + set: function( elem, value ) { + var optionSet, option, + options = elem.options, + values = jQuery.makeArray( value ), + i = options.length; + + while ( i-- ) { + option = options[ i ]; + + /* eslint-disable no-cond-assign */ + + if ( option.selected = + jQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1 + ) { + optionSet = true; + } + + /* eslint-enable no-cond-assign */ + } + + // Force browsers to behave consistently when non-matching value is set + if ( !optionSet ) { + elem.selectedIndex = -1; + } + return values; + } + } + } +} ); + +// Radios and checkboxes getter/setter +jQuery.each( [ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + set: function( elem, value ) { + if ( Array.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 ); + } + } + }; + if ( !support.checkOn ) { + jQuery.valHooks[ this ].get = function( elem ) { + return elem.getAttribute( "value" ) === null ? "on" : elem.value; + }; + } +} ); + + + + +// Return jQuery for attributes-only inclusion +var location = window.location; + +var nonce = { guid: Date.now() }; + +var rquery = ( /\?/ ); + + + +// Cross-browser xml parsing +jQuery.parseXML = function( data ) { + var xml, parserErrorElem; + if ( !data || typeof data !== "string" ) { + return null; + } + + // Support: IE 9 - 11 only + // IE throws on parseFromString with invalid input. + try { + xml = ( new window.DOMParser() ).parseFromString( data, "text/xml" ); + } catch ( e ) {} + + parserErrorElem = xml && xml.getElementsByTagName( "parsererror" )[ 0 ]; + if ( !xml || parserErrorElem ) { + jQuery.error( "Invalid XML: " + ( + parserErrorElem ? + jQuery.map( parserErrorElem.childNodes, function( el ) { + return el.textContent; + } ).join( "\n" ) : + data + ) ); + } + return xml; +}; + + +var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + stopPropagationCallback = function( e ) { + e.stopPropagation(); + }; + +jQuery.extend( jQuery.event, { + + trigger: function( event, data, elem, onlyHandlers ) { + + var i, cur, tmp, bubbleType, ontype, handle, special, lastElement, + eventPath = [ elem || document ], + type = hasOwn.call( event, "type" ) ? event.type : event, + namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split( "." ) : []; + + cur = lastElement = tmp = elem = elem || document; + + // Don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "." ) > -1 ) { + + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split( "." ); + type = namespaces.shift(); + namespaces.sort(); + } + ontype = type.indexOf( ":" ) < 0 && "on" + type; + + // Caller can pass in a jQuery.Event object, Object, or just an event type string + event = event[ jQuery.expando ] ? + event : + new jQuery.Event( type, typeof event === "object" && event ); + + // Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true) + event.isTrigger = onlyHandlers ? 2 : 3; + event.namespace = namespaces.join( "." ); + event.rnamespace = event.namespace ? + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ) : + null; + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data == null ? + [ event ] : + jQuery.makeArray( data, [ event ] ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (trac-9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (trac-9724) + if ( !onlyHandlers && !special.noBubble && !isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + if ( !rfocusMorph.test( bubbleType + type ) ) { + cur = cur.parentNode; + } + for ( ; cur; cur = cur.parentNode ) { + eventPath.push( cur ); + tmp = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( tmp === ( elem.ownerDocument || document ) ) { + eventPath.push( tmp.defaultView || tmp.parentWindow || window ); + } + } + + // Fire handlers on the event path + i = 0; + while ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) { + lastElement = cur; + event.type = i > 1 ? + bubbleType : + special.bindType || type; + + // jQuery handler + handle = ( dataPriv.get( cur, "events" ) || Object.create( null ) )[ event.type ] && + dataPriv.get( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + + // Native handler + handle = ontype && cur[ ontype ]; + if ( handle && handle.apply && acceptData( cur ) ) { + event.result = handle.apply( cur, data ); + if ( event.result === false ) { + event.preventDefault(); + } + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( ( !special._default || + special._default.apply( eventPath.pop(), data ) === false ) && + acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name as the event. + // Don't do default actions on window, that's where global variables be (trac-6170) + if ( ontype && isFunction( elem[ type ] ) && !isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + tmp = elem[ ontype ]; + + if ( tmp ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + + if ( event.isPropagationStopped() ) { + lastElement.addEventListener( type, stopPropagationCallback ); + } + + elem[ type ](); + + if ( event.isPropagationStopped() ) { + lastElement.removeEventListener( type, stopPropagationCallback ); + } + + jQuery.event.triggered = undefined; + + if ( tmp ) { + elem[ ontype ] = tmp; + } + } + } + } + + return event.result; + }, + + // Piggyback on a donor event to simulate a different one + // Used only for `focus(in | out)` events + simulate: function( type, elem, event ) { + var e = jQuery.extend( + new jQuery.Event(), + event, + { + type: type, + isSimulated: true + } + ); + + jQuery.event.trigger( e, null, elem ); + } + +} ); + +jQuery.fn.extend( { + + trigger: function( type, data ) { + return this.each( function() { + jQuery.event.trigger( type, data, this ); + } ); + }, + triggerHandler: function( type, data ) { + var elem = this[ 0 ]; + if ( elem ) { + return jQuery.event.trigger( type, data, elem, true ); + } + } +} ); + + +var + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i, + rsubmittable = /^(?:input|select|textarea|keygen)/i; + +function buildParams( prefix, obj, traditional, add ) { + var name; + + if ( Array.isArray( obj ) ) { + + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + + // Item is non-scalar (array or object), encode its numeric index. + buildParams( + prefix + "[" + ( typeof v === "object" && v != null ? i : "" ) + "]", + v, + traditional, + add + ); + } + } ); + + } else if ( !traditional && toType( obj ) === "object" ) { + + // Serialize object item. + for ( name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + + // Serialize scalar item. + add( prefix, obj ); + } +} + +// Serialize an array of form elements or a set of +// key/values into a query string +jQuery.param = function( a, traditional ) { + var prefix, + s = [], + add = function( key, valueOrFunction ) { + + // If value is a function, invoke it and use its return value + var value = isFunction( valueOrFunction ) ? + valueOrFunction() : + valueOrFunction; + + s[ s.length ] = encodeURIComponent( key ) + "=" + + encodeURIComponent( value == null ? "" : value ); + }; + + if ( a == null ) { + return ""; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( Array.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + } ); + + } else { + + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ); +}; + +jQuery.fn.extend( { + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + serializeArray: function() { + return this.map( function() { + + // Can add propHook for "elements" to filter or add form elements + var elements = jQuery.prop( this, "elements" ); + return elements ? jQuery.makeArray( elements ) : this; + } ).filter( function() { + var type = this.type; + + // Use .is( ":disabled" ) so that fieldset[disabled] works + return this.name && !jQuery( this ).is( ":disabled" ) && + rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) && + ( this.checked || !rcheckableType.test( type ) ); + } ).map( function( _i, elem ) { + var val = jQuery( this ).val(); + + if ( val == null ) { + return null; + } + + if ( Array.isArray( val ) ) { + return jQuery.map( val, function( val ) { + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ); + } + + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ).get(); + } +} ); + + +var + r20 = /%20/g, + rhash = /#.*$/, + rantiCache = /([?&])_=[^&]*/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg, + + // trac-7653, trac-8125, trac-8152: local protocol detection + rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Avoid comment-prolog char sequence (trac-10098); must appease lint and evade compression + allTypes = "*/".concat( "*" ), + + // Anchor tag for parsing the document origin + originAnchor = document.createElement( "a" ); + +originAnchor.href = location.href; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + var dataType, + i = 0, + dataTypes = dataTypeExpression.toLowerCase().match( rnothtmlwhite ) || []; + + if ( isFunction( func ) ) { + + // For each dataType in the dataTypeExpression + while ( ( dataType = dataTypes[ i++ ] ) ) { + + // Prepend if requested + if ( dataType[ 0 ] === "+" ) { + dataType = dataType.slice( 1 ) || "*"; + ( structure[ dataType ] = structure[ dataType ] || [] ).unshift( func ); + + // Otherwise append + } else { + ( structure[ dataType ] = structure[ dataType ] || [] ).push( func ); + } + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) { + + var inspected = {}, + seekingTransport = ( structure === transports ); + + function inspect( dataType ) { + var selected; + inspected[ dataType ] = true; + jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) { + var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR ); + if ( typeof dataTypeOrTransport === "string" && + !seekingTransport && !inspected[ dataTypeOrTransport ] ) { + + options.dataTypes.unshift( dataTypeOrTransport ); + inspect( dataTypeOrTransport ); + return false; + } else if ( seekingTransport ) { + return !( selected = dataTypeOrTransport ); + } + } ); + return selected; + } + + return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" ); +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes trac-9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + + for ( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } + + return target; +} + +/* Handles responses to an ajax request: + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var ct, type, finalDataType, firstDataType, + contents = s.contents, + dataTypes = s.dataTypes; + + // Remove auto dataType and get content-type in the process + while ( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "Content-Type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[ 0 ] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +/* Chain conversions given the request and the original response + * Also sets the responseXXX fields on the jqXHR instance + */ +function ajaxConvert( s, response, jqXHR, isSuccess ) { + var conv2, current, conv, tmp, prev, + converters = {}, + + // Work with a copy of dataTypes in case we need to modify it for conversion + dataTypes = s.dataTypes.slice(); + + // Create converters map with lowercased keys + if ( dataTypes[ 1 ] ) { + for ( conv in s.converters ) { + converters[ conv.toLowerCase() ] = s.converters[ conv ]; + } + } + + current = dataTypes.shift(); + + // Convert to each sequential dataType + while ( current ) { + + if ( s.responseFields[ current ] ) { + jqXHR[ s.responseFields[ current ] ] = response; + } + + // Apply the dataFilter if provided + if ( !prev && isSuccess && s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + prev = current; + current = dataTypes.shift(); + + if ( current ) { + + // There's only work to do if current dataType is non-auto + if ( current === "*" ) { + + current = prev; + + // Convert response if prev dataType is non-auto and differs from current + } else if ( prev !== "*" && prev !== current ) { + + // Seek a direct converter + conv = converters[ prev + " " + current ] || converters[ "* " + current ]; + + // If none found, seek a pair + if ( !conv ) { + for ( conv2 in converters ) { + + // If conv2 outputs current + tmp = conv2.split( " " ); + if ( tmp[ 1 ] === current ) { + + // If prev can be converted to accepted input + conv = converters[ prev + " " + tmp[ 0 ] ] || + converters[ "* " + tmp[ 0 ] ]; + if ( conv ) { + + // Condense equivalence converters + if ( conv === true ) { + conv = converters[ conv2 ]; + + // Otherwise, insert the intermediate dataType + } else if ( converters[ conv2 ] !== true ) { + current = tmp[ 0 ]; + dataTypes.unshift( tmp[ 1 ] ); + } + break; + } + } + } + } + + // Apply converter (if not an equivalence) + if ( conv !== true ) { + + // Unless errors are allowed to bubble, catch and return them + if ( conv && s.throws ) { + response = conv( response ); + } else { + try { + response = conv( response ); + } catch ( e ) { + return { + state: "parsererror", + error: conv ? e : "No conversion from " + prev + " to " + current + }; + } + } + } + } + } + } + + return { state: "success", data: response }; +} + +jQuery.extend( { + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {}, + + ajaxSettings: { + url: location.href, + type: "GET", + isLocal: rlocalProtocol.test( location.protocol ), + global: true, + processData: true, + async: true, + contentType: "application/x-www-form-urlencoded; charset=UTF-8", + + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + throws: false, + traditional: false, + headers: {}, + */ + + accepts: { + "*": allTypes, + text: "text/plain", + html: "text/html", + xml: "application/xml, text/xml", + json: "application/json, text/javascript" + }, + + contents: { + xml: /\bxml\b/, + html: /\bhtml/, + json: /\bjson\b/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText", + json: "responseJSON" + }, + + // Data converters + // Keys separate source (or catchall "*") and destination types with a single space + converters: { + + // Convert anything to text + "* text": String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": JSON.parse, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + url: true, + context: true + } + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + return settings ? + + // Building a settings object + ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) : + + // Extending ajaxSettings + ajaxExtend( jQuery.ajaxSettings, target ); + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var transport, + + // URL without anti-cache param + cacheURL, + + // Response headers + responseHeadersString, + responseHeaders, + + // timeout handle + timeoutTimer, + + // Url cleanup var + urlAnchor, + + // Request state (becomes false upon send and true upon completion) + completed, + + // To know if global events are to be dispatched + fireGlobals, + + // Loop variable + i, + + // uncached part of the url + uncached, + + // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + + // Callbacks context + callbackContext = s.context || s, + + // Context for global events is callbackContext if it is a DOM node or jQuery collection + globalEventContext = s.context && + ( callbackContext.nodeType || callbackContext.jquery ) ? + jQuery( callbackContext ) : + jQuery.event, + + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks( "once memory" ), + + // Status-dependent callbacks + statusCode = s.statusCode || {}, + + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + + // Default abort message + strAbort = "canceled", + + // Fake xhr + jqXHR = { + readyState: 0, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( completed ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while ( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[ 1 ].toLowerCase() + " " ] = + ( responseHeaders[ match[ 1 ].toLowerCase() + " " ] || [] ) + .concat( match[ 2 ] ); + } + } + match = responseHeaders[ key.toLowerCase() + " " ]; + } + return match == null ? null : match.join( ", " ); + }, + + // Raw string + getAllResponseHeaders: function() { + return completed ? responseHeadersString : null; + }, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( completed == null ) { + name = requestHeadersNames[ name.toLowerCase() ] = + requestHeadersNames[ name.toLowerCase() ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( completed == null ) { + s.mimeType = type; + } + return this; + }, + + // Status-dependent callbacks + statusCode: function( map ) { + var code; + if ( map ) { + if ( completed ) { + + // Execute the appropriate callbacks + jqXHR.always( map[ jqXHR.status ] ); + } else { + + // Lazy-add the new callbacks in a way that preserves old ones + for ( code in map ) { + statusCode[ code ] = [ statusCode[ code ], map[ code ] ]; + } + } + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + var finalText = statusText || strAbort; + if ( transport ) { + transport.abort( finalText ); + } + done( 0, finalText ); + return this; + } + }; + + // Attach deferreds + deferred.promise( jqXHR ); + + // Add protocol if not provided (prefilters might expect it) + // Handle falsy url in the settings object (trac-10093: consistency with old signature) + // We also use the url parameter if available + s.url = ( ( url || s.url || location.href ) + "" ) + .replace( rprotocol, location.protocol + "//" ); + + // Alias method option to type as per ticket trac-12004 + s.type = options.method || options.type || s.method || s.type; + + // Extract dataTypes list + s.dataTypes = ( s.dataType || "*" ).toLowerCase().match( rnothtmlwhite ) || [ "" ]; + + // A cross-domain request is in order when the origin doesn't match the current origin. + if ( s.crossDomain == null ) { + urlAnchor = document.createElement( "a" ); + + // Support: IE <=8 - 11, Edge 12 - 15 + // IE throws exception on accessing the href property if url is malformed, + // e.g. http://example.com:80x/ + try { + urlAnchor.href = s.url; + + // Support: IE <=8 - 11 only + // Anchor's host property isn't correctly set when s.url is relative + urlAnchor.href = urlAnchor.href; + s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !== + urlAnchor.protocol + "//" + urlAnchor.host; + } catch ( e ) { + + // If there is an error parsing the URL, assume it is crossDomain, + // it can be rejected by the transport if it is invalid + s.crossDomain = true; + } + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefilter, stop there + if ( completed ) { + return jqXHR; + } + + // We can fire global events as of now if asked to + // Don't fire events if jQuery.event is undefined in an AMD-usage scenario (trac-15118) + fireGlobals = jQuery.event && s.global; + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Save the URL in case we're toying with the If-Modified-Since + // and/or If-None-Match header later on + // Remove hash to simplify url manipulation + cacheURL = s.url.replace( rhash, "" ); + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // Remember the hash so we can put it back + uncached = s.url.slice( cacheURL.length ); + + // If data is available and should be processed, append data to url + if ( s.data && ( s.processData || typeof s.data === "string" ) ) { + cacheURL += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data; + + // trac-9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Add or update anti-cache param if needed + if ( s.cache === false ) { + cacheURL = cacheURL.replace( rantiCache, "$1" ); + uncached = ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + ( nonce.guid++ ) + + uncached; + } + + // Put hash and anti-cache on the URL that will be requested (gh-1732) + s.url = cacheURL + uncached; + + // Change '%20' to '+' if this is encoded form body content (gh-2658) + } else if ( s.data && s.processData && + ( s.contentType || "" ).indexOf( "application/x-www-form-urlencoded" ) === 0 ) { + s.data = s.data.replace( r20, "+" ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + if ( jQuery.lastModified[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] ); + } + if ( jQuery.etag[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ? + s.accepts[ s.dataTypes[ 0 ] ] + + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && + ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || completed ) ) { + + // Abort if not done already and return + return jqXHR.abort(); + } + + // Aborting is no longer a cancellation + strAbort = "abort"; + + // Install callbacks on deferreds + completeDeferred.add( s.complete ); + jqXHR.done( s.success ); + jqXHR.fail( s.error ); + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + + // If request was aborted inside ajaxSend, stop there + if ( completed ) { + return jqXHR; + } + + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = window.setTimeout( function() { + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + completed = false; + transport.send( requestHeaders, done ); + } catch ( e ) { + + // Rethrow post-completion exceptions + if ( completed ) { + throw e; + } + + // Propagate others as results + done( -1, e ); + } + } + + // Callback for when everything is done + function done( status, nativeStatusText, responses, headers ) { + var isSuccess, success, error, response, modified, + statusText = nativeStatusText; + + // Ignore repeat invocations + if ( completed ) { + return; + } + + completed = true; + + // Clear timeout if it exists + if ( timeoutTimer ) { + window.clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + // Determine if successful + isSuccess = status >= 200 && status < 300 || status === 304; + + // Get response data + if ( responses ) { + response = ajaxHandleResponses( s, jqXHR, responses ); + } + + // Use a noop converter for missing script but not if jsonp + if ( !isSuccess && + jQuery.inArray( "script", s.dataTypes ) > -1 && + jQuery.inArray( "json", s.dataTypes ) < 0 ) { + s.converters[ "text script" ] = function() {}; + } + + // Convert no matter what (that way responseXXX fields are always set) + response = ajaxConvert( s, response, jqXHR, isSuccess ); + + // If successful, handle type chaining + if ( isSuccess ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + modified = jqXHR.getResponseHeader( "Last-Modified" ); + if ( modified ) { + jQuery.lastModified[ cacheURL ] = modified; + } + modified = jqXHR.getResponseHeader( "etag" ); + if ( modified ) { + jQuery.etag[ cacheURL ] = modified; + } + } + + // if no content + if ( status === 204 || s.type === "HEAD" ) { + statusText = "nocontent"; + + // if not modified + } else if ( status === 304 ) { + statusText = "notmodified"; + + // If we have data, let's convert it + } else { + statusText = response.state; + success = response.data; + error = response.error; + isSuccess = !error; + } + } else { + + // Extract error from statusText and normalize for non-aborts + error = statusText; + if ( status || !statusText ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = ( nativeStatusText || statusText ) + ""; + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError", + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + return jqXHR; + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + } +} ); + +jQuery.each( [ "get", "post" ], function( _i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + + // Shift arguments if data argument was omitted + if ( isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + // The url can be an options object (which then must have .url) + return jQuery.ajax( jQuery.extend( { + url: url, + type: method, + dataType: type, + data: data, + success: callback + }, jQuery.isPlainObject( url ) && url ) ); + }; +} ); + +jQuery.ajaxPrefilter( function( s ) { + var i; + for ( i in s.headers ) { + if ( i.toLowerCase() === "content-type" ) { + s.contentType = s.headers[ i ] || ""; + } + } +} ); + + +jQuery._evalUrl = function( url, options, doc ) { + return jQuery.ajax( { + url: url, + + // Make this explicit, since user can override this through ajaxSetup (trac-11264) + type: "GET", + dataType: "script", + cache: true, + async: false, + global: false, + + // Only evaluate the response if it is successful (gh-4126) + // dataFilter is not invoked for failure responses, so using it instead + // of the default converter is kludgy but it works. + converters: { + "text script": function() {} + }, + dataFilter: function( response ) { + jQuery.globalEval( response, options, doc ); + } + } ); +}; + + +jQuery.fn.extend( { + wrapAll: function( html ) { + var wrap; + + if ( this[ 0 ] ) { + if ( isFunction( html ) ) { + html = html.call( this[ 0 ] ); + } + + // The elements to wrap the target around + wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true ); + + if ( this[ 0 ].parentNode ) { + wrap.insertBefore( this[ 0 ] ); + } + + wrap.map( function() { + var elem = this; + + while ( elem.firstElementChild ) { + elem = elem.firstElementChild; + } + + return elem; + } ).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( isFunction( html ) ) { + return this.each( function( i ) { + jQuery( this ).wrapInner( html.call( this, i ) ); + } ); + } + + return this.each( function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + } ); + }, + + wrap: function( html ) { + var htmlIsFunction = isFunction( html ); + + return this.each( function( i ) { + jQuery( this ).wrapAll( htmlIsFunction ? html.call( this, i ) : html ); + } ); + }, + + unwrap: function( selector ) { + this.parent( selector ).not( "body" ).each( function() { + jQuery( this ).replaceWith( this.childNodes ); + } ); + return this; + } +} ); + + +jQuery.expr.pseudos.hidden = function( elem ) { + return !jQuery.expr.pseudos.visible( elem ); +}; +jQuery.expr.pseudos.visible = function( elem ) { + return !!( elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length ); +}; + + + + +jQuery.ajaxSettings.xhr = function() { + try { + return new window.XMLHttpRequest(); + } catch ( e ) {} +}; + +var xhrSuccessStatus = { + + // File protocol always yields status code 0, assume 200 + 0: 200, + + // Support: IE <=9 only + // trac-1450: sometimes IE returns 1223 when it should be 204 + 1223: 204 + }, + xhrSupported = jQuery.ajaxSettings.xhr(); + +support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported ); +support.ajax = xhrSupported = !!xhrSupported; + +jQuery.ajaxTransport( function( options ) { + var callback, errorCallback; + + // Cross domain only allowed if supported through XMLHttpRequest + if ( support.cors || xhrSupported && !options.crossDomain ) { + return { + send: function( headers, complete ) { + var i, + xhr = options.xhr(); + + xhr.open( + options.type, + options.url, + options.async, + options.username, + options.password + ); + + // Apply custom fields if provided + if ( options.xhrFields ) { + for ( i in options.xhrFields ) { + xhr[ i ] = options.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( options.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( options.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !options.crossDomain && !headers[ "X-Requested-With" ] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Set headers + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + + // Callback + callback = function( type ) { + return function() { + if ( callback ) { + callback = errorCallback = xhr.onload = + xhr.onerror = xhr.onabort = xhr.ontimeout = + xhr.onreadystatechange = null; + + if ( type === "abort" ) { + xhr.abort(); + } else if ( type === "error" ) { + + // Support: IE <=9 only + // On a manual native abort, IE9 throws + // errors on any property access that is not readyState + if ( typeof xhr.status !== "number" ) { + complete( 0, "error" ); + } else { + complete( + + // File: protocol always yields status 0; see trac-8605, trac-14207 + xhr.status, + xhr.statusText + ); + } + } else { + complete( + xhrSuccessStatus[ xhr.status ] || xhr.status, + xhr.statusText, + + // Support: IE <=9 only + // IE9 has no XHR2 but throws on binary (trac-11426) + // For XHR2 non-text, let the caller handle it (gh-2498) + ( xhr.responseType || "text" ) !== "text" || + typeof xhr.responseText !== "string" ? + { binary: xhr.response } : + { text: xhr.responseText }, + xhr.getAllResponseHeaders() + ); + } + } + }; + }; + + // Listen to events + xhr.onload = callback(); + errorCallback = xhr.onerror = xhr.ontimeout = callback( "error" ); + + // Support: IE 9 only + // Use onreadystatechange to replace onabort + // to handle uncaught aborts + if ( xhr.onabort !== undefined ) { + xhr.onabort = errorCallback; + } else { + xhr.onreadystatechange = function() { + + // Check readyState before timeout as it changes + if ( xhr.readyState === 4 ) { + + // Allow onerror to be called first, + // but that will not handle a native abort + // Also, save errorCallback to a variable + // as xhr.onerror cannot be accessed + window.setTimeout( function() { + if ( callback ) { + errorCallback(); + } + } ); + } + }; + } + + // Create the abort callback + callback = callback( "abort" ); + + try { + + // Do send the request (this may raise an exception) + xhr.send( options.hasContent && options.data || null ); + } catch ( e ) { + + // trac-14683: Only rethrow if this hasn't been notified as an error yet + if ( callback ) { + throw e; + } + } + }, + + abort: function() { + if ( callback ) { + callback(); + } + } + }; + } +} ); + + + + +// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432) +jQuery.ajaxPrefilter( function( s ) { + if ( s.crossDomain ) { + s.contents.script = false; + } +} ); + +// Install script dataType +jQuery.ajaxSetup( { + accepts: { + script: "text/javascript, application/javascript, " + + "application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /\b(?:java|ecma)script\b/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +} ); + +// Handle cache's special case and crossDomain +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + } +} ); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function( s ) { + + // This transport only deals with cross domain or forced-by-attrs requests + if ( s.crossDomain || s.scriptAttrs ) { + var script, callback; + return { + send: function( _, complete ) { + script = jQuery( " +@endpush diff --git a/resources/views/dashboard/ips/index.blade.php b/resources/views/dashboard/ips/index.blade.php new file mode 100644 index 0000000..a8a2e08 --- /dev/null +++ b/resources/views/dashboard/ips/index.blade.php @@ -0,0 +1,37 @@ +@extends('security::layouts.bootstrap.app') + +@section('content') +
+
+
+
+
+
+ @lang('security::dashboard.ips') ({{ $ipsCount }}) +
+ +
+
+ {!! $dataTable->table([ + 'class' => 'table table-striped table-bordered' + ]) !!} +
+
+
+
+
+@endsection + +@push('scripts') + {!! $dataTable->scripts() !!} + + +@endpush diff --git a/resources/views/dashboard/logs/index.blade.php b/resources/views/dashboard/logs/index.blade.php new file mode 100644 index 0000000..ecedab5 --- /dev/null +++ b/resources/views/dashboard/logs/index.blade.php @@ -0,0 +1,37 @@ +@extends('security::layouts.bootstrap.app') + +@section('content') +
+
+
+
+
+
+ @lang('security::dashboard.logs') ({{ $logsCount }}) +
+ +
+
+ {!! $dataTable->table([ + 'class' => 'table table-striped table-bordered' + ]) !!} +
+
+
+
+
+@endsection + +@push('scripts') + {!! $dataTable->scripts() !!} + + +@endpush diff --git a/resources/views/datatables/template.blade.php b/resources/views/datatables/template.blade.php new file mode 100644 index 0000000..2164fbc --- /dev/null +++ b/resources/views/datatables/template.blade.php @@ -0,0 +1,4 @@ +$(function(){ + window.DataTables = window.DataTables || {}; + window.DataTables["%1$s"] = $("#%1$s").DataTable(%2$s); +}); diff --git a/resources/views/layouts/bootstrap/_navbar.blade.php b/resources/views/layouts/bootstrap/_navbar.blade.php new file mode 100644 index 0000000..75ef30b --- /dev/null +++ b/resources/views/layouts/bootstrap/_navbar.blade.php @@ -0,0 +1,40 @@ + diff --git a/resources/views/layouts/bootstrap/_theme-switcher.blade.php b/resources/views/layouts/bootstrap/_theme-switcher.blade.php new file mode 100644 index 0000000..38b00c6 --- /dev/null +++ b/resources/views/layouts/bootstrap/_theme-switcher.blade.php @@ -0,0 +1,129 @@ + +
    +
  • + +
    • +
  • + +
    • +
  • + +
    • +
+ +@push('scripts') + + +@endpush diff --git a/resources/views/layouts/bootstrap/app.blade.php b/resources/views/layouts/bootstrap/app.blade.php new file mode 100644 index 0000000..6bf9dda --- /dev/null +++ b/resources/views/layouts/bootstrap/app.blade.php @@ -0,0 +1,57 @@ + + + + + + + + + + @yield('title', 'Dashboard') • Laravel Security + + + + + + + + + + + + + + + + + + @stack('head') + + + + @include('security::layouts.bootstrap._navbar') + + +
+ + @yield('content') +
+ + + + + + @stack('scripts') + + diff --git a/resources/views/layouts/bootstrap/outdated.blade.php b/resources/views/layouts/bootstrap/outdated.blade.php new file mode 100644 index 0000000..471b0f5 --- /dev/null +++ b/resources/views/layouts/bootstrap/outdated.blade.php @@ -0,0 +1,72 @@ + + + + + + + + + + Out of Date • Laravel Security + + + + + + + + + + + +
+ +
+ + diff --git a/resources/views/notifications/button.blade.php b/resources/views/notifications/button.blade.php new file mode 100644 index 0000000..4a9bf7d --- /dev/null +++ b/resources/views/notifications/button.blade.php @@ -0,0 +1,24 @@ +@props([ + 'url', + 'color' => 'primary', + 'align' => 'center', +]) + + + + + diff --git a/resources/views/notifications/footer.blade.php b/resources/views/notifications/footer.blade.php new file mode 100644 index 0000000..3ff41f8 --- /dev/null +++ b/resources/views/notifications/footer.blade.php @@ -0,0 +1,11 @@ + + + + + + + + + diff --git a/resources/views/notifications/header.blade.php b/resources/views/notifications/header.blade.php new file mode 100644 index 0000000..9b8fca7 --- /dev/null +++ b/resources/views/notifications/header.blade.php @@ -0,0 +1,8 @@ +@props(['url']) + + + + + + + diff --git a/resources/views/notifications/layout.blade.php b/resources/views/notifications/layout.blade.php new file mode 100644 index 0000000..e55f6a6 --- /dev/null +++ b/resources/views/notifications/layout.blade.php @@ -0,0 +1,57 @@ + + + +{{ config('app.name') }} + + + + + + + + + + + + + + + diff --git a/resources/views/notifications/message.blade.php b/resources/views/notifications/message.blade.php new file mode 100644 index 0000000..30b92fe --- /dev/null +++ b/resources/views/notifications/message.blade.php @@ -0,0 +1,26 @@ + +{{-- Header --}} + +@component('security::notifications.header', ['url' => config('app.url')]) +@endcomponent + + +{{-- Body --}} +{{ $slot }} + +{{-- Subcopy --}} +@isset($subcopy) + + +{{ $subcopy }} + + +@endisset + +{{-- Footer --}} + + +© {{ date('Y') }} {{ config('app.name') }}. @lang('All rights reserved.') + + + diff --git a/resources/views/notifications/panel.blade.php b/resources/views/notifications/panel.blade.php new file mode 100644 index 0000000..2975a60 --- /dev/null +++ b/resources/views/notifications/panel.blade.php @@ -0,0 +1,14 @@ + + + + + + diff --git a/resources/views/notifications/security-report-notification.blade.php b/resources/views/notifications/security-report-notification.blade.php new file mode 100644 index 0000000..d8a178a --- /dev/null +++ b/resources/views/notifications/security-report-notification.blade.php @@ -0,0 +1,68 @@ +{{-- @formatter:off --}} +@component('security::notifications.message') + +{{-- Intro Lines --}} +@foreach ($introLines as $line) +{{ $line }} + +@endforeach + +

+ @lang('security::notifications.security_report.last_modified_files') +

+ + + + + + + + + + + @foreach($recentlyModifiedFiles as $file) + + + + + @endforeach + +
+ @lang('security::notifications.security_report.last_modification') + + @lang('security::notifications.security_report.file') +
{{ date('Y-m-d H:i:s', $file[1]) }}{{ str_replace(base_path(), '', $file[0]) }}
+ + +{{-- Outro Lines --}} +@foreach ($outroLines as $line) +{{ $line }} + +@endforeach + +{{-- Salutation --}} +@if (! empty($salutation)) +{{ $salutation }} +@else +@lang('Regards'),
+{{ config('app.name') }} +@endif + +{{-- Subcopy --}} +@isset($actionText) +@slot('subcopy') +@lang("If you're having trouble clicking the \":actionText\" button, copy and paste the URL below\n". +'into your web browser:', [ + 'actionText' => $actionText, +]) +[{{ $displayableActionUrl }}]({{ $actionUrl }}) +@endslot +@endisset + +{{-- Footer --}} +@slot('footer') +@component('mail::footer') +© {{ date('Y') }} **{{ config('app.name') }}**
+@endcomponent +@endslot +@endcomponent diff --git a/resources/views/notifications/subcopy.blade.php b/resources/views/notifications/subcopy.blade.php new file mode 100644 index 0000000..790ce6c --- /dev/null +++ b/resources/views/notifications/subcopy.blade.php @@ -0,0 +1,7 @@ + + + + + diff --git a/resources/views/notifications/table.blade.php b/resources/views/notifications/table.blade.php new file mode 100644 index 0000000..a5f3348 --- /dev/null +++ b/resources/views/notifications/table.blade.php @@ -0,0 +1,3 @@ +
+{{ Illuminate\Mail\Markdown::parse($slot) }} +
diff --git a/resources/views/notifications/themes/default.css b/resources/views/notifications/themes/default.css new file mode 100644 index 0000000..08469d6 --- /dev/null +++ b/resources/views/notifications/themes/default.css @@ -0,0 +1,319 @@ +/* Base */ + +body, +body *:not(html):not(style):not(br):not(tr):not(code) { + box-sizing: border-box; + font-family: -apple-system, BlinkMacSystemFont, 'Segoe UI', Roboto, Helvetica, Arial, sans-serif, + 'Apple Color Emoji', 'Segoe UI Emoji', 'Segoe UI Symbol'; + position: relative; +} + +body { + -webkit-text-size-adjust: none; + background-color: #ffffff; + color: #151515; + height: 100%; + line-height: 1.4; + margin: 0; + padding: 0; + width: 100% !important; +} + +p, +ul, +ol, +blockquote { + line-height: 1.4; + text-align: left; +} + +.text-left { + text-align: left; +} + +a { + color: #3869d4; +} + +a img { + border: none; +} + +/* Typography */ + +h1 { + color: #3d4852; + font-size: 16px; + font-weight: bold; + margin-top: 0; + text-align: left; +} + +h1.section-title { + margin-block-end: -1em; +} + +h2 { + font-size: 14px; + font-weight: bold; + margin-top: 0; + text-align: left; +} + +h3 { + font-size: 12px; + font-weight: bold; + margin-top: 0; + text-align: left; +} + +p { + font-size: 14px; + line-height: 1.5em; + margin-top: 0; + text-align: left; +} + +p.sub { + font-size: 10px; +} + +img { + max-width: 100%; +} + +/* Layout */ + +.wrapper { + -premailer-cellpadding: 0; + -premailer-cellspacing: 0; + -premailer-width: 100%; + background-color: #edf2f7; + margin: 0; + padding: 0; + width: 100%; +} + +.content { + -premailer-cellpadding: 0; + -premailer-cellspacing: 0; + -premailer-width: 100%; + margin: 0; + padding: 0; + width: 100%; +} + +/* Header */ + +.header { + padding: 25px 0; + text-align: center; +} + +.header a { + color: #3d4852; + font-size: 19px; + font-weight: bold; + text-decoration: none; +} + +/* Logo */ + +.logo { + height: 75px; + max-height: 75px; + width: 75px; +} + +/* Body */ + +.body { + -premailer-cellpadding: 0; + -premailer-cellspacing: 0; + -premailer-width: 100%; + background-color: #edf2f7; + border-bottom: 1px solid #edf2f7; + border-top: 1px solid #edf2f7; + margin: 0; + padding: 0; + width: 100%; +} + +.inner-body { + -premailer-cellpadding: 0; + -premailer-cellspacing: 0; + -premailer-width: 670px; + background-color: #ffffff; + border-color: #e8e5ef; + border-radius: 2px; + border-width: 1px; + box-shadow: 0 2px 0 rgba(0, 0, 150, 0.025), 2px 4px 0 rgba(0, 0, 150, 0.015); + margin: 0 auto; + padding: 0; + width: 670px; +} + +/* Subcopy */ + +.subcopy { + border-top: 1px solid #e8e5ef; + margin-top: 25px; + padding-top: 25px; +} + +.subcopy p { + font-size: 14px; +} + +/* Footer */ + +.footer { + -premailer-cellpadding: 0; + -premailer-cellspacing: 0; + -premailer-width: 670px; + margin: 0 auto; + padding: 0; + text-align: center; + width: 670px; +} + +.footer p { + color: #b0adc5; + font-size: 12px; + text-align: center; +} + +.footer a { + color: #b0adc5; + text-decoration: underline; +} + +/* Tables */ + +.table table { + -premailer-cellpadding: 0; + -premailer-cellspacing: 0; + -premailer-width: 100%; + margin: 30px auto; + width: 100%; +} + +.table .rmf { + border-spacing: 1px; +} + +.table .rmf th { + font-size: 14px; +} + +.table th { + background-color: #dcdcdc; + border-bottom: 1px solid #edeff2; + margin: 0; + padding: 4px; +} + +.white-space-nowrap { + white-space: nowrap; +} + +.table td { + color: #151515; + font-size: 13px; + line-height: 18px; + margin: 0; + padding: 4px; +} + +.table tr:nth-child(odd) td { + background-color: #f1f1f1; +} + +.table tr:nth-child(even) td { + background-color: #ececec; +} + +.content-cell { + max-width: 100vw; + padding: 32px; +} + +/* Buttons */ + +.action { + -premailer-cellpadding: 0; + -premailer-cellspacing: 0; + -premailer-width: 100%; + margin: 30px auto; + padding: 0; + text-align: center; + width: 100%; +} + +.button { + -webkit-text-size-adjust: none; + border-radius: 4px; + color: #fff; + display: inline-block; + overflow: hidden; + text-decoration: none; +} + +.button-blue, +.button-primary { + background-color: #2d3748; + border-bottom: 8px solid #2d3748; + border-left: 18px solid #2d3748; + border-right: 18px solid #2d3748; + border-top: 8px solid #2d3748; +} + +.button-green, +.button-success { + background-color: #48bb78; + border-bottom: 8px solid #48bb78; + border-left: 18px solid #48bb78; + border-right: 18px solid #48bb78; + border-top: 8px solid #48bb78; +} + +.button-red, +.button-error { + background-color: #e53e3e; + border-bottom: 8px solid #e53e3e; + border-left: 18px solid #e53e3e; + border-right: 18px solid #e53e3e; + border-top: 8px solid #e53e3e; +} + +/* Panels */ + +.panel { + border-left: #2d3748 solid 4px; + margin: 21px 0; +} + +.panel-content { + background-color: #edf2f7; + color: #718096; + padding: 16px; +} + +.panel-content p { + color: #718096; +} + +.panel-item { + padding: 0; +} + +.panel-item p:last-of-type { + margin-bottom: 0; + padding-bottom: 0; +} + +/* Utilities */ + +.break-all { + word-break: break-all; +} diff --git a/src/Abstracts/Middleware.php b/src/Abstracts/Middleware.php index dc4f010..45daacf 100644 --- a/src/Abstracts/Middleware.php +++ b/src/Abstracts/Middleware.php @@ -2,7 +2,7 @@ namespace OzanKurt\Security\Abstracts; -use OzanKurt\Security\Events\AttackDetected; +use OzanKurt\Security\Events\AttackDetectedEvent; use OzanKurt\Security\Traits\Helper; use Closure; use Illuminate\Support\Facades\Redirect; @@ -37,18 +37,30 @@ public function skip($request) $this->prepare($request); if ($this->isDisabled()) { + if ($this->middleware == 'xss') { + dump('isDisabled'); + } return true; } if ($this->isWhitelist()) { + if ($this->middleware == 'xss') { + dump('isWhitelist'); + } return true; } if (! $this->isMethod()) { + if ($this->middleware == 'xss') { + dump('isMethod'); + } return true; } if ($this->isRoute()) { + if ($this->middleware == 'xss') { + dump('isRoute'); + } return true; } @@ -78,7 +90,7 @@ public function check($patterns) $log = $this->log(); - event(new AttackDetected($log)); + event(new AttackDetectedEvent($log)); break; } diff --git a/src/Commands/SendSecurityReportNotificationCommand.php b/src/Commands/SendSecurityReportNotificationCommand.php new file mode 100644 index 0000000..894eb48 --- /dev/null +++ b/src/Commands/SendSecurityReportNotificationCommand.php @@ -0,0 +1,17 @@ +blocked()->each(function ($ip) use ($now) { if (empty($ip->log)) { return; diff --git a/src/DataTables/IpsDataTable.php b/src/DataTables/IpsDataTable.php new file mode 100644 index 0000000..29e1f06 --- /dev/null +++ b/src/DataTables/IpsDataTable.php @@ -0,0 +1,89 @@ +eloquent($query); + + $builder->addColumn('action', function (Ip $ip) { + return 'actions'; + }); + + $builder->editColumn('created_at', function (Ip $ip) { + return $ip->created_at ? $ip->created_at->format('Y-m-d H:i:s') : 'n/a'; + }); + $builder->editColumn('updated_at', function (Ip $ip) { + return $ip->updated_at ? $ip->updated_at->format('Y-m-d H:i:s') : 'n/a'; + }); + + // https://yajrabox.com/docs/laravel-datatables/master/row-options + $builder->setRowId('id'); + $builder->addIndexColumn(); + + $builder->rawColumns([ + 'actions', + ]); + + $builder->filter(function ($query) { + $filters = request('filters', []); + + if (empty($filters)) { + return; + } + + if (array_key_exists('roles', $filters)) { + $query->whereIn('role_id', $filters['roles']); + } + + $this->updateFilters(); + }, true); + + return $builder; + } + + public function query(): Builder + { + $model = config('security.database.ip.model', Ip::class); + + $query = $model::query(); + + return $query; + } + + public function html() + { + return $this->builder() + ->setTableId('ipsDataTable') + ->columns($this->getColumns()) + ->minifiedAjax(app('security')->route('ips.index', [ + 'mode' => 'dataTable', + ])) + ->orderBy(1) + ->responsive(true) + ->autoWidth(true) + ->setTemplate('security::datatables.template'); + } + + protected function getColumns(): array + { + return [ + Column::make('id')->class('all dtr-control'), + Column::make('ip')->class('all'), + Column::make('log_id')->class('all'), + Column::make('is_blocked')->class('all'), + Column::make('request_count')->class('none'), + Column::make('created_at')->class('none'), + Column::make('updated_at')->class('none'), + ]; + } +} diff --git a/src/DataTables/LogsDataTable.php b/src/DataTables/LogsDataTable.php new file mode 100644 index 0000000..4a8712d --- /dev/null +++ b/src/DataTables/LogsDataTable.php @@ -0,0 +1,101 @@ +eloquent($query); + + $builder->addColumn('action', function (Log $log) { + return 'actions'; + }); + + $builder->editColumn('created_at', function (Log $log) { + return $log->created_at ? $log->created_at->format('Y-m-d H:i:s') : 'n/a'; + }); + $builder->editColumn('updated_at', function (Log $log) { + return $log->updated_at ? $log->updated_at->format('Y-m-d H:i:s') : 'n/a'; + }); + + $builder->editColumn('request_data', function (Log $log) { + $dataJson = json_encode($log->request_data, JSON_PRETTY_PRINT); + $dataJson = htmlspecialchars($dataJson, ENT_QUOTES, 'UTF-8'); + + return '
' . $dataJson . '
'; + }); + + // https://yajrabox.com/docs/laravel-datatables/master/row-options + $builder->setRowId('id'); + $builder->addIndexColumn(); + + $builder->rawColumns([ + 'request_data', + 'actions', + ]); + + $builder->filter(function ($query) { + $filters = request('filters', []); + + if (empty($filters)) { + return; + } + + if (array_key_exists('roles', $filters)) { + $query->whereIn('role_id', $filters['roles']); + } + + $this->updateFilters(); + }, true); + + return $builder; + } + + public function query(): Builder + { + $model = config('security.database.log.model', Ip::class); + + $query = $model::query(); + + return $query; + } + + public function html() + { + return $this->builder() + ->setTableId('logsDataTable') + ->columns($this->getColumns()) + ->minifiedAjax(app('security')->route('logs.index', [ + 'mode' => 'dataTable', + ])) + ->orderBy(1) + ->responsive(true) + ->autoWidth(true) + ->setTemplate('security::datatables.template'); + } + + protected function getColumns(): array + { + return [ + Column::make('id')->class('all dtr-control'), + Column::make('user_id')->class('all'), + Column::make('middleware')->class('all'), + Column::make('level')->class('all'), + Column::make('ip')->class('all'), + Column::make('url')->class('all'), + Column::make('user_agent')->class('none'), + Column::make('referrer')->class('none'), + Column::make('request_data')->class('none'), + Column::make('created_at')->class('none'), + Column::make('updated_at')->class('none'), + ]; + } +} diff --git a/src/Events/AttackDetected.php b/src/Events/AttackDetectedEvent.php similarity index 88% rename from src/Events/AttackDetected.php rename to src/Events/AttackDetectedEvent.php index c1dc6f1..43e5e60 100644 --- a/src/Events/AttackDetected.php +++ b/src/Events/AttackDetectedEvent.php @@ -2,7 +2,7 @@ namespace OzanKurt\Security\Events; -class AttackDetected +class AttackDetectedEvent { public $log; diff --git a/src/Helpers/BladeEchoCleaner.php b/src/Helpers/BladeEchoCleaner.php new file mode 100644 index 0000000..4d09477 --- /dev/null +++ b/src/Helpers/BladeEchoCleaner.php @@ -0,0 +1,33 @@ +bladeEchoPatterns[] = sprintf('/(@)?%s\s*(.+?)\s*%s(\r?\n)?/s', $pair[0], $pair[1]); + } + + usort($this->bladeEchoPatterns, fn ($a, $b) => strlen($b) <=> strlen($a)); + } + + public function clean(string $value): string + { + foreach ($this->bladeEchoPatterns as $pattern) { + if (preg_match($pattern, $value, $matches)) { + return str_replace($matches[0], '', $value); + } + } + + return $value; + } +} diff --git a/src/Helpers/DirectoryIterator.php b/src/Helpers/DirectoryIterator.php new file mode 100644 index 0000000..9b9ea84 --- /dev/null +++ b/src/Helpers/DirectoryIterator.php @@ -0,0 +1,72 @@ +directory = $directory; + $this->directory_limit = $max_files_per_directory; + $this->max_iterations = $max_iterations; + } + + public function run(): void + { + $this->iterations = 0; + $this->scan($this->directory); + } + + protected function scan(string $dir): bool + { + $dir = rtrim($dir, DIRECTORY_SEPARATOR); + $handle = opendir($dir); + $file_count = 0; + while ($file = readdir($handle)) { + if ($file == '.' || $file == '..') { + continue; + } + $file_path = $dir . '/' . $file; + $real_path = realpath($file_path); + if (isset($this->directories_processed[$real_path]) || isset($this->directories_entered[$real_path])) { //Already processed or being processed, possibly a recursive symlink + continue; + } else if (is_dir($file_path)) { + $this->directories_entered[$real_path] = 1; + if ($this->scan($file_path) === false) { + closedir($handle); + return false; + } + $this->directories_processed[$real_path] = 1; + unset($this->directories_entered[$real_path]); + } else { + if ($this->file($file_path) === false) { + closedir($handle); + return false; + } + } + if (++$file_count >= $this->directory_limit) { + break; + } + if (++$this->iterations >= $this->max_iterations) { + closedir($handle); + return false; + } + } + closedir($handle); + return true; + } +} + diff --git a/src/Helpers/RecentlyModifiedFiles.php b/src/Helpers/RecentlyModifiedFiles.php new file mode 100644 index 0000000..b37e4e1 --- /dev/null +++ b/src/Helpers/RecentlyModifiedFiles.php @@ -0,0 +1,89 @@ +time_range = $time_range; + $excluded_directories = [ + '.idea', + '.git', + '.vitepress', + '.vscode', + 'vendor', + 'node_modules', + 'storage/logs', + 'storage/framework', + 'storage/debugbar', + ]; + $this->excluded_directories = []; + foreach ($excluded_directories as $index => $path) { + if (($dir = realpath($directory . '/' . $path)) !== false) { + $this->excluded_directories[$dir] = 1; + } + } + } + + protected function scan(string $dir): bool + { + if (!array_key_exists(realpath($dir), $this->excluded_directories)) { + return parent::scan($dir); + } + return true; + } + + public function file(string $file): void + { + $mtime = filemtime($file); + if (time() - $mtime < $this->time_range) { + $this->files[] = array($file, $mtime); + } + } + + public function mostRecentFiles(int $limit = 300): array + { + usort($this->files, array( + $this, + '_sortMostRecentFiles', + )); + + return array_slice($this->files, 0, $limit); + } + + /** + * Sort in descending order. + */ + private function _sortMostRecentFiles(mixed $a, mixed $b): int + { + if ($a[1] > $b[1]) { + return -1; + } + if ($a[1] < $b[1]) { + return 1; + } + return 0; + } + + public function getFiles(): mixed + { + return $this->files; + } +} diff --git a/src/Http/Controllers/DashboardController.php b/src/Http/Controllers/DashboardController.php new file mode 100644 index 0000000..c15aeac --- /dev/null +++ b/src/Http/Controllers/DashboardController.php @@ -0,0 +1,61 @@ +count(); + $requestsBlocked = Ip::blocked()->sum('request_count'); + + $recentlyModifiedFiles = app('security')->getRecentlyModifiedFiles(now()->subDays(7), 100); + + return view('security::dashboard.index')->with([ + 'attacksDetected' => $attacksDetected, + 'ipsBlocked' => $ipsBlocked, + 'requestsBlocked' => $requestsBlocked, + + 'recentlyModifiedFiles' => $recentlyModifiedFiles, + ]); + } + + public function whitelist() + { + return view('security::dashboard.whitelist'); + } + + public function whitelistStore() + { + return redirect()->route('security.whitelist'); + } + + public function whitelistDestroy() + { + return redirect()->route('security.whitelist'); + } + + public function blacklist() + { + return view('security::dashboard.blacklist'); + } + + public function blacklistStore() + { + return redirect()->route('security.blacklist'); + } + + public function blacklistDestroy() + { + return redirect()->route('security.blacklist'); + } +} diff --git a/src/Http/Controllers/IpsController.php b/src/Http/Controllers/IpsController.php new file mode 100644 index 0000000..bcad912 --- /dev/null +++ b/src/Http/Controllers/IpsController.php @@ -0,0 +1,29 @@ +ajax()) { + return $dataTable->ajax(); + } + + $ipsCount = Ip::count(); + + return view('security::dashboard.ips.index')->with([ + 'ipsCount' => $ipsCount, + 'dataTable' => $dataTable->html(), + ]); + } +} diff --git a/src/Http/Controllers/LogsController.php b/src/Http/Controllers/LogsController.php new file mode 100644 index 0000000..1126715 --- /dev/null +++ b/src/Http/Controllers/LogsController.php @@ -0,0 +1,29 @@ +ajax()) { + return $dataTable->ajax(); + } + + $logsCount = Log::count(); + + return view('security::dashboard.logs.index')->with([ + 'logsCount' => $logsCount, + 'dataTable' => $dataTable->html(), + ]); + } +} diff --git a/src/Http/Middleware/SecurityDashboardMiddleware.php b/src/Http/Middleware/SecurityDashboardMiddleware.php new file mode 100644 index 0000000..e1cd2e3 --- /dev/null +++ b/src/Http/Middleware/SecurityDashboardMiddleware.php @@ -0,0 +1,29 @@ +notify(new AttackDetected($event->log)); + (new Notifiable)->notify(new AttackDetectedNotification($event->log)); } catch (Throwable $e) { report($e); } diff --git a/src/Listeners/BlockIp.php b/src/Listeners/BlockIpListener.php similarity index 62% rename from src/Listeners/BlockIp.php rename to src/Listeners/BlockIpListener.php index 7f3be6d..05883a6 100644 --- a/src/Listeners/BlockIp.php +++ b/src/Listeners/BlockIpListener.php @@ -2,12 +2,12 @@ namespace OzanKurt\Security\Listeners; -use OzanKurt\Security\Events\AttackDetected; +use OzanKurt\Security\Events\AttackDetectedEvent; use OzanKurt\Security\Models\Ip; use OzanKurt\Security\Models\Log; use Carbon\Carbon; -class BlockIp +class BlockIpListener { /** * Handle the event. @@ -16,22 +16,25 @@ class BlockIp * * @return void */ - public function handle(AttackDetected $event) + public function handle(AttackDetectedEvent $event) { $end = Carbon::now(config('app.timezone')); - $start = $end->copy()->subSeconds(config('security.middleware.' . $event->log->middleware . '.auto_block.frequency')); + $middleware = $event->log->middleware ?? 'default'; + + $start = $end->copy()->subSeconds(config("security.middleware.{$middleware}.auto_block.frequency")); $log = config('security.database.log.model', Log::class); $count = $log::where('ip', $event->log->ip) - ->where('middleware', $event->log->middleware) + ->where('middleware', $middleware) ->whereBetween('created_at', [$start, $end]) ->count(); - if ($count < config('security.middleware.' . $event->log->middleware . '.auto_block.attempts')) { + if ($count < config("security.middleware.{$middleware}.auto_block.attempts")) { return; } $ip = config('security.database.ip.model', Ip::class); + $ip::create([ 'ip' => $event->log->ip, 'log_id' => $event->log->id, diff --git a/src/Listeners/CheckLogin.php b/src/Listeners/FailedLoginListener.php similarity index 84% rename from src/Listeners/CheckLogin.php rename to src/Listeners/FailedLoginListener.php index 3f75c31..28c2a20 100644 --- a/src/Listeners/CheckLogin.php +++ b/src/Listeners/FailedLoginListener.php @@ -2,11 +2,11 @@ namespace OzanKurt\Security\Listeners; -use OzanKurt\Security\Events\AttackDetected; +use OzanKurt\Security\Events\AttackDetectedEvent; use OzanKurt\Security\Traits\Helper; use Illuminate\Auth\Events\Failed as Event; -class CheckLogin +class FailedLoginListener { use Helper; @@ -24,7 +24,7 @@ public function handle(Event $event): void $log = $this->log(); - event(new AttackDetected($log)); + event(new AttackDetectedEvent($log)); } public function skip($event): bool diff --git a/src/Listeners/SuccessfulLogin.php b/src/Listeners/SuccessfulLoginListener.php similarity index 80% rename from src/Listeners/SuccessfulLogin.php rename to src/Listeners/SuccessfulLoginListener.php index 8a4ee72..91b6b66 100644 --- a/src/Listeners/SuccessfulLogin.php +++ b/src/Listeners/SuccessfulLoginListener.php @@ -4,8 +4,9 @@ use OzanKurt\Security\Traits\Helper; use Illuminate\Auth\Events\Failed as Event; +use OzanKurt\Security\Notifications\SuccessfulLoginNotification; -class SuccessfulLogin +class SuccessfulLoginListener { use Helper; @@ -22,7 +23,7 @@ public function handle(Event $event): void $this->request['password'] = '[redacted]'; try { - (new Notifiable)->notify(new SuccessfulLogin($event)); + (new Notifiable)->notify(new SuccessfulLoginNotification($event)); } catch (Throwable $e) { report($e); } diff --git a/src/Middleware/Ip.php b/src/Middleware/Ip.php index 8c038e8..8105e99 100644 --- a/src/Middleware/Ip.php +++ b/src/Middleware/Ip.php @@ -15,7 +15,12 @@ public function check($patterns) try { $ip = config('security.database.ip.model', Model::class); - $isBlocked = $ip::blocked($this->ip())->exists(); + $blockedIp = $ip::blocked($this->ip())->first(); + + if ($blockedIp) { + $blockedIp->increment('request_count'); + $isBlocked = true; + } } catch (QueryException $e) { // Base table or view not found //$isBlocked = ($e->getCode() == '42S02') ? false : true; diff --git a/src/Middleware/Keyword.php b/src/Middleware/Keyword.php index 6e5030b..93f9dd7 100644 --- a/src/Middleware/Keyword.php +++ b/src/Middleware/Keyword.php @@ -3,6 +3,7 @@ namespace OzanKurt\Security\Middleware; use OzanKurt\Security\Abstracts\Middleware; +use OzanKurt\Security\Events\AttackDetectedEvent; class Keyword extends Middleware { @@ -18,7 +19,7 @@ public function check($patterns) $log = $this->log(); - event(new AttackDetected($log)); + event(new AttackDetectedEvent($log)); break; } diff --git a/src/Middleware/Xss.php b/src/Middleware/Xss.php index f612c6d..559ea70 100644 --- a/src/Middleware/Xss.php +++ b/src/Middleware/Xss.php @@ -2,9 +2,157 @@ namespace OzanKurt\Security\Middleware; +use Closure; use OzanKurt\Security\Abstracts\Middleware; +use OzanKurt\Security\Events\AttackDetectedEvent; +use OzanKurt\Security\Security; +use OzanKurt\Security\Helpers\BladeEchoCleaner; +use Symfony\Component\HttpFoundation\File\UploadedFile; +use Symfony\Component\HttpFoundation\ParameterBag; class Xss extends Middleware { - // All done by parent class + public function __construct( + protected Security $security, + protected BladeEchoCleaner $bladeEchoCleaner, + ) { } + + /** + * Handle an incoming request. + * + * @param \Illuminate\Http\Request $request + * @param \Closure $next + * @return mixed + */ + public function handle($request, Closure $next) + { + if ($this->skip($request)) { + return $next($request); + } + + $mode = config('security.middleware.xss.mode', 'block'); + + $this->clean($request); + + if ($mode === 'block') { + if ($this->check($this->getPatterns())) { + return $this->respond(config('security.responses.block')); + } + } + + return $next($request); + } + + public function check($patterns) + { + $log = null; + + if ($this->security->antiXss->isXssFound()) { + $log = $this->log(); + + event(new AttackDetectedEvent($log)); + } else { + foreach ($patterns as $pattern) { + if (! $match = $this->match($pattern, $this->request->input())) { + continue; + } + + $log = $this->log(); + + event(new AttackDetectedEvent($log)); + + break; + } + } + + if ($log) { + return true; + } + + return false; + } + + /** + * Clean the request's data. + * + * @param \Illuminate\Http\Request $request + * @return void + */ + protected function clean($request) + { + $this->cleanParameterBag($request->query); + + if ($request->isJson()) { + $this->cleanParameterBag($request->json()); + } elseif ($request->request !== $request->query) { + $this->cleanParameterBag($request->request); + } + } + + /** + * Clean the data in the parameter bag. + * + * @param \Symfony\Component\HttpFoundation\ParameterBag $bag + * @return void + */ + protected function cleanParameterBag(ParameterBag $bag) + { + $bag->replace($this->cleanArray($bag->all())); + } + + /** + * Clean the data in the given array. + * + * @param array $data + * @param string $keyPrefix + * @return array + */ + protected function cleanArray(array $data, $keyPrefix = '') + { + foreach ($data as $key => $value) { + $data[$key] = $this->cleanValue($keyPrefix . $key, $value); + } + + return $data; + } + + /** + * Clean the given value. + * + * @param string $key + * @param mixed $value + * @return mixed + */ + protected function cleanValue($key, $value) + { + if (is_array($value)) { + return $this->cleanArray($value, $key . '.'); + } + + return $this->transform($key, $value); + } + + /** + * Transform the given value. + * + * @param string $key + * @param mixed $value + * @return mixed + */ + protected function transform($key, $value) + { + $output = $this->security->cleanInput((string) $value); + + if (! config('security.middleware.xss.allow_blade_echoes')) { + $output = $this->bladeEchoCleaner->clean((string) $output); + } + + if ($output === $value) { + return $output; + } + + $mode = config('security.middleware.xss.mode', 'block'); + + return $mode === 'clean' ? null : $value; + } } diff --git a/src/Models/Ip.php b/src/Models/Ip.php index bd9bd4e..ce54128 100644 --- a/src/Models/Ip.php +++ b/src/Models/Ip.php @@ -23,9 +23,14 @@ public function __construct(array $attributes = []) } if (! isset($this->table)) { - $this->setTable(config('security.database.tables.firewall_logs')); + $this->setTable(config('security.database.table_prefix').config('security.database.ip.table')); } + // add a scope to the model +// $this->addGlobalScope('test', function ($builder) { +// $builder->where('id', 0); +// }); + parent::__construct($attributes); } diff --git a/src/Models/Log.php b/src/Models/Log.php index 153b93a..0a873cc 100644 --- a/src/Models/Log.php +++ b/src/Models/Log.php @@ -23,7 +23,7 @@ public function __construct(array $attributes = []) } if (! isset($this->table)) { - $this->setTable(config('security.database.log.table')); + $this->setTable(config('security.database.table_prefix').config('security.database.log.table')); } parent::__construct($attributes); diff --git a/src/Notifications/AttackDetected.php b/src/Notifications/AttackDetectedNotification.php similarity index 55% rename from src/Notifications/AttackDetected.php rename to src/Notifications/AttackDetectedNotification.php index 267ced2..afbd5a9 100644 --- a/src/Notifications/AttackDetected.php +++ b/src/Notifications/AttackDetectedNotification.php @@ -3,12 +3,14 @@ namespace OzanKurt\Security\Notifications; use Illuminate\Bus\Queueable; -use Illuminate\Contracts\Queue\ShouldQueue; use Illuminate\Notifications\Notification; +use Illuminate\Contracts\Queue\ShouldQueue; use Illuminate\Notifications\Messages\MailMessage; use Illuminate\Notifications\Messages\SlackMessage; +use OzanKurt\Security\Notifications\Channels\Discord\DiscordChannel; +use OzanKurt\Security\Notifications\Channels\Discord\DiscordMessage; -class AttackDetected extends Notification implements ShouldQueue +class AttackDetectedNotification extends Notification implements ShouldQueue { use Queueable; @@ -32,7 +34,7 @@ class AttackDetected extends Notification implements ShouldQueue public function __construct($log) { $this->log = $log; - $this->notifications = config('security.middleware.' . $log->middleware . '.notifications', config('security.notifications')); + $this->notifications = config('security.notifications'); } /** @@ -50,7 +52,7 @@ public function via($notifiable) continue; } - $channels[] = $channel; + $channels[] = $this->getChannelClass($channel); } return $channels; @@ -60,10 +62,11 @@ public function via($notifiable) * Get the notification's queues. * @return array|string */ - public function viaQueues(): array { - return array_map(fn ($channel) => $channel['queue'] ?? 'default', $this->notifications); + return array_map(function ($channel) { + return $channel['queue'] ?? 'default'; + }, $this->notifications); } /** @@ -76,11 +79,11 @@ public function toMail($notifiable) { $domain = request()->getHttpHost(); - $subject = trans('security::notifications.mail.subject', [ + $subject = trans('security::notifications.attack_detected.mail.subject', [ 'domain' => $domain, ]); - $message = trans('security::notifications.mail.message', [ + $message = trans('security::notifications.attack_detected.mail.message', [ 'domain' => $domain, 'middleware' => ucfirst($this->log->middleware), 'ip' => $this->log->ip, @@ -101,7 +104,7 @@ public function toMail($notifiable) */ public function toSlack($notifiable) { - $message = trans('security::notifications.slack.message', [ + $message = trans('security::notifications.attack_detected.slack.message', [ 'domain' => request()->getHttpHost(), ]); @@ -119,4 +122,43 @@ public function toSlack($notifiable) ]); }); } + + public function toDiscord() + { + $body = trans('security::notifications.attack_detected.discord.message', [ + 'domain' => request()->getHttpHost(), + ]); + + try { + $url = $this->log->url; + $url = preg_replace('/^https?:\/\/[^\/]+/', '', $url); + + return (new DiscordMessage) + ->from(config('security.notifications.discord.from'), config('security.notifications.discord.from_img')) + ->url(config('security.notifications.discord.route')) + ->title(config('security.notifications.discord.title')) + ->description($body) + ->fields([ + 'IP' => $this->log->ip, + 'Type' => ucfirst($this->log->middleware), + 'User ID' => $this->log->user_id === 0 ? 'Guest' : $this->log->user_id, + ], true) + ->fields([ + 'URL' => $url, + ], false) + ->timestamp(now()) + ->footer(config('security.notifications.discord.footer'), config('security.notifications.discord.footer_img')) + ->warning(); + } catch (\Throwable $exception) { + dd($exception); + } + } + + public function getChannelClass(string $channel): string + { + return match ($channel) { + 'discord' => DiscordChannel::class, + default => $channel, + }; + } } diff --git a/src/Notifications/Channels/Discord/DiscordChannel.php b/src/Notifications/Channels/Discord/DiscordChannel.php new file mode 100644 index 0000000..7032e33 --- /dev/null +++ b/src/Notifications/Channels/Discord/DiscordChannel.php @@ -0,0 +1,20 @@ +toDiscord(); // @phpstan-ignore-line + + $discordWebhook = $notifiable->routeNotificationForDiscord(); + + $response = Http::post($discordWebhook, $discordMessage->toArray()); + + $response->throw(); + } +} diff --git a/src/Notifications/Channels/Discord/DiscordMessage.php b/src/Notifications/Channels/Discord/DiscordMessage.php new file mode 100644 index 0000000..1135e91 --- /dev/null +++ b/src/Notifications/Channels/Discord/DiscordMessage.php @@ -0,0 +1,136 @@ +username = $username; + + if (! is_null($avatarUrl)) { + $this->avatarUrl = $avatarUrl; + } + + return $this; + } + + public function url(?string $url): self + { + $this->url = $url; + + return $this; + } + + public function title($title): self + { + $this->title = $title; + + return $this; + } + + public function description(?string $description): self + { + $this->description = $description; + + return $this; + } + + public function timestamp(Carbon $carbon): self + { + $this->timestamp = $carbon->toIso8601String(); + + return $this; + } + + public function footer(string $footer, ?string $footerUrl = null): self + { + $this->footer = $footer; + $this->footerUrl = $footerUrl; + + return $this; + } + + public function success(): self + { + $this->color = static::COLOR_SUCCESS; + + return $this; + } + + public function warning(): self + { + $this->color = static::COLOR_WARNING; + + return $this; + } + + public function error(): self + { + $this->color = static::COLOR_ERROR; + + return $this; + } + + public function fields(array $fields, bool $inline = true): self + { + foreach ($fields as $label => $value) { + $this->fields[] = [ + 'name' => $label, + 'value' => $value, + 'inline' => $inline, + ]; + } + + return $this; + } + + public function toArray(): array + { + return [ + 'username' => $this->username ?? 'Laravel Backup', + 'avatar_url' => $this->avatarUrl, + 'embeds' => [ + [ + 'title' => $this->title, + 'url' => $this->url, + 'type' => 'rich', + 'description' => $this->description, + 'fields' => $this->fields, + 'color' => hexdec($this->color), + 'footer' => [ + 'text' => $this->footer ?? '', + 'icon_url' => $this->footerImg ?? '', + ], + 'timestamp' => $this->timestamp ?? now(), + ], + ], + ]; + } +} diff --git a/src/Notifications/Notifiable.php b/src/Notifications/Notifiable.php index e15e795..cd7b594 100644 --- a/src/Notifications/Notifiable.php +++ b/src/Notifications/Notifiable.php @@ -18,6 +18,11 @@ public function routeNotificationForSlack() return config('security.notifications.slack.to'); } + public function routeNotificationForDiscord() + { + return config('security.notifications.discord.webhook_url'); + } + public function getKey() { return 1; diff --git a/src/Notifications/SecurityReportNotification.php b/src/Notifications/SecurityReportNotification.php new file mode 100644 index 0000000..26326e7 --- /dev/null +++ b/src/Notifications/SecurityReportNotification.php @@ -0,0 +1,157 @@ +notifications as $channel => $settings) { +// if (empty($settings['enabled'])) { +// continue; +// } +// +// $channels[] = $this->getChannelClass($channel); +// } + $channels = ['mail']; + + return $channels; + } + + /** + * Get the notification's queues. + * @return array|string + */ + public function viaQueues(): array + { + return array_map(function ($channel) { + return $channel['queue'] ?? 'default'; + }, $this->notifications); + } + + /** + * Build the mail representation of the notification. + * + * @param mixed $notifiable + * @return \Illuminate\Notifications\Messages\MailMessage + */ + public function toMail($notifiable) + { + $domain = request()->getSchemeAndHttpHost(); + $message = trans('security::notifications.security_report.mail.message', [ + 'domain' => "**[$domain]($domain)**", + 'start' => "**{$this->start->format('d/m/Y')}**", + 'end' => "**{$this->end->format('d/m/Y')}**", + ]); + + return (new MailMessage) + ->theme('security::notifications.themes.default') + ->markdown('security::notifications.security-report-notification', [ + 'recentlyModifiedFiles' => $this->recentlyModifiedFiles, + ]) +// ->from($this->notifications['mail']['from'], $this->notifications['mail']['name']) + ->subject($subject ?? '$subject') + ->line($message ?? '$message'); + } + + /** + * Get the Slack representation of the notification. + * + * @param mixed $notifiable + * @return SlackMessage + */ + public function toSlack($notifiable) + { + $message = trans('security::notifications.slack.message', [ + 'domain' => request()->getHttpHost(), + ]); + + return (new SlackMessage) + ->error() + ->from($this->notifications['slack']['from'], $this->notifications['slack']['emoji']) + ->to($this->notifications['slack']['channel']) + ->content($message) + ->attachment(function ($attachment) { + $attachment->fields([ + 'IP' => $this->log->ip, + 'Type' => ucfirst($this->log->middleware), + 'User ID' => $this->log->user_id, + 'URL' => $this->log->url, + ]); + }); + } + + public function toDiscord() + { + $body = trans('security::notifications.discord.message', [ + 'domain' => request()->getHttpHost(), + ]); + + return (new DiscordMessage) + ->from('test', 'https://ozankurt.com/images/min/ozan_kurt.png') + ->url('https://ozankurt.com/images/min/ozan_kurt.png') + ->title('title') + ->description('description') + ->fields([ + 'label1' => 'test', + 'label2' => 'test', + 'label3' => 'test', + ], true) + ->fields([ + 'label4' => 'test', + 'label5' => 'test', + ], true) + ->fields([ + 'label6' => 'test', + ], false) + ->timestamp(now()->addWeek()) + ->footer('footer') + ->success() + ; + } + + public function getChannelClass(string $channel): string + { + return match ($channel) { + 'discord' => DiscordChannel::class, + default => $channel, + }; + } +} diff --git a/src/Notifications/SuccessfulLogin.php b/src/Notifications/SuccessfulLoginNotification.php similarity index 97% rename from src/Notifications/SuccessfulLogin.php rename to src/Notifications/SuccessfulLoginNotification.php index 91d7cc6..acf53b9 100644 --- a/src/Notifications/SuccessfulLogin.php +++ b/src/Notifications/SuccessfulLoginNotification.php @@ -9,7 +9,7 @@ use Illuminate\Notifications\Messages\MailMessage; use Illuminate\Notifications\Messages\SlackMessage; -class SuccessfulLogin extends Notification implements ShouldQueue +class SuccessfulLoginNotification extends Notification implements ShouldQueue { use Queueable; diff --git a/src/Security.php b/src/Security.php new file mode 100644 index 0000000..76bcf52 --- /dev/null +++ b/src/Security.php @@ -0,0 +1,70 @@ +antiXss = $antiXss; + } + + public function route(string $route) + { + return route(config('security.dashboard.route_name') . $route); + } + + public function routeIsActive(string $route) + { + return request()->route()->getName() === config('security.dashboard.route_name') . $route; + } + + public function getRecentlyModifiedFiles(int|Carbon $time_range = 604800, int $limit = 15, bool $resetCache = false): array + { + if ($time_range instanceof Carbon) { + $time_range = $time_range->diffInSeconds(Carbon::now()); + } + + $cacheKey = 'recently_modified_files_' . $time_range . '_' . $limit; + + if ($resetCache) { + cache()->forget($cacheKey); + } + + $mostRecentFiles = cache()->remember($cacheKey, now()->addMinutes(5), function () use ($time_range, $limit) { + $rmf = new RecentlyModifiedFiles(base_path(), $time_range); + $rmf->run(); + return $rmf->mostRecentFiles($limit); + }); + + return $mostRecentFiles; + } + + public static function assetsOutdated() + { + $publishedManifest = public_path('vendor/security/manifest.json'); + + if (!File::exists($publishedManifest)) { + return true; + } + + $publishedManifest = json_decode(File::get($publishedManifest), true); + + $packageManifest = __DIR__ . '/../public/manifest.json'; + $packageManifest = json_decode(File::get($packageManifest), true); + + return $publishedManifest['version'] !== $packageManifest['version']; + } + + public function cleanInput(string|array $input): string|array + { + return $this->antiXss->xss_clean($input); + } +} diff --git a/src/SecurityServiceProvider.php b/src/SecurityServiceProvider.php index 9d36a2f..1c6bddb 100644 --- a/src/SecurityServiceProvider.php +++ b/src/SecurityServiceProvider.php @@ -2,135 +2,192 @@ namespace OzanKurt\Security; -use OzanKurt\Security\Commands\UnblockIp; -use OzanKurt\Security\Events\AttackDetected; -use OzanKurt\Security\Listeners\BlockIp; -use OzanKurt\Security\Listeners\CheckLogin; -use OzanKurt\Security\Listeners\NotifyUsers; -use Illuminate\Auth\Events\Authenticated as LoginAuthenticated; -use Illuminate\Auth\Events\Failed as LoginFailed; +use OzanKurt\Security\Http\Controllers\IpsController; +use OzanKurt\Security\Http\Controllers\DashboardController; +use OzanKurt\Security\Http\Controllers\LogsController; +use voku\helper\AntiXSS; use Illuminate\Console\Scheduling\Schedule; +use Illuminate\Notifications\ChannelManager; use Illuminate\Routing\Router; +use Illuminate\Support\Facades\Notification; +use Illuminate\Support\Facades\View; use Illuminate\Support\ServiceProvider; +use Illuminate\Auth\Events\Login as LoginAuthenticated; +use Illuminate\Auth\Events\Failed as LoginFailed; +use OzanKurt\Security\Commands\SendSecurityReportNotificationCommand; +use OzanKurt\Security\Commands\UnblockIpsCommand; +use OzanKurt\Security\Events\AttackDetectedEvent; +use OzanKurt\Security\Listeners\AttackDetectedListener; +use OzanKurt\Security\Listeners\BlockIpListener; +use OzanKurt\Security\Listeners\FailedLoginListener; +use OzanKurt\Security\Listeners\SuccessfulLoginListener; +use OzanKurt\Security\Notifications\Channels\Discord\DiscordChannel; class SecurityServiceProvider extends ServiceProvider { /** * Register the application services. - * - * @return void */ - public function register() + public function register(): void { $this->mergeConfigFrom(__DIR__ . '/../config/security.php', 'security'); $this->app->register(\Jenssegers\Agent\AgentServiceProvider::class); + + $this->app->singleton(Security::class, function () { + $antiXss = new AntiXSS(); + + return new Security($antiXss); + }); + + $this->app->alias(Security::class, 'security'); } /** * Bootstrap the application services. - * - * @param Router $router - * - * @return void */ - public function boot(Router $router) + public function boot(Router $router): void { - $langPath = 'vendor/security'; - - $langPath = (function_exists('lang_path')) - ? lang_path($langPath) - : resource_path('lang/' . $langPath); - - $this->publishes([ - __DIR__ . '/../config/security.php' => config_path('security.php'), - __DIR__ . '/../resources/lang' => $langPath, - __DIR__ . '/../database/migrations/create_ips_table.php' => $this->getMigrationPathFor('ip'), - __DIR__ . '/../database/migrations/create_logs_table.php' => $this->getMigrationPathFor('log'), - ], 'security'); + $this->publishAssets(); $this->registerMiddleware($router); $this->registerListeners(); - $this->registerTranslations($langPath); + $this->registerTranslations(); $this->registerCommands(); + $this->registerViews(); + $this->registerRoutes($router); } - /** - * Register middleware. - * - * @param Router $router - * - * @return void - */ - public function registerMiddleware($router) + protected function registerRoutes(Router $router): void + { + $router->group([ + 'namespace' => 'OzanKurt\Security\Http\Controllers', + 'prefix' => config('security.dashboard.route_prefix', 'security'), + 'middleware' => config('security.dashboard.route_middleware', []), + ], function ($router) { + $name = config('security.dashboard.route_name', 'security.'); + $router->get('', [DashboardController::class, 'index'])->name($name.'dashboard.index'); + $router->get('/logs', [LogsController::class, 'index'])->name($name.'logs.index'); + $router->get('/ips', [IpsController::class, 'index'])->name($name.'ips.index'); + + $router->get('/whitelist', [DashboardController::class, 'whitelist'])->name($name.'whitelist'); + $router->post('/whitelist', [DashboardController::class, 'whitelistStore'])->name($name.'whitelist.store'); + $router->delete('/whitelist/{id}', [DashboardController::class, 'whitelistDestroy'])->name($name.'whitelist.destroy'); + + $router->get('/blacklist', [DashboardController::class, 'blacklist'])->name($name.'blacklist'); + $router->post('/blacklist', [DashboardController::class, 'blacklistStore'])->name($name.'blacklist.store'); + $router->delete('/blacklist/{id}', [DashboardController::class, 'blacklistDestroy'])->name($name.'blacklist.destroy'); + }); + } + + protected function registerMiddleware(Router $router): void { $router->middlewareGroup('firewall.all', config('security.all_middleware')); - $router->aliasMiddleware('firewall.agent', \OzanKurt\Security\Middleware\Agent::class); - $router->aliasMiddleware('firewall.bot', \OzanKurt\Security\Middleware\Bot::class); - $router->aliasMiddleware('firewall.ip', \OzanKurt\Security\Middleware\Ip::class); - $router->aliasMiddleware('firewall.geo', \OzanKurt\Security\Middleware\Geo::class); - $router->aliasMiddleware('firewall.lfi', \OzanKurt\Security\Middleware\Lfi::class); - $router->aliasMiddleware('firewall.php', \OzanKurt\Security\Middleware\Php::class); - $router->aliasMiddleware('firewall.referrer', \OzanKurt\Security\Middleware\Referrer::class); - $router->aliasMiddleware('firewall.rfi', \OzanKurt\Security\Middleware\Rfi::class); - $router->aliasMiddleware('firewall.session', \OzanKurt\Security\Middleware\Session::class); - $router->aliasMiddleware('firewall.sqli', \OzanKurt\Security\Middleware\Sqli::class); - $router->aliasMiddleware('firewall.swear', \OzanKurt\Security\Middleware\Swear::class); - $router->aliasMiddleware('firewall.url', \OzanKurt\Security\Middleware\Url::class); - $router->aliasMiddleware('firewall.whitelist', \OzanKurt\Security\Middleware\Whitelist::class); - $router->aliasMiddleware('firewall.xss', \OzanKurt\Security\Middleware\Xss::class); - $router->aliasMiddleware('firewall.keyword', \OzanKurt\Security\Middleware\Keyword::class); + + $middlewares = [ + 'firewall.agent' => \OzanKurt\Security\Middleware\Agent::class, + 'firewall.bot' => \OzanKurt\Security\Middleware\Bot::class, + 'firewall.ip' => \OzanKurt\Security\Middleware\Ip::class, + 'firewall.geo' => \OzanKurt\Security\Middleware\Geo::class, + 'firewall.lfi' => \OzanKurt\Security\Middleware\Lfi::class, + 'firewall.php' => \OzanKurt\Security\Middleware\Php::class, + 'firewall.referrer' => \OzanKurt\Security\Middleware\Referrer::class, + 'firewall.rfi' => \OzanKurt\Security\Middleware\Rfi::class, + 'firewall.session' => \OzanKurt\Security\Middleware\Session::class, + 'firewall.sqli' => \OzanKurt\Security\Middleware\Sqli::class, + 'firewall.swear' => \OzanKurt\Security\Middleware\Swear::class, + 'firewall.url' => \OzanKurt\Security\Middleware\Url::class, + 'firewall.whitelist' => \OzanKurt\Security\Middleware\Whitelist::class, + 'firewall.xss' => \OzanKurt\Security\Middleware\Xss::class, + 'firewall.keyword' => \OzanKurt\Security\Middleware\Keyword::class, + ]; + + foreach ($middlewares as $name => $class) { + $router->aliasMiddleware($name, $class); + } } - /** - * Register listeners. - * - * @return void - */ - public function registerListeners() + protected function registerListeners(): void { - $this->app['events']->listen(AttackDetected::class, BlockIp::class); - $this->app['events']->listen(AttackDetected::class, NotifyUsers::class); - $this->app['events']->listen(LoginAuthenticated::class, CheckLogin::class); - $this->app['events']->listen(LoginFailed::class, CheckLogin::class); + $this->app['events']->listen(AttackDetectedEvent::class, BlockIpListener::class); + $this->app['events']->listen(AttackDetectedEvent::class, AttackDetectedListener::class); + $this->app['events']->listen(LoginAuthenticated::class, SuccessfulLoginListener::class); + $this->app['events']->listen(LoginFailed::class, FailedLoginListener::class); } - /** - * Register translations. - * - * @return void - */ - public function registerTranslations($langPath) + protected function registerTranslations(): void { $this->loadTranslationsFrom(__DIR__ . '/../resources/lang', 'security'); - - $this->loadTranslationsFrom($langPath, 'security'); } - public function registerCommands() + protected function registerCommands(): void { - $this->commands(UnblockIp::class); + $this->commands(UnblockIpsCommand::class); + $this->commands(SendSecurityReportNotificationCommand::class); if (config('security.cron.enabled')) { $this->app->booted(function () { - app(Schedule::class)->command('security:unblockip')->cron(config('security.cron.expression')); + app(Schedule::class)->command('security:unblock-ips')->cron(config('security.cron.expression')); }); } } - public function getMigrationPathFor(string $modelKey): string + protected function registerViews(): void + { + View::addNamespace('security', __DIR__ . '/../resources/views'); + } + + protected function getMigrationPathFor(string $modelKey): string { - $prefix = date('Y_m_d').'_000000'; + $prefix = date('Y_m_d') . '_000000'; $tableName = $this->getNameTable($modelKey); return database_path("migrations/{$prefix}_create_{$tableName}_table.php"); } - public function getNameTable(string $modelKey): string + protected function getNameTable(string $modelKey): string { - $tablePrefix = config('security.database.table_prefix', 'sec_'); + $tablePrefix = config('security.database.table_prefix', 'security_'); $tableName = config("security.database.{$modelKey}.table", $modelKey); - return $tablePrefix.$tableName; + return $tablePrefix . $tableName; + } + + public function publishAssets(): void + { + // config + $this->publishes([ + __DIR__ . '/../config/security.php' => config_path('security.php'), + ], 'security-config'); + + // lang + $langPath = 'vendor/security'; + $langPath = (function_exists('lang_path')) + ? lang_path($langPath) + : resource_path('lang/' . $langPath); + + $this->publishes([ + __DIR__ . '/../resources/lang' => $langPath, + ], 'security-lang'); + + // migrations + $this->publishes([ + __DIR__ . '/../database/migrations/create_ips_table.php' => $this->getMigrationPathFor('ip'), + __DIR__ . '/../database/migrations/create_logs_table.php' => $this->getMigrationPathFor('log'), + ], 'security-migrations'); + + // public + $this->publishes([ + __DIR__ . '/../public' => public_path('vendor/security'), + ], 'security-assets'); + } + + protected function registerDiscordChannel(): void + { + Notification::resolved(function (ChannelManager $service) { + $service->extend(DiscordChannel::class, function ($app) { + return new DiscordChannel(); + }); + }); } } diff --git a/src/Traits/Helper.php b/src/Traits/Helper.php index 575d09f..4f23e8c 100644 --- a/src/Traits/Helper.php +++ b/src/Traits/Helper.php @@ -3,31 +3,35 @@ namespace OzanKurt\Security\Traits; use Illuminate\Http\Request; -use OzanKurt\Security\Models\Log; +use Jenssegers\Agent\Agent as Parser; use OzanKurt\Security\Enums\LogLevel; +use OzanKurt\Security\Models\Log; use Symfony\Component\HttpFoundation\IpUtils; -use Jenssegers\Agent\Agent as Parser; trait Helper { public Request|string|array|null $request = null; - public string|null $middleware = null; - public int|null $user_id = null; + public ?string $middleware = null; + public ?int $user_id = null; public function isEnabled($middleware = null) { $middleware = $middleware ?? $this->middleware; - return config('security.middleware.' . $middleware . '.enabled', config('security.enabled', false)); + return config("security.middleware.{$middleware}.enabled", config('security.enabled', false)); } public function isDisabled($middleware = null) { - return ! $this->isEnabled($middleware); + return !$this->isEnabled($middleware); } public function isWhitelist() { + if (request()->has('_debug')) { + return false; + } + return IpUtils::checkIp($this->ip(), config('security.whitelist', [])); } @@ -35,7 +39,7 @@ public function isMethod($middleware = null) { $middleware = $middleware ?? $this->middleware; - if (! $methods = config('security.middleware.' . $middleware . '.methods')) { + if (!$methods = config("security.middleware.{$middleware}.methods")) { return false; } @@ -50,12 +54,12 @@ public function isRoute($middleware = null) { $middleware = $middleware ?? $this->middleware; - if (! $routes = config('security.middleware.' . $middleware . '.routes')) { + if (!$routes = config("security.middleware.{$middleware}.routes")) { return false; } foreach ($routes['except'] as $ex) { - if (! $this->request->is($ex)) { + if (!$this->request->is($ex)) { continue; } @@ -77,20 +81,20 @@ public function isInput($name, $middleware = null) { $middleware = $middleware ?? $this->middleware; - if (! $inputs = config('security.middleware.' . $middleware . '.inputs')) { + if (!$inputs = config("security.middleware.{$middleware}.inputs")) { return true; } - if (! empty($inputs['only']) && ! in_array((string) $name, (array) $inputs['only'])) { + if (!empty($inputs['only']) && !in_array((string)$name, (array)$inputs['only'])) { return false; } - return ! in_array((string) $name, (array) $inputs['except']); + return !in_array((string)$name, (array)$inputs['except']); } public function log( - ?string $middleware = null, - ?int $user_id = null, + ?string $middleware = null, + ?int $user_id = null, LogLevel $level = LogLevel::MEDIUM ): Log { diff --git a/tests/Feature/IpTest.php b/tests/Feature/IpTest.php index b4aa3cb..54d28ab 100644 --- a/tests/Feature/IpTest.php +++ b/tests/Feature/IpTest.php @@ -3,7 +3,7 @@ namespace OzanKurt\Security\Tests\Feature; use OzanKurt\Security\Middleware\Ip; -use OzanKurt\Security\Models\Ip as Model; +use OzanKurt\Security\Models\Ip as IpModel; use OzanKurt\Security\Tests\TestCase; class IpTest extends TestCase @@ -15,7 +15,7 @@ public function testShouldAllow() public function testShouldBlock() { - Model::create(['ip' => '127.0.0.1', 'is_blocked' => 1]); + IpModel::create(['ip' => '127.0.0.1', 'is_blocked' => 1]); $response = (new Ip())->handle($this->app->request, $this->getNextClosure()); diff --git a/tests/Feature/NotificationTest.php b/tests/Feature/NotificationTest.php new file mode 100644 index 0000000..8ba6277 --- /dev/null +++ b/tests/Feature/NotificationTest.php @@ -0,0 +1,23 @@ +request = request(); + $log = $this->log('ip', 0); + + (new Notifiable)->notify(new AttackDetected($log)); + } +} diff --git a/tests/TestCase.php b/tests/TestCase.php index 20abfab..8b3efa2 100644 --- a/tests/TestCase.php +++ b/tests/TestCase.php @@ -11,12 +11,12 @@ protected function setUp(): void { parent::setUp(); - $this->setUpDatabase(); - $this->setUpConfig(); + $this->setUpDatabase(); + $this->artisan('vendor:publish', ['--tag' => 'security']); - $this->artisan('migrate:refresh', ['--database' => 'testbench']); + // $this->artisan('migrate:refresh', ['--database' => 'testbench']); } protected function tearDown(): void @@ -32,21 +32,26 @@ protected function getPackageProviders($app) } protected function setUpDatabase() + { + $create_logs_table = include __DIR__.'/../database/migrations/create_logs_table.php'; + $create_logs_table->up(); + $create_ips_table = include __DIR__.'/../database/migrations/create_ips_table.php'; + $create_ips_table->up(); + } + + protected function setUpConfig() { config(['database.default' => 'testbench']); - config(['database.connections.testbench' => [ + config([ + 'database.connections.testbench' => [ 'driver' => 'sqlite', 'database' => ':memory:', 'prefix' => '', ], ]); - } - - protected function setUpConfig() - { - config(['security' => require __DIR__ . '/../config/security.php']); + config(['security' => include __DIR__.'/../config/security.php']); config(['security.database.connection' => 'testbench']); config(['security.notifications.mail.enabled' => false]); diff --git a/tests/TestCase_backup.php b/tests/TestCase_backup.php new file mode 100644 index 0000000..836c4af --- /dev/null +++ b/tests/TestCase_backup.php @@ -0,0 +1,82 @@ +artisan('vendor:publish', ['--tag' => 'security']); + + $this->afterApplicationCreated(function () { + $this->artisan('migrate:refresh', ['--database' => 'testbench']); + }); + + $this->beforeApplicationDestroyed(function () { + $this->artisan('migrate:rollback', ['--database' => 'testbench']); + }); + } + + /** + * Define environment setup. + * + * @param \Illuminate\Foundation\Application $app + * @return void + */ + protected function defineEnvironment($app) + { + // Setup default database to use sqlite :memory: + tap($app['config'], function (Repository $config) { + $config->set('database.default', 'testbench'); + $config->set('database.connections.testbench', [ + 'driver' => 'sqlite', + 'database' => 'database.sqlite', + 'prefix' => '', + ]); + + // Setup security config + $config->set(['security' => require __DIR__ . '/../config/security.php']); + + $config->set(['security.database.connection' => 'testbench']); + + $config->set(['security.notifications.mail.enabled' => false]); + $config->set(['security.middleware.ip.methods' => ['all']]); + $config->set(['security.middleware.lfi.methods' => ['all']]); + $config->set(['security.middleware.rfi.methods' => ['all']]); + $config->set(['security.middleware.sqli.methods' => ['all']]); + $config->set(['security.middleware.xss.methods' => ['all']]); + + $config->set(['security.notifications.discord.enabled' => true]); + $config->set(['security.notifications.discord.to' => 'https://discord.com/api/webhooks/1213258698470727770/z48rQz0svhO4WvllVWq_6mh8ehnsJEPg2KnE5Mk7V0q2pBrlQ4Kv0ePwyBFz3xOl5GU9']); + $config->set(['security.notifications.discord.channel' => \NotificationChannels\Discord\DiscordChannel::class]); + }); + } + + protected function tearDown(): void + { + parent::tearDown(); + } + + protected function getPackageProviders($app) + { + return [ + SecurityServiceProvider::class, + ]; + } + + public function getNextClosure() + { + return function () { + return 'next'; + }; + } +}