diff --git a/cido.owl b/cido.owl
index 754379f..6baa4be 100644
--- a/cido.owl
+++ b/cido.owl
@@ -26,11 +26,12 @@
xmlns:ncbitaxon="http://purl.obolibrary.org/obo/ncbitaxon#"
xmlns:rdf-schema="http://www.w3.org/20000/01/rdf-schema#">
- Ghida Arnous
+
Barry Smith
Brian Athey
Gil Omenn
Hongfang Liu
+ Ghida Arnous
Anthony Huffman
Ashley Yan
Asiyah Yu Lin
@@ -41,8 +42,10 @@
Guirui Huang (Ray)
Hong Yu
Hsin-Hui Huang
+ Jie Zheng
John Beverley
Liwei Wang
+ Muhui Ye
Roshan Desai
Sivaram Arabandi
Suyuan Peng
@@ -53,14 +56,12 @@
Yujia Tian
Zalan Shah
Zhigang Wang
- 11-4-2023
The Ontology of Coronavirus Infectious Disease (CIDO) is a community-driven open-source biomedical ontology in the area of coronavirus infectious disease. The CIDO is developed to provide standardized human- and computer-interpretable annotation and representation of various coronavirus infectious diseases, including their etiology, transmission, pathogenesis, diagnosis, prevention, and treatment.
OWL-DL
CIDO: A biomedical ontology in the area of coronavirus infectious disease.
CIDO: Ontology of Coronavirus Infectious Disease
- Muhui Ye
http://creativecommons.org/licenses/by/4.0/
- 1.0.369
+ 2024-02-16
@@ -371,14 +372,14 @@
- definition
definition
+ definition
textual definition
English language definitions of what NCI means by the concept. These are limited to 1024 characters. They may also include information about the definition's source and attribution in a form that can easily be interpreted by software.
The official OBI definition, explaining the meaning of a class or property. Shall be Aristotelian, formalized and normalized. Can be augmented with colloquial definitions.
- The official definition, explaining the meaning of a class or property. Shall be Aristotelian, formalized and normalized. Can be augmented with colloquial definitions.
The official definition, explaining the meaning of a class or property. Shall be Aristotelian, formalized and normalized. Can be augmented with colloquial definitions.
+ The official definition, explaining the meaning of a class or property. Shall be Aristotelian, formalized and normalized. Can be augmented with colloquial definitions.
The official definition.
2012-04-05:
Barry Smith
@@ -399,13 +400,33 @@ We don't have definitions of 'meaning' or 'expression'
Personally, I am more comfortable weakening definition to documentation, with instructions as to what is desirable.
+We also have the outstanding issue of how to aim different definitions to different audiences. A clinical audience reading chebi wants a different sort of definition documentation/definition from a chemistry trained audience, and similarly there is a need for a definition that is adequate for an ontologist to work with.
+ 2012-04-05:
+Barry Smith
+
+The official OBI definition, explaining the meaning of a class or property: 'Shall be Aristotelian, formalized and normalized. Can be augmented with colloquial definitions' is terrible.
+
+Can you fix to something like:
+
+A statement of necessary and sufficient conditions explaining the meaning of an expression referring to a class or property.
+
+Alan Ruttenberg
+
+Your proposed definition is a reasonable candidate, except that it is very common that necessary and sufficient conditions are not given. Mostly they are necessary, occasionally they are necessary and sufficient or just sufficient. Often they use terms that are not themselves defined and so they effectively can't be evaluated by those criteria.
+
+On the specifics of the proposed definition:
+
+We don't have definitions of 'meaning' or 'expression' or 'property'. For 'reference' in the intended sense I think we use the term 'denotation'. For 'expression', I think we you mean symbol, or identifier. For 'meaning' it differs for class and property. For class we want documentation that let's the intended reader determine whether an entity is instance of the class, or not. For property we want documentation that let's the intended reader determine, given a pair of potential relata, whether the assertion that the relation holds is true. The 'intended reader' part suggests that we also specify who, we expect, would be able to understand the definition, and also generalizes over human and computer reader to include textual and logical definition.
+
+Personally, I am more comfortable weakening definition to documentation, with instructions as to what is desirable.
+
We also have the outstanding issue of how to aim different definitions to different audiences. A clinical audience reading chebi wants a different sort of definition documentation/definition from a chemistry trained audience, and similarly there is a need for a definition that is adequate for an ontologist to work with.
PERSON:Daniel Schober
GROUP:OBI:<http://purl.obolibrary.org/obo/obi>
DEFINITION
- definition
definition
+ definition
textual definition
@@ -427,8 +448,8 @@ We also have the outstanding issue of how to aim different definitions to differ
1
editor_note
- editor note
editor note
+ editor note
@@ -446,10 +467,10 @@ We also have the outstanding issue of how to aim different definitions to differ
PERSON:Daniel Schober
GROUP:OBI:<http://purl.obolibrary.org/obo/obi>
+ definition editor
definition editor
term editor
term editor
- definition editor
@@ -457,12 +478,17 @@ We also have the outstanding issue of how to aim different definitions to differ
+ alternative label
alternative term
+ A label for a class or property that can be used to refer to the class or property instead of the preferred rdfs:label. Alternative labels should be used to indicate community- or context-specific labels, abbreviations, shorthand forms and the like.
An alternative name for a class or property which means the same thing as the preferred name (semantically equivalent)
+ OBO Operations committee
PERSON:Daniel Schober
GROUP:OBI:<http://purl.obolibrary.org/obo/obi>
+ Consider re-defing to: An alternative name for a class or property which can mean the same thing as the preferred name (semantically equivalent, narrow, broad or related).
+ alternative label
alternative term
alternative term
@@ -477,12 +503,12 @@ We also have the outstanding issue of how to aim different definitions to differ
Formal citation, e.g. identifier in external database to indicate / attribute source(s) for the definition. Free text indicate / attribute source(s) for the definition. EXAMPLE: Author Name, URI, MeSH Term C04, PUBMED ID, Wiki uri on 31.01.2007
formal citation, e.g. identifier in external database to indicate / attribute source(s) for the definition. Free text indicate / attribute source(s) for the definition. EXAMPLE: Author Name, URI, MeSH Term C04, PUBMED ID, Wiki uri on 31.01.2007
PERSON:Daniel Schober
+ Discussion on obo-discuss mailing-list, see http://bit.ly/hgm99w
Discussion on obo-discuss mailing-list, see http://bit.ly/hgm99w
GROUP:OBI:<http://purl.obolibrary.org/obo/obi>
- Discussion on obo-discuss mailing-list, see http://bit.ly/hgm99w
- definition source
definition source
+ definition source
@@ -587,8 +613,8 @@ We also have the outstanding issue of how to aim different definitions to differ
OBO foundry unique label
An alternative name for a class or property which is unique across the OBO Foundry.
- The intended usage of that property is as follow: OBO foundry unique labels are automatically generated based on regular expressions provided by each ontology, so that SO could specify unique label = 'sequence ' + [label], etc. , MA could specify 'mouse + [label]' etc. Upon importing terms, ontology developers can choose to use the 'OBO foundry unique label' for an imported term or not. The same applies to tools .
The intended usage of that property is as follow: OBO foundry unique labels are automatically generated based on regular expressions provided by each ontology, so that SO could specify unique label = 'sequence ' + [label], etc. , MA could specify 'mouse + [label]' etc. Upon importing terms, ontology developers can choose to use the 'OBO foundry unique label' for an imported term or not. The same applies to tools .
+ The intended usage of that property is as follow: OBO foundry unique labels are automatically generated based on regular expressions provided by each ontology, so that SO could specify unique label = 'sequence ' + [label], etc. , MA could specify 'mouse + [label]' etc. Upon importing terms, ontology developers can choose to use the 'OBO foundry unique label' for an imported term or not. The same applies to tools .
PERSON:Alan Ruttenberg
PERSON:Bjoern Peters
PERSON:Chris Mungall
@@ -1073,10 +1099,8 @@ where pmid1 and pmid2 are specfic PubMed IDs (PMIDs).
An assertion that involves at least one OWL object that is intended to be expanded into one or more logical axioms. The logical expansion can yield axioms expressed using any formal logical system, including, but not limited to OWL2-DL.
- logical macro assertion
logical macro assertion
http://purl.obolibrary.org/obo/ro/docs/shortcut-relations/
- https://github.com/oborel/obo-relations/wiki/ShortcutRelations
@@ -1085,7 +1109,6 @@ where pmid1 and pmid2 are specfic PubMed IDs (PMIDs).
A logical macro assertion whose domain is an IRI for a property
- logical macro assertion on a property
logical macro assertion on a property
@@ -1096,7 +1119,6 @@ where pmid1 and pmid2 are specfic PubMed IDs (PMIDs).
Used to annotate object properties to describe a logical meta-property or characteristic of the object property.
- logical macro assertion on an object property
logical macro assertion on an object property
@@ -1328,9 +1350,8 @@ Where we have an annotation assertion
An annotation property that represents the trade name of a product.
- YH
+ Oliver He
trade name
- trade name
@@ -1340,9 +1361,9 @@ Where we have an annotation assertion
The vaccine Prevnar (trade name) has a FDA-defined proper name: Pneumococcal 7-valent Conjugate Vaccine (Diphtheria CRM197 Protein). Reference: https://www.fda.gov/biologicsbloodvaccines/vaccines/approvedproducts/ucm180017.htm
An annotation property that represents the proper name of a vaccine, which is defined in an official way such as one defined by FDA.
- Oliver He, Kallan Roan
+ Kallan Roan
+ Oliver He
vaccine proper name
- vaccine proper name
@@ -1351,20 +1372,22 @@ Where we have an annotation assertion
The vaccine Prevnar has the manufacturer: Wyeth Pharmaceuticals Inc. Reference: https://www.fda.gov/biologicsbloodvaccines/vaccines/approvedproducts/ucm180017.htm
- An annotation property that represents the manufacturer of a product such as vaccine
- Oliver He, Kallan Roan
- manufacturer
- manufacturer
+ An annotation property that represents the manufacturer of a vaccine
+ Kallan Roan
+ Oliver He
+ vaccine manufacturer
-
+
-
- An identifier assigned by the Vaccine Adjuvant Compendium (VAC: https://vac.niaid.nih.gov/)
- https://vac.niaid.nih.gov/
- VAC adjuvant ID
+
+ An annotation property that refers to a specific CVX ID.
+ Oliver He
+ Penny Pan
+ https://www2a.cdc.gov/vaccines/iis/iisstandards/vaccines.asp?rpt=cvx
+ CVX code
@@ -1475,7 +1498,6 @@ Where we have an annotation assertion
Creator
Creator
- creator
@@ -1657,7 +1679,13 @@ Where we have an annotation assertion
+ An alternative label for a class or property which has a more general meaning than the preferred name/primary label.
+
+ https://github.com/information-artifact-ontology/ontology-metadata/issues/18
+ has broad synonym
has_broad_synonym
+ https://github.com/information-artifact-ontology/ontology-metadata/issues/18
+
@@ -1682,12 +1710,18 @@ Where we have an annotation assertion
- Fully qualified synonym, contains the string, term type, source, and an optional source code if appropriate. Each subfield is deliniated to facilitate interpretation by software.
+ An alternative label for a class or property which has the exact same meaning than the preferred name/primary label.
Exact synonym.
+ Fully qualified synonym, contains the string, term type, source, and an optional source code if appropriate. Each subfield is deliniated to facilitate interpretation by software.
+
+ https://github.com/information-artifact-ontology/ontology-metadata/issues/20
FULL_SYN
Synonym with Source Data
has exact synonym
+ has exact synonym
has_exact_synonym
+ https://github.com/information-artifact-ontology/ontology-metadata/issues/20
+
@@ -1695,7 +1729,13 @@ Where we have an annotation assertion
+ An alternative label for a class or property which has a more specific meaning than the preferred name/primary label.
+
+ https://github.com/information-artifact-ontology/ontology-metadata/issues/19
+ has narrow synonym
has_narrow_synonym
+ https://github.com/information-artifact-ontology/ontology-metadata/issues/19
+
@@ -1721,18 +1761,18 @@ Where we have an annotation assertion
+ An alternative label for a class or property that has been used synonymously with the primary term name, but the usage is not strictly correct.
Has related synonym.
+
+ https://github.com/information-artifact-ontology/ontology-metadata/issues/21
+ has related synonym
has_related_synonym
+ https://github.com/information-artifact-ontology/ontology-metadata/issues/21
+
-
-
-
-
-
-
@@ -1741,12 +1781,6 @@ Where we have an annotation assertion
-
-
-
-
-
-
@@ -1760,8 +1794,8 @@ Where we have an annotation assertion
- Used to associate the concept defining a particular terminology subset with concepts that belong to this subset.
In subset.
+ Used to associate the concept defining a particular terminology subset with concepts that belong to this subset.
Concept_In_Subset
in subset
in_subset
@@ -1886,12 +1920,6 @@ Where we have an annotation assertion
-
-
-
-
-
-
@@ -2324,10 +2352,10 @@ A continuant cannot be part of an occurrent: use 'participates in'. An
part_of
is part of
- part of
- part_of
part of
+ part of
part_of
+ part_of
http://www.obofoundry.org/ro/#OBO_REL:part_of
@@ -2374,8 +2402,8 @@ A continuant cannot have an occurrent as part: use 'participates in'.
false
has_part
- has part
has part
+ has part
has_part
@@ -2441,7 +2469,6 @@ A continuant cannot have an occurrent as part: use 'participates in'.
realized_in
-
http://purl.obolibrary.org/obo/ro.owl
[copied from inverse property 'realizes'] to say that b realizes c at t is to assert that there is some material entity d & b is a process which has participant d at t & c is a disposition or role of which d is bearer_of at t& the type instantiated by b is correlated with the type instantiated by c. (axiom label in BFO2 Reference: [059-003])
@@ -2463,11 +2490,9 @@ A continuant cannot have an occurrent as part: use 'participates in'.
this shattering realizes this fragility
-
to say that b realizes c at t is to assert that there is some material entity d & b is a process which has participant d at t & c is a disposition or role of which d is bearer_of at t& the type instantiated by b is correlated with the type instantiated by c. (axiom label in BFO2 Reference: [059-003])
Paraphrase of elucidation: a relation between a process and a realizable entity, where there is some material entity that is bearer of the realizable entity and participates in the process, and the realizable entity comes to be realized in the course of the process
-
realizes
@@ -4288,10 +4313,8 @@ Some currently missing phenomena that should be considered "about" are
person:Alan Ruttenberg
Smith, Ceusters, Ruttenberg, 2000 years of philosophy
-
-
http://purl.obolibrary.org/obo/iao.owl
is about
is about
@@ -4318,11 +4341,12 @@ Some currently missing phenomena that should be considered "about" are
- has_specified_input
has_specified_input
+ has_specified_input
see is_input_of example_of_usage
A relation between a planned process and a continuant participating in that process that is not created during the process. The presence of the continuant during the process is explicitly specified in the plan specification which the process realizes the concretization of.
+ The inverse property of is_specified_input_of
8/17/09: specified inputs of one process are not necessarily specified inputs of a larger process that it is part of. This is in contrast to how 'has participant' works.
PERSON: Alan Ruttenberg
PERSON: Bjoern Peters
@@ -4341,8 +4365,8 @@ Some currently missing phenomena that should be considered "about" are
- is_specified_input_of
is_specified_input_of
+ is_specified_input_of
some Autologous EBV(Epstein-Barr virus)-transformed B-LCL (B lymphocyte cell line) is_input_for instance of Chromum Release Assay described at https://wiki.cbil.upenn.edu/obiwiki/index.php/Chromium_Release_assay
A relation between a planned process and a continuant participating in that process that is not created during the process. The presence of the continuant during the process is explicitly specified in the plan specification which the process realizes the concretization of.
@@ -4367,10 +4391,11 @@ Some currently missing phenomena that should be considered "about" are
- has_specified_output
has_specified_output
+ has_specified_output
A relation between a planned process and a continuant participating in that process. The presence of the continuant at the end of the process is explicitly specified in the objective specification which the process realizes the concretization of.
+ The inverse property of is_specified_output_of
PERSON: Alan Ruttenberg
PERSON: Bjoern Peters
PERSON: Larry Hunter
@@ -4386,15 +4411,6 @@ Some currently missing phenomena that should be considered "about" are
-
-
-
-
-
-
-
-
-
is_manufactured_by
http://www.affymetrix.com/products/arrays/specific/hgu133.affx is_manufactered_by http://www.affymetrix.com/ (if we decide to use these URIs for the actual entities)
@@ -4415,8 +4431,8 @@ Some currently missing phenomena that should be considered "about" are
- is_specified_output_of
is_specified_output_of
+ is_specified_output_of
A relation between a planned process and a continuant participating in that process. The presence of the continuant at the end of the process is explicitly specified in the objective specification which the process realizes the concretization of.
Alan Ruttenberg
@@ -4451,6 +4467,7 @@ Some currently missing phenomena that should be considered "about" are
+
achieves_planned_objective
@@ -4495,7 +4512,6 @@ Some currently missing phenomena that should be considered "about" are
OBI
OBI
-
objective_achieved_by
@@ -4637,7 +4653,10 @@ Some currently missing phenomena that should be considered "about" are
inheres in
this fragility inheres in this vase
+ this fragility is a characteristic of this vase
this red color inheres in this apple
+ this red color is a characteristic of this apple
+ a relation between a specifically dependent continuant (the characteristic) and any other entity (the bearer), in which the characteristic depends on the bearer for its existence.
a relation between a specifically dependent continuant (the dependent) and an independent continuant (the bearer), in which the dependent specifically depends on the bearer for its existence
A dependent inheres in its bearer at all times for which the dependent exists.
inheres_in
@@ -4647,6 +4666,7 @@ Some currently missing phenomena that should be considered "about" are
http://purl.obolibrary.org/obo/ro.owl
+ Note that this relation was previously called "inheres in", but was changed to be called "characteristic of" because BFO2 uses "inheres in" in a more restricted fashion. This relation differs from BFO2:inheres_in in two respects: (1) it does not impose a range constraint, and thus it allows qualities of processes, as well as of information entities, whereas BFO2 restricts inheres_in to only apply to independent continuants (2) it is declared functional, i.e. something can only be a characteristic of one thing.
characteristic of
inheres in
@@ -4656,10 +4676,12 @@ Some currently missing phenomena that should be considered "about" are
+
bearer of
this apple is bearer of this red color
this vase is bearer of this fragility
+ Inverse of characteristic_of
a relation between an independent continuant (the bearer) and a specifically dependent continuant (the dependent), in which the dependent specifically depends on the bearer for its existence
A bearer can have many dependents, and its dependents can exist for different periods of time, but none of its dependents can exist when the bearer does not exist.
bearer_of
@@ -4670,6 +4692,7 @@ Some currently missing phenomena that should be considered "about" are
bearer of
+ has characteristic
@@ -4677,6 +4700,7 @@ Some currently missing phenomena that should be considered "about" are
+
participates in
@@ -4713,6 +4737,7 @@ Some currently missing phenomena that should be considered "about" are
http://purl.obolibrary.org/obo/ro.owl
http://www.obofoundry.org/ro/#OBO_REL:has_participant
+ http://www.obofoundry.org/ro/#OBO_REL:has_participant
has participant
has_participant
@@ -4730,7 +4755,6 @@ Some currently missing phenomena that should be considered "about" are
A relationship between a specifically dependent continuant and a generically dependent continuant, in which the generically dependent continuant depends on some independent continuant in virtue of the fact that the specifically dependent continuant also depends on that same independent continuant. Multiple specifically dependent continuants can concretize the same generically dependent continuant.
-
concretizes
@@ -4764,9 +4788,9 @@ Some currently missing phenomena that should be considered "about" are
A role inheres in its bearer at all times for which the role exists, however the role need not be realized at all the times that the role exists.
is role of
role_of
-
+ This relation is modeled after the BFO relation of the same name which was in BFO2, but is used in a more restricted sense - specifically, we model this relation as functional (inherited from characteristic-of). Note that this relation is now removed from BFO2020.
role of
@@ -4828,8 +4852,8 @@ Some currently missing phenomena that should be considered "about" are
false
false
has_role
- has role
has role
+ has role
@@ -4941,6 +4965,7 @@ Some currently missing phenomena that should be considered "about" are
+
@@ -4968,13 +4993,14 @@ Some currently missing phenomena that should be considered "about" are
this rat is located in this cage
a relation between two independent continuants, the target and the location, in which the target is entirely within the location
Location as a relation between instances: The primitive instance-level relation c located_in r at t reflects the fact that each continuant is at any given time associated with exactly one spatial region, namely its exact location. Following we can use this relation to define a further instance-level location relation - not between a continuant and the region which it exactly occupies, but rather between one continuant and another. c is located in c1, in this sense, whenever the spatial region occupied by c is part_of the spatial region occupied by c1. Note that this relation comprehends both the relation of exact location between one continuant and another which obtains when r and r1 are identical (for example, when a portion of fluid exactly fills a cavity), as well as those sorts of inexact location relations which obtain, for example, between brain and head or between ovum and uterus
+ Most location relations will only hold at certain times, but this is difficult to specify in OWL. See http://purl.obolibrary.org/obo/ro/docs/temporal-semantics/
Most location relations will only hold at certain times, but this is difficult to specify in OWL. See https://code.google.com/p/obo-relations/wiki/ROAndTime
located_in
-
http://www.obofoundry.org/ro/#OBO_REL:located_in
+ http://www.obofoundry.org/ro/#OBO_REL:located_in
located in
@@ -5616,14 +5642,16 @@ Some currently missing phenomena that should be considered "about" are
- q inheres in part of w if and only if there exists some p such that q inheres in p and p part of w.
- Because part_of is transitive, inheres in is a sub-relation of inheres in part of
- Chris Mungall
+ q characteristic of part of w if and only if there exists some p such that q inheres in p and p part of w.
+ Because part_of is transitive, inheres in is a sub-relation of characteristic of part of
+
+ inheres in part of
- inheres in part of
+ characteristic of part of
+
@@ -6166,10 +6194,11 @@ For example, A and B may be gene products and binding of B by A positively regul
- Chris Mungall
+
depends on
+
@@ -7461,24 +7490,13 @@ For example, protein A (transcription factor) indirectly increases by expression
-
-
-
-
- an object property that specifies a process that is induced by vaccination of a vaccine
- YH
-
- induced by vaccination of
-
-
-
-
- an object property that defines a relation between a vaccine and its component
- YL, YH
+ An object property that defines a relation between a vaccine and its component
+ Asiyah Yu Lin
+ Oliver He
has vaccine component
@@ -7488,35 +7506,24 @@ For example, protein A (transcription factor) indirectly increases by expression
-
- an object property that specifies a vaccine antigen
- YL, YH
+ An object property that specifies a vaccine antigen
+ This relation only works for those vaccine antigen that is physically part of a vaccine preparation. It does not include those antigens that are not part of vaccine. For example, a protein antigen expressed in a DNA vaccine is not a part of vaccine pe ser. In this case, the vaccine expresses the protein, but the gene is part of the vaccine, not the protein. For the case, we can use the relation 'DNA vaccine expresses protein antigen' under the relation 'expresses'.
+ Asiyah Yu Lin
+ Oliver He
- This relation only works for those vaccine antigen that is physically part of a vaccine preparation. It does not include those antigens that are not part of vaccine. For example, a protein antigen expressed in a DNA vaccine is not a part of vaccine pe ser. In this case, the vaccine expresses the protein, but the gene is part of the vaccine, not the protein. For the case, we can use the relation 'DNA vaccine expresses protein antigen' under the relation 'expresses'.
has vaccine antigen
-
-
-
-
- a type of 'has vaccine component' relation that is specifically for vaccine adjuvant component
- YL, YH
-
- has vaccine adjuvant
-
-
-
-
- a type of 'has vaccine component' relation that is specifically for vaccine vector component
- YL, YH
+ A type of 'has vaccine component' relation that is specifically for vaccine vector component
+ Asiyah Yu Lin
+ Oliver He
has vaccine vector
@@ -7528,8 +7535,8 @@ For example, protein A (transcription factor) indirectly increases by expression
+ An object property that specifies a relation between a vaccine and a vaccinate route
- an object property that specifies a relation between a vaccine and a vaccinate route
vaccinated in route
@@ -7540,12 +7547,12 @@ For example, protein A (transcription factor) indirectly increases by expression
- a shortcut relation that equals to:
+ A shortcut relation that equals to:
'processed material' and (is_specified_output_of some 'vaccine preparation') and ('has function' some ('vaccine function' and ('is realized by' only ('vaccine immunization' and (realizes some ('vaccine host role' and (role_of some 'organism')))))))).
The domain of this relation is a vaccine.
The range of this relation is a organism.
- YL
- Yongqun He
+ Asiyah Yu Lin
+ Oliver He
immunization for host
vaccine immunization for host
@@ -7557,17 +7564,31 @@ The range of this relation is a organism.
- a shortcut relation that equals to:
-
-processed material and (is_specified_output_of some vaccine preparation) and (has function some (vaccine function and (is realized by only (vaccine immunization and (realizes some ('immunization target role' and (role_of some 'MICROBE'))))))))
+
+
+
+
+
+
+
+
+
+
+
+
+ A shortcut relation that equals to:
+processed material and (is_specified_output_of some vaccine preparation) and (has function some (vaccine function and (is realized by only (vaccine immunization and (realizes some ('immunization target role' and (role_of some 'pathogen'))))))))
-The domain of this relation is a vaccine.
-The range of this relation is a microbe (a bacterium, a virus, a fungus, and a parasite)
- Yongqun He
- immunization against microbe
- vaccine immunization against microbe
+The domain of this relation is a vaccine.
+The range of this relation is a pathogen (a bacterium, a virus, a fungus, and a parasite)
+Ranges: organism and 'has role' some 'pathogen role'
+ Oliver He
+ immunization against pathogen
+ immunizes against microbe
+ vaccine immunization against pathogen
+ https://github.com/vaccineontology/VO/issues/675
- immunizes against microbe
+ immunizes against pathogen
@@ -7587,20 +7608,10 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
An object property that represents a relation between a material entity and biological process
- Anthony Huffman, Oliver He
-
- up-expressed as immune signature of
-
-
-
-
-
-
-
- An object property that represents a relation between a material entity (such as vaccine or vaccine adjuvant) and an immune profile where the material entity can induce the immune profile in a host.
- Oliver He, Amogh Madireddi
+ Anthony Huffman
+ Oliver He
- induces immune profile
+ up-expressed as immune signature of
@@ -7750,8 +7761,8 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
http://purl.org/obo/owl/relationship
OBO_REL:0000007
relationship
- has_proper_part
has_proper_part
+ has_proper_part
@@ -27752,7 +27763,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
your body mass index
BFO 2 Reference: In all areas of empirical inquiry we encounter general terms of two sorts. First are general terms which refer to universals or types:animaltuberculosissurgical procedurediseaseSecond, are general terms used to refer to groups of entities which instantiate a given universal but do not correspond to the extension of any subuniversal of that universal because there is nothing intrinsic to the entities in question by virtue of which they – and only they – are counted as belonging to the given group. Examples are: animal purchased by the Emperortuberculosis diagnosed on a Wednesdaysurgical procedure performed on a patient from Stockholmperson identified as candidate for clinical trial #2056-555person who is signatory of Form 656-PPVpainting by Leonardo da VinciSuch terms, which represent what are called ‘specializations’ in [81
Entity doesn't have a closure axiom because the subclasses don't necessarily exhaust all possibilites. For example Werner Ceusters 'portions of reality' include 4 sorts, entities (as BFO construes them), universals, configurations, and relations. It is an open question as to whether entities as construed in BFO will at some point also include these other portions of reality. See, for example, 'How to track absolutely everything' at http://www.referent-tracking.com/_RTU/papers/CeustersICbookRevised.pdf
-
@@ -27772,7 +27782,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
An entity is anything that exists or has existed or will exist. (axiom label in BFO2 Reference: [001-001])
- entity
entity
@@ -27785,11 +27794,9 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
continuant
Continuant
continuant
- An entity that exists in full at any time in which it exists at all, persists through time while maintaining its identity and has no temporal parts.
An entity that exists in full at any time in which it exists at all, persists through time while maintaining its identity and has no temporal parts.
BFO 2 Reference: Continuant entities are entities which can be sliced to yield parts only along the spatial dimension, yielding for example the parts of your table which we call its legs, its top, its nails. ‘My desk stretches from the window to the door. It has spatial parts, and can be sliced (in space) in two. With respect to time, however, a thing is a continuant.’ [60, p. 240
Continuant doesn't have a closure axiom because the subclasses don't necessarily exhaust all possibilites. For example, in an expansion involving bringing in some of Ceuster's other portions of reality, questions are raised as to whether universals are continuants
-
@@ -27816,7 +27823,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
(forall (x) (if (Continuant x) (Entity x))) // axiom label in BFO2 CLIF: [008-002]
(forall (x) (if (Material Entity x) (exists (t) (and (TemporalRegion t) (existsAt x t))))) // axiom label in BFO2 CLIF: [011-002]
- continuant
continuant
@@ -27834,7 +27840,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
BFO 2 Reference: s-dependence obtains between every process and its participants in the sense that, as a matter of necessity, this process could not have existed unless these or those participants existed also. A process may have a succession of participants at different phases of its unfolding. Thus there may be different players on the field at different times during the course of a football game; but the process which is the entire game s-depends_on all of these players nonetheless. Some temporal parts of this process will s-depend_on on only some of the players.
Occurrent doesn't have a closure axiom because the subclasses don't necessarily exhaust all possibilites. An example would be the sum of a process and the process boundary of another process.
Simons uses different terminology for relations of occurrents to regions: Denote the spatio-temporal location of a given occurrent e by 'spn[e]' and call this region its span. We may say an occurrent is at its span, in any larger region, and covers any smaller region. Now suppose we have fixed a frame of reference so that we can speak not merely of spatio-temporal but also of spatial regions (places) and temporal regions (times). The spread of an occurrent, (relative to a frame of reference) is the space it exactly occupies, and its spell is likewise the time it exactly occupies. We write 'spr[e]' and `spl[e]' respectively for the spread and spell of e, omitting mention of the frame.
-
@@ -27881,7 +27886,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
the interior of your mouth
A continuant that is a bearer of quality and realizable entity entities, in which other entities inhere and which itself cannot inhere in anything.
b is an independent continuant = Def. b is a continuant which is such that there is no c and no t such that b s-depends_on c at t. (axiom label in BFO2 Reference: [017-002])
-
@@ -27900,6 +27904,7 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
(forall (x t) (if (IndependentContinuant x) (exists (r) (and (SpatialRegion r) (locatedInAt x r t))))) // axiom label in BFO2 CLIF: [134-001]
(forall (x t) (if (and (IndependentContinuant x) (existsAt x t)) (exists (y) (and (Entity y) (specificallyDependsOnAt y x t))))) // axiom label in BFO2 CLIF: [018-002]
(iff (IndependentContinuant a) (and (Continuant a) (not (exists (b t) (specificallyDependsOnAt a b t))))) // axiom label in BFO2 CLIF: [017-002]
+ A continuant that is a bearer of quality and realizable entity entities, in which other entities inhere and which itself cannot inhere in anything.
independent continuant
@@ -27994,7 +27999,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
An occurrent that has temporal proper parts and for some time t, p s-depends_on some material entity at t.
p is a process = Def. p is an occurrent that has temporal proper parts and for some time t, p s-depends_on some material entity at t. (axiom label in BFO2 Reference: [083-003])
BFO 2 Reference: The realm of occurrents is less pervasively marked by the presence of natural units than is the case in the realm of independent continuants. Thus there is here no counterpart of ‘object’. In BFO 1.0 ‘process’ served as such a counterpart. In BFO 2.0 ‘process’ is, rather, the occurrent counterpart of ‘material entity’. Those natural – as contrasted with engineered, which here means: deliberately executed – units which do exist in the realm of occurrents are typically either parasitic on the existence of natural units on the continuant side, or they are fiat in nature. Thus we can count lives; we can count football games; we can count chemical reactions performed in experiments or in chemical manufacturing. We cannot count the processes taking place, for instance, in an episode of insect mating behavior.Even where natural units are identifiable, for example cycles in a cyclical process such as the beating of a heart or an organism’s sleep/wake cycle, the processes in question form a sequence with no discontinuities (temporal gaps) of the sort that we find for instance where billiard balls or zebrafish or planets are separated by clear spatial gaps. Lives of organisms are process units, but they too unfold in a continuous series from other, prior processes such as fertilization, and they unfold in turn in continuous series of post-life processes such as post-mortem decay. Clear examples of boundaries of processes are almost always of the fiat sort (midnight, a time of death as declared in an operating theater or on a death certificate, the initiation of a state of war)
-
@@ -28012,6 +28016,7 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
(iff (Process a) (and (Occurrent a) (exists (b) (properTemporalPartOf b a)) (exists (c t) (and (MaterialEntity c) (specificallyDependsOnAt a c t))))) // axiom label in BFO2 CLIF: [083-003]
+ An occurrent that has temporal proper parts and for some time t, p s-depends_on some material entity at t.
process
@@ -28034,7 +28039,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
BFO 2 Reference: Dispositions exist along a strength continuum. Weaker forms of disposition are realized in only a fraction of triggering cases. These forms occur in a significant number of cases of a similar type.
-
@@ -28066,7 +28070,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
-
@@ -28132,7 +28135,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
the role of being a doctor
the shape of this hole.
the smell of this portion of mozzarella
- A continuant that inheres in or is borne by other entities. Every instance of A requires some specific instance of B which must always be the same.
A continuant that inheres in or is borne by other entities. Every instance of A requires some specific instance of B which must always be the same.
b is a relational specifically dependent continuant = Def. b is a specifically dependent continuant and there are n > 1 independent continuants c1, … cn which are not spatial regions are such that for all 1 i < j n, ci and cj share no common parts, are such that for each 1 i n, b s-depends_on ci at every time t during the course of b’s existence (axiom label in BFO2 Reference: [131-004])
b is a specifically dependent continuant = Def. b is a continuant & there is some independent continuant c which is not a spatial region and which is such that b s-depends_on c at every time t during the course of b’s existence. (axiom label in BFO2 Reference: [050-003])
@@ -28155,6 +28157,7 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
(iff (RelationalSpecificallyDependentContinuant a) (and (SpecificallyDependentContinuant a) (forall (t) (exists (b c) (and (not (SpatialRegion b)) (not (SpatialRegion c)) (not (= b c)) (not (exists (d) (and (continuantPartOfAt d b t) (continuantPartOfAt d c t)))) (specificallyDependsOnAt a b t) (specificallyDependsOnAt a c t)))))) // axiom label in BFO2 CLIF: [131-004]
(iff (SpecificallyDependentContinuant a) (and (Continuant a) (forall (t) (if (existsAt a t) (exists (b) (and (IndependentContinuant b) (not (SpatialRegion b)) (specificallyDependsOnAt a b t))))))) // axiom label in BFO2 CLIF: [050-003]
+ A continuant that inheres in or is borne by other entities. Every instance of A requires some specific instance of B which must always be the same.
specifically dependent continuant
@@ -28274,7 +28277,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
your left nostril (a fiat part – the opening – of your left nasal cavity)
-
@@ -28336,6 +28338,7 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
(iff (GenericallyDependentContinuant a) (and (Continuant a) (exists (b t) (genericallyDependsOnAt a b t)))) // axiom label in BFO2 CLIF: [074-001]
+ A continuant that is dependent on one or other independent continuant bearers. For every instance of A requires some instance of (an independent continuant type) B but which instance of B serves can change from time to time.
generically dependent continuant
@@ -28426,8 +28429,8 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
BFO 2 Reference: Material entities (continuants) can preserve their identity even while gaining and losing material parts. Continuants are contrasted with occurrents, which unfold themselves in successive temporal parts or phases [60
BFO 2 Reference: Object, Fiat Object Part and Object Aggregate are not intended to be exhaustive of Material Entity. Users are invited to propose new subcategories of Material Entity.
BFO 2 Reference: ‘Matter’ is intended to encompass both mass and energy (we will address the ontological treatment of portions of energy in a later version of BFO). A portion of matter is anything that includes elementary particles among its proper or improper parts: quarks and leptons, including electrons, as the smallest particles thus far discovered; baryons (including protons and neutrons) at a higher level of granularity; atoms and molecules at still higher levels, forming the cells, organs, organisms and other material entities studied by biologists, the portions of rock studied by geologists, the fossils studied by paleontologists, and so on.Material entities are three-dimensional entities (entities extended in three spatial dimensions), as contrasted with the processes in which they participate, which are four-dimensional entities (entities extended also along the dimension of time).According to the FMA, material entities may have immaterial entities as parts – including the entities identified below as sites; for example the interior (or ‘lumen’) of your small intestine is a part of your body. BFO 2.0 embodies a decision to follow the FMA here.
-
+
@@ -28437,6 +28440,7 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
+
A material entity is an independent continuant that has some portion of matter as proper or improper continuant part. (axiom label in BFO2 Reference: [019-002])
Every entity which has a material entity as continuant part is a material entity. (axiom label in BFO2 Reference: [020-002])
@@ -28477,7 +28481,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
The simplest type of process profiles are what we shall call ‘quality process profiles’, which are the process profiles which serve as the foci of the sort of selective abstraction that is involved when measurements are made of changes in single qualities, as illustrated, for example, by process profiles of mass, temperature, aortic pressure, and so on.
b is a process_profile =Def. there is some process c such that b process_profile_of c (axiom label in BFO2 Reference: [093-002])
-
b process_profile_of c holds when b proper_occurrent_part_of c& there is some proper_occurrent_part d of c which has no parts in common with b & is mutually dependent on b& is such that b, c and d occupy the same temporal region (axiom label in BFO2 Reference: [094-005])
(forall (x y) (if (processProfileOf x y) (and (properContinuantPartOf x y) (exists (z t) (and (properOccurrentPartOf z y) (TemporalRegion t) (occupiesSpatioTemporalRegion x t) (occupiesSpatioTemporalRegion y t) (occupiesSpatioTemporalRegion z t) (not (exists (w) (and (occurrentPartOf w x) (occurrentPartOf w z))))))))) // axiom label in BFO2 CLIF: [094-005]
(iff (ProcessProfile a) (exists (b) (and (Process b) (processProfileOf a b)))) // axiom label in BFO2 CLIF: [093-002]
@@ -31663,7 +31666,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
602.585
602.22540
[C@]1(O[C@@H]([C@H]([C@H]1O)O)CO[P@@](N[C@H](C(OCC(CC)CC)=O)C)(OC=2C=CC=CC2)=O)(C#N)C=3N4N=CN=C(C4=CC3)N
- PubChem CID: 121304016
CAS:1809249-37-3
DrugBank:DB14761
KEGG:D11472
@@ -31684,6 +31686,7 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
PMID:32145386
PMID:32147516
PMID:32152082
+ PubChem CID: 121304016
Wikipedia:Remdesivir
2-ethylbutyl N-[(S)-{[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxytetrahydrofuran-2-yl]methoxy}(phenoxy)phosphoryl]-L-alaninate
chebi_ontology
@@ -100704,36 +100707,6 @@ results from evaporation of droplets coughed or sneezed into the atmosphere or b
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
Anthony Huffman, Oliver He
https://pubmed.ncbi.nlm.nih.gov/32753554/
SLLIVNNATNVVIKV
@@ -558418,18 +558391,29 @@ POC: https://www.fda.gov/media/136315/download
- cell
cell
PMID:18089833.Cancer Res. 2007 Dec 15;67(24):12018-25. "...Epithelial cells were harvested from histologically confirmed adenocarcinomas .."
A material entity of anatomical origin (part of or deriving from an organism) that has as its parts a maximally connected cell compartment surrounded by a plasma membrane.
- cell
cell
+
+
+
+
+ native cell
+ A cell that is found in a natural setting, which includes multicellular organism cells 'in vivo' (i.e. part of an organism), and unicellular organisms 'in environment' (i.e. part of a natural environment).
+
+
+ native cell
+
+
+
+
@@ -558521,6 +558505,33 @@ POC: https://www.fda.gov/media/136315/download
+
+
+
+
+ mononuclear cell
+ A leukocyte with a single non-segmented nucleus in the mature form.
+
+
+ mononuclear cell
+
+
+
+
+
+
+
+
+
+ peripheral blood mononuclear cell
+ A leukocyte with a single non-segmented nucleus in the mature form found in the circulatory pool of blood.
+
+
+ peripheral blood mononuclear cell
+
+
+
+
@@ -558970,10 +558981,10 @@ POC: https://www.fda.gov/media/136315/download
UMLS_CUI:C5203670
2019 Novel Coronavirus (2019-nCoV)
2019-nCoV infection
- Wuhan coronavirus infection
- Wuhan seafood market pneumonia virus infection
COVID19
SARS-CoV-2 infection
+ Wuhan coronavirus infection
+ Wuhan seafood market pneumonia virus infection
disease_ontology
DOID:0080600
COVID-19
@@ -559100,8 +559111,8 @@ POC: https://www.fda.gov/media/136315/download
DOID:0060208
OMIM:600795
- FTD3
CHMP2B-related frontotemporal dementia
+ FTD3
amyotrophic lateral sclerosis type 17
disease_ontology
DOID:0111227
@@ -559260,8 +559271,8 @@ POC: https://www.fda.gov/media/136315/download
ARDS
Non-cardiogenic pulmonary edema
Shock lung
- adult RDS
acute respiratory distress syndrome
+ adult RDS
disease_ontology
DOID:11394
@@ -559653,8 +559664,8 @@ POC: https://www.fda.gov/media/136315/download
NCI:C3389
SNOMEDCT_US_2021_09_01:192415000
UMLS_CUI:C0038436
- traumatic neurosis
PTSD
+ traumatic neurosis
disease_ontology
post-traumatic stress disorder
DOID:2055
@@ -560979,8 +560990,8 @@ OMIM mapping confirmed by DO. [SN].
William R. Hogan
mu agonist
- function-activating mu receptor binding disposition
function-activating mu receptor binding disposition
+ function-activating mu receptor binding disposition
@@ -567166,7 +567177,6 @@ OMIM mapping confirmed by DO. [SN].
-
immune response
@@ -567174,11 +567184,10 @@ OMIM mapping confirmed by DO. [SN].
-
biological_process
GO:0006955
+
- This term was improved by GO_REF:0000022. It was redefined and moved.
immune response
@@ -568751,7 +568760,9 @@ OMIM mapping confirmed by DO. [SN].
biological_process
+ A biological process is the execution of a genetically-encoded biological module or program. It consists of all the steps required to achieve the specific biological objective of the module. A biological process is accomplished by a particular set of molecular functions carried out by specific gene products (or macromolecular complexes), often in a highly regulated manner and in a particular temporal sequence.
A biological process represents a specific objective that the organism is genetically programmed to achieve. Biological processes are often described by their outcome or ending state, e.g., the biological process of cell division results in the creation of two daughter cells (a divided cell) from a single parent cell. A biological process is accomplished by a particular set of molecular functions carried out by specific gene products (or macromolecular complexes), often in a highly regulated manner and in a particular temporal sequence.
+ https://github.com/geneontology/go-ontology/issues/24968
@@ -568767,6 +568778,13 @@ OMIM mapping confirmed by DO. [SN].
single organism process
single-organism process
GO:0008150
+
+
+
+
+
+
+
@@ -577124,6 +577142,12 @@ OMIM mapping confirmed by DO. [SN].
physiological response to stimulus
biological_process
GO:0050896
+
+
+
+
+
+
@@ -580752,8 +580776,8 @@ OMIM mapping confirmed by DO. [SN].
UMLS:C1290857
UMLS:C4025871
Abnormal face
- Facial abnormality
Abnormality of the face
+ Facial abnormality
Disorder of the face
human_phenotype
Anomaly of face
@@ -580777,10 +580801,10 @@ OMIM mapping confirmed by DO. [SN].
UMLS:C0240547
UMLS:C0265736
UMLS:C2235909
+ Abnormality of the nose
Anomaly of the nose
Nasal abnormality
Nasal anomaly
- Abnormality of the nose
Deformity of the nose
Malformation of the nose
Nasal deformity
@@ -580961,8 +580985,8 @@ OMIM mapping confirmed by DO. [SN].
MSH:D007037
SNOMEDCT_US:40930008
UMLS:C0020676
- Underactive thyroid
Low T4
+ Underactive thyroid
human_phenotype
HP:0000821
Hypothyroidism
@@ -581177,8 +581201,8 @@ OMIM mapping confirmed by DO. [SN].
MSH:D001168
SNOMEDCT_US:3723001
UMLS:C0003864
- Joint inflammation
Arthritis
+ Joint inflammation
human_phenotype
HP:0001369
Arthritis
@@ -581214,8 +581238,8 @@ OMIM mapping confirmed by DO. [SN].
MSH:D008103
SNOMEDCT_US:19943007
UMLS:C0023890
- Scar tissue replaces healthy tissue in the liver
Hepatic cirrhosis
+ Scar tissue replaces healthy tissue in the liver
Liver cirrhosis
HP:0001394
Cirrhosis is caused by chronic liver disease as a result of viral infections (hepatitis), alcohol abuse, certain medications, certain metabolic disorders of iron and copper, and many others. Cirrhosis may lead to a number of abnormalities including hepatomegaly, jaundice, abnormal liver function tests, ascites, dilatation of veins in the abdominal wall, anemia, and clotting deficiencies.
@@ -581295,14 +581319,14 @@ OMIM mapping confirmed by DO. [SN].
UMLS:C0018798
UMLS:C0152021
Abnormality of cardiac morphology
+ Abnormality of the heart
Abnormally shaped heart
+ Cardiac abnormality
+ Cardiac anomalies
Cardiac anomaly
Congenital heart defect
Congenital heart defects
Heart defect
- Abnormality of the heart
- Cardiac abnormality
- Cardiac anomalies
human_phenotype
HP:0001627
Abnormal heart morphology
@@ -581323,10 +581347,10 @@ OMIM mapping confirmed by DO. [SN].
UMLS:C0018801
UMLS:C0018802
CHF
- Cardiac failures
- Chronic heart failure
Cardiac failure
+ Cardiac failures
Cardiac insufficiency
+ Chronic heart failure
Heart failure
human_phenotype
HP:0001635
@@ -581447,8 +581471,8 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:53741008
UMLS:C1956346
Coronary atherosclerosis
- Plaque build-up in arteries supplying blood to heart
Coronary disease
+ Plaque build-up in arteries supplying blood to heart
human_phenotype
HP:0001677
Coronary artery disease, also called atherosclerotic heart disease, is the result of atheromatous plaques within the coronary arteries leading to myocardial ischemia and infarction.
@@ -581596,9 +581620,9 @@ OMIM mapping confirmed by DO. [SN].
UMLS:C0027429
Blockage of nose
Nasal blockage
+ Nasal obstruction
Obstruction of nose
Stuffy nose
- Nasal obstruction
Congestion of nose
Nasal congestion
human_phenotype
@@ -581644,8 +581668,8 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:134199001
SNOMEDCT_US:24827003
UMLS:C0152009
- Abnormality of leukocytes
Abnormal leukocyte function
+ Abnormality of leukocytes
human_phenotype
HP:0001881
Leukocytes are nucleated cells of the myeloid or lymphoid lineages, found in blood or other tissue.
@@ -581748,9 +581772,9 @@ OMIM mapping confirmed by DO. [SN].
+ HP:0002146
HP:0004355
HP:0004367
- HP:0002146
UMLS:C4021768
Laboratory abnormality
Metabolism abnormality
@@ -581775,12 +581799,12 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:386661006
SNOMEDCT_US:50177009
UMLS:C0015967
- elevated body temperature
- febris
- high body temperature
Fever
Hyperthermia
Pyrexia
+ elevated body temperature
+ febris
+ high body temperature
human_phenotype
HP:0001945
Hyperthermia is defined as a temperature greater than 37.5-38.3 degree celsius (100-101 degree Fahrenheit).
@@ -581840,9 +581864,9 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:23853001
UMLS:C0007682
UMLS:C4021765
+ Abnormality of the central nervous system
Morphological abnormality of the CNS
Morphological abnormality of the central nervous system
- Abnormality of the central nervous system
Central nervous system disease
HP:0002011
Morphological central nervous system abnormality
@@ -581863,8 +581887,8 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:300359004
SNOMEDCT_US:422400008
UMLS:C0042963
- Throwing up
Emesis
+ Throwing up
Vomiting
human_phenotype
HP:0002013
@@ -581885,13 +581909,13 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:267060006
SNOMEDCT_US:62315008
UMLS:C0011991
+ Diarrhea
Diarrhoea
Watery stool
diarhea
diarhoea
loose bowel movement
loose stool
- Diarrhea
human_phenotype
HP:0002014
Diarrhea
@@ -581947,9 +581971,9 @@ OMIM mapping confirmed by DO. [SN].
MSH:D015746
SNOMEDCT_US:21522001
UMLS:C0000737
+ Abdominal pain
Pain in stomach
Stomach pain
- Abdominal pain
human_phenotype
Abdominal discomfort
Upset stomach
@@ -581971,10 +581995,10 @@ OMIM mapping confirmed by DO. [SN].
MSH:D000855
SNOMEDCT_US:79890006
UMLS:C0003123
+ Anorexia
appetite loss
loss of appetite
no appetite
- Anorexia
human_phenotype
HP:0002039
Note that this term does not refer to the condition anorexia nervosa (A disorder characterized by an obsessive desire to lose weight by refusing to eat).
@@ -582007,10 +582031,10 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:19829001
UMLS:C0024115
UMLS:C4021760
- Abnormally shaped lung
- Unusal lung shape
Abnormality of lung structure
Abnormality of the lungs
+ Abnormally shaped lung
+ Unusal lung shape
Lung disease
HP:0002088
Abnormal lung morphology
@@ -582033,9 +582057,9 @@ OMIM mapping confirmed by DO. [SN].
Abnormal breathing
Breathing difficulty
Difficult to breathe
+ Dyspnoea
Trouble breathing
shortness of breath
- Dyspnoea
HP:0002094
Dyspnea
@@ -582207,9 +582231,9 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:53888004
UMLS:C0037317
Difficulty sleeping
- Trouble sleeping
Sleep disturbances
Sleep dysfunction
+ Trouble sleeping
human_phenotype
HP:0002360
Sleep disturbance
@@ -582243,16 +582267,16 @@ OMIM mapping confirmed by DO. [SN].
HP:0003008
HP:0006741
Abnormal tissue mass
- NCIT:C3262
MSH:D009369
+ NCIT:C3262
SNOMEDCT_US:108369006
SNOMEDCT_US:363346000
UMLS:C0006826
UMLS:C0027651
- Tumor
- Tumour
Neoplasia
Oncological abnormality
+ Tumor
+ Tumour
human_phenotype
Cancer
Oncology
@@ -582316,10 +582340,10 @@ OMIM mapping confirmed by DO. [SN].
HP:0002784
SNOMEDCT_US:195708003
UMLS:C0581381
- Recurrent URI
- Recurrent colds
Frequent upper respiratory infections
Frequent upper respiratory tract infections
+ Recurrent URI
+ Recurrent colds
Recurrent upper respiratory and lower respiratory infections
Recurrent upper respiratory infection
Recurrent upper respiratory infections
@@ -582393,8 +582417,8 @@ OMIM mapping confirmed by DO. [SN].
HP:0001439
UMLS:C4021750
- Abnormality of the thighbone
Abnormality of the femora
+ Abnormality of the thighbone
human_phenotype
HP:0002823
The femur (plural: femora) is the thigh bone.
@@ -582486,17 +582510,17 @@ OMIM mapping confirmed by DO. [SN].
UMLS:C0877359
UMLS:C1842003
UMLS:C1848701
- High liver enzymes
- Raised liver enzymes
Abnormal liver enzymes
Abnormal liver function
Abnormal liver function tests
Elevated liver enzymes
Elevated serum transaminases
Elevated transaminases
+ High liver enzymes
Increased liver enzymes
Increased liver function tests
Increased transaminases
+ Raised liver enzymes
Subclinical abnormal liver function tests
Elevated liver function tests
HP:0002910
@@ -582547,8 +582571,8 @@ OMIM mapping confirmed by DO. [SN].
高脂血症
An elevated lipid concentration in the blood.
- HP:0008356
HP:0008159
+ HP:0008356
MSH:D006949
SNOMEDCT_US:55822004
UMLS:C0020473
@@ -583053,8 +583077,8 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:111255008
SNOMEDCT_US:240241003
UMLS:C0023234
- Osteonecrosis of the femoral head
Osteochondrosis of the femoral head
+ Osteonecrosis of the femoral head
Perthes-like femoral head changes
human_phenotype
Coxa plana
@@ -583080,15 +583104,15 @@ OMIM mapping confirmed by DO. [SN].
MSH:D003924
SNOMEDCT_US:44054006
UMLS:C0011860
- NIDDM
- Non-insulin dependent diabetes
- Type 2 diabetes
- Type II diabetes
Diabetes mellitus Type II
Diabetes mellitus, noninsulin-dependent
+ NIDDM
NIDDM diabetes mellitus
+ Non-insulin dependent diabetes
Noninsulin dependent diabetes mellitus
Noninsulin-dependent diabetes
+ Type 2 diabetes
+ Type II diabetes
human_phenotype
Diabetes mellitus type 2
Noninsulin-dependent diabetes mellitus
@@ -583190,8 +583214,8 @@ OMIM mapping confirmed by DO. [SN].
UMLS:C0206062
Abnormal lung parenchyma morphology
Abnormality in area between air sacs in lung
- Interstitial pulmonary disease
Interstitial lung disease
+ Interstitial pulmonary disease
HP:0006530
Abnormal pulmonary Interstitial morphology
@@ -583326,8 +583350,8 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:418107008
SNOMEDCT_US:419045004
UMLS:C0041657
- Passing out
Loss of consciousness
+ Passing out
human_phenotype
HP:0007185
Loss of consciousness
@@ -583358,15 +583382,15 @@ OMIM mapping confirmed by DO. [SN].
peter
2008-04-01T11:55:00Z
- NCIT:C3262
MSH:D005770
+ NCIT:C3262
SNOMEDCT_US:126768004
UMLS:C0017185
GI tract tumor
- Neoplasm of the GI tract
Gastrointestinal tract neoplasia
Gastrointestinal tract neoplasm
Gastrointestinal tract tumor
+ Neoplasm of the GI tract
human_phenotype
HP:0007378
Neoplasm of the gastrointestinal tract
@@ -584169,9 +584193,9 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:248274002
SNOMEDCT_US:84229001
UMLS:C0015672
+ Fatigue
Tired
Tiredness
- Fatigue
Malaise
HP:0012378
Fatigue is distinct from muscle weakness.
@@ -585015,8 +585039,8 @@ However, with the advent of genetic analysis, adenovirus and parvovirus B19 have
UMLS:C0239337
UMLS:C4073131
Abnormal limbs
- Limb anomaly
Abnormality of limbs
+ Limb anomaly
Dysmelia
Abnormality of limbs
@@ -585045,8 +585069,8 @@ However, with the advent of genetic analysis, adenovirus and parvovirus B19 have
HPO:skoehler
HP:0040066
- UMLS:C4022457
UMLS:C4022455
+ UMLS:C4022457
Abnormal morphology of bones of the lower limbs
Abnormal shape of bones of the lower limbs
Abnormality of lower limb bone
@@ -585065,11 +585089,11 @@ However, with the advent of genetic analysis, adenovirus and parvovirus B19 have
HPO:skoehler
SNOMEDCT_US:165534000
UMLS:C0580550
+ Abnormal lymphocyte count
Abnormal lymphocyte counts
Abnormal number of lymphocytes
Abnormal numbers of lymphocytes
Abnormality of lymphocyte number
- Abnormal lymphocyte count
Abnormal lymphocyte count
@@ -585203,8 +585227,8 @@ However, with the advent of genetic analysis, adenovirus and parvovirus B19 have
MSH:D002637
SNOMEDCT_US:29857009
UMLS:C0008031
- Thoracic pain
Chest pain
+ Thoracic pain
human_phenotype
HP:0100749
Chest pain
@@ -585243,8 +585267,8 @@ However, with the advent of genetic analysis, adenovirus and parvovirus B19 have
doelkens
2011-06-07T05:28:27Z
UMLS:C0747556
- Recurrent sore throat
Pharyngitis, recurrent
+ Recurrent sore throat
human_phenotype
HP:0100776
Recurrent pharyngitis
@@ -585280,8 +585304,8 @@ However, with the advent of genetic analysis, adenovirus and parvovirus B19 have
doelkens
2011-06-09T06:03:45Z
- NCIT:C3262
MSH:D015179
+ NCIT:C3262
SNOMEDCT_US:126837005
UMLS:C0009404
Large intestine tumor
@@ -585397,6 +585421,7 @@ of a plan towards which the realization of the plan is directed."OBI Plan and Planned Process/Roles Branch
OBI_0000217
+
@@ -585421,7 +585446,6 @@ of a plan towards which the realization of the plan is directed."
-
action specification
@@ -585458,14 +585482,16 @@ of a plan towards which the realization of the plan is directed."
- data item
data item
+ data item
Data items include counts of things, analyte concentrations, and statistical summaries.
An information content entity that is intended to be a truthful statement about something (modulo, e.g., measurement precision or other systematic errors) and is constructed/acquired by a method which reliably tends to produce (approximately) truthful statements.
a data item is an information content entity that is intended to be a truthful statement about something (modulo, e.g., measurement precision or other systematic errors) and is constructed/acquired by a method which reliably tends to produce (approximately) truthful statements.
2/2/2009 Alan and Bjoern discussing FACS run output data. This is a data item because it is about the cell population. Each element records an event and is typically further composed a set of measurment data items that record the fluorescent intensity stimulated by one of the lasers.
+ 2009-03-16: data item deliberatly ambiguous: we merged data set and datum to be one entity, not knowing how to define singular versus plural. So data item is more general than datum.
2009-03-16: data item deliberatly ambiguous: we merged data set and datum to be one entity, not knowing how to define singular versus plural. So data item is more general than datum.
+ 2009-03-16: removed datum as alternative term as datum specifically refers to singular form, and is thus not an exact synonym.
2009-03-16: removed datum as alternative term as datum specifically refers to singular form, and is thus not an exact synonym.
2014-03-31: See discussion at http://odontomachus.wordpress.com/2014/03/30/aboutness-objects-propositions/
JAR: datum -- well, this will be very tricky to define, but maybe some
@@ -585475,14 +585501,12 @@ process... I would include lists, tables, sentences... I think I might
defer to Barry, or to Brian Cantwell Smith
JAR: A data item is an approximately justified approximately true approximate belief
- 2009-03-16: data item deliberatly ambiguous: we merged data set and datum to be one entity, not knowing how to define singular versus plural. So data item is more general than datum.
- 2009-03-16: removed datum as alternative term as datum specifically refers to singular form, and is thus not an exact synonym.
- PERSON: Alan Ruttenberg
- PERSON: Chris Stoeckert
- PERSON: Jonathan Rees
PERSON: Alan Ruttenberg
+ PERSON: Alan Ruttenberg
PERSON: Chris Stoeckert
+ PERSON: Chris Stoeckert
PERSON: Jonathan Rees
+ PERSON: Jonathan Rees
data
@@ -585546,10 +585570,10 @@ JAR: A data item is an approximately justified approximately true approximate be
information_content_entity 'is_encoded_in' some digital_entity in obi before split (040907). information_content_entity 'is_encoded_in' some physical_document in obi before split (040907).
Previous. An information content entity is a non-realizable information entity that 'is encoded in' some digital or physical entity.
- PERSON: Chris Stoeckert
PERSON: Chris Stoeckert
- OBI_0000142
+ PERSON: Chris Stoeckert
OBI_0000142
+ OBI_0000142
@@ -585751,8 +585775,8 @@ concretized and realized by an actor" with alternative term "instruct
data about an ontology part
Data about an ontology part is a data item about a part of an ontology, for example a term
data about an ontology part is a data item about a part of an ontology, for example a term
- Person:Alan Ruttenberg
Person:Alan Ruttenberg
+ Person:Alan Ruttenberg
@@ -585784,11 +585808,14 @@ concretized and realized by an actor" with alternative term "instruct
A directive information entity with action specifications and objective specifications as parts that, when concretized, is realized in a process in which the bearer tries to achieve the objectives by taking the actions specified.
+ A directive information entity with action specifications and objective specifications as parts, and that may be concretized as a realizable entity that, if realized, is realized in a process in which the bearer tries to achieve the objectives by taking the actions specified.
a directive information entity that when concretized it is realized in a process in which the bearer tries to achieve the objectives, in part by taking the actions specified. Plan specifications includes parts such as objective specification, action specifications and conditional specifications.
2009-03-16: provenance: a term a plan was proposed for OBI (OBI_0000344) , edited by the PlanAndPlannedProcess branch. Original definition was " a plan is a specification of a process that is realized by an actor to achieve the objective specified as part of the plan". It has been subsequently moved to IAO where the objective for which the original term was defined was satisfied with the definitionof this, different, term.
2014-03-31: A plan specification can have other parts, such as conditional specifications.
+ 2022-01-16 Updated definition to that proposed by Clint Dowloand, IAO Issue 231.
Alternative previous definition: a plan is a set of instructions that specify how an objective should be achieved
Alan Ruttenberg
+ Clint Dowland
OBI Plan and Planned Process branch
OBI_0000344
@@ -585813,6 +585840,7 @@ Request that IAO either clarify these or change definitions not to use them
plan specification
+ https://github.com/information-artifact-ontology/IAO/issues/231#issuecomment-1010455131
@@ -586716,6 +586744,53 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Adenoviridae
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Mastadenovirus
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ Canine adenovirus type 2
+ Canine adenovirus type 2 Cav-1
+ Mastadenovirus c2
+ Mastadenovirus can2
+ dog adenovirus 2
+ ncbi_taxonomy
+ Canine adenovirus 2
+
+
+
+
@@ -586766,6 +586841,22 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:1
+ Canine adenovirus
+ Canine adenovirus A
+ ncbi_taxonomy
+ Canine mastadenovirus A
+
+
+
+
@@ -586988,6 +587079,20 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+ CPV
+ GC_ID:1
+ ncbi_taxonomy
+ Canine parvovirus
+
+
+
+
@@ -587010,6 +587115,81 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:1
+ Rotaviruses
+ ncbi_taxonomy
+ Rotavirus
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Porcine rotavirus
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ bovine rotavirus BRV
+ ncbi_taxonomy
+ Bovine rotavirus
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Birnaviridae
+
+
+
+
+
+
+
+
+
+
+ NCBITaxon:12740
+ IBDV
+ GC_ID:1
+ Avian infectious bursal disease virus
+ Gumboro virus
+ Infectious bursal disease virus of chickens
+ infectious bursal disease virus IBDV
+ ncbi_taxonomy
+ Infectious bursal disease virus
+
+
+
+
@@ -587070,8 +587250,10 @@ Request that IAO either clarify these or change definitions not to use them
+
+
IBV
GC_ID:1
Avian infectious bronchitis virus
@@ -587274,7 +587456,9 @@ Request that IAO either clarify these or change definitions not to use them
+
+
FIPV
GC_ID:1
ncbi_taxonomy
@@ -587455,6 +587639,7 @@ Request that IAO either clarify these or change definitions not to use them
+
NCBITaxon:12859
TGEV
GC_ID:1
@@ -587524,6 +587709,35 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:1
+ negative-sense genome single-stranded RNA viruses
+ ncbi_taxonomy
+ Mononegavirales
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Paramyxoviridae
+
+
+
+
@@ -587554,6 +587768,21 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:1
+ Morbilliviruses
+ ncbi_taxonomy
+ Morbillivirus
+
+
+
+
@@ -587937,10 +588166,7 @@ Request that IAO either clarify these or change definitions not to use them
- Euteleostomi
- bony vertebrates
-
NCBITaxon:40673
@@ -588024,6 +588250,28 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:11
+ PMID:11321122
+ PMID:11837318
+ purple photosynthetic bacteria and relatives
+ ncbi_taxonomy
+ "Alphaproteobacteriota" Whitman et al. 2018
+ Alphaproteobacteriota
+ Proteobacteria
+ Proteobacteriota
+ proteobacteria
+ Pseudomonadota
+
+
+
+
@@ -588152,6 +588400,61 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:11
+ PMID:23334881
+ ncbi_taxonomy
+ Proteobacteria gamma subdivision
+ Pseudomonadia
+ Purple bacteria, gamma subdivision
+ g-proteobacteria
+ gamma proteobacteria
+ gamma subdivision
+ gamma subgroup
+ Gammaproteobacteria
+
+
+
+
+
+
+
+
+
+
+
+ NCBITaxon:31968
+ GC_ID:11
+ PMID:10555317
+ PMID:11034484
+ PMID:11542017
+ PMID:15143038
+ PMID:25403554
+ PMID:37409558
+ Firmicutes
+ low G+C Gram-positive bacteria
+ low GC Gram+
+ ncbi_taxonomy
+ "Firmicutes" corrig. Gibbons and Murray 1978 (Approved Lists 1980)
+ Bacillaeota
+ Bacillota corrig. Gibbons and Murray 2021
+ Bacillus/Clostridium group
+ Clostridium group firmicutes
+ Firmicuteota
+ Low G+C firmicutes
+ clostridial firmicutes
+ firmicutes
+ Bacillota
+
+
+
+
@@ -589811,6 +590114,26 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:11
+ PMID:11075904
+ PMID:11542017
+ PMID:16558735
+ PMID:1917844
+ PMID:23908650
+ ncbi_taxonomy
+ spirochetes
+ Spirochaetales
+
+
+
+
@@ -589954,6 +590277,29 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:11
+ PMID:1380285
+ PMID:1503971
+ PMID:24744012
+ PMID:7699027
+ PMID:7981102
+ PMID:8995796
+ PMID:9336916
+ Lyme disease spirochete
+ ncbi_taxonomy
+ Borrelia burgdorferi
+ Borreliella burgdorferi
+
+
+
+
@@ -590831,6 +591177,24 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ NCBITaxon:69207
+ GC_ID:11
+ PMID:26643615
+ PMID:27488356
+ ncbi_taxonomy
+ Anaerobacter
+ Clostridium
+
+
+
+
@@ -590908,6 +591272,41 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+ NCBITaxon:2588446
+ NCBITaxon:2588447
+ NCBITaxon:41533
+ NCBITaxon:592
+ GC_ID:11
+ PMID:10758910
+ Salmonella enterica serovar Enteritidis
+ ncbi_taxonomy
+ Bacillus enteritidis
+ Salmonella enteritidis
+ Salmonella enterica subsp. enterica serovar Enteritidis
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Canine parainfluenza virus
+
+
+
+
@@ -590921,6 +591320,27 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ NCBITaxon:1683536
+ GC_ID:11
+ PMID:1374625
+ PMID:184898
+ ncbi_taxonomy
+ 'Clostridium plagarum'
+ Bacillus perfringens
+ Bacterium welchii
+ Clostridium plagarum
+ Clostridium perfringens
+
+
+
+
@@ -591255,6 +591675,23 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ NCBITaxon:10781
+ GC_ID:1
+ Parvovirus
+ Parvoviruses
+ ncbi_taxonomy
+ Protoparvovirus
+
+
+
+
@@ -591748,6 +592185,22 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Galloanseri
+ ducks, geese, chickens, fowl, quail, currasows and allies
+ Galloanserae
+
+
+
+
@@ -592017,6 +592470,29 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:11
+ PMID:1503975
+ PMID:8427802
+ ncbi_taxonomy
+ Bacillus insidiosus
+ Bacillus rhusiopathiae suis
+ Bacterium rhusiopathiae
+ Erysipelothrix erysipeloides
+ Erysipelothrix insidiosa
+ Erysipelothrix murisepticus
+ Erysipelothrix porci
+ Erysipelothrix rhusiopathiae
+
+
+
+
@@ -593510,6 +593986,27 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ NCBITaxon:29512
+ NCBITaxon:29514
+ NCBITaxon:29516
+ GC_ID:11
+ PMID:10425768
+ PMID:1581182
+ PMID:19868121
+ PMID:9103653
+ ncbi_taxonomy
+ Leptospira
+
+
+
+
@@ -593536,6 +594033,34 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ NCBITaxon:2843297
+ NCBITaxon:2843299
+ GC_ID:11
+ PMID:15545494
+ PMID:19867994
+ PMID:19868337
+ PMID:19972157
+ PMID:25288661
+ PMID:9542090
+ ncbi_taxonomy
+ Leptospira icteroides
+ Spirochaeta biflexa
+ Spirochaeta icterogenes
+ Spirochaeta icterohaemorrhagiae
+ Spirochaeta interrogans
+ Spirochaeta nodosa
+ Leptospira interrogans
+
+
+
+
@@ -593692,6 +594217,22 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:11
+ PMID:18988685
+ PMID:23851394
+ ncbi_taxonomy
+ Terrabacteria group
+
+
+
+
@@ -595275,7 +595816,6 @@ Request that IAO either clarify these or change definitions not to use themeubacteria
-
GC_ID:11
@@ -595298,6 +595838,8 @@ Request that IAO either clarify these or change definitions not to use themPMID:12054223
PMID:2112744
PMID:270744
+ PMID:32628106
+ PMID:36748408
PMID:7520741
PMID:8123559
PMID:8186100
@@ -595445,6 +595987,25 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:11
+ PMID:11837318
+ PMID:25288668
+ PMID:26654112
+ ncbi_taxonomy
+ "Leptospiria" Cavalier-Smith 2020
+ Spirochaetes
+ Spirochaetia
+
+
+
+
@@ -596490,6 +597051,21 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:4
+ ncbi_taxonomy
+ Mycoplasma gallisepticum
+ Mycoplasmoides gallisepticum
+
+
+
+
@@ -596529,6 +597105,20 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+ GC_ID:11
+ ncbi_taxonomy
+ Leptospira canicola
+ Leptospira interrogans serovar Canicola
+
+
+
+
@@ -596597,6 +597187,8 @@ Request that IAO either clarify these or change definitions not to use themPMID:2112744
PMID:25527841
PMID:270744
+ PMID:32628106
+ PMID:36748408
PMID:8123559
PMID:8590690
PMID:9103655
@@ -598129,6 +598721,21 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:1
+ Negative-strand RNA viruses
+ ncbi_taxonomy
+ Negarnaviricota
+
+
+
+
@@ -598726,6 +599333,56 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Avulavirinae
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Orthoparamyxovirinae
+
+
+
+
+
+
+
+
+
+
+ NCBITaxon:11176
+ NDV
+ GC_ID:1
+ Avian Paramyxovirus Serotype I
+ Avian paramyxovirus type 1
+ Avian paramyxovirus type-1
+ Newcastle disease virus
+ Newcastle disease virus NDV
+ avian paramyxovirus 1
+ ncbi_taxonomy
+ Avian avulavirus 1
+ Avian orthoavulavirus 1
+
+
+
+
@@ -600080,7 +600737,6 @@ Request that IAO either clarify these or change definitions not to use them
-
@@ -600349,8 +601005,6 @@ Request that IAO either clarify these or change definitions not to use them
SARS-CoV-2
GC_ID:1
- HCoV-19; COVID-19 virus; SARS-2; Human coronavirus 2019; SARS-CoV2; SARS2; 2019-nCoV
- Wuhan coronavirus
2019-nCoV
COVID-19
COVID-19 virus
@@ -600361,6 +601015,7 @@ Request that IAO either clarify these or change definitions not to use themSARS-CoV-2
SARS-CoV2
SARS2
+ Wuhan coronavirus
ncbi_taxonomy
NCBITaxon:2697049
The list of the marker variants is as follows (as of 3/6/2021):
@@ -601240,6 +601895,34 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Bamfordvirae
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Shotokuvirae
+
+
+
+
@@ -601280,6 +601963,20 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Cossaviricota
+
+
+
+
@@ -601308,6 +602005,22 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ NCBITaxon:10880
+ GC_ID:1
+ ncbi_taxonomy
+ Reoviridae
+ Reovirales
+
+
+
+
@@ -601533,6 +602246,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
GC_ID:1
ncbi_taxonomy
@@ -601647,6 +602361,23 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:4
+ PMID:31385780
+ PMID:31971499
+ PMID:35947640
+ ncbi_taxonomy
+ Mycoplasmoidales
+
+
+
+
@@ -604088,6 +604819,22 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ NCBITaxon:689832
+ GC_ID:1
+ ncbi_taxonomy
+ Sedoreovirinae
+ Sedoreoviridae
+
+
+
+
@@ -604818,6 +605565,41 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ NCBITaxon:11232
+ CDV
+ GC_ID:1
+ Canine distemper virus
+ Canine morbillivirus
+ canine distemper virus CDV
+ ncbi_taxonomy
+ Morbillivirus canis
+
+
+
+
+
+
+
+
+
+
+
+ NCBITaxon:1511906
+ GC_ID:1
+ Carnivore protoparvovirus 1
+ ncbi_taxonomy
+ Protoparvovirus carnivoran1
+
+
+
+
@@ -605191,10 +605973,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
-
- Euarchontoglires
-
GC_ID:1
@@ -605229,8 +606008,8 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
-
+
@@ -605434,13 +606213,8 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
-
- Tetrapoda
- tetrapods
-
-
GC_ID:1
tetrapods
@@ -605455,10 +606229,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
- Amniota
- amniotes
-
GC_ID:1
@@ -605486,8 +606257,10 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
GC_ID:1
diapsids
@@ -605515,9 +606288,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
- Opisthokonta
-
GC_ID:1
@@ -605551,9 +606322,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
- Bilateria
-
GC_ID:1
@@ -605991,8 +606760,10 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
GC_ID:1
ncbi_taxonomy
@@ -606140,6 +606911,21 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:1
+ Avian reovirus
+ ncbi_taxonomy
+ Avian orthoreovirus
+
+
+
+
@@ -607412,6 +608198,20 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Parvovirinae
+
+
+
+
@@ -607428,10 +608228,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
- Mammalia
- mammals
-
GC_ID:1
@@ -609176,6 +609973,45 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:11
+ PMID:10555323
+ PMID:10555334
+ PMID:16166704
+ PMID:27620848
+ ncbi_taxonomy
+ Enterobacteraceae
+ enterobacteria
+ gamma-3 proteobacteria
+ Enterobacteriaceae
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:11
+ Tenericutes
+ ncbi_taxonomy
+ "Mollicutaeota" Oren et al. 2015
+ "Tenericutes" Murray 1984
+ Mollicutota
+ Mycoplasmatota
+
+
+
+
@@ -609280,6 +610116,32 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ NCBITaxon:1637691
+ NCBITaxon:1806490
+ NCBITaxon:469598
+ NCBITaxon:662101
+ NCBITaxon:662104
+ GC_ID:11
+ PMID:10319482
+ E. coli
+ Escherichia/Shigella coli
+ ncbi_taxonomy
+ Bacillus coli
+ Bacterium coli
+ Bacterium coli commune
+ Enterococcus coli
+ Escherichia coli
+
+
+
+
@@ -609448,6 +610310,28 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:11
+ PMID:10319519
+ PMID:10939679
+ PMID:12072558
+ PMID:15653929
+ PMID:15653930
+ PMID:3231714
+ PMID:37486130
+ PMID:9731304
+ ncbi_taxonomy
+ Salmonella
+
+
+
+
@@ -609496,6 +610380,30 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ NCBITaxon:149049
+ GC_ID:11
+ PMID:15653929
+ PMID:15653930
+ PMID:7149525
+ ncbi_taxonomy
+ Salmonella cholerae-suis subsp. cholerae-suis
+ Salmonella choleraesuis subsp. choleraesuis
+ Salmonella enterica I
+ Salmonella enterica subsp. I
+ Salmonella enterica subsp. Subsp. I
+ Salmonella enterica subsp. Subsp. Ixxx
+ Salmonella enterica subsp. enterica
+
+
+
+
@@ -609954,6 +610862,43 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ NCBITaxon:1618316
+ GC_ID:11
+ PMID:10515907
+ PMID:10758897
+ PMID:16585709
+ PMID:24744012
+ PMID:27930271
+ PMID:28141502
+ PMID:30154058
+ PMID:30586413
+ PMID:31454394
+ PMID:31722850
+ PMID:31836459
+ PMID:32320380
+ PMID:35816828
+ PMID:36748499
+ PMID:7981102
+ PMID:8573491
+ PMID:8934900
+ PMID:8995795
+ PMID:9336916
+ Lyme Disease Borrelia
+ ncbi_taxonomy
+ Borrelia burgdorferi group
+ Borrelia burgdorferi sensu lato
+ Borreliella
+
+
+
+
@@ -611117,6 +612062,26 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:11
+ PMID:10843050
+ PMID:15280320
+ PMID:15388716
+ PMID:17220461
+ PMID:2223605
+ PMID:29923825
+ ncbi_taxonomy
+ Pasteurellaceae
+
+
+
+
@@ -611597,6 +612562,25 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:11
+ PMID:15184562
+ ncbi_taxonomy
+ Bacterium multocidum
+ Micrococcus gallicidus
+ Pasteurella cholerae-gallinarum
+ Pasteurella gallicida
+ Pasteurella multocida
+
+
+
+
@@ -612154,11 +613138,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
- Vertebrata <vertebrates>
- Vertebrata
- vertebrates
-
GC_ID:1
@@ -612186,6 +613166,19 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+ GC_ID:11
+ ncbi_taxonomy
+ Clostridium perfringens C
+
+
+
+
@@ -612855,6 +613848,37 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:1
+ birds
+ ncbi_taxonomy
+ avian
+ birds
+ Aves
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Neognathae
+
+
+
+
@@ -612904,6 +613928,55 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ NCBITaxon:9099
+ GC_ID:1
+ turkeys
+ ncbi_taxonomy
+ Phasianidae
+
+
+
+
+
+
+
+
+
+
+ GC_ID:11
+ ncbi_taxonomy
+ Leptospira interrogans serovar Icterohaemorrhagiae
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ Gallus domesticus
+ bantam
+ chicken
+ chickens
+ ncbi_taxonomy
+ Gallus gallus domesticus
+ Phasianus gallus
+ Gallus gallus
+
+
+
+
@@ -613862,11 +614935,31 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:11
+ PMID:27620848
+ ncbi_taxonomy
+ Enterobacteriaceae and related endosymbionts
+ Enterobacteriaceae group
+ Enterobacteriales
+ gamma-3 proteobacteria
+ Enterobacterales
+
+
+
+
+
GC_ID:1
whales, hippos, ruminants, pigs, camels etc.
@@ -614654,6 +615747,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
GC_ID:1
primate
@@ -614861,7 +615955,9 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
grivet
savanah monkey
ncbi_taxonomy
+ Cercopithecus aethiops
Ceropithecus aethiops
+ Simia aethiops
Chlorocebus aethiops
@@ -615123,12 +616219,12 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
- Homo sapiens
Homo sapiens
- person
+ Homo sapiens
human
human being
man
+ person
https://pubmed.ncbi.nlm.nih.gov/15347429/
https://pubmed.ncbi.nlm.nih.gov/26695637/
https://pubmed.ncbi.nlm.nih.gov/29551135/
@@ -615146,8 +616242,8 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
man
ncbi_taxonomy
humans
- Homo sapiens
Homo sapiens
+ Homo sapiens
@@ -615544,8 +616640,10 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
GC_ID:1
ncbi_taxonomy
@@ -615573,6 +616671,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
https://pubmed.ncbi.nlm.nih.gov/15921605/
https://pubmed.ncbi.nlm.nih.gov/32402157/
+
NCBITaxon:36475
GC_ID:1
@@ -615800,8 +616899,10 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
GC_ID:1
pig
@@ -616190,6 +617291,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
GC_ID:1
ncbi_taxonomy
@@ -616215,6 +617317,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
@@ -616224,6 +617327,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
https://pubmed.ncbi.nlm.nih.gov/32629960
+
NCBITaxon:272461
GC_ID:1
@@ -618306,8 +619410,8 @@ https://www.nlm.nih.gov/medlineplus/ency/article/003088.htm
- planned process
planned process
+ planned process
Injecting mice with a vaccine in order to test its efficacy
A process that realizes a plan which is the concretization of a plan specification.
@@ -618317,8 +619421,8 @@ https://www.nlm.nih.gov/medlineplus/ency/article/003088.htm
objectives is a planned process.
Bjoern Peters
branch derived
- This class merges the previously separated objective driven process and planned process, as they the separation proved hard to maintain. (1/22/09, branch call)
6/11/9: Edited at workshop. Used to include: is initiated by an agent
+ This class merges the previously separated objective driven process and planned process, as they the separation proved hard to maintain. (1/22/09, branch call)
@@ -618481,8 +619585,9 @@ objectives is a planned process.
assay
Assay the wavelength of light emitted by excited Neon atoms. Count of geese flying over a house.
- A planned process with the objective to produce information about the material entity that is the evaluant, by physically examining it or its proxies.
- 12/3/12: BP: the reference to the 'physical examination' is included to point out that a prediction is not an assay, as that does not require physical examiniation.
+ A planned process that has the objective to produce information about a material entity (the evaluant) by examining it.
+ 12/3/12: BP: the reference to the 'physical examination' is included to point out that a prediction is not an assay, as that does not require physical examiniation.
+ Discussion on OBI call 2023-05-01 resulted in an agreement to revise the textual definition of 'assay'. https://github.com/obi-ontology/obi/issues/1683.
PlanAndPlannedProcess Branch
measuring
scientific observation
@@ -618516,7 +619621,7 @@ Modification made by JZ.
-
+
reagent role
Buffer, dye, a catalyst, a solvating agent.
@@ -618526,8 +619631,7 @@ Modification made by JZ.
PERSON:Matthew Brush
Feb 10, 2009. changes after discussion at OBI Consortium Workshop Feb 2-6, 2009. accepted as core term.
-May 28 2013. Updated definition taken from ReO based on discussions initiated in Philly 2011 workshop. Former defnition described a narrower view of reagents in chemistry that restricts bearers of the role to be chemical entities ("a role played by a molecular entity used to produce a chemical reaction to detect, measure, or produce other substances"). Updated definition allows for broader view of reagents in the domain of biomedical research to include larger materials that have parts that participate chemically in a molecular reaction or interaction.
-
+May 28 2013. Updated definition taken from ReO based on discussions initiated in Philly 2011 workshop. Former defnition described a narrower view of reagents in chemistry that restricts bearers of the role to be chemical entities ("a role played by a molecular entity used to produce a chemical reaction to detect, measure, or produce other substances"). Updated definition allows for broader view of reagents in the domain of biomedical research to include larger materials that have parts that participate chemically in a molecular reaction or interaction.
(copied from ReO)
Reagents are distinguished from instruments or devices that also participate in scientific techniques by the fact that reagents are chemical or biological in nature and necessarily participate in or have parts that participate in some chemical interaction or reaction during their intended participation in some technique. By contrast, instruments do not participate in a chemical reaction/interaction during the technique.
@@ -618604,16 +619708,17 @@ In regard to the statement that reagents are 'distinct' from the speci
liver section; a portion of a culture of cells; a nemotode or other animal once no longer a subject (generally killed); portion of blood from a patient.
a role borne by a material entity that is gained during a specimen collection process and that can be realized by use of the specimen in an investigation
+ 22Jun09. The definition includes whole organisms, and can include a human. The link between specimen role and study subject role has been removed. A specimen taken as part of a case study is not considered to be a population representative, while a specimen taken as representing a population, e.g. person taken from a cohort, blood specimen taken from an animal) would be considered a population representative and would also bear material sample role.
+ Note: definition is in specimen creation objective which is defined as an objective to obtain and store a material entity for potential use as an input during an investigation.
blood taken from animal: animal continues in study, whereas blood has role specimen.
something taken from study subject, leaves the study and becomes the specimen.
parasite example
- when parasite in people we study people, people are subjects and parasites are specimen
- when parasite extracted, they become subject in the following study
specimen can later be subject.
- 22Jun09. The definition includes whole organisms, and can include a human. The link between specimen role and study subject role has been removed. A specimen taken as part of a case study is not considered to be a population representative, while a specimen taken as representing a population, e.g. person taken from a cohort, blood specimen taken from an animal) would be considered a population representative and would also bear material sample role.
- Note: definition is in specimen creation objective which is defined as an objective to obtain and store a material entity for potential use as an input during an investigation.
GROUP: Role Branch
OBI
+
specimen role
@@ -618653,8 +619758,7 @@ specimen can later be subject.
antigen role
- Antigen is a role played by material which when introduced into an immune-competent organism causes an immune response
- a role that inheres in a vaccine component and plays an antigen role, i.e., it is introducd into an immune-competent organism to cause an immune response
+ A role of a material entity that is being recognized in whole or in part by receptors of the immune system such as antibodies or T cell receptors.
An antigen is a substance that prompts the generation of antibodies and can cause an immune response. Wikipedia http://en.wikipedia.org/wiki/Antigen. In the strict sense, immunogens are those substances that elicit a response from the immune system, whereas antigens are defined as substances that bind to specific antibodies. Not all antigens produce an immunogenic response, but all immunogens are antigens
Role Branch
OBI
@@ -618720,7 +619824,7 @@ for now.
-
+
DNA extraction
@@ -618807,7 +619911,7 @@ for now.
material to be added role
drug added to a buffer contained in a tube; substance injected into an animal;
- material to be added role is a protocol participant role realized by a material which is added into a material bearing the target of material addition role in a material addition process
+ A role of a material entity that is realized in an "adding a material entity into a target" process where the bearer of the role is added into another material entity (the target).
Role Branch
OBI
9 March 09 from discussion with PA branch
@@ -619227,7 +620331,7 @@ that has_part some material entity is a material entity. If we add as equivalent
target of material addition role
peritoneum of an animal receiving an interperitoneal injection; solution in a tube receiving additional material; location of absorbed material following a dermal application.
- target of material addition role is a role realized by an entity into which a material is added in a material addition process
+ A role of a material entity that is realized in an "adding a material entity into a target" process where the bearer of the role (the target) receives the addition of another material entity.
From Branch discussion with BP, AR, MC -- there is a need for the recipient to interact with the administered material. for example, a tooth receiving a filling was not considered to be a target role.
GROUP: Role Branch
OBI
@@ -619426,7 +620530,7 @@ Eur J Cancer. 2009 Jan;45(1):74-81. PMID: 19008094
urine specimen
a portion of urine collected from an organism
- 4/10/2011BP: It seems to me that the editor notes refer to a previous version, and are no longer relevant.
+ 4/10/2011BP: It seems to me that the editor notes refer to a previous version, and are no longer relevant.
This could be instead a kind of collection of secreted stuff. Among secreted stuff there is passive, and active. urine is secreted, passiv. lavage is secreted, active
are we happy calling collection of urine a material separation?
@@ -619536,11 +620640,11 @@ Eur J Cancer. 2009 Jan;45(1):74-81. PMID: 19008094
drawing blood from a patient for analysis, collecting a piece of a plant for depositing in a herbarium, buying meat from a butcher in order to measure its protein content in an investigation
A planned process with the objective of collecting a specimen.
+ Note: definition is in specimen creation objective which is defined as an objective to obtain and store a material entity for potential use as an input during an investigation.
Philly2013: A specimen collection can have as part a material entity acquisition, such as ordering from a bank. The distinction is that specimen collection necessarily involves the creation of a specimen role. However ordering cell lines cells from ATCC for use in an investigation is NOT a specimen collection, because the cell lines already have a specimen role.
Philly2013: The specimen_role for the specimen is created during the specimen collection process.
label changed to 'specimen collection process' on 10/27/2014, details see tracker:
http://sourceforge.net/p/obi/obi-terms/716/
- Note: definition is in specimen creation objective which is defined as an objective to obtain and store a material entity for potential use as an input during an investigation.
Bjoern Peters
specimen collection
5/31/2012: This process is not necessarily an acquisition, as specimens may be collected from materials already in posession
@@ -619686,6 +620790,36 @@ http://sourceforge.net/p/obi/obi-terms/716/
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ pathogen role
+ Pathogen: An agent of disease. A disease producer. The term pathogen most commonly is used to refer to infectious organisms. These include bacteria (such as staph), viruses (such as HIV), and fungi (such as yeast). Less commonly, pathogen refers to a noninfectious agent of disease such as a chemical. http://www.medterms.com/script/main/art.asp?articlekey=6383
+
+ pathogen role is a role which inheres in an organism and realized in the process of disease course in the organism bearing host role caused by the organism bearing pathogen role
+ GROUP: Role Branch
+ OBI
+ 6 April 2009: from the Vaccine Community
+
+
+ pathogen role
+
+
+
+
@@ -619706,7 +620840,6 @@ http://sourceforge.net/p/obi/obi-terms/716/
OBI
http://en.wikipedia.org/wiki/Host_(biology)
-
host role
@@ -619721,6 +620854,7 @@ http://sourceforge.net/p/obi/obi-terms/716/
A material sample role is a specimen role borne by a material entity that is the output of a material sampling process.
7/13/09: Note that this is a relational role: between the sample taken and the 'sampled' material of which the sample is thought to be representative off.
+
material sample role
@@ -619748,6 +620882,7 @@ http://sourceforge.net/p/obi/obi-terms/716/
A material entity that has the material sample role
OBI: workshop
sample population
+
sample
material sample
@@ -619853,7 +620988,7 @@ http://sourceforge.net/p/obi/obi-terms/716/
material maintenance
- a process with that achieves the objective to maintain some or all of the characteristics of an input material over time
+ A planned process with the objective to maintain some or all of the characteristics of an input material over time.
material maintenance
@@ -620701,6 +621836,17 @@ A blood specimen that has been centrifuged to obtain the white blood cells.
+ 2012-12-17 JAO: In common lab usage, there is a distinction made between devices and reagents that is difficult to model. Therefore we have chosen to specifically exclude reagents from the definition of "device", and are enumerating the types of roles that a reagent can perform.
+
+2013-6-5 MHB: The following clarifications are outcomes of the May 2013 Philly Workshop. Reagents are distinguished from devices that also participate in scientific techniques by the fact that reagents are chemical or biological in nature and necessarily participate in some chemical interaction or reaction during the realization of their experimental role. By contrast, devices do not participate in such chemical reactions/interactions. Note that there are cases where devices use reagent components during their operation, where the reagent-device distinction is less clear. For example:
+
+(1) An HPLC machine is considered a device, but has a column that holds a stationary phase resin as an operational component. This resin qualifies as a device if it participates purely in size exclusion, but bears a reagent role that is realized in the running of a column if it interacts electrostatically or chemically with the evaluant. The container the resin is in (“the column”) considered alone is a device. So the entire column as well as the entire HPLC machine are devices that have a reagent as an operating part.
+
+(2) A pH meter is a device, but its electrode component bears a reagent role in virtue of its interacting directly with the evaluant in execution of an assay.
+
+(3) A gel running box is a device that has a metallic lead as a component that participates in a chemical reaction with the running buffer when a charge is passed through it. This metallic lead is considered to have a reagent role as a component of this device realized in the running of a gel.
+
In the examples above, a reagent is an operational component of a device, but the device itself does not realize a reagent role (as bearing a reagent role is not transitive across the part_of relation). In this way, the asserted disjointness between a reagent and device holds, as both roles are never realized in the same bearer during execution of an assay.
PERSON: Helen Parkinson
instrument
@@ -620747,8 +621893,7 @@ In the examples above, a reagent is an operational component of a device, but th
sequence data
example of usage: the representation of a nucleotide sequence in FASTA format used for a sequence similarity search.
- A measurement datum that representing the primary structure of a macromolecule(it's sequence) sometimes associated with an indicator of confidence of that measurement.
-
+ A measurement datum that representing the primary structure of a macromolecule(it's sequence) sometimes associated with an indicator of confidence of that measurement.
Person:Chris Stoeckert
GROUP: OBI
@@ -621202,7 +622347,7 @@ In regard to the statement that reagents are 'distinct' from the speci
cell freezing medium
- A processed material that serves as a liquid vehicle for freezing cells for long term quiescent stroage, which contains chemicls needed to sustain cell viability across freeze-thaw cycles.
+ A processed material that serves as a liquid vehicle for freezing cells for long term quiescent stroage, which contains chemicls needed to sustain cell viability across freeze-thaw cycles.
PERSON: Matthew Brush
cell freezing medium
@@ -621389,7 +622534,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621397,6 +622542,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621423,7 +622577,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621431,6 +622585,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621457,7 +622620,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621465,6 +622628,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621491,7 +622663,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621499,6 +622671,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621526,7 +622707,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621534,6 +622715,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621561,7 +622751,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621569,6 +622759,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621595,7 +622794,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621603,6 +622802,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621629,7 +622837,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621637,6 +622845,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621663,7 +622880,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621671,6 +622888,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621697,7 +622923,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621705,6 +622931,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621731,7 +622966,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621739,6 +622974,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621765,11 +623009,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -621800,7 +623063,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621808,6 +623071,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621834,11 +623106,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -621868,7 +623159,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621876,6 +623167,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621902,7 +623202,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621910,6 +623210,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621936,11 +623245,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -621952,7 +623280,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from brain.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
brain specimen
@@ -621970,7 +623298,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621978,6 +623306,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621986,7 +623323,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from hair.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
hair specimen
@@ -622004,11 +623341,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622020,7 +623376,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from prostate gland.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
prostate gland specimen
@@ -622038,7 +623394,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -622046,6 +623402,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -622054,7 +623419,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from skeletal muscle.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
skeletal muscle tissue specimen
@@ -622072,11 +623437,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622088,7 +623472,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from heart.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
heart specimen
@@ -622106,11 +623490,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622123,7 +623526,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from renal medulla.
Chris Stoeckert
kidney medulla specimen
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
renal medulla specimen
@@ -622141,11 +623544,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622157,7 +623579,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from adrenal gland.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
adrenal gland specimen
@@ -622175,11 +623597,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622189,10 +623630,10 @@ In regard to the statement that reagents are 'distinct' from the speci
breast specimen
- A specimen that is derived from breast.
+ A specimen that is derived from breast.
Chris Stoeckert
mammary tissue specimen
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
breast specimen
@@ -622210,11 +623651,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622226,7 +623686,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from urinary bladder.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
urinary bladder specimen
@@ -622244,11 +623704,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622260,7 +623739,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from tibial artery.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
tibial artery specimen
@@ -622278,11 +623757,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622295,7 +623793,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from skin.
Chris Stoeckert
skin specimen
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
skin of body specimen
@@ -622313,11 +623811,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622329,7 +623846,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from pancreas.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
pancreas specimen
@@ -622347,11 +623864,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622363,7 +623899,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from stomach.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
stomach specimen
@@ -622381,11 +623917,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622397,7 +623952,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from pituitary gland.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
pituitary gland specimen
@@ -622415,7 +623970,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -622423,6 +623978,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -622431,7 +623995,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from adipose tissue.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
adipose tissue specimen
@@ -622449,11 +624013,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622466,7 +624049,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from cortex of kidney.
Chris Stoeckert
kidney cortex specimen
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
cortex of kidney specimen
@@ -622484,11 +624067,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622500,7 +624102,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from esophagus mucosa.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
esophagus mucosa specimen
@@ -622518,11 +624120,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622534,7 +624155,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from colon.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
colon specimen
@@ -622552,11 +624173,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622568,7 +624208,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from lung.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
lung specimen
@@ -622586,11 +624226,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622603,7 +624262,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from esophagus muscularis mucosa.
Chris Stoeckert
esophagus muscularis specimen
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
esophagus muscularis mucosa specimen
@@ -622621,11 +624280,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622638,7 +624316,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from cerebral cortex.
Chris Stoeckert
brain cortex specimen
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
cerebral cortex specimen
@@ -622656,11 +624334,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622672,7 +624369,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from thyroid gland.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
thyroid gland specimen
@@ -622690,11 +624387,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622707,7 +624423,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from cerebellum.
Chris Stoeckert
brain cerebellum specimen
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
cerebellum specimen
@@ -622725,11 +624441,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622741,7 +624476,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from tibial nerve.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
tibial nerve specimen
@@ -622759,11 +624494,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622775,7 +624529,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from coronary artery.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
coronary artery specimen
@@ -622793,11 +624547,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622809,7 +624582,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from spleen.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
spleen specimen
@@ -622827,11 +624600,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622843,7 +624635,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from aorta.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
aorta specimen
@@ -622861,11 +624653,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622877,7 +624688,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from the atrium auricular region.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
atrial appendage specimen
@@ -622895,11 +624706,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622911,7 +624741,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from the esophagogastric junction.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
esophagogastric junction specimen
@@ -622929,11 +624759,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622945,7 +624794,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from ileum.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
ileum specimen
@@ -622963,11 +624812,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622979,7 +624847,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from liver.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
liver specimen
@@ -622997,11 +624865,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -623013,7 +624900,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from minor salivary gland.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
minor salivary gland specimen
@@ -623031,11 +624918,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -623047,7 +624953,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from omentum.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
omentum specimen
@@ -623065,11 +624971,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -623081,7 +625006,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from female gonad.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
ovary specimen
@@ -623099,11 +625024,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -623115,7 +625059,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from sigmoid colon.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
sigmoid colon specimen
@@ -623133,11 +625077,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -623149,7 +625112,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from suprapubic skin.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
suprapubic skin specimen
@@ -623167,11 +625130,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -623183,7 +625165,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from testis.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
testis specimen
@@ -623201,11 +625183,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -623217,7 +625218,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from uterus.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
uterus specimen
@@ -623235,11 +625236,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -623251,7 +625271,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from vagina.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
vagina specimen
@@ -623344,6 +625364,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623352,7 +625381,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623371,7 +625400,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the surface of an areola of a breast.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
areolar swab specimen
@@ -623384,6 +625413,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623392,7 +625430,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623411,7 +625449,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the surface of a breast.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
breast swab specimen
@@ -623424,6 +625462,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623432,7 +625479,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623451,7 +625498,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the cheek portion of the inside surface of a mouth.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
cheek swab specimen
@@ -623464,6 +625511,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623472,7 +625528,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623491,7 +625547,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the surface of a nasopharynx.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
nasopharyngeal swab specimen
@@ -623504,6 +625560,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623512,7 +625577,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623531,7 +625596,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the inside surface of a mouth.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
oral swab specimen
@@ -623544,6 +625609,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623552,7 +625626,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623571,7 +625645,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the surface of a oropharynx.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
oropharyngeal swab specimen
@@ -623584,6 +625658,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623592,7 +625675,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623611,7 +625694,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the surface of a rectum.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
rectal swab specimen
@@ -623624,6 +625707,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623632,7 +625724,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623651,7 +625743,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the surface of a tongue.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
tongue swab specimen
@@ -623664,6 +625756,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623672,7 +625773,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623691,7 +625792,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the surface of a vagina.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
vagina swab specimen
@@ -623704,6 +625805,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623712,7 +625822,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623732,7 +625842,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the surface of a feces.
Chris Stoeckert
stool swab specimen
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
fecal swab specimen
@@ -623745,6 +625855,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623753,7 +625872,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623772,7 +625891,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the surface of an environmenal material.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
environmental swab specimen
@@ -623818,6 +625937,63 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ biopsy
+ Biopsy of a potentially cancerous mole.
+
+ A specimen collection that obtains a sample of tissue or cell from a living multicellular organism body for diagnostic purposes by means intended to be minimally invasive.
+ Damion Dooley
+ Nicole Vasilevsky
+ https://en.wikipedia.org/wiki/Biopsy
+
+ biopsy
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ bone marrow biopsy
+ A bone marrow biopsy removes bone with the marrow inside to look at under a microscope
+
+ A biopsy where a small amount of bone and a small amount of fluid and bone marrow are collected.
+ Nicole Vasilevsky
+ http://www.webmd.com/cancer/bone-marrow-aspiration-and-biopsy
+
+ bone marrow biopsy
+
+
+
+
@@ -623898,7 +626074,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
@@ -623907,6 +626083,17 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
+
+
induced sputum specimen
A sputum specimen that is collected from an organism following its inhalation of a nebulized salt solution.
@@ -623935,7 +626122,18 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
+
+
+
+
+
+
+
+
+
+
+
@@ -623945,7 +626143,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
@@ -623960,7 +626158,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
tracheal aspirate specimen
A specimen that is collected with a suctioning tube from the trachea.
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
tracheal wash specimen
PMID:25338241
@@ -623975,6 +626173,15 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
@@ -623983,7 +626190,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
@@ -624001,7 +626208,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
mid-turbinate nasal swab specimen
A specimen that is collected with a mid-turbinate nasal swab from the turbinate area of the nasal cavity.
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
https://seattlechildrenslab.testcatalog.org/catalogs/185/files/11633
mid-turbinate nasal swab specimen
@@ -624015,6 +626222,15 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
@@ -624023,7 +626239,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
@@ -624037,13 +626253,13 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
nasal aspirate specimen
A specimen that is collected with a suctioning tube from the nasal cavity.
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
nasal wash specimen|nasopharyngeal aspirate
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
nasal aspirate specimen
@@ -624056,6 +626272,15 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
@@ -624064,7 +626289,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
@@ -624078,13 +626303,13 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
lower respiratory tract aspirate specimen
A specimen that is collected with a suctioning tube from the lower respiratory tract.
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
lower respiratory tract wash specimen
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
lower respiratory tract aspirate specimen
@@ -624097,6 +626322,15 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
@@ -624105,7 +626339,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
@@ -624123,8 +626357,8 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
upper respiratory specimen
A specimen that is derived from the upper respiratory tract
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
upper respiratory specimen
@@ -624137,34 +626371,30 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
-
+
lower respiratory tract specimen
A specimen that is derived from the lower respiratory tract.
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
lower respiratory tract specimen
@@ -624177,6 +626407,15 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
@@ -624185,7 +626424,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
@@ -624203,14 +626442,30 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
anterior nasal swab specimen
A specimen that is derived from the anterior nasal wall
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
anterior nasal swab specimen
+
+
+
+
+ aspiration specimen collection
+
+ Procedure using suction, usually with a thin needle and syringe, to remove bodily fluid or tissue.
+ Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ aspiration procedure
+ https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI_Thesaurus&ns=ncit&code=C15631
+
+ aspiration specimen collection
+
+
+
+
@@ -624221,7 +626476,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
@@ -624230,10 +626485,21 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
+
+
endotracheal tube specimen
A specimen that derives from a biofilm that forms on the inner surface of an endotracheal tube while the tube is in the trachea. The specimen is collected upon removal of the tube from the trachea.
- John Judkins|ORCID:0000-0001-6595-0902
+ John Judkins ORCID:0000-0001-6595-0902
https://bmcpulmmed.biomedcentral.com/articles/10.1186/s12890-019-0926-3
endotracheal tube specimen
@@ -624251,7 +626517,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
@@ -624260,10 +626526,21 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
+
+
endotracheal aspirate specimen
A specimen that derives from a biofilm that forms on the inner surface of an endotracheal tube while the tube is in the trachea. The specimen is collected by suction without removing the tube.
- John Judkins|ORCID:0000-0001-6595-0902
+ John Judkins ORCID:0000-0001-6595-0902
https://bmcpulmmed.biomedcentral.com/articles/10.1186/s12890-019-0926-3
endotracheal aspirate specimen
@@ -624271,6 +626548,340 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ blood specimen in vacutainer
+
+ A blood specimen that is located in a vacutainer.
+ John Judkins
+ Vacutainer sample
+ VEuPathDB
+
+ blood specimen in vacutainer
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ blood specimen on filter paper
+
+ A blood specimen that is located on a filter paper.
+ Chris Stoeckert
+ Jie Zheng
+ Filter paper sample
+ Penn Group
+
+ blood specimen on filter paper
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ placental blood specimen
+
+ A specimen that is derived from placental blood.
+ John Judkins
+ VEuPathDB
+
+ placental blood specimen
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ peripheral blood mononuclear cell specimen
+
+ A processed specimen that is extracted from whole blood using gradient centrifugation that separates the blood into a layer of peripheral blood mononuclear cells under the top layer of plasma. It contains lymphocytes, monocytes or macrophages that are critical components in the immune system.
+ Chris Stoeckert
+ Jie Zheng
+ PBMC specimen
+ http://en.wikipedia.org/wiki/Peripheral_blood_mononuclear_cell
+
+ peripheral blood mononuclear cell specimen
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ lymph specimen
+
+ A specimen that is derived from a portion of lymph collected from an organism.
+ John Judkins ORCID:0000-0001-6595-0902
+ VEuPathDB
+
+ lymph specimen
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ digestive tract specimen
+
+ A specimen that is derived from part of a digestive tract.
+ John Judkins ORCID:0000-0001-6595-0902
+ VEuPathDB
+
+ digestive tract specimen
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ nasal lavage fluid
+
+ A specimen collected through nasal cavity lavage that contains the reagents used to for the lavage process, organisms, cells, cellular secretions, and other biomaterials present in the nasal cavity space.
+ Randi Vita
+ Sebastian Duesing
+
+ nasal lavage fluid
+
+
+
+
+
+
+
+
+ reactant role
+
+ A role borne by a biological or chemical entity that participates or has molecular components that participate in a chemical reaction.
+ Sebastian Duesing
+
+ reactant role
+
+
+
+
@@ -624367,6 +626978,16 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
+
organism
animal
@@ -624415,6 +627036,7 @@ This issue is outside the scope of OBI.
PERSON: James Malone
PERSON: Philippe Rocca-Serra
GROUP: OBI Biomaterial Branch
+
@@ -624592,10 +627214,10 @@ Thyroidectomy during laryngectomy for advanced laryngeal carcinoma--whole organ
Helen Parkinson
James Malone
Melanie Courtot
+ Philippe Rocca-Serra
Richard Scheuermann
Ryan Brinkman
Tina Hernandez-Boussard
- Philippe Rocca-Serra
data analysis
data operation
data processing
@@ -624802,7 +627424,7 @@ Thyroidectomy during laryngectomy for advanced laryngeal carcinoma--whole organ
storage
PMID: 18550121.Total Prostate Specific Antigen Stability Confirmed After Long-Term Storage of Serum at -80C. J Urol. 2008 Jun 10.
- A maintenance process by which material entities that are not actively metabolizing are placed in well identified location and possibly under controlled environment in ad-hoc devices/structures in order to preserve and protect them from decay/alteration and maintain availability
+ A planned process with the objective to preserve and protect material entities by placing them in an identified location which may have a controlled environment.
Philippe Rocca-Serra
OBI-Branch
@@ -624927,48 +627549,17 @@ Thyroidectomy during laryngectomy for advanced laryngeal carcinoma--whole organ
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
administering substance in vivo
- injecting mice with 10 ug morphine intranasally, a patient taking two pills of 1 mg aspirin orally
Balb/c mice received an intracameral or subconjunctival injection of trinitrophenylated spleen cells
+ injecting mice with 10 ug morphine intranasally, a patient taking two pills of 1 mg aspirin orally
A process by which a substance is intentionally given to an organism resulting in exposure of the organism to that substance.
+ 2009-11-10. Tracker: https://sourceforge.net/tracker/?func=detail&aid=2893050&group_id=177891&atid=886178
Different routes and means of administration should go as children underneath this
Update the definition based on the discussion. Details see the tracker:
https://sourceforge.net/p/obi/obi-terms/738/
needs roles such as perturber and perturbee (children of input role). Perturb is too strong. Host might be the name for one role. Others considered: Doner, Donated, Acceptor.
- 2009-11-10. Tracker: https://sourceforge.net/tracker/?func=detail&aid=2893050&group_id=177891&atid=886178
Bjoern Peters
Person:Bjoern Peters
IEDB
@@ -625051,7 +627642,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
maintaining cell culture
When harvesting blood from a human, isolating T cells, and then limited dilution cloning of the cells, the maintaining_cell_culture step comprises all steps after the initial dilution and plating of the cells into culture, e.g. placing the culture into an incubator, changing or adding media, and splitting a cell culture
- a protocol application in which cells are kept alive in a defined environment outside of an organism. part of cell_culturing
+ A planned process with the objective to keep cells alive in a defined environment outside of an organism.
PlanAndPlannedProcess Branch
OBI branch derived
@@ -625092,8 +627683,8 @@ https://sourceforge.net/p/obi/obi-terms/738/
The use of M-MLV reverse transcriptase from the Moloney murine leukemia virus to transcribe an RNA sample into cDNA
a protocol with the objective to transcribe single-stranded RNA into complementary DNA (cDNA)
- We need to indicate the relationship between the cDNA generated and the RNA that was used as a template. This may be outside of the OBI scope
It could also be added that the reverse transcriptase is bearer of a GO:0003964 RNA-directed DNA polymerase activity, which is realized in this process.
+ We need to indicate the relationship between the cDNA generated and the RNA that was used as a template. This may be outside of the OBI scope
PERSON:Kevin Clancy
OBI branch derived
@@ -625290,7 +627881,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
RNA extraction
@@ -625326,7 +627917,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
nucleic acid extraction
@@ -625387,7 +627978,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
epitope
- a material entity bearing the epitope role
+ A material entity with the disposition to be bound by an adaptive immune receptor.
IEDB
IEDB
@@ -625467,16 +628058,17 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
antigen
- is a material entity that has the antigen role
+ A material entity that has the antigen role.
IEDB
IEDB
+
antigen
@@ -625564,7 +628156,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
target of material addition
A cell culture into which a mixture of peptides is being added.
- A material entity into which another is being added in a material combinatino process
+ A material entity that receives the addition of another material entity in an “adding a material entity into a target” process.
10/26/09: This defined class is used as a 'macro' to reduce the size of the IEDB export.
IEDB
@@ -625605,27 +628197,6 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
-
-
-
-
-
-
-
-
-
- assay antigen role
-
- Any molecule recognized by the adaptive immune receptors? Recognized means bound with a certain affinity? From GO ag binding:Interacting selectively with an antigen, any substance which is capable of inducing a specific immune response and of reacting with the products of that response, the specific antibody or specifically sensitized T-lymphocytes, or both. Binding may counteract the biological activity of the antigen. see OBI_1110120 below
- IEDB
- IEDB
-
- assay antigen role
-
-
-
-
@@ -625657,11 +628228,30 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -625671,9 +628261,11 @@ https://sourceforge.net/p/obi/obi-terms/738/
uterine cervix specimen
- A specimen that is derived from some uterine cervix
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some uterine cervix
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
uterine cervix specimen
@@ -625691,11 +628283,30 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -625705,9 +628316,11 @@ https://sourceforge.net/p/obi/obi-terms/738/
urethra specimen
- A specimen that is derived from some urethra
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some urethra
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
urethra specimen
@@ -625725,7 +628338,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -625733,15 +628346,26 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
cervical mucus specimen
- A specimen that is derived from some cervical mucus
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some cervical mucus
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
cervical mucus specimen
@@ -625759,11 +628383,30 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -625773,9 +628416,11 @@ https://sourceforge.net/p/obi/obi-terms/738/
throat specimen
- A specimen that is derived from some throat
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some throat
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
throat specimen
@@ -625793,11 +628438,30 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -625807,9 +628471,11 @@ https://sourceforge.net/p/obi/obi-terms/738/
eye specimen
- A specimen that is derived from some eye
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some eye
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
eye specimen
@@ -625827,11 +628493,30 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -625841,9 +628526,11 @@ https://sourceforge.net/p/obi/obi-terms/738/
respiratory system specimen
- A specimen that is derived from some respiratory system
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some respiratory system
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
respiratory system specimen
@@ -625861,11 +628548,30 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -625875,9 +628581,11 @@ https://sourceforge.net/p/obi/obi-terms/738/
upper respiratory tract specimen
- A specimen that is derived from some upper respiratory tract
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some upper respiratory tract
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
upper respiratory tract specimen
@@ -625895,11 +628603,30 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -625909,9 +628636,11 @@ https://sourceforge.net/p/obi/obi-terms/738/
nasopharynx specimen
- A specimen that is derived from some nasopharynx
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some nasopharynx
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
nasopharynx specimen
@@ -625929,7 +628658,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -625937,6 +628666,15 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
@@ -625944,8 +628682,10 @@ https://sourceforge.net/p/obi/obi-terms/738/
semen specimen
A specimen that is derived from some semen
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
semen specimen
@@ -625963,7 +628703,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -625971,6 +628711,15 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
@@ -625978,8 +628727,10 @@ https://sourceforge.net/p/obi/obi-terms/738/
bodily fluid specimen
A specimen that is derived from some bodily fluid
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
bodily fluid specimen
@@ -625997,11 +628748,30 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -626011,9 +628781,11 @@ https://sourceforge.net/p/obi/obi-terms/738/
chorionic villus specimen
- A specimen that is derived from some chorionic villus
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some chorionic villus
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
chorionic villus specimen
@@ -626031,7 +628803,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -626039,15 +628811,26 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
meconium specimen
- A specimen that is derived from some meconium
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some meconium
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
meconium specimen
@@ -626065,7 +628848,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -626073,15 +628856,26 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
-
+
umbilical cord blood specimen
A specimen that is derived from some umbilical cord blood
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
umbilical cord blood specimen
@@ -626099,7 +628893,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -626107,6 +628901,15 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
@@ -626114,8 +628917,10 @@ https://sourceforge.net/p/obi/obi-terms/738/
arterial blood specimen
A specimen that is derived from some arterial blood
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
arterial blood specimen
@@ -626133,7 +628938,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -626141,6 +628946,15 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
@@ -626148,8 +628962,10 @@ https://sourceforge.net/p/obi/obi-terms/738/
venous blood specimen
A specimen that is derived from some venous blood
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
venous blood specimen
@@ -626167,7 +628983,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -626175,6 +628991,15 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
@@ -626182,8 +629007,10 @@ https://sourceforge.net/p/obi/obi-terms/738/
capillary blood specimen
A specimen that is derived from some capillary blood
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
capillary blood specimen
@@ -626194,6 +629021,17 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
+
+
@@ -626203,7 +629041,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -626218,8 +629056,10 @@ https://sourceforge.net/p/obi/obi-terms/738/
erythrocyte specimen
A specimen that is derived from some erythrocytes
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
erythrocyte specimen
@@ -626230,6 +629070,17 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
+
+
@@ -626239,7 +629090,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -626253,9 +629104,11 @@ https://sourceforge.net/p/obi/obi-terms/738/
reticulocyte specimen
- A specimen that is derived from some reticulocytes
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some reticulocytes
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
reticulocyte specimen
@@ -626266,6 +629119,17 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
+
+
@@ -626275,7 +629139,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -626290,8 +629154,10 @@ https://sourceforge.net/p/obi/obi-terms/738/
leukocyte specimen
A specimen that is derived from some leukocytes
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
leukocyte specimen
@@ -627315,8 +630181,12 @@ https://sourceforge.net/p/obi/obi-terms/738/
The totality of all processes through which a given disease instance is realized.
+ Albert Goldfain
+ http://ontology.buffalo.edu/medo/Disease_and_Diagnosis.pdf
+ creation date: 2009-06-23T11:55:44Z
+
disease course
@@ -629566,17 +632436,16 @@ Daily dose = Acetaminophen dose/drug duration
-
- viability
viability
- An organismal quality inhering in a bearer or a population by virtue of the bearer's ability or inability to survive and develop normally or the number of surviving individuals in a given population.
An organismal quality inhering in a bearer or a population by virtue of the bearer's disposition to survive and develop normally or the number of surviving individuals in a given population.
-
- viability
+ quality
+ PATO:0000169
+
+
viability
@@ -629629,32 +632498,19 @@ Daily dose = Acetaminophen dose/drug duration
-
-
-
-
- quality of a single physical entity
- A physical object quality which inheres in a single-bearer.
-
-
- quality of a single physical entity
-
-
-
-
- physical object quality
physical object quality
- A quality which inheres in a continuant.
A quality which inheres in a continuant.
-
+ PATO:0001237
+ PATO:0001238
+ snap:Quality
monadic quality of a continuant
multiply inhering quality of a physical entity
quality of a continuant
@@ -629663,7 +632519,9 @@ Daily dose = Acetaminophen dose/drug duration
quality of continuant
monadic quality of an object
monadic quality of continuant
- physical object quality
+ quality
+ PATO:0001241
+ Relational qualities are qualities that hold between multiple entities. Normal (monadic) qualities such as the shape of a eyeball exist purely as a quality of that eyeball. A relational quality such as sensitivity to light is a quality of that eyeball (and connecting nervous system) as it relates to incoming light waves/particles.
physical object quality
@@ -629773,17 +632631,14 @@ Daily dose = Acetaminophen dose/drug duration
-
- organismal quality
organismal quality
- A quality that inheres in an entire organism or part of an organism.
A quality that inheres in an entire organism or part of an organism.
-
- organismal quality
+ quality
+ PATO:0001995
organismal quality
@@ -629793,11 +632648,16 @@ Daily dose = Acetaminophen dose/drug duration
- virulence
- A quality inhering in a bearer by virtue of the bearer's pathogenicity.
+ A quality inhering in a bearer by virtue of the severity of infectious disease caused by the bearer in a target organism.
+
-
- virulence
+
+ 2009-10-30T05:04:06Z
+ quality
+ PATO:0002146
+
+
+ virulence
@@ -629824,7 +632684,6 @@ Daily dose = Acetaminophen dose/drug duration
-
natural protein
native protein
protein
@@ -644389,8 +647248,8 @@ Daily dose = Acetaminophen dose/drug duration
angiotensinogenase
PR:000013883
Category=gene.
- renin
renin
+ renin
@@ -650220,8 +653079,8 @@ Daily dose = Acetaminophen dose/drug duration
protein
PR:000050025
Category=family.
- angiotensinogenase
angiotensinogenase
+ angiotensinogenase
@@ -679671,8 +682530,8 @@ Daily dose = Acetaminophen dose/drug duration
+
-
@@ -679744,7 +682603,6 @@ Daily dose = Acetaminophen dose/drug duration
S
PR:P0DTC2
Category=organism-gene. Note: 1273 aa protein. Undergoes additional processing by proteolytic cleavage.
- S protein of SARS-CoV-2 Wuhan strain
spike glycoprotein (SARS-CoV-2)
@@ -680009,6 +682867,7 @@ Daily dose = Acetaminophen dose/drug duration
+
@@ -680070,12 +682929,17 @@ Daily dose = Acetaminophen dose/drug duration
A protein that is a translation product of the E gene in SARS-CoV-2.
+ Category=organism-gene. Note: 75 aa protein. A protein that is a translation product of the E gene in SARS-CoV-2.
+ E (SARS2)
+ envelope protein (SARS-CoV-2)
+ sM protein (SARS-CoV-2)
Reference: PMID: 24391744
Reference: PMID: 26035625
Reference: PMID: 26815195
Reference: PMID: 29764999
Reference: PMID: 31969702
+
GenPept:YP_009724392
UniProtKB:P0DTC4
E (SARS2)
@@ -800963,14 +803827,12 @@ Daily dose = Acetaminophen dose/drug duration
-
The olfactory organ of vertebrates, consisting of nares, olfactory epithelia and the structures and skeletal framework of the nasal cavity.
-
Organ that is the specialized structure of the face that contains olfactory neurons. The peripheral olfactory organ is paired[ZFA:0000047].
a protuberance in vertebrates that houses the nostrils, or nares, which admit and expel air for respiration in conjunction with the mouth. Behind the nose are the olfactory mucosa and the sinuses. Behind the nasal cavity, air next passes through the pharynx, shared with the digestive system, and then into the rest of the respiratory system. In humans, the nose is located centrally on the face; on most other mammals, it is on the upper tip of the snout[WP]. GO: The nose is the specialized structure of the face that serves as the organ of the sense of smell and as part of the respiratory system. Includes the nasi externus (external nose) and cavitas nasi (nasal cavity)[Wikipedia:Nose].
the organ that is specialized for smell and is part of the respiratory system
@@ -801003,21 +803865,14 @@ Daily dose = Acetaminophen dose/drug duration
uberon
nasus
olfactory apparatus
- proboInOwlInOwlscis
proboInOwlscis
UBERON:0000004
-
-
-
-
-
nose
-
http://upload.wikimedia.org/wikipedia/commons/d/d0/Canine-nose.jpg
@@ -801093,7 +803948,7 @@ Daily dose = Acetaminophen dose/drug duration
urethra
- the fibromuscular tubular canal through which urine is discharged from the bladder to the exterior via the external urinary meatus; in males, the urethra is joined by the ejaculatory ducts and serves as a passageway for semen during ejaculation, as well as a canal for urine during voiding; in females, the urethra is shorter and emerges above the vaginal opening
+ The fibromuscular tubular canal through which urine is discharged from the bladder to the exterior via the external urinary meatus; in males, the urethra is joined by the ejaculatory ducts and serves as a passageway for semen during ejaculation, as well as a canal for urine during voiding; in females, the urethra is shorter and emerges above the vaginal opening.
urethra
@@ -801105,7 +803960,6 @@ Daily dose = Acetaminophen dose/drug duration
-
@@ -801116,7 +803970,6 @@ Daily dose = Acetaminophen dose/drug duration
-
AAO:0010825
@@ -801156,12 +804009,10 @@ Daily dose = Acetaminophen dose/drug duration
Anatomical structure that performs a specific function or group of functions [WP].
-
Organs are commonly observed as visibly distinct structures, but may also exist as loosely associated clusters of cells that work together to perform a specific function or functions.
CARO v1 does not include a generic 'organ' class, only simple and compound organ. CARO v2 may include organ, see https://github.com/obophenotype/caro/issues/4
-
BIRNLEX:4
CARO:0020004
@@ -801180,7 +804031,6 @@ Daily dose = Acetaminophen dose/drug duration
body organ
element
UBERON:0000062
-
organ
@@ -801194,8 +804044,6 @@ Daily dose = Acetaminophen dose/drug duration
A multicellular structure that is a part of an organ.
currently defined in a very broad sense, may be replaced by more specific classes in the future
-
-
AAO:0011124
@@ -801206,9 +804054,6 @@ Daily dose = Acetaminophen dose/drug duration
uberon
regional part of organ
UBERON:0000064
-
-
-
@@ -801314,14 +804159,12 @@ Daily dose = Acetaminophen dose/drug duration
The proximal portion of the digestive tract, containing the oral cavity and bounded by the oral opening. In vertebrates, this extends to the pharynx and includes gums, lips, tongue and parts of the palate. Typically also includes the teeth, except where these occur elsewhere (e.g. pharyngeal jaws) or protrude from the mouth (tusks).
-
Cavity in which food is initially ingested and generally contains teeth, tongue and glands.[AAO]
Molecular and developmental cell lineage data suggest that the acoel mouth opening is homologous to the mouth of protostomes and deuterostomes and that the last common ancestor of the Bilateria (the 'urbilaterian') had only this single digestive opening.[well established][VHOG]
oral
some AOs place this as developing from the stomodeum but we weaken this to developmental contribution, as the mouth includes non-ectodermal derivatives
in FMA, the tongue, palate etc are part of the mouth which is itself a subdivision of the face. ZFA includes a separate class 'oral region' which is part of the mouth, but excludes tongue and lips
-
AAO:0010355
@@ -801367,14 +804210,6 @@ Daily dose = Acetaminophen dose/drug duration
vestibule of mouth
vestibulum oris
UBERON:0000165
-
-
-
-
-
-
-
-
@@ -801382,7 +804217,6 @@ Daily dose = Acetaminophen dose/drug duration
mouth
https://github.com/obophenotype/uberon/issues/661
-
http://upload.wikimedia.org/wikipedia/commons/0/06/Mouth_illustration-Otis_Archives.jpg
@@ -801474,7 +804308,7 @@ Daily dose = Acetaminophen dose/drug duration
renal medulla
- the inner portion of the kidney consisting of the renal pyramids
+ The inner portion of the kidney consisting of the renal pyramids.
renal medulla
@@ -801506,7 +804340,6 @@ Daily dose = Acetaminophen dose/drug duration
-
AAO:0010264
AEO:0000006
BILA:0000006
@@ -801546,7 +804379,7 @@ Daily dose = Acetaminophen dose/drug duration
anatomical cluster
- Anatomical group that has its parts adjacent to one another.
+ Anatomical group whose component anatomical structures lie in close proximity to each other.
anatomical cluster
@@ -801720,7 +804553,7 @@ Daily dose = Acetaminophen dose/drug duration
aorta
- The main trunk of the systemic arterial system that carries blood from the heart to all the organs and other structures of the body, bringing oxygenated blood to all parts of the body in the systemic circulation
+ The main trunk of the systemic arterial system that carries blood from the heart to all the organs and other structures of the body, bringing oxygenated blood to all parts of the body in the systemic circulation.
aorta
@@ -801806,7 +804639,7 @@ Daily dose = Acetaminophen dose/drug duration
-
+
cerebral cortex
The thin layer of gray matter on the surface of the cerebral hemisphere that develops from the telencephalon. It consists of the neocortex (6 layered cortex or isocortex), the hippocampal formation and the olfactory cortex.
@@ -801834,7 +804667,7 @@ Daily dose = Acetaminophen dose/drug duration
ovary
- the gonad of a female organism which contains germ cells
+ The gonad of a female organism which contains germ cells.
ovary
@@ -801847,7 +804680,7 @@ Daily dose = Acetaminophen dose/drug duration
uterus
- the female muscular organ of gestation in which the developing embryo or fetus is nourished until birth
+ The female muscular organ of gestation in which the developing embryo or fetus is nourished until birth.
uterus
@@ -801886,7 +804719,7 @@ Daily dose = Acetaminophen dose/drug duration
adipose tissue
- Portion of connective tissue composed of adipocytes enmeshed in areolar tissue
+ Portion of connective tissue composed of adipocytes enmeshed in areolar tissue.
adipose tissue
@@ -801912,7 +804745,7 @@ Daily dose = Acetaminophen dose/drug duration
rectum
- the terminal portion of the intestinal tube, terminating with the anus
+ The terminal portion of the intestinal tube, terminating with the anus.
rectum
@@ -801930,7 +804763,6 @@ Daily dose = Acetaminophen dose/drug duration
-
@@ -801980,7 +804812,7 @@ Daily dose = Acetaminophen dose/drug duration
urine
- Excretion that is the output of a kidney
+ Excretion that is the output of a kidney.
urine
@@ -802018,40 +804850,11 @@ Daily dose = Acetaminophen dose/drug duration
-
skeletal muscle tissue
Muscle tissue that consists primarily of skeletal muscle fibers.
- TODO - add skeletal muscle organ? See GO:0060538 skeletal muscle organ development. Todo - group FBbt:00005073 - somatic muscle.
-
- Muscle, composed of long cylindrical, multinucleated cells that attaches to the skeleton via tendons.[TAO]
- Tissue which consists of skeletal muscle fibers surrounded by endomysium. Examples: Skeletal muscle tissue of biceps, Skeletal muscle tissue of diaphragm[FMA]
- This result implies the following views in terms of evolutionary differentiation: (1) Arthropod striated muscle and vertebrate skeletal and cardiac muscles share a common ancestor. In other words, they did not evolve independently (...) (5) The divergence of vertebrate skeletal and cardiac muscles/vertebrate smooth muscle and nonmuscle is at least before that of vertebrates/arthropods. In other words, emergence of skeletal and cardiac musle type tissues preceded the vertebrate/arthropod divergence (ca. 700 MYA).[well established][VHOG]
-
-
-
-
- skeletal muscle
-
-
-
- EMAPA:32716
- FMA:14069
- MA:0002439
- NCIT:C13050
- UMLS:C0242692
- uberon
- skeletal muscle system
- somatic muscle
- UBERON:0001134
-
-
-
-
-
skeletal muscle tissue
-
@@ -802061,7 +804864,7 @@ Daily dose = Acetaminophen dose/drug duration
colon
- Last portion of the large intestine before it becomes the rectum.
+ A portion of the large intestine before it becomes the rectum. In mammals, the colon is the most part of the large intestine, excluding the vermiform appendix, the rectum and the anal canal.
colon
@@ -802100,7 +804903,7 @@ Daily dose = Acetaminophen dose/drug duration
urinary bladder
- distensible musculomembranous organ situated in the anterior part of the pelvic cavity in which urine collects before excretion[MP].
+ Distensible musculomembranous organ situated in the anterior part of the pelvic cavity in which urine collects before excretion[MP].
urinary bladder
@@ -802113,7 +804916,7 @@ Daily dose = Acetaminophen dose/drug duration
pancreas
- An endoderm derived structure that produces precursors of digestive enzymes and blood glucose regulating enzymes[GO].
+ An endoderm derived structure that produces precursors of digestive enzymes and blood glucose regulating hormones[GO].
pancreas
@@ -802137,7 +804940,7 @@ Daily dose = Acetaminophen dose/drug duration
-
+
tibial nerve
The tibial nerve is a branch of the sciatic nerve. The tibial nerve passes through the popliteal fossa to pass below the arch of soleus. In the popliteal fossa the nerve gives off branches to gastrocnemius, popliteus, soleus and plantaris muscles, an articular branch to the knee joint, and a cutaneous branch that will become the sural nerve. The sural nerve is joined by fibres from the common peroneal nerve and runs down the calf to supply the lateral side of the foot. Below the soleus muscle the nerve lies close to the tibia and supplies the tibialis posterior, the flexor digitorum longus and the flexor hallucis longus. The nerve passes into the foot running posterior to the medial malleolus. Here it is bound down by the flexor retinaculum in company with the posterior tibial artery. [WP,unvetted].
@@ -802160,6 +804963,19 @@ Daily dose = Acetaminophen dose/drug duration
+
+
+
+
+ digestive tract
+ A tube extending from the mouth to the anus.
+
+
+ digestive tract
+
+
+
+
@@ -802178,7 +804994,7 @@ Daily dose = Acetaminophen dose/drug duration
lower respiratory tract
- The segment of the respiratory tract that starts proximally with the trachea and includes all distal structures including the lungs[WP,modified]
+ The segment of the respiratory tract that starts proximally with the trachea and includes all distal structures including the lungs[WP,modified].
lower respiratory tract
@@ -802202,7 +805018,7 @@ Daily dose = Acetaminophen dose/drug duration
-
+
coronary artery
An artery that supplies the myocardium.
@@ -802212,6 +805028,19 @@ Daily dose = Acetaminophen dose/drug duration
+
+
+
+
+ artery
+ An epithelial tube or tree of tibes that transports blood away from the heart[modified from AEO definition].
+
+
+ artery
+
+
+
+
@@ -802230,7 +805059,7 @@ Daily dose = Acetaminophen dose/drug duration
nasopharynx
- the section of the pharynx that lies above the soft palate
+ The section of the pharynx that lies above the soft palate.
nasopharynx
@@ -802243,7 +805072,7 @@ Daily dose = Acetaminophen dose/drug duration
oropharynx
- the portion of the pharynx that lies between the soft palate and the upper edge of the epiglottis
+ The portion of the pharynx that lies between the soft palate and the upper edge of the epiglottis.
oropharynx
@@ -802256,7 +805085,7 @@ Daily dose = Acetaminophen dose/drug duration
vitreous humor
- A transparent, semigelatinous substance that fills the cavity behind the crystalline lens of the eye and in front of the retina
+ A transparent, semigelatinous substance that fills the cavity behind the crystalline lens of the eye and in front of the retina.
vitreous humor
@@ -802334,7 +805163,7 @@ Daily dose = Acetaminophen dose/drug duration
bile
- vital aqueous secretion of the liver that is formed by hepatocytes and modified down stream by absorptive and secretory properties of the bile duct epithelium.
+ Vital aqueous secretion of the liver that is formed by hepatocytes and modified down stream by absorptive and secretory properties of the bile duct epithelium.
bile
@@ -802376,7 +805205,7 @@ Daily dose = Acetaminophen dose/drug duration
placenta
- organ of metabolic interchange between fetus and mother, partly of embryonic origin and partly of maternal origin[GO]. The fetal portion of the placenta is known as the villous chorion. The maternal portion is known as the decidua basalis. The two portions are held together by anchoring villi that are anchored to the decidua basalis by the cytotrophoblastic shell.
+ Organ of metabolic interchange between fetus and mother, partly of embryonic origin and partly of maternal origin[GO]. The fetal portion of the placenta is known as the villous chorion. The maternal portion is known as the decidua basalis. The two portions are held together by anchoring villi that are anchored to the decidua basalis by the cytotrophoblastic shell.
placenta
@@ -802391,6 +805220,7 @@ Daily dose = Acetaminophen dose/drug duration
feces
Portion of semisolid bodily waste discharged through the anus[MW,modified]
+ Portion of semisolid bodily waste discharged through the anus[MW,modified].
Excretion in semisolid state processed by the intestine.[FMA]
@@ -802546,96 +805376,15 @@ Daily dose = Acetaminophen dose/drug duration
-
-
-
-
-
- Lowermost layer of the integumentary system in vertebrates. Types of cells that are found in the hypodermis are fibroblasts, adipose cells, and macrophages. It is derived from the mesoderm, but unlike the dermis, it is not derived from the dermatome region of the mesoderm. The hypodermis is used mainly for fat storage[WP].
-
-
- A layer separating the inner face of the dermis from the subjacent muscle cells. It is covered on both sides by a basement membrane. It contains pigment cells. Le Guellec et al, 2004.[TAO]
- A layer separating the inner face of the dermis from the subjacent muscle cells. It is covered on both sides by a basement membrane. It contains pigment cells[FMA:70544].
- hypodermal
- subcutaneous
- subcutaneus
- BTO has 'subcutis', as part of dermis. We follow FMA in having distinct classes for hypodermis and superficial fascia, and including these as part of the non-skin intgeument.
-
-
- BTO:0001314
- CALOHA:TS-2366
- FMA:70544
- NCIT:C33645
- TAO:0001136
- UMLS:C0278403
- ZFA:0001136
- hypoderm
- vertebrate hypodermis
- uberon
- sub-tegumental tissue
- subcutaneous tissue
- subcutis
- subtegumental tissue
- superficial fascia
- tela subcutanea
- UBERON:0002072
-
-
-
-
-
- hypodermis
-
-
-
-
-
-
-
skin of body
The organ covering the body that consists of the dermis and epidermis.
- consider 'integumentary system' for invertebrates
-
- MA uses the term skin to refer to what is called here: zone of skin
-
-
-
- BTO:0001253
- CALOHA:TS-0934
- EFO:0000962
- EHDAA2:0001844
- EMAPA:17525
- FMA:7163
- MESH:D012867
- MFMO:0000099
- NCIT:C12470
- OpenCyc:Mx4rvVjX3ZwpEbGdrcN5Y29ycA
- UMLS:C1123023
- XAO:0000023
- galen:Skin
- entire skin
- skin organ
- uberon
- entire integument
- integument
- integumental organ
- pelt
- skin
- UBERON:0002097
-
-
-
-
-
-
skin of body
-
@@ -802645,7 +805394,7 @@ Daily dose = Acetaminophen dose/drug duration
spleen
- the organ that functions to filter blood and to store red corpuscles and platelets
+ The organ that functions to filter blood and to store red corpuscles and platelets.
spleen
@@ -802716,7 +805465,7 @@ Daily dose = Acetaminophen dose/drug duration
ileum
- the portion of the small intestine that extends from the jejunum to the colon
+ The portion of the small intestine that extends from the jejunum to the colon.
ileum
@@ -802857,7 +805606,7 @@ Daily dose = Acetaminophen dose/drug duration
bone marrow
- the soft tissue that fills the cavities of bones
+ The soft tissue that fills the cavities of bones.
bone marrow
@@ -802865,37 +805614,15 @@ Daily dose = Acetaminophen dose/drug duration
-
+
-
-
-
- Muscle tissue is a contractile tissue made up of actin and myosin fibers[GO].
+
+
+ lymph
+ Lymph is the fluid that is formed when interstitial fluid enters the conduits of the lymphatic system through lymph capillaries[WP].
+
-
- One of the four types of tissue in traditional classifications. Tissue that contains cells with contractile filaments that move past each other and change the size of the cell. Muscle tissue also is separated into three distinct categories.[AAO]
-
-
-
- AAO:0000306
- AEO:0000122
- CALOHA:TS-0642
- EHDAA2:0003122
- EMAPA:32715
- FMA:9641
- MA:0002437
- MESH:D009132
- NCIT:C12435
- UMLS:C2328219
- galen:MuscleTissue
- muscular tissue
- portion of muscle tissue
- textus muscularis
- uberon
- UBERON:0002385
-
- Vertebrate muscle is categorized into three major muscle types defined by their structural and functional properties: skeletal, cardiac and smooth. In Dmel the counterparts are somatic, heart/cardiac and visceral. Here we take a cell type based approach.
- muscle tissue
+ lymph
@@ -802905,7 +805632,7 @@ Daily dose = Acetaminophen dose/drug duration
pericardial fluid
- Transudate contained in the pericardial cavity.[FMA]
+ Transudate contained in the pericardial cavity.[FMA].
pericardial fluid
@@ -803003,12 +805730,10 @@ Daily dose = Acetaminophen dose/drug duration
An anatomical structure that develops (entirely or partially) from the mesoderm.
Grouping term for query purposes
-
FBbt:00025998
mesodermal derivative
uberon
UBERON:0004120
-
mesoderm-derived structure
@@ -803022,12 +805747,10 @@ Daily dose = Acetaminophen dose/drug duration
An anatomical structure that develops (entirely or partially) from the ectoderm.
Grouping term for query purposes
-
FBbt:00025990
ectodermal deriviative
uberon
UBERON:0004121
-
ectoderm-derived structure
@@ -803054,7 +805777,6 @@ Daily dose = Acetaminophen dose/drug duration
A proximal-distal subdivision of the digestive tract.
intended to denote both embryonic and adult structures. Note the FMA grouping here is not quite correct.
-
FBbt:00100315
FMA:71131
uberon
@@ -803063,7 +805785,6 @@ Daily dose = Acetaminophen dose/drug duration
segment of intestinal tract
subdivision of alimentary system
UBERON:0004921
-
subdivision of digestive tract
@@ -803253,7 +805974,7 @@ Daily dose = Acetaminophen dose/drug duration
-
+
tibial artery
The anterior and posterior arteries created at the bifurcation of the popliteal artery. The anterior tibial artery begins at the lower border of the popliteus muscle and lies along the tibia at the distal part of the leg to surface superficially anterior to the ankle joint. Its branches are distributed throughout the leg, ankle, and pes. The posterior tibial artery begins at the lower border of the popliteus muscle, lies behind the tibia in the lower part of its course, and is found situated between the medial malleolus and the medial process of the calcaneal tuberosity. Its branches are distributed throughout the leg and foot.
@@ -803268,7 +805989,7 @@ Daily dose = Acetaminophen dose/drug duration
esophagogastric junction
- The junction between the esophagus and the stomach epithelium
+ The junction between the esophagus and the stomach epithelium.
esophagogastric junction
@@ -803282,13 +806003,11 @@ Daily dose = Acetaminophen dose/drug duration
An anatomical structure that has more than one cell as a part.
-
CARO:0010000
FBbt:00100313
multicellular structure
uberon
UBERON:0010000
-
multicellular anatomical structure
@@ -803313,9 +806032,9 @@ Daily dose = Acetaminophen dose/drug duration
-
+
umbilical cord blood
- blood that remains in the placenta and in the attached umbilical cord after childbirth[WP].
+ Blood that remains in the placenta and in the attached umbilical cord after childbirth[WP].
umbilical cord blood
@@ -803454,6 +806173,19 @@ Daily dose = Acetaminophen dose/drug duration
+
+
+
+
+ placental blood
+ Blood located in the placenta.
+
+
+ placental blood
+
+
+
+
@@ -803471,35 +806203,17 @@ Daily dose = Acetaminophen dose/drug duration
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
A vaccine is a processed material with the function that when administered, it prevents or ameliorates a disorder in a target organism by inducing or modifying adaptive immune responses specific to the antigens in the vaccine.
Many vaccines are developed to protect against infectious pathogens that causes infectious diseases. Many vaccines are also being developed against other diseases such as cancer, allergy, and autoimmune diseases.
YH, BP, BS, MC, LC, XZ, RS
- a role that inheres in a prepared material entity that is designed to induce protection or treament for a diease or infection in vivo.
+ vaccine
vaccine
MeSH: D014612
@@ -803545,6 +806259,38 @@ Daily dose = Acetaminophen dose/drug duration
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -803571,94 +806317,63 @@ Daily dose = Acetaminophen dose/drug duration
YH, BP
vaccine administration
+ process
vaccination
-
-
-
-
- YH
-
- vaccine-induced B cell mediated immunity
-
-
-
-
-
-
-
-
- a vaccine adjuvant that is formed as a mineral salt.
- SGS, YH
-
- mineral salt vaccine adjuvant
- CVX: 119
-
-
-
-
-
-
-
-
- YH
-
- vaccine-induced T cell mediated immunity
-
-
-
-
-
-
-
-
- YH, SGS
- a vaccine adjuvant that contains microbial derived material.
-
- microbial derivative vaccine adjuvant
- CVX: 52
- CVX: 83
-
-
+
-
-
-
-
-
- an aluminum vaccine adjuvant that contains aluminum hydroxide.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A vaccine that is composed of a plasmid vaccine vector (a circular double stranded DNA molecule) containing the whole of parts of genes encoding one or more vaccine antigen proteins.
YH
- alum
+ genetic vaccine
+ naked DNA vaccine
+ nucleic acid vaccine
- aluminum hydroxide vaccine adjuvant
+ vaccine
+ DNA vaccine
-
+
-
-
- an aluminum vaccine adjuvant that is aluminum phosphate.
- YH, SGS
- Adju-Phos®
- Al(PO)4
-
- aluminum phosphate vaccine adjuvant
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A bacterial vaccine that prevents against Escherichia coli infection.
YH
+ E. coli vaccine
- vaccine-induced adaptive immune response
+ vaccine
+ Escherichia coli vaccine
+ MeSH: D022361
@@ -803670,6 +806385,7 @@ Daily dose = Acetaminophen dose/drug duration
a viral vaccine vector that uses an adenovirus as the vector.
YH
+ vaccine component
adenovirus vaccine vector
NCBI Taxonomy ID: 10508
@@ -803681,26 +806397,37 @@ Daily dose = Acetaminophen dose/drug duration
a vaccine component role that inheres in a recombinant vaccine vector as a vaccine component. The combination of a recombinant vaccine vector and a heterogenous protective antigen(s) inserted inside the vector for a recombinant vector vaccine.
- YH,YL
+ YH
+ YL
+ role
recombinant vaccine vector role
-
+
-
-
- an adjuvant role that inheres in a vaccine component which is added as part of a vaccine and induces enhanced adaptive immune response to the vaccine antigen.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A vaccine that targets against a bacterial disease.
YH
- The Latin "adjuvans" means to help, particularly to reach a goal.
-
-Adjuvant therapy for cancer is surgery followed by chemotherapy or radiation to help decrease the risk of the cancer recurring (coming back).
-
-An adjuvant is a substance that helps and enhances the pharmacological effect of a drug or increases the ability of an antigen to stimulate the immune system.
- vaccine adjuvant role
+ vaccine
+ bacterial vaccine
+ MeSH: D001428
@@ -803712,6 +806439,7 @@ An adjuvant is a substance that helps and enhances the pharmacological effect of
a virulence of vaccine organism that shows an attenuated pheontype of the organism as the major component of a vaccine.
YH
+ quality
vaccine organism live attenuated
@@ -803732,46 +806460,61 @@ An adjuvant is a substance that helps and enhances the pharmacological effect of
+
+
+
+
+
+
a processed material that is output of the vaccine preparation and part of a vaccine.
YH
cardinal part of vaccine
vaccine ingredient
+ vaccine component
vaccine component
-
+
-
-
- an organismal quality of a whole organism vaccine where the whole organism is inactivated/killed and lacks the capability of replication.
- YH
- vaccine organism killed
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A vaccine that uses RNA(s) derived from a pathogen organism.
+ Using RNA may eliminate the problem of having to tailor a vaccine for each individual patient with their specific immunity. The advantage of RNA is that it can be used for all immunity types and can be taken from a single cell. DNA vaccines need to produce RNA which then prompts the manufacture of proteins. However, RNA vaccine eliminates the step from DNA to RNA.
+ Oliver He
+ mRNA vaccine
+ https://en.wikipedia.org/wiki/RNA_vaccine
- vaccine organism inactivated
+ vaccine
+ RNA vaccine
-
+
-
-
+
+
+ an organismal quality of a whole organism vaccine where the whole organism is inactivated/killed and lacks the capability of replication.
YH
+ vaccine organism killed
- vaccine-induced antiviral neutralizing antibody response
-
-
-
-
-
-
-
-
-
- vaccine-induced T cell interferon-gamma production
+ quality
+ vaccine organism inactivated
@@ -803788,136 +806531,164 @@ An adjuvant is a substance that helps and enhances the pharmacological effect of
- vaccine function is a function that inheres in a vaccine that induces protective immune response against a disease. It is realized in the immunization process in the host.
+ vaccine function is a function that inheres in a vaccine that induces protective immune response against a disease. It is realized in the immunization process in the host.
PERSPN: Oliver He: There has been hot discussion about whether we use 'vaccine function' or 'vaccine role'. Vaccine role may not be the good term to use. Vaccine is designed to be 'vaccine', so it should be vaccine function. One special case is cowpox virus. The cowpox virus can be mixed with some liquid like water and used as a smallpox vaccine. In this case, people often say: the cowpox virus has a 'vaccine role'. However, the cowpox virus vaccine is a processed material of a mix of the virus with water. The virus is a virus, it is not a vaccine per se. Therefore, vaccine role may not be an accurate term.
- YH, MC, XZ, and AR
+ MC
+ XZ
+ and AR
+ YH
+ disposition
vaccine function
-
+
-
-
- Any immune system process that functions in the calibrated response of the host to a vaccine.
- The definition of this term is based on the definition of 'immune response (GO:0006955)' . It is a child term of this GO term.
- Y.L.
+
+
+ A legal organization that represents an association of people with a specific objective.
+ YH
+ https://en.wikipedia.org/wiki/Company
- Y.H.
- vaccine-induced host immune response
+ material entity
+ company
-
+
-
-
-
+
+
-
-
+
+
-
+
+
-
-
-
-
-
-
-
-
-
-
-
-
+
+
- a processual entity that specifies host response to a vaccine.
+ A whole organism vaccine that uses an inativated pathogen organism as its component.
YH
+ inactivated organism vaccine
+ killed vaccine
- vaccine-induced host response
+ vaccine
+ inactivated vaccine
-
+
-
-
- YH
- https://en.wikipedia.org/wiki/Company
+
+
+ A route of administration that inject the material(such as vaccines, allergens) directly into a muscle.
+ YH,YL
+ intramuscular injection route
- A legal organization that represents an association of people with a specific objective.
- company
+ site
+ intramuscular route
-
+
-
-
+
+
+ A rounte of administration that located in nose.
YH
- immunoglobulin mediated immune response to vaccine
- vaccine-induced antibody mediated immune response
+ site
+ intranasal route
-
+
-
-
+
+
+
+
+
+
+
+
-
-
+
+
- a route of administration that inject the material(such as vaccines, allergens) directly into a muscle.
- YH,YL
- intramuscular injection route
+ A vaccine that is licensed for commercial use.
+ YH
- I.M.
- intramuscular route
+ vaccine
+ licensed vaccine
-
+
-
-
+
+
+
+
+
+
+
+
-
-
+
+
- rounte of administration that located in nose.
+ A vaccine that is made from microbes that have been attenuated (weakened) in the laboratory so that they can't cause disease.
YH
+ attenuated vaccine
- I.N.
- intranasal route
+ vaccine
+ live attenuated vaccine
-
+
-
-
- YL,YH
- Page 73, Chapter 6, Vaccine, 5th Edition. EXPERT CONSULT by Plotkin SA., et. al. 2008
- a role inheres in a material entity, that has been added into a vaccine's formulation by the manufacture for a specific purpose. For example: adjuvant to enhance the effect of immunogen, perservatives, stablizers and those materials added for affecting PH and isotonicity.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ bacterial vaccine that is used to protect against Leptospira spp. infection
+ YL
- vaccine additive role
+ vaccine
+ Leptospira spp. vaccine
@@ -803929,6 +806700,7 @@ An adjuvant is a substance that helps and enhances the pharmacological effect of
a viral vaccine vector that uses an poxvirus as the vector.
YH
+ vaccine component
poxvirus vaccine vector
NCBI Taxonomy ID: 10240
@@ -803961,6 +806733,7 @@ An adjuvant is a substance that helps and enhances the pharmacological effect of
YH
prophylactic vaccine function
+ disposition
preventive vaccine function
@@ -803970,9 +806743,10 @@ An adjuvant is a substance that helps and enhances the pharmacological effect of
- Protective antigen is an antigen that stimulates protective immunity when used in vivo.
+ An antigen that stimulates protective immunity when used in vivo.
YH
+ role
protective antigen role
@@ -803987,16 +806761,23 @@ An adjuvant is a substance that helps and enhances the pharmacological effect of
-
+
- A vaccine that uses a modified virus or bacterium to deliver genes that code for microbial antigens to cells of the body.
+
+
+
+
+
+
+ A vaccine that uses a modified virus or bacterium as the vector to deliver vaccine antigen(s) to the cells of the host body.
YH
+ vaccine
recombinant vector vaccine
@@ -804007,9 +806788,10 @@ An adjuvant is a substance that helps and enhances the pharmacological effect of
immunization is a processual entity that primes or modifies an adaptivie immune response to some antigens.
- YH, XZ, BP
+ YH, XZ, BP
WEB: http://en.wikipedia.org/wiki/Immunization
+ process
immunization
@@ -804023,9 +806805,7 @@ An adjuvant is a substance that helps and enhances the pharmacological effect of
YH, XZ
WEB: http://en.wikipedia.org/wiki/Immunization
- Active immunization entails the introduction of a foreign molecule into the body, which causes the body itself to generate immunity against the target. This immunity comes from the T cells and the B cells with their antibodies.
-Active immunization can occur naturally when a person comes in contact with, for example, a microbe. If the person has not yet come into contact with the microbe and has no pre-made antibodies for defense (like in passive immunization), the person becomes immunized. The immune system will eventually create antibodies and other defenses against the microbe. The next time, the immune response against this microbe can be very efficient; this is the case in many of the childhood infections that a person only contracts once, but then is immune.
-Artificial active immunization is where the microbe, or parts of it, are injected into the person before they are able to take it in naturally. If whole microbes are used, they are pre-treated, Attenuated vaccine. (Wikipedia)
+ process
active immunization
@@ -804068,6 +806848,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
artificial active immunization
WEB: http://en.wikipedia.org/wiki/Immunization
+ process
vaccine immunization
@@ -804080,6 +806861,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
induction of adaptive immune response to antigen is an active immunization process that results in induction of adaptive immune response to some antigens, for example, in a vaccine.
YH, XZ
+ process
induction of adaptive immune response to antigen
@@ -804092,6 +806874,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
disorder prevention is a processual entity that prevents a disorder that is the physical basis of a disease.
YH, XZ
+ process
disorder prevention
@@ -804104,39 +806887,60 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
disorder treatment is a processual entity that leads to treat a disorder that is the physical basis of a disease.
YH, XZ
+ process
disorder treatment
-
+
-
-
- modification of adaptive immune response to antigen is an active immunization process that results in modification of an adaptive immune response to some antigens, for example, in a therapeutic vaccine.
- YH, XZ
+
+
+ A route of administration that is loacted in the hypodermis (subcutaneous tissue) region.
+ YL, YH
- modification of adaptive immune response to antigen
+ site
+ subcutaneous route
-
+
-
-
+
+
+
+
+
+
+
+
-
-
+
+
- a route of administration that is loacted in the hypodermis (subcutaneous tissue) region.
- YL
+ A vaccine that is composed of a purified protein(s) or other antigenic determinant(s) from a disease-causing organism. A subunit vaccine does not include the whole organism of a pathogen, so the subunits have less risk of causing adverse reactions.
+ YH
- YH
- S.C.
- subcutaneous route
+ vaccine
+ subunit vaccine
+
+
+
+
+
+
+
+
+ a vaccine that is designed to immunize against two or more strains of the same microorganism, or against two or more microorganisms.
+ NF, YH
+ WEB: http://coastalcarolinaresearch.com/?p=679
+
+ vaccine
+ multivalent vaccine
@@ -804145,20 +806949,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
-
-
-
-
-
-
-
-
@@ -804174,6 +806964,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
The therapeutic vaccine function is a function realized by the process of vaccination and leading to induction of an adaptive immune response to the antigens in a vaccine, which ameliorates a specific disorder.
YH
+ disposition
therapeutic vaccine function
@@ -804183,17 +806974,12 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
- a path that is located in gross anatomical part of an organism (e.g., human) and is used for administering a vaccine, a drug, fluid, poison, or other substance into the body.
+ A path that is located in gross anatomical part of an organism (e.g., human) and is used for administering a vaccine, a drug, fluid, poison, or other substance into the body.
CDISC has a codelist: Rout of Administration. Desription from CDISC: The course by which a substance was administered in order to reach the site of action in the body. CDISC_SDTM_Route_of_Administration_Terminology
YH,YL
http://en.wikipedia.org/wiki/Route_of_administration
+ site
route of administration
http://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C38114
http://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66729
@@ -804201,79 +806987,58 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- a vaccine component that is chemical substance added to vaccine and enhance and direct immune response to protective antigen. Many of vaccine adjuvants cause a range of serious side-effects.
- YH
-
- vaccine adjuvant
-
-
-
-
immunization objective is the specification of an objective to achieve immunization.
- YH, XZ
+ XZ
+ YH
WEB: http://en.wikipedia.org/wiki/Immunization
+ information content entity
immunization objective
-
+
-
-
-
-
-
-
+
+
+
+
-
-
+
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
-
-
+
+
- vaccine preparation is a manufacturing process to produce a vaccine.
- YH, BP
- vaccine generation
- vaccine production
+ a multivalent vaccine that is designed to immunize against at least one bacterial disease and one viral disease.
+ NF, YH
- vaccine preparation
-
-
-
-
-
-
-
-
- YH
-
- vaccine specific T cell cytokine production
+ vaccine
+ multivalent vaccine against bacterial and viral diseases
@@ -804293,6 +807058,12 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+
+
+
+
+
+
a vaccine component that uses a microbe (e.g., bacterium, virus, and parasitic organism) as a vector that is inserted with the DNA(s) of a heterologous protective antigen(s) to generate a "recombinant vector vaccine". The microorganism used as a vector generally has a stable non or low pathogenic phenotype for the species the vaccine is intended for.
YH
recombinant vector
@@ -804300,6 +807071,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
WEB: http://www.biosafety.be/GT/Regulatory/Veterinary_vaccines/EMEA_000404en.pdf
WEB: http://www.ema.europa.eu/docs/en_GB/document_library/Scientific_guideline/2009/09/WC500003856.pdf
+ vaccine component
recombinant vaccine vector
@@ -804312,6 +807084,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
an orthopoxvirus vaccine vector that uses vaccinia virus as the vector
YH
+ vaccine component
vaccinia virus vector
NCBI Taxonomy ID: 10245
@@ -804327,7 +807100,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
+
@@ -804337,6 +807110,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A vaccine that targets against a viral disease.
YH
+ vaccine
viral vaccine
MeSH: D014765
@@ -804350,6 +807124,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
a vaccine vector that uses a virus as the vector.
YH
+ vaccine component
viral vaccine vector
NCBI Taxonomy ID: 10239
@@ -804360,10 +807135,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+ A role that inheres in a prepared material entity that is designed to induce protection or treatment for a disease or infection.
YH
- a role that inheres in a prepared material entity that is designed to induce protection or treatment for a disease or infection.
- vaccine role
+ role
+ vaccine role
@@ -804383,10 +807159,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+ A role that inheres in a material entity that becomes an ingredient of a vaccine.
YH
- a role that inheres in a material entity that becomes an ingredient of a vaccine.
- vaccine component role
+ role
+ vaccine component role
@@ -804398,7 +807175,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
a vaccine role that indicates the vaccine being a DNA vaccine.
YH
- DNA vaccine role
+ role
+ DNA vaccine role
@@ -804410,7 +807188,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
a vaccine role that indicates the vaccine being a subunit vaccine.
YH
- subunit vaccine role
+ role
+ subunit vaccine role
@@ -804422,6 +807201,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
licensed vaccine role is a regulation-assigned role that indicates that a vaccine obtains official approval for commercial production and selling on the market.
YH
+ role
licensed vaccine role
@@ -804434,7 +807214,70 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
a vaccine role that indicates the vaccine being a recombinant vector vaccine.
YH
- recombinant vector vaccine role
+ role
+ recombinant vector vaccine role
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A viral vaccine that protects against infection with Rotavirus.
+ YH
+
+ vaccine
+ Rotavirus vaccine
+ MeSH: D022243; UMLS_CUI: C0597418; SNOMEDCT: 116077000
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ a viral vaccine that is inactivated
+ killed viral vaccine
+
+ vaccine
+ inactivated viral vaccine
@@ -804446,32 +807289,48 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
a vaccine role that indicates the vaccine being a RNA vaccine.
YH
- RNA vaccine role
+ role
+ RNA vaccine role
-
+
-
-
- a licensed vaccine role that indicates the vaccine occurs in USA.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A bacterial vaccine that protects against infections by various Salmonella species.
YH
+ https://en.wikipedia.org/wiki/Salmonella
- USA licensed vaccine role
+ vaccine
+ Salmonella vaccine
+ MeSH: D022562
-
+
-
-
- a mineral salt vaccine adjuvant that is composed of aluminum salt.
- Aluminum vaccine adjuvant is a vaccine adjuvant that is composed of some aluminum compound.
+
+
+ a licensed vaccine role that indicates the vaccine occurs in USA.
YH
- aluminum vaccine adjuvant
+ role
+ USA licensed vaccine role
@@ -804480,15 +807339,10 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
+ A route of administration that located in the mouth
YH
- a route of administration that located in the mouth
+ site
oral route
@@ -804498,17 +807352,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
- a route of administration that inject the material(such as vaccines, allergens) into the skin itself.
+ A route of administration that inject the material(such as vaccines, allergens) into the skin itself.
YH,YL
intradermal injection route
- I.D.
+ site
intradermal route
@@ -804533,6 +807381,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Modified live virus
YH
+ vaccine
RECOMBITEK Corona MLV
@@ -804550,6 +807399,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
YH
+ vaccine
canine coronavirus vaccine
@@ -804562,7 +807412,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
an adenovirus vaccine vector that uses a chimpanzee adenovirus strain
Yongqun He, Shunzhou Deng
- chimpanzee adenovirus vaccine vector
+ vaccine component
+ chimpanzee adenovirus vaccine vector
NCBI Taxonomy ID: 310542
@@ -804577,7 +807428,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
NDV vaccine vector
PMID: 23845804
- Newcastle disease virus vaccine vector
+ vaccine component
+ Newcastle disease virus vaccine vector
NCBI Taxonomy ID: 11176
@@ -804591,6 +807443,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Yongqun He
human adenovirus 5 vaccine vector
+ vaccine component
adenovirus serotype 5 vaccine vector
NCBI Taxonomy ID: 28285
@@ -804605,7 +807458,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
YH
PMID: 24933081
- Modified Vaccinia Ankara (MVA) virus vaccine vector
+ vaccine component
+ Modified Vaccinia Ankara (MVA) virus vaccine vector
NCBI Taxonomy ID: 467144
@@ -804616,8 +807470,10 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
vaccine viability is a viability of a vaccine organism.
- YH, ZX
+ ZX
+ YH
+ quality
vaccine organism viability
@@ -804630,32 +807486,101 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
a poxvirus vaccine vector that uses an orthopox virus as the vector
Yongqun He
+ vaccine component
Orthopoxvirus vaccine vector
NCBI Taxonomy ID: 10242
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ a bacterial vaccine that uses inactivated bacterial organism.
+ YH
+
+ vaccine
+ inactivated bacterial vaccine
+
+
+
+
+
-
-
- A microbial derivative vaccine adjuvant compsed of CpG DNA.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A viral vaccine that protects aganist Newcastle disease virus infection.
YH
- PMID: 12899580
- CpG DNA vaccine adjuvant
+ vaccine
+ Newcastle disease virus vaccine
-
+
-
-
- a tensoactive compound vaccine adjuvant that is derived from saponin, a compound that is an immunostimulator found in the plant P. senega.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ ZX
+ YH
- saponin vaccine adjuvant
+ material entity
+ protective antigen
@@ -804663,7 +807588,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
+
@@ -804676,135 +807601,1104 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- a role of host that contains vaccine. It is a role that inheres in an organism that is the target of a vaccine administration (vaccination process).
- YH, ZX
+ A role that inheres in an organism that is the target of a vaccination.
+ Jie Zheng
+ ZX
+ YH
+ https://github.com/vaccineontology/VO/issues/677
+ role
vaccine host role
-
+
-
-
- An emulsion vaccine adjuvant consisting of an oil (squalene)-in-water nano emulsion.
- PMID: 20488726
- SGS
- MF59
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A vaccine licensed in the USA
+ Oliver He, Kallan Roan
+ https://www.fda.gov/BiologicsBloodVaccines/Vaccines/ApprovedProducts/ucm093833.htm
- MF59 vaccine adjuvant
+ vaccine
+ USA licensed vaccine
-
+
-
-
- AS03 is an emusion vaccine adjuvant that contains α-tocopherol and squalene, two biodegradable polyprenyls, in an oil-in-water emulsion.
- SGS
- AS03
- PMID: 21256188
+
+
+
+
+
+
+
+
+ viral vaccine that is used to protect against Porcine rotavirus infection
+ YL
- AS03 vaccine adjuvant
+ vaccine
+ Porcine rotavirus vaccine
-
+
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ viral vaccine that is used to protect against Infectious Bursal Disease Virus (IBDV) infection
+ YL, YH, RS, NF
+ IBDV vaccine
- emulsion vaccine adjuvant
+ vaccine
+ infectious bursal disease virus vaccine
-
+
-
-
- a vaccine adjuvant that includes tensioactive material. Tensioactive materials, surfactants or active surface agents are chemical substances with a polar-non polar structure. These substances have a tendency to locate themselves at the surface creating an adsorbed monomolecular layer on the interface.
- YH, SGS
- tensioactive compound vaccine adjuvant
- WEB: http://www.citt.ufl.edu/team/sepulveda/html/en_tensioactivos.htm
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ viral vaccine that is used to protect against Infectious Bronchitis Virus (IBV) infection
+ YL
- tensoactive compound vaccine adjuvant
+ vaccine
+ Infectious Bronchitis Virus vaccine
-
+
-
-
- YH, SGS
- a vaccine adjuvant that is primarily composed of carbohydrates.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ viral vaccine that is used to protect against Bovine coronavirus infection
+ YL
- carbohydrate vaccine adjuvant
+ vaccine
+ bovine coronavirus vaccine
-
+
-
-
- The objective that intends to produce vaccine via the vaccine preparation process.
+
+
+
+
+
+
+
+
+ viral vaccine that is used to protect against Feline infectious peritonitis virus infection
+ YL, YH
- YH
- vaccine target specification
+ vaccine
+ Feline infectious peritonitis virus vaccine
-
+
-
-
+
+
+
-
+
-
-
- viral vaccine that is used to protect against Bovine coronavirus infection
- generated using OntoRat
+
+ viral vaccine that is used to protect against Transmissible gastroenteritis virus infection
YL
- bovine coronavirus vaccine
+ vaccine
+ Transmissible gastroenteritis virus vaccine
-
+
-
-
-
+
+
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
-
-
+
+
-
+
+
+
+
+
+
+
+
+
+ viral vaccine that is used to protect against Canine parainfluenza virus infection
+ YL
+
+ vaccine
+ canine parainfluenza virus vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Feline Infectious Peritonitis Modified Live Virus Vaccine (USDA: 15A1.20)
+ USDA: 15A1.20
+ violinID:1771
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass Type, Live Virus Vaccine (USDA: 1231.11)
+ USDA: 1231.11
+ violinID:1361
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bronchitis Ark Type, Live Virus Vaccine (USDA: 1231.1M)
+ USDA: 1231.1M
+ violinID:1373
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Ark Type, Live Virus Vaccine (USDA: 1231.20)
+ USDA: 1231.20
+ violinID:1375
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Ark Type, Live Virus Vaccine (USDA: 1231.21)
+ USDA: 1231.21
+ violinID:1376
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bronchitis Ark Type, Live Virus Vaccine (USDA: 1231.22)
+ USDA: 1231.22
+ violinID:1377
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Conn Type, Live Virus Vaccine (USDA: 1231.15)
+ USDA: 1231.15
+ violinID:1365
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bronchitis Delaware Type, Modified Live Virus Vaccine (USDA: 1231.1D)
+ USDA: 1231.1D
+ violinID:1368
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Georgia Type, Live Virus Vaccine (USDA: 1231.1J)
+ USDA: 1231.1J
+ violinID:1371
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bronchitis Georgia Type, Live Virus Vaccine (USDA: 1231.1L)
+ USDA: 1231.1L
+ violinID:1372
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass & Ark Types, Killed Virus Vaccine (USDA: 1235.15)
+ USDA: 1235.15
+ violinID:1382
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass & Ark Types, Live Virus Vaccine (USDA: 1231.13)
+ USDA: 1231.13
+ violinID:1363
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass & Conn Types, Live Virus Vaccine (USDA: 1231.14)
+ USDA: 1231.14
+ violinID:1364
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bronchitis Mass & Conn Types, Live Virus Vaccine (USDA: 1231.1G)
+ USDA: 1231.1G
+ violinID:1370
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bronchitis Mass & Conn Types, Live Virus Vaccine (USDA:1231.1N)
+ USDA:1231.1N
+ violinID:1374
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass Type, Live Virus Vaccine (USDA: 1231.12)
+ USDA: 1231.12
+ violinID:1362
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass Type, Live Virus Vaccine (USDA: 1231.18)
+ USDA: 1231.18
+ violinID:1366
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bronchitis Mass Type, Live Virus Vaccine (USDA: 1231.1A)
+ USDA: 1231.1A
+ violinID:1367
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bronchitis Mass Type, Live Virus Vaccine (USDA: 1231.1F)
+ USDA: 1231.1F
+ violinID:1369
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass Type, Live Virus Vaccine (USDA: 1232.10)
+ USDA: 1232.10
+ violinID:1378
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass Type, Live Virus Vaccine (USDA: 1232.15)
+ USDA: 1232.15
+ violinID:1379
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass Type, Live Virus Vaccine (USDA: 1233.10)
+ USDA: 1233.10
+ violinID:1380
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass Type, Live Virus Vaccine (USDA: 1235.10)
+ USDA: 1235.10
+ violinID:1381
+
+
+
+
+
+
+
+
+
+
@@ -804829,9 +808723,9 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- generated using OntoRat
YL
+ vaccine
Canine Coronavirus Killed Virus Vaccine (USDA: 14P5.20)
USDA: 14P5.20
violinID:1562
@@ -804842,7 +808736,9 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+
+
@@ -804876,6 +808772,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
generated using OntoRat
YL
+ vaccine
Canine Coronavirus Killed Virus Vaccine (USDA: 14P5.21)
USDA: 14P5.21
violinID:1563
@@ -804886,7 +808783,9 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+
+
@@ -804917,9 +808816,9 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- generated using OntoRat
YL
+ vaccine
Canine Coronavirus Modified Live Virus Vaccine (USDA: 14P1.20)
USDA: 14P1.20
violinID:1561
@@ -804927,33 +808826,5720 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
+
-
-
- Rebecca Racz, Yongqun He
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
- An E mutant is attenuated in hamsters and induces significant protection from challenge with wild type SARS
- SARS-CoV E gene mutant vaccine
+ vaccine
+ Transmissible Gastroenteritis Modified Live Virus Vaccine (USDA: 1961.20)
+ USDA: 1961.20
+ violinID:2142
-
+
-
-
- A CpG DNA vaccine adjuvant that is a short, synthetic, unmethylated CpG oligodeoxynucleotide (CpG ODN) with immunostimulatory activity.
- Oliver He, Kallan Roan
- ISS 1018 CpG ODN
- ISS 1018 CpG oligodeoxynucleotide
- ISS-1018
- https://www.cancer.gov/publications/dictionaries/cancer-drug/def/iss-1018-cpg-oligodeoxynucleotide
- https://www.drugbank.ca/drugs/DB05463
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Modified Killed Virus Vaccine (USDA: 1935.20)
+ USDA: 1935.20
+ violinID:1350
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Modified Live Virus Vaccine (USDA: 1931.20)
+ USDA: 1931.20
+ violinID:1349
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Killed Virus Vaccine-Clostridium Perfringens Type C-Escherichia Coli Bacterin-Toxoid (USDA: 4570.20)
+ USDA: 4570.20
+ violinID:2520;2521;2522;2523
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Killed Virus Vaccine-Clostridium Perfringens Type C-Escherichia Coli Bacterin-Toxoid (USDA: 4570.22)
+ USDA: 4570.22
+ violinID:2524;2525;2526;2527
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Killed Virus Vaccine-Clostridium Perfringens Types C & D-Escherichia Coli Bacterin-Toxoid (USDA: 4575.20)
+ USDA: 4575.20
+ violinID:2528;2529;2530;2531
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Killed Virus Vaccine-Escherichia Coli Bacterin (USDA: 4585.20)
+ USDA: 4585.20
+ violinID:2532;2533;2534
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Killed Virus Vaccine-Escherichia Coli Bacterin (USDA: 4585.22)
+ USDA: 4585.22
+ violinID:2535;2536;2537
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis Standard & Variant, Mass & Ark Types, Killed Virus Vaccine (USDA: 12D5.45)
+ USDA: 12D5.45
+ violinID:1467;1465;1466
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis B1 Type, B1 Strain, Mass & Ark Types, Live Virus Vaccine (USDA: 12H1.4M)
+ USDA: 12H1.4M
+ violinID:1469;1468;1470
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis B1 Type, B1 Strain, Mass & Ark Types, Live Virus Vaccine (USDA: 12H1.67)
+ USDA: 12H1.67
+ violinID:1471;1473;1472
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis Mass Type, Killed Virus Vaccine (USDA: 12J5.40)
+ USDA: 12J5.40
+ violinID:1475;1474;1476
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis Mass Type, Killed Virus Vaccine (USDA: 12J5.43)
+ USDA: 12J5.43
+ violinID:1477;1479;1478
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis Standard & Variant, Mass Type, Killed Virus Vaccine (USDA: 12J5.61)
+ USDA: 12J5.61
+ violinID:1481;1480;1482
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis Mass Type, Killed Virus Vaccine (USDA: 12J5.62)
+ USDA: 12J5.62
+ violinID:1483;1485;1484
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Standard & Variant, Mass Type, Killed Virus Vaccine (USDA: 12M5.00)
+ USDA: 12M5.00
+ violinID:1487;1489;1486;1488
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Standard & Variant, Mass Type, Killed Virus Vaccine (USDA: 12M5.01)
+ USDA: 12M5.01
+ violinID:1491;1493;1490;1492
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Mass Type, Killed Virus Vaccine (USDA: 12M5.11)
+ USDA: 12M5.11
+ violinID:1495;1497;1494;1496
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Killed Virus Vaccine (USDA: 12M5.40)
+ USDA: 12M5.40
+ violinID:1499;1501;1500;1498
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Standard & Variant, Mass & Ark Types, Killed Virus Vaccine (USDA: 12M5.41)
+ USDA: 12M5.41
+ violinID:1503;1505;1502;1504
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Standard & Variant, Mass & Ark Types, Killed Virus Vaccine (USDA: 12M5.42)
+ USDA: 12M5.42
+ violinID:1507;1509;1506;1508
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Mass Type, Killed Virus Vaccine (USDA: 12M5.43)
+ USDA: 12M5.43
+ violinID:1511;1513;1510;1512
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Mass Type, Killed Virus Vaccine (USDA: 12M5.50)
+ USDA: 12M5.50
+ violinID:1517;1515;1516;1514
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Mass Type, Killed Virus Vaccine (USDA: 12M5.90)
+ USDA: 12M5.90
+ violinID:1519;1521;1518;1520
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Mass Type, Killed Virus Vaccine (USDA: 12M5.91)
+ USDA: 12M5.91
+ violinID:1523;1525;1522;1524
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Standard & Variant, Mass Type, Killed Virus Vaccine (USDA: 12M5.E0)
+ USDA: 12M5.E0
+ violinID:1527;1529;1526;1528
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Coronavirus-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 14D7.20)
+ USDA: 14D7.20
+ violinID:1677;1676;1678
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Coronavirus-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 14D9.27)
+ USDA: 14D9.27
+ violinID:1681;1679;1680
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus-Parvovirus Modified Live Virus Vaccine (USDA: 14R1.20)
+ USDA: 14R1.20
+ violinID:1565;1564
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Coronavirus-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 14R7.20)
+ USDA: 14R7.20
+ violinID:1567;1566
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Coronavirus-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 14R7.21)
+ USDA: 14R7.21
+ violinID:1569;1568
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Coronavirus-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 14R7.22)
+ USDA: 14R7.22
+ violinID:1571;1570
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Coronavirus-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 14R7.25)
+ USDA: 14R7.25
+ violinID:1573;1572
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Coronavirus-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 14R7.29)
+ USDA: 14R7.29
+ violinID:1575;1574
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live Virus; Canarypox Vector Vaccine (USDA: 1591.R1)
+ USDA: 1591.R1
+ violinID:1583;1581;1582;1584;1580
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 1599.20)
+ USDA: 1599.20
+ violinID:1585;1587;1589;1586;1588
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 1599.21)
+ USDA: 1599.21
+ violinID:1591;1593;1590;1592;1594
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 1599.25)
+ USDA: 1599.25
+ violinID:1599;1595;1597;1598;1596
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 1599.29)
+ USDA: 1599.29
+ violinID:1601;1603;1600;1602;1604
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass Type, Live Virus Vaccine (USDA: 1761.11)
+ USDA: 1761.11
+ violinID:1996;1997
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass Type, Live Virus Vaccine (USDA: 1761.12)
+ USDA: 1761.12
+ violinID:1998;1999
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Conn Type, Live Virus Vaccine (USDA: 1761.13)
+ USDA: 1761.13
+ violinID:2000;2001
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 1761.14)
+ USDA: 1761.14
+ violinID:2002;2003
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 1761.15)
+ USDA: 1761.15
+ violinID:2004;2005
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 1761.17)
+ USDA: 1761.17
+ violinID:2006;2007
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass Type, Live Virus Vaccine (USDA: 1761.18)
+ USDA: 1761.18
+ violinID:2008;2009
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass Type, Live Virus Vaccine (USDA: 1761.19)
+ USDA: 1761.19
+ violinID:2010;2011
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Conn Type, Live Virus Vaccine (USDA: 1761.1A)
+ USDA: 1761.1A
+ violinID:2012;2013
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass Type, Live Virus Vaccine (USDA: 1762.11)
+ USDA: 1762.11
+ violinID:2014;2015
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Conn Type, Live Virus Vaccine (USDA: 1762.13)
+ USDA: 1762.13
+ violinID:2016;2017
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 1762.1H)
+ USDA: 1762.1H
+ violinID:2018;2019
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, LaSota Strain, Mass Type, Live Virus Vaccine (USDA: 1771.11)
+ USDA: 1771.11
+ violinID:2020;2021
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, LaSota Strain, Mass Type, Live Virus Vaccine (USDA: 1771.12)
+ USDA: 1771.12
+ violinID:2022;2023
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, LaSota Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 1771.14)
+ USDA: 1771.14
+ violinID:2024;2025
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, LaSota Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 1771.17)
+ USDA: 1771.17
+ violinID:2026;2027
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, LaSota Strain, Mass Type, Live Virus Vaccine (USDA: 1771.18)
+ USDA: 1771.18
+ violinID:2028;2029
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, LaSota Strain, Mass Type, Live Virus Vaccine (USDA: 1771.19)
+ USDA: 1771.19
+ violinID:2030;2031
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, LaSota Strain, Mass Type, Live Virus Vaccine (USDA: 1771.1A)
+ USDA: 1771.1A
+ violinID:2032;2033
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Mass Type, Killed Virus Vaccine (USDA: 1775.10)
+ USDA: 1775.10
+ violinID:2034;2035
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Mass Type, Killed Virus Vaccine (USDA: 1775.11)
+ USDA: 1775.11
+ violinID:2036;2037
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Mass Type, Killed Virus Vaccine (USDA: 1776.10)
+ USDA: 1776.10
+ violinID:2038;2039
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Mass & Ark Types, Killed Virus Vaccine (USDA: 1785.10)
+ USDA: 1785.10
+ violinID:2040;2041
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Mass Type, Killed Virus Vaccine (USDA: 1785.11)
+ USDA: 1785.11
+ violinID:2042;2043
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Mass & Ark Types, Killed Virus Vaccine (USDA: 1785.12)
+ USDA: 1785.12
+ violinID:2044;2045
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 1791.14)
+ USDA: 1791.14
+ violinID:2046;2047
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 1791.15)
+ USDA: 1791.15
+ violinID:2048;2049
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass Type, Live Virus Vaccine (USDA: 1791.19)
+ USDA: 1791.19
+ violinID:2050;2051
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Ark Types, Live Virus Vaccine (USDA: 1791.1X)
+ USDA: 1791.1X
+ violinID:2054;2055;2052;2053
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Ark Types, Live Virus Vaccine (USDA: 17A1.1M)
+ USDA: 17A1.1M
+ violinID:2056;2057
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Ark Types, Live Virus Vaccine (USDA: 17A1.1N)
+ USDA: 17A1.1N
+ violinID:2058;2059
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Ark Types, Live Virus Vaccine (USDA: 17A2.1M)
+ USDA: 17A2.1M
+ violinID:2060;2061
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, LaSota Strain, Mass & Conn Types Vaccine (USDA: 17B1.17)
+ USDA: 17B1.17
+ violinID:2062;2063
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis VG/GA Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 17V1.10)
+ USDA: 17V1.10
+ violinID:2064;2065
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis VG/GA Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 17V1.11)
+ USDA: 17V1.11
+ violinID:2066;2067
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Porcine Rotavirus-Transmissible Gastroenteritis Modified Live Virus Vaccine (USDA: 19H1.20)
+ USDA: 19H1.20
+ violinID:2106;2105
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, C2 Strain, Mass Type, Live Virus Vaccine (USDA: 1XB1.10)
+ USDA: 1XB1.10
+ violinID:2068;2069
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, C2 Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 1XC1.10)
+ USDA: 1XC1.10
+ violinID:2070;2071
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2 Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 4629.20)
+ USDA: 4629.20
+ violinID:2574;2576;2575
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2 Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract (USDA: 4629.27)
+ USDA: 4629.27
+ violinID:2572;2573;2571
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 4637.20)
+ USDA: 4637.20
+ violinID:2698;2697;2696;2700;2699
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 4637.22)
+ USDA: 4637.22
+ violinID:2704;2702;2705;2701;2703
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 4637.23)
+ USDA: 4637.23
+ violinID:2706;2708;2710;2707;2709
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract (USDA: 4637.29)
+ USDA: 4637.29
+ violinID:2672;2674;2671;2673;2675
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 4639.21)
+ USDA: 4639.21
+ violinID:2712;2714;2711;2713;2715
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 4639.22)
+ USDA: 4639.22
+ violinID:2716;2718;2720;2717;2719
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract (USDA: 4639.25)
+ USDA: 4639.25
+ violinID:2676;2678;2680;2677;2679
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract (USDA: 4639.27)
+ USDA: 4639.27
+ violinID:2688;2690;2686;2689;2687
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract (USDA: 4639.28)
+ USDA: 4639.28
+ violinID:2692;2694;2691;2693;2695
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus, Live Canarypox Vector Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 4639.R1)
+ USDA: 4639.R1
+ violinID:2722;2724;2721;2723;2725
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 4659.20)
+ USDA: 4659.20
+ violinID:2668;2670;2667;2669
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Borrelia Burgdorferi Bacterin-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract (USDA: 46B9.21)
+ USDA: 46B9.21
+ violinID:2590;2592;2594;2589;2591;2593;2595
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Killed Virus Vaccine-Leptospira Icterohaemorrhagiae Bacterial Extract (USDA: 46D5.27)
+ USDA: 46D5.27
+ violinID:1154;1159
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Killed Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 46E5.20)
+ USDA: 46E5.20
+ violinID:1153;1158
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Killed Virus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract (USDA: 46E5.21)
+ USDA: 46E5.21
+ violinID:1145;1144
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Killed Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract (USDA: 46E5.23)
+ USDA: 46E5.23
+ violinID:1150;1151
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Killed Virus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract (USDA: 46E5.24)
+ USDA: 46E5.24
+ violinID:1147;1149
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Killed Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract (USDA: 46E5.25)
+ USDA: 46E5.25
+ violinID:1152;1146
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 46J7.20)
+ USDA: 46J7.20
+ violinID:2632;2634;2636;2633;2635;2637
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 46J7.22)
+ USDA: 46J7.22
+ violinID:2640;2642;2638;2639;2641;2643
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 46J8.20)
+ USDA: 46J8.20
+ violinID:2726;2728;2730;2727;2729
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 46J9.20)
+ USDA: 46J9.20
+ violinID:2644;2646;2648;2645;2647;2649
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract (USDA: 46J9.21)
+ USDA: 46J9.21
+ violinID:2614;2616;2618;2615;2617;2619
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract (USDA: 46J9.25)
+ USDA: 46J9.25
+ violinID:2596;2598;2600;2597;2599;2601
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract (USDA: 46J9.26)
+ USDA: 46J9.26
+ violinID:2622;2624;2620;2623;2625;2621
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract (USDA: 46J9.27)
+ USDA: 46J9.27
+ violinID:2626;2628;2630;2627;2629;2631
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract (USDA: 46J9.29)
+ USDA: 46J9.29
+ violinID:2606;2602;2604;2607;2603;2605
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live Virus, Live Canarypox Vector Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 46J9.R1)
+ USDA: 46J9.R1
+ violinID:2650;2652;2654;2655;2651;2653
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Icterohaemorrhagiae Bacterial Extract (USDA: 46L9.27)
+ USDA: 46L9.27
+ violinID:2656;2658;2660;2657;2659;2661
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Icterohaemorrhagiae Bacterial Extract (USDA: 46P9.27)
+ USDA: 46P9.27
+ violinID:2662;2664;2666;2663;2665
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Coronavirus Killed Virus Vaccine-Borrelia Burgdorferi Bacterin (USDA: 47A5.20)
+ USDA: 47A5.20
+ violinID:1137;1136
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Borrelia Burgdorferi Bacterin (USDA: 47C5.20)
+ USDA: 47C5.20
+ violinID:2578;2580;2582;2577;2579;2581
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Borrelia Burgdorferi Bacterin (USDA: 47C5.29)
+ USDA: 47C5.29
+ violinID:2584;2586;2588;2583;2585;2587
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Killed Virus Vaccine-Borrelia Burgdorferi Bacterin-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract (USDA: 47E5.20)
+ USDA: 47E5.20
+ violinID:1140;1142;1143
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Killed Virus Vaccine-Borrelia Burgdorferi Bacterin-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract (USDA: 47E5.21)
+ USDA: 47E5.21
+ violinID:1139;1138;1141
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterin (USDA: 47K1.20)
+ USDA: 47K1.20
+ violinID:2682;2684;2681;2683;2685
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterin (USDA: 47L9.20)
+ USDA: 47L9.20
+ violinID:2608;2610;2612;2609;2611;2613
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Mass Type, Killed Virus Vaccine-Mycoplasma Gallisepticum Bacterin (USDA: 48B5.10)
+ USDA: 48B5.10
+ violinID:2912;2911;2913
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Mass Type, Killed Virus Vaccine-Mycoplasma Gallisepticum Bacterin (USDA: 48B6.10)
+ USDA: 48B6.10
+ violinID:2914;2916;2915
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Mass Type, Killed Virus Vaccine-Salmonella Enteritidis Bacterin (USDA: 48D6.10)
+ USDA: 48D6.10
+ violinID:2918;2919;2917
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle Disease-Bronchitis Mass & Ark Types, Killed Virus Vaccine-Salmonella Enteritidis Bacterin (USDA: 48D7.10)
+ USDA: 48D7.10
+ violinID:2906;2905;2907
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle Disease-Bronchitis Mass & Ark Types, Killed Virus Vaccine-Salmonella Enteritidis Bacterin (USDA: 48D7.11)
+ USDA: 48D7.11
+ violinID:2908;2910;2909
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Porcine Rotavirus-Transmissible Gastroenteritis Modified Live Virus Vaccine-Clostridium Perfringens Type C-Escherichia Coli Bacterin-Toxoid (USDA: 49B1.21)
+ USDA: 49B1.21
+ violinID:3004;3006;3003;3005
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Porcine Rotavirus-Transmissible Gastroenteritis Modified Live Virus Vaccine-Escherichia Coli Bacterin (USDA: 49P1.20)
+ USDA: 49P1.20
+ violinID:3008;3007;3009
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Porcine Rotavirus-Transmissible Gastroenteritis Modified Live Virus Vaccine-Bordetella Bronchiseptica-Clostridium Perfringens Type C-Erysipelothrix Rhusiopathiae-Escherichia Coli-Pasteurella Multocida Bacterin-Toxoid (USDA: 49T9.21)
+ USDA: 49T9.21
+ violinID:3002;2996;2998;3000;2997;2999;3001
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ chicken bursal disease-Newcastle disease vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Vaccine-Clostridium Perfringens Type C-Escherichia Coli Bacterin-Toxoid
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Vaccine-Clostridium Perfringens Types C & D-Escherichia Coli Bacterin-Toxoid
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Vaccine-Escherichia Coli Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Vaccine
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Vaccine-Borrelia Burgdorferi Bacterin-Leptospira Canicola-GrippotyphosaIcterohaemorrhagiae-Pomona Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Vaccine-Borrelia Burgdorferi Bacterin-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Vaccine-Leptospira Icterohaemorrhagiae Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Vaccine-Borrelia Burgdorferi Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus-Parvovirus Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2 Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Vaccine
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2 Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2 Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Vaccine-Borrelia Burgdorferi Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Vaccine-Borrelia Burgdorferi Bacterin-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterin
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Vaccine-Leptospira Icterohaemorrhagiae Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parvovirus Vaccine-Leptospira Icterohaemorrhagiae Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Vaccine-Leptospira CanicolaGrippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Vaccine-Leptospira CanicolaGrippotyphosa-Icterohaemorrhagiae-Pomona Bacterin
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Parvovirus Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle Disease-Bronchitis Vaccine-Salmonella Enteritidis Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Vaccine-Mycoplasma Gallisepticum Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Porcine Rotavirus-Transmissible Gastroenteritis Vaccine-Bordetella Bronchiseptica-Clostridium Perfringens Type C-Erysipelothrix Rhusiopathiae-Escherichia Coli-Pasteurella Multocida Bacterin-Toxoid
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Porcine Rotavirus-Transmissible Gastroenteritis Vaccine-Clostridium Perfringens Type C-Escherichia Coli Bacterin-Toxoid
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Porcine Rotavirus-Transmissible Gastroenteritis Vaccine-Escherichia Coli Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Porcine Rotavirus Vaccine-Clostridium Perfringens Type C-Escherichia Coli Bacterin-Toxoid
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Porcine Rotavirus Vaccine-Escherichia Coli Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Porcine Rotavirus-Transmissible Gastroenteritis Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Coronavirus-Parvovirus Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Icterohaemorrhagiae Bacterial Extract (USDA: 46L9.20)
+ USDA: 46L9.20
+
+
+
+
+
+
+
+
+ Rebecca Racz, Yongqun He
+
+ VO:0002962
+ VO:0002963
+ vaccine
+ A 3abc deletion mutant in Feline infectious peritonitis virus (FIPV) was attenuated and provided protection against virulent FIPV strain 79-1146 challenge in kittens
+ Feline infectiour peritonitis virus 3abc mutant vaccine
+
+
+
+
+
+
+
+
+ Rebecca Racz, Yongqun He
+
+ VO:0002965
+ vaccine
+ A 7ab deletion mutant in Feline infectious peritonitis virus is attenuated and provides protection against virulent FIPV strain 79-1146 challenge in kittens
+ Feline infectious peritonitis virus 7ab mutant vaccine
+
+
+
+
+
+
+
+
+ Rebecca Racz, Yongqun He
+
+ vaccine
+ An E mutant is attenuated in hamsters and induces significant protection from challenge with wild type SARS
+ SARS-CoV E gene mutant vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A vaccine that is used against an infection by a pathogen under Spirochaetes.
+ vaccine against Spirochaetes
+ https://en.wikipedia.org/wiki/Spirochaete
+
+ vaccine
+ Spirochaetes vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A vaccine that is used against an infection by a pathogen under Borreliella.
+ vaccine against Borreliella
+ https://en.wikipedia.org/wiki/Borrelia
+
+ vaccine
+ Borreliella vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ Kallan Roan, Oliver He
+
+ vaccine
+ Proteobacteria vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ vaccine
+ Gammaproteobacteria vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A vaccine that is used against an infection by a pathogen under Reoviridae.
+ vaccine against Reoviridae
+ https://en.wikipedia.org/wiki/Reoviridae
+
+ vaccine
+ Reoviridae vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A vaccine that is used against an infection by a pathogen under Sedoreovirinae.
+ vaccine against Sedoreovirinae
+ https://en.wikipedia.org/wiki/Sedoreovirinae
+
+ vaccine
+ Sedoreovirinae vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A vaccine that is used against an infection by a pathogen under Morbillivirus.
+ vaccine against Morbillivirus
+ https://en.wikipedia.org/wiki/Morbillivirus
+
+ vaccine
+ Morbillivirus vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ vaccine
+ Enterobacterales vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ vaccine
+ Enterobacteriaceae vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ vaccine
+ Spirochaetia vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ vaccine
+ Firmicutes vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ RS, NF, YH
+
+ vaccine
+ IBV DNA vaccine pVAX1-16S1/M/N
+ violinID: 3889
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ RS, NF, YH
+
+ vaccine
+ IBV DNA vaccine pVAX1-N
+ violinID: 3938
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ RS, NF, YH
+
+ vaccine
+ IBV DNA vaccine pVAX-S1 with GM-CSF adjuvant
+ violinID: 3939
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ RS, NF, YH
- ISS 1018 is a short, synthetic, unmethylated CpG oligodeoxynucleotide (CpG ODN) with immunostimulatory activity. ISS 1018 signals through Toll-like receptor 9 (TLR9) to induce the production of immunoglobulin by B cells and interferon (IFN) -alpha, IFN-beta, interleukin-12 (IL-12), and tumor necrosis factor - alpha (TNF-alpha) by plasmacytoid dendritic cells (pDC). ISS 1018 CpG ODN promotes antigen presentation and co-stimulatory molecule expression. ISS 1018 is currently being investigated in combination with HBsAg vaccine as a prophylactic treatment for to prevent Hepatitis B in adults. It is also being investigated in combination with rituximab for treatment of b-cell or non-hodgkin's lymphoma.
- ISS 1018 CpG ODN vaccine adjuvant
- DrugBank Accession number: DB05463
+ vaccine
+ Infectious Bronchitis Virus DNA Vaccine encoding S1, N, and M
+ violinID: 3941
@@ -804972,6 +814558,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=4160
https://pubmed.ncbi.nlm.nih.gov/18708674/
+ vaccine
RBD-rAAV-SARS-CoV
violinID: 4160
@@ -804992,6 +814579,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=4161
https://pubmed.ncbi.nlm.nih.gov/18289745/
+ vaccine
RBD-rAAV-SARS-CoV prime/RBD-specific T cell peptide boost
violinID: 4161
@@ -805010,12 +814598,32 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
RS, NF, YH
+ vaccine
rMV- SARS-CoV -S/Ssol
violinID: 4196
+
+
+
+
+
+
+
+
+
+
+ RS, NF, YH
+
+ vaccine
+ Ac-CMV-S1 (infectious bronchitis virus)
+ violinID: 4242
+
+
+
+
@@ -805035,7 +814643,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A vaccine against coronavirus infection
Hong Yu, Oliver He
- coronavirus vaccine
+ vaccine
+ coronavirus vaccine
@@ -805058,7 +814667,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
MERS-CoV vaccine
- MERS vaccine
+ vaccine
+ MERS vaccine
@@ -805073,22 +814683,10 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
-
-
-
-
-
-
-
https://www.ncbi.nlm.nih.gov/pmc/articles/PMC5884803/
- MERS-CoV S protein with alum and CpG adjuvant
+ vaccine
+ MERS-CoV S protein with alum and CpG adjuvant
@@ -805109,7 +814707,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- MERS-CoV protein
+ protein
+ MERS-CoV protein
@@ -805119,7 +814718,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- MERS-CoV S protein
+ protein
+ MERS-CoV S protein
@@ -805127,7 +814727,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
+
@@ -805146,7 +814746,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
https://en.wikipedia.org/wiki/COVID-19_vaccine
https://www.fda.gov/emergency-preparedness-and-response/coronavirus-disease-2019-covid-19/covid-19-vaccines
- COVID-19 vaccine
+ vaccine
+ COVID-19 vaccine
@@ -805187,7 +814788,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A SARS-CoV-2 RNA vaccine formed from a lipid nanoparticle-formulated trimerized SARS-CoV-2 receptor-binding domain
Philip Huang, Rohit Goru, Oliver He
- BNT162b2
+ BNT162b2
PF-07302048
Tozinameran
PubMed: 32839784
@@ -805197,6 +814798,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
https://www.fda.gov/emergency-preparedness-and-response/coronavirus-disease-2019-covid-19/pfizer-biontech-covid-19-vaccine
https://www.fda.gov/media/144246/download
+ vaccine
Comirnaty
@@ -805219,37 +814821,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Oliver He, Philip Huang
- SARS-CoV-2 protein
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- Replaced term with S protein of SARS-CoV-2 Wuhan strain (PR_P0DTC2) for ontology harmonization
- Anthony Huffman
-
- S protein of SARS-CoV-2
- true
+ protein
+ SARS-CoV-2 protein
@@ -805259,7 +814832,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- E protein of SARS-CoV-2
+ protein
+ E protein of SARS-CoV-2
@@ -805299,7 +814873,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
https://en.wikipedia.org/wiki/BBV152
https://go.drugbank.com/drugs/DB15847
- COVAXIN
+ vaccine
+ COVAXIN
@@ -805308,12 +814883,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
@@ -805330,7 +814899,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04636697
- CoVLP
+ vaccine
+ CoVLP
@@ -805379,7 +814949,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04405908
- SCB-2019
+ vaccine
+ SCB-2019
@@ -805416,7 +814987,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04545749
- UB-612
+ vaccine
+ UB-612
@@ -805447,7 +815019,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04666012
- AdCLD-CoV19
+ vaccine
+ AdCLD-CoV19
@@ -805484,7 +815057,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
https://www.akstonbio.com/programs/covid-19-vaccine/
- AKS-452
+ vaccine
+ AKS-452
@@ -805515,7 +815089,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04386252
- AV-COVID-19
+ vaccine
+ AV-COVID-19
@@ -805546,7 +815121,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
https://www.biologicale.com/news.html
- Corbevax
+ vaccine
+ Corbevax
@@ -805554,7 +815130,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
@@ -805568,12 +815143,13 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A SARS-CoV-2 protein subunit vaccine based on recombinant RBD subunits manufactured by the Center for Genetic Engineering and Biotechnology (CIGB).
+ An authorized SARS-CoV-2 protein subunit vaccine based on recombinant RBD subunits manufactured by the Center for Genetic Engineering and Biotechnology (CIGB).
Philip Huang
CIGB-66
https://rpcec.sld.cu/en/trials/RPCEC00000345-En
- Abdala
+ vaccine
+ Abdala
@@ -805598,7 +815174,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
https://rpcec.sld.cu/en/trials/RPCEC00000345-En
- CIGB-669
+ vaccine
+ CIGB-669
@@ -805631,277 +815208,196 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A SARS-CoV-2 inactivated virus vaccine by Shenzhen Kangtai Biological Products and Beijing Minhai Biotechnology Co.
- Philip Huang, Oliver He
- NCT04852705
- http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
-
- KCONVAC
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- A stabilised pre-fusion SARS-CoV-2 spike protein vaccine produced in a baculovirus expression system and manufactured by Sanofi Pasteur and GlaxoSmithKline
- Philip Huang
- CoV2 preS dTM
- PubMed ID: 33887209
-
- VAT00002
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- An influenza virus vector SARS-CoV-2 vaccine administered as an intranasal spray manufactured by University of Hong Kong, Xiamen University, and Beijing Wantai Biological Pharmacy.
- Philip Huang
- http://www.chictr.org.cn/showprojen.aspx?proj=55421
-
- DelNS1-2019-nCoV-RBD-OPT1
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- A SARS-CoV-2 protein subunit vaccine that relies on chemically synthesized peptide antigens of SARS-CoV-2 proteins, conjugated to a carrier protein and adsorbed on an aluminum-containing adjuvant (aluminum hydroxide).
- Philip Huang
- NCT04527575
- http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
-
- EpiVacCorona
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- A SARS-CoV-2 plasmid DNA vaccine developed by GeneOne Life Science.
- Philip Huang
- NCT04673149
-
- GLS-5310
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- A rVSV-SARS-CoV-2-S vaccine developed by the Israel Institute for Biological Research (IIBR)
- Philip Huang
- Brilife
- NCT04608305
-
- IIBR-100
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- A SARS-CoV-2 recombinant vector vaccine by Shenzhen Geno-Immune Medical Institute
- Philip Huang
- NCT04276896
-
- LV-SMENP-DC
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- A SARS-CoV-2 subunit vaccine with recombinant SARS-CoV-2 spike (S) protein and aluminum phosphate adjuvant
- Philip Huang
- NCT04683484
-
- Nanocovax
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- A SARS-CoV-2 inactivated vaccine manufactured by the Research Institute for Biological Safety Problems (Republic of Kazakhstan)
+ A SARS-CoV-2 inactivated virus vaccine by Shenzhen Kangtai Biological Products and Beijing Minhai Biotechnology Co.
+ Philip Huang, Oliver He
+ NCT04852705
+ http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
+
+ vaccine
+ KCONVAC
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A stabilised pre-fusion SARS-CoV-2 spike protein vaccine produced in a baculovirus expression system and manufactured by Sanofi Pasteur and GlaxoSmithKline
Philip Huang
- QazCovid-in
- NCT04691908
+ CoV2 preS dTM
+ PubMed ID: 33887209
+
+ vaccine
+ VAT00002
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ An influenza virus vector SARS-CoV-2 vaccine administered as an intranasal spray manufactured by University of Hong Kong, Xiamen University, and Beijing Wantai Biological Pharmacy.
+ Philip Huang
+ http://www.chictr.org.cn/showprojen.aspx?proj=55421
+
+ vaccine
+ DelNS1-2019-nCoV-RBD-OPT1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A SARS-CoV-2 protein subunit vaccine that relies on chemically synthesized peptide antigens of SARS-CoV-2 proteins, conjugated to a carrier protein and adsorbed on an aluminum-containing adjuvant (aluminum hydroxide).
+ Philip Huang
+ NCT04527575
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
- QazVac
+ vaccine
+ EpiVacCorona
-
+
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A SARS-CoV-2 plasmid DNA vaccine developed by GeneOne Life Science.
+ Philip Huang
+ NCT04673149
+
+ vaccine
+ GLS-5310
+
+
+
+
+
+
+
+
-
+
-
-
+
+
+
+
+
+
+
+
+
+
+ A rVSV-SARS-CoV-2-S vaccine developed by the Israel Institute for Biological Research (IIBR)
+ Philip Huang
+ Brilife
+ NCT04608305
+
+ vaccine
+ IIBR-100
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A SARS-CoV-2 recombinant vector vaccine by Shenzhen Geno-Immune Medical Institute
+ Philip Huang
+ NCT04276896
+
+ vaccine
+ LV-SMENP-DC
+
+
+
+
+
+
+
+
+
+
+
+
@@ -805916,11 +815412,78 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+ A SARS-CoV-2 subunit vaccine with recombinant SARS-CoV-2 spike (S) protein and aluminum phosphate adjuvant
+ Philip Huang
+ NCT04683484
+
+ vaccine
+ Nanocovax
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A SARS-CoV-2 inactivated vaccine manufactured by the Research Institute for Biological Safety Problems (Republic of Kazakhstan)
+ Philip Huang
+ QazCovid-in
+ NCT04691908
+ http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
+
+ vaccine
+ QazVac
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
A SARS-CoV-2 virus-like particle vaccine that contains the Receptor Binding Domain (RBD) of the SARS-CoV-2 spike (S) protein and is adjuvanted with aluminum.
Philip Huang
ACTRN12620001308987
- RBD-HBsAg VLP
+ vaccine
+ RBD-HBsAg VLP
@@ -805945,7 +815508,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04640402
- Recombinant SARS-CoV-2 vaccine (Sf9 cell)
+ vaccine
+ Recombinant SARS-CoV-2 vaccine (Sf9 cell)
@@ -805967,10 +815531,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
- A SARS-CoV-2 recombinant protein vaccine that uses the Baculovirus expression vector system
+ A SARS-CoV-2 recombinant protein vaccine that uses the Baculovirus expression vector system
https://www.shionogi.com/content/dam/shionogi/global/news/pdf/2020/12/e-201216.pdf
- S-268019
+ vaccine
+ S-268019
@@ -805978,7 +815543,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
@@ -805994,9 +815558,10 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A SARS-CoV-2 subunit vaccine developed by Finlay Vaccine Institute (IFV)
Philip Huang
- FINLAY-FR-2
+ FINLAY-FR-2
https://rpcec.sld.cu/en/trials/RPCEC00000347-En
+ vaccine
Soberana 02
@@ -806022,7 +815587,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang, Oliver He
https://www.merck.com/news/merck-discontinues-development-of-sars-cov-2-covid-19-vaccine-candidates-continues-development-of-two-investigational-therapeutic-candidates/
- V591
+ vaccine
+ V591
@@ -806037,18 +815603,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
-
-
-
-
-
-
@@ -806067,11 +815621,12 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A SARS-CoV-2 inactivated, Vero-cell based vaccine adjuvanted with aluminum and CpG 1018. It uses the manufacturing platform of Valneva’s commercial Japanese encephalitis (JE) vaccine
+ A SARS-CoV-2 inactivated, Vero-cell based vaccine adjuvanted with aluminum and CpG 1018. It uses the manufacturing platform of Valneva’s commercial Japanese encephalitis (JE) vaccine
Philip Huang
https://valneva.com/research-development/covid-19-vla2001/
- VLA2001
+ vaccine
+ VLA2001
@@ -806080,10 +815635,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- 'A SARS DNA vaccine that is made from recombinant plasmid containing nucleocapsid protein (N) sequence constructed then expressed and purified from E. coli bacteria’
+ 'A SARS DNA vaccine that is made from recombinant plasmid containing nucleocapsid protein (N) sequence constructed then expressed and purified from E. coli bacteria’
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5732
+ vaccine
PubMed ID:16423399
SARS N protein DNA vaccine
VIOLIN ID: 5732
@@ -806095,10 +815651,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- 'A SARS DNA combination vaccine that is made from recombinant plasmids’ containing membrane protein (M) and nucleocapsid protein (N) sequences constructed then expressed and purified from E. coli bacteria’
+ 'A SARS DNA combination vaccine that is made from recombinant plasmids’ containing membrane protein (M) and nucleocapsid protein (N) sequences constructed then expressed and purified from E. coli bacteria’
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5733
+ vaccine
PubMed ID:16423399
SARS N + SARS M DNA vaccine
VIOLIN ID: 5733
@@ -806110,10 +815667,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- 'A SARS DNA vaccine that is made from recombinant plasmid containing membrane protein (M) sequence constructed then expressed and purified from E. coli bacteria’
+ 'A SARS DNA vaccine that is made from recombinant plasmid containing membrane protein (M) sequence constructed then expressed and purified from E. coli bacteria’
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5731
+ vaccine
PubMed ID:16423399
SARS M protein DNA vaccine
VIOLIN ID: 5731
@@ -806125,10 +815683,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- 'A SARS DNA vaccine that is made from oral live-attenuated auxotrophic S. typhimurium aroA strain SL7207 that contained CTLA4HingeSARS800 with SARS-CoV S protein‘
+ 'A SARS DNA vaccine that is made from oral live-attenuated auxotrophic S. typhimurium aroA strain SL7207 that contained CTLA4HingeSARS800 with SARS-CoV S protein‘
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5738
+ vaccine
PubMed ID:15993989
Salmonella-CTLA4-S SARS DNA vaccine
VIOLIN ID: 5738
@@ -806139,6 +815698,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+
@@ -806150,6 +815710,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5734
+ vaccine
PubMed ID:15993989
Recombinant SARS spike polypeptide vaccine
VIOLIN ID: 5734
@@ -806165,6 +815726,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5737
+ vaccine
PubMed ID:15993989
SARS CTLA4-S DNA vaccine
VIOLIN ID: 5737
@@ -806180,6 +815742,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5736
+ vaccine
PubMed ID:15993989
SARS tPA-S DNA vaccine
VIOLIN ID: 5736
@@ -806195,6 +815758,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5739
+ vaccine
PubMed ID:15993989
Salmonella-tPA-S SARS DNA vaccine
VIOLIN ID: 5739
@@ -806210,6 +815774,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5729
+ vaccine
PubMed ID:23142821
SARS MA-ExoN vaccine
VIOLIN ID: 5729
@@ -806221,10 +815786,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A SARS recombinant vector vaccine that is made from recombinant MA15 virulent mouse-adapted SARS-CoV (MA15) background of E-deleted vaccine candidate (rMA15-ΔE)
+ A SARS recombinant vector vaccine that is made from recombinant MA15 virulent mouse-adapted SARS-CoV (MA15) background of E-deleted vaccine candidate (rMA15-ΔE)
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5728
+ vaccine
PubMed ID:16423399
SARS rMA15-ΔE vaccine
VIOLIN ID: 5728
@@ -806240,6 +815806,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5726
+ vaccine
PubMed ID:15708987
SARS ADS-MVA vaccine
VIOLIN ID: 5726
@@ -806251,16 +815818,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
A MERS subunit vaccine that has a combined adjuvant of aluminum hydroxide and CpG oligodeoxynucleotides.
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5714
+ vaccine
PubMed ID:29618723
MERS-CoV S vaccine adjuvanted with CpG and Alum
VIOLIN ID: 5714
@@ -806282,6 +815844,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5721
+ vaccine
PubMed ID:29618723
Inactivated whole MERS-CoV (IV) vaccine with CpG and Alum
VIOLIN ID: 5721
@@ -806297,6 +815860,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5725
+ vaccine
PubMed ID:15096611
SARS MVA/S vaccine
VIOLIN ID: 5725
@@ -806318,6 +815882,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5730
+ vaccine
PubMed ID:16476986
β-propiolactone-inactivated SARS-CoV vaccine
VIOLIN ID: 5730
@@ -806333,6 +815898,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5727
+ vaccine
PubMed ID:16476986
SARS Ad S/N vaccine
VIOLIN ID: 5727
@@ -806354,6 +815920,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5719
+ vaccine
PubMed ID:25192975
Ad5.MERS-S1 vaccine
VIOLIN ID: 5719
@@ -806375,6 +815942,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5720
+ vaccine
PubMed ID:25192975
Ad5.MERS-S vaccine
VIOLIN ID: 5720
@@ -806390,6 +815958,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5715
+ vaccine
PubMed ID:26218507
MERS England1 S1 protein subunit Vaccine
VIOLIN ID: 5715
@@ -806405,6 +815974,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5717
+ vaccine
PubMed ID:26218507
MERS England1 S DNA + England1 S protein subunit vaccine
VIOLIN ID: 5717
@@ -806420,6 +815990,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5716
+ vaccine
PubMed ID:26218507
MERS England1 S DNA Vaccine
VIOLIN ID: 5716
@@ -806435,6 +816006,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5723
+ vaccine
PubMed ID:28536429
MERS rRBD plus alum vaccine
VIOLIN ID: 5723
@@ -806450,6 +816022,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5718
+ vaccine
PubMed ID:28314561
MERS-CoV pcDNA3.1-S1 DNA vaccine
VIOLIN ID: 5718
@@ -806461,10 +816034,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A MERS recombinant vector virus made from chimeric virus based on the vesicular stomatitis virus (VSV) in which the G gene was replaced by MERS-CoV S gene (VSVΔG-MERS).
+ A MERS recombinant vector virus made from chimeric virus based on the vesicular stomatitis virus (VSV) in which the G gene was replaced by MERS-CoV S gene (VSVΔG-MERS).
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5722
+ vaccine
PubMed ID:29246504
VSVΔG-MERS vaccine
VIOLIN ID: 5722
@@ -806480,6 +816054,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5724
+ vaccine
PubMed ID:28536429
MERS rNTD vaccine
VIOLIN ID: 5724
@@ -806501,6 +816076,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5742
+ vaccine
PubMed ID:22536382
inactivated whole (formalin and UV radiation) SARS-CoV vaccine
VIOLIN ID: 5742
@@ -806511,6 +816087,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+
@@ -806518,10 +816095,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A SARS DNA vaccine made from rDNA-expressed ectodomain of the S protein.
+ A recombinant SARS DNA vaccine made from rDNA-expressed ectodomain of the S protein.
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5743
+ vaccine
PubMed ID:22536382
recombinant SARS DNA spike protein vaccine
VIOLIN ID: 5743
@@ -806537,8 +816115,9 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5747
+ vaccine
PubMed ID:22536382
- Viral-like-particle S-MHV SARS vaccine
+ Viral-like-particle S-MHV SARS vaccine
VIOLIN ID: 5747
@@ -806558,6 +816137,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5741
+ vaccine
PubMed ID:22536382
UV-Inactivated SARS + TLR agonist vaccine
VIOLIN ID: 5741
@@ -806579,6 +816159,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5740
+ vaccine
PubMed ID:22536382
UV-Inactivated SARS vaccine
VIOLIN ID: 5740
@@ -806594,6 +816175,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5748
+ vaccine
PubMed ID:26954467
VRP-MERS-N vaccine
VIOLIN ID: 5748
@@ -806609,6 +816191,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5749
+ vaccine
PubMed ID:26954467
VRP-SARS-N vaccine
VIOLIN ID: 5749
@@ -806624,6 +816207,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5750
+ vaccine
PubMed ID:26954467
rVV-SARS vaccine
VIOLIN ID: 5750
@@ -806639,6 +816223,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5757
+ vaccine
PubMed ID:26355094
MVvac2-MERS-S(H) vaccine
VIOLIN ID: 5757
@@ -806654,6 +816239,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5760
+ vaccine
PubMed ID:29902727
MVvac2-MERS-N vaccine
VIOLIN ID: 5760
@@ -806671,10 +816257,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A MERS recombinant vector made of Chimpanzee adenovirus Oxford 1 vector expressing S protein from MERS-CoV’
+ A MERS recombinant vector made of Chimpanzee adenovirus Oxford 1 vector expressing S protein from MERS-CoV’
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5751
+ vaccine
PubMed ID:29263883
ChAdOx1-MERS-S vaccine
VIOLIN ID: 5751
@@ -806686,10 +816273,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A MERS recombinant vector made of Adenovirus type 41 used as vector for MERS-CoV S protein.’
+ A MERS recombinant vector made of Adenovirus type 41 used as vector for MERS-CoV S protein.’
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5760
+ vaccine
PubMed ID:25762305
Ad41.MERS vaccine
VIOLIN ID: 5760
@@ -806705,6 +816293,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5758
+ vaccine
PubMed ID:23986586
MVA-MERS vaccine
VIOLIN ID: 5758
@@ -806720,6 +816309,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5753
+ vaccine
PubMed ID:15078946
CRT-N SARS vaccine
VIOLIN ID: 5753
@@ -806735,8 +816325,9 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=3155
+ vaccine
PubMed ID:18463152
- rSARS-CoV-ΔE vaccine
+ rSARS-CoV-ΔE vaccine
VIOLIN ID: 3155
@@ -806750,6 +816341,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5759
+ vaccine
PubMed ID:26355094
MVvac2-MERS-solS vaccine
VIOLIN ID: 5759
@@ -806792,6 +816384,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
https://en.wikipedia.org/wiki/CoronaVac
+ vaccine
PubMed ID:32376603
CoronaVac
VIOLIN ID: 5761
@@ -806809,12 +816402,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
@@ -806838,6 +816425,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5764
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
+ vaccine
ZF2001
VIOLIN ID: 5764
@@ -806882,6 +816470,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman, Philip Huang
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5771
+ vaccine
PubMed ID:32647131
LNP-nCoVsaRNA
VIOLIN ID: 5771
@@ -806893,12 +816482,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
@@ -806917,12 +816500,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
@@ -806930,11 +816507,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A SARS-CoV-2 vaccine made from a recombinant adinvorius type-5 expressing SARS-CoV-2 S protein.
- A SARS-CoV-2 vaccine made of self-coding RNA encoding SARS-CoV-2 spike protein encapsulated within a lipid nanoparticle.
Anthony Huffman, Philip Huang
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5768
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
+ vaccine
PubMed ID:32450106
Ad5-nCoV
VIOLIN ID: 5768
@@ -806962,6 +816539,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5769
+ vaccine
PubMed ID:32450106
MERS GLS-5300 vaccine
VIOLIN ID: 5769
@@ -806983,6 +816561,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5770
+ vaccine
PubMed ID:18824060
VRC-SRSDNA015-00-VP vaccine
VIOLIN ID: 5770
@@ -807004,6 +816583,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5766
+ vaccine
PubMed ID:17535926
SARS NDV-BC/S vaccine
VIOLIN ID: 5766
@@ -807025,6 +816605,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5767
+ vaccine
PubMed ID:17535926
SARS NDV-VF/S vaccine
VIOLIN ID: 5767
@@ -807037,9 +816618,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A SARS DNA vaccine made from rDNA-expressed ectodomain of the S protein.
+ JZ: may be same as VO:0005126
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5745
+ vaccine
PubMed ID:16497416
rDNA-expressed S SARS protein vaccine
VIOLIN ID: 5745
@@ -807061,6 +816644,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5762
+ vaccine
PubMed ID:18346823
rMV-S + rMV-N vaccine
VIOLIN ID: 5762
@@ -807082,8 +816666,9 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5763
+ vaccine
PubMed ID:22536382
- SARS-CoV Baculovirus S protein Vaccine
+ SARS-CoV Baculovirus S protein Vaccine
VIOLIN ID: 5763
@@ -807103,6 +816688,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5752
+ vaccine
PubMed ID:32325037
MVA-MERS-S vaccine
VIOLIN ID: 5752
@@ -807130,7 +816716,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
https://altimmune.com/adcovid/
- AdCOVID
+ vaccine
+ AdCOVID
@@ -807148,7 +816735,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A plasmid pCI-N, encoding the full-length N gene of SARS-CoV, was constructed and expressed in Escherichia coli DH5alpha
[PubMed: 15582659]
- SARS-CoV pCI-N DNA vaccine
+ vaccine
+ SARS-CoV pCI-N DNA vaccine
VIOLIN ID: 5735
@@ -807170,12 +816758,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
@@ -807193,6 +816775,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Covovax
PubMed:32376603
+ vaccine
NVX-CoV2373
@@ -807224,6 +816807,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman, Philip Huang
NCT04758962
+ vaccine
CoV2 SAM
@@ -807268,6 +816852,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
https://www.cdc.gov/coronavirus/2019-ncov/vaccines/different-vaccines/Moderna.html
https://www.fda.gov/emergency-preparedness-and-response/coronavirus-disease-2019-covid-19/moderna-covid-19-vaccine
+ vaccine
Moderna COVID-19 vaccine
@@ -807277,12 +816862,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
@@ -807316,7 +816895,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
https://en.wikipedia.org/wiki/AZD1222
Covishield
- Oxford–AstraZeneca COVID-19 vaccine
+ vaccine
+ Oxford-AstraZeneca COVID-19 vaccine
violinID:2020-001072-15, 2020-001228-32, ISRCTN89951424
@@ -807377,6 +816957,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
PubMed:32731257
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
+ vaccine
Ad26.COV2.S
@@ -807415,6 +816996,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
PubMed:32789505
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
+ vaccine
WIBP-CorV
@@ -807446,6 +817028,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman, Philip Huang
PubMed:32795413
+ vaccine
ARCoV
@@ -807458,7 +817041,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
+
@@ -807477,6 +817060,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
PubMed:32800805
+ vaccine
ZyCoV-D
@@ -807530,6 +817114,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
https://en.wikipedia.org/wiki/Gam-COVID-Vac
Gam-COVID-Vac
+ vaccine
Sputnik V
@@ -807567,6 +817152,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman, Philip Huang
PubMed:32973505
+ vaccine
ARCT-021
@@ -807588,10 +817174,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A SARS-CoV-2 DNA vaccine developed by AnGes.
+ A SARS-CoV-2 DNA vaccine developed by AnGes, named as AG0301-COVID19.
Anthony Huffman
NCT04463472
+ vaccine
AG0301-COVID19
@@ -807632,6 +817219,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
https://en.wikipedia.org/wiki/BBIBP-CorV
https://go.drugbank.com/drugs/DB15807
+ vaccine
BBIBP-CorV
@@ -807640,7 +817228,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
@@ -807672,6 +817259,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
PubMed:32376603
Covidful
+ vaccine
Chinese Academy of Medical Sciences COVID-19 vaccine
@@ -807697,6 +817285,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman, Philip Huang
NCT04449276
+ vaccine
CVnCoV
@@ -807734,6 +817323,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman, Philip Huang
https://www.covidx.eu/grad-cov2
+ vaccine
GRAd-COV2
@@ -807759,6 +817349,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman, Philip Huang
NCT04445389
+ vaccine
GX-19
@@ -807793,11 +817384,12 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A SARS-CoV-2 subunit vaccine that is made of a protein subunit made of the RBD domain of the S protein.
+ Anthony Huffman
Philip Huang
PMID:32973505
- Anthony Huffman
- KBP-COVID-19
+ vaccine
+ KBP-COVID-19
@@ -807825,11 +817417,12 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A DNA vaccine that expresses S protein from the pGX9501 vector
+ Anthony Huffman
Philip Huang
PMID:32433465
- Anthony Huffman
- INO-4800
+ vaccine
+ INO-4800
@@ -807856,14 +817449,14 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A SARS-CoV-2 protein subunit vaccine developed by Adimmune Corporation.
- AdimrSC-2f is a candidate vaccine against COVID-19 developed by Adimmune Corporation (Adimmune). Using the baculovirus-insect cells expression system, the recombinant receptor binding domain (RBD) of SARS-CoV-2 spike (S) protein is amplified and purified. AdimrSC-2f is formulated in the different dosages of Spike (S) protein without/with aluminum content as adjuvant.
+ A SARS-CoV-2 protein subunit vaccine developed by Adimmune Corporation. AdimrSC-2f is a candidate vaccine against COVID-19 developed by Adimmune Corporation (Adimmune). Using the baculovirus-insect cells expression system, the recombinant receptor binding domain (RBD) of SARS-CoV-2 spike (S) protein is amplified and purified. AdimrSC-2f is formulated in the different dosages of Spike (S) protein without/with aluminum content as adjuvant.
Philip Huang, Oliver He
NCT04522089
https://go.drugbank.com/drugs/DB16436
https://www.smartpatients.com/trials/NCT04522089
- AdimrSC-2f
+ vaccine
+ AdimrSC-2f
@@ -807907,7 +817500,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
NCT04334980
https://www.symvivo.com/covid-19
- bacTRL-Spike
+ vaccine
+ bacTRL-Spike
@@ -807938,32 +817532,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04566276
- ChulaCov19
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- A synthetic modified vaccinia Ankara (MVA)-based SARS-CoV-2 vaccine
- Philip Huang
- NCT04639466
-
- COH04S1
+ vaccine
+ ChulaCov19
@@ -807972,10 +817542,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+ an adenovirus vaccine vector that uses a gorilla adenovirus.
+ Anthony Huffman
- Anthony Huffman
- gorilla adenovirus vector
- an adenovirus vaccine vector that uses a gorilla adenovirus.
+ vaccine component
+ gorilla adenovirus vector
@@ -807986,9 +817557,9 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
- adenovirus serotype 26 vaccine vector
+ vaccine component
+ adenovirus serotype 26 vaccine vector
NCBI Taxonomy ID: 46928
- an adenovirus vaccine vector that uses an Adenovirus serotype 26 strain.
@@ -807998,10 +817569,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A nanoparticle vector composed of lipids.
+ Anthony Huffman
PMID: 20402623
- Anthony Huffman
- lipid nanoparticle vector
+ vaccine component
+ lipid nanoparticle vector
@@ -808011,10 +817583,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A vaccine component composed of a synthetic component that is solid and spherical structures ranging to around 100 nm in size and prepared from natural or synthetic polymers.
+ Anthony Huffman
PMID: 22353619
- Anthony Huffman
- nanoparticle vector
+ vaccine component
+ nanoparticle vector
@@ -808026,7 +817599,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A chimpanzee adenovirus vaccine vector that patented by Oxford and derived from ChAd serotype Y25 that exchanges the native E4 orf4, orf6 and orf6/7 genes for those from HAdV-C5
PMID: 29527232
- chimpanzee adenovirus Oxford1 vaccine vector
+ vaccine component
+ chimpanzee adenovirus Oxford1 vaccine vector
ChAdOx1
@@ -808058,7 +817632,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04627675
- CORVax12
+ vaccine
+ CORVax12
@@ -808083,7 +817658,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04299724
- COVID-19 aAPC vaccine
+ vaccine
+ COVID-19 aAPC vaccine
@@ -808115,7 +817691,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
NCT04813796
https://investors.modernatx.com/news-releases/news-release-details/first-participants-dosed-phase-1-study-evaluating-mrna-1283
- mRNA-1283
+ vaccine
+ mRNA-1283
@@ -808140,7 +817717,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04591184
- Covigenix VAX-001
+ vaccine
+ Covigenix VAX-001
@@ -808165,7 +817743,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04619628
- COVI-VAC
+ vaccine
+ COVI-VAC
@@ -808173,7 +817752,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
@@ -808201,9 +817779,10 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A SARS-CoV-2 inactivated vaccine developed by Health Institutes of Turkey
Philip Huang
- ERUCOV-VAC
+ ERUCOV-VAC
NCT04691947
+ vaccine
Turkovac
@@ -808241,7 +817820,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04591717
- hAd5-COVID-19
+ vaccine
+ hAd5-COVID-19
@@ -808266,7 +817846,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04546841
- IMP CoVac-1
+ vaccine
+ IMP CoVac-1
@@ -808297,7 +817878,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04569383
- MVA-SARS-2-S
+ vaccine
+ MVA-SARS-2-S
@@ -808312,12 +817894,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
@@ -808346,7 +817922,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04487210
- MVC-COV1901
+ vaccine
+ MVC-COV1901
@@ -808361,12 +817938,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
@@ -808384,7 +817955,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
SpikoGen
NCT04453852
- COVAX-19
+ vaccine
+ COVAX-19
@@ -808415,7 +817987,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04702178
- COVAC
+ vaccine
+ COVAC
@@ -808434,7 +818007,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang, Oliver He
https://www.merck.com/news/merck-discontinues-development-of-sars-cov-2-covid-19-vaccine-candidates-continues-development-of-two-investigational-therapeutic-candidates/
- V590
+ vaccine
+ V590
@@ -808459,7 +818033,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04563702
- VXA-CoV2-1
+ vaccine
+ VXA-CoV2-1
@@ -808468,12 +818043,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
@@ -808490,7 +818059,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04750343
- SKYCovione
+ vaccine
+ SKYCovione
@@ -808498,6 +818068,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+
@@ -808507,7 +818078,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang, Rohit Goru, Oliver He
- COVID-19 RNA vaccine
+ vaccine
+ COVID-19 RNA vaccine
@@ -808523,10 +818095,12 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+
Philip Huang, Rohit Goru, Oliver He
- COVID-19 recombinant vector vaccine
+ vaccine
+ COVID-19 recombinant vector vaccine
@@ -808537,7 +818111,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang, Rohit Goru, Oliver He
- COVID-19 recombinant adenoviral vector vaccine
+ vaccine
+ COVID-19 recombinant adenoviral vector vaccine
@@ -808548,7 +818123,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang, Rohit Goru, Oliver He
- COVID-19 inactivated vaccine
+ vaccine
+ COVID-19 inactivated vaccine
@@ -808556,6 +818132,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+
@@ -808565,7 +818142,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
- COVID-19 subunit vaccine
+ vaccine
+ COVID-19 subunit vaccine
@@ -808576,7 +818154,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
- COVID-19 DNA vaccine
+ vaccine
+ COVID-19 DNA vaccine
@@ -808587,7 +818166,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
- COVID-19 live, attenuated vaccine
+ vaccine
+ COVID-19 live, attenuated vaccine
@@ -808598,117 +818178,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
- COVID-19 virus-like particle vaccine
-
-
-
-
-
-
-
-
- A vaccine adjuvant comprised of 40 nm nanoparticles composed of Quillaja saponins, cholesterol and phospholipid.
- Philip Huang
- PMID: 22844480
-
- Matrix-M vaccine adjuvant
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- A polysaccharide adjuvant derived from delta inulin
- Chemical Nature: Carbohydrate
-Mechanism of Action: Complement, Dendritic cells (unknown receptor), Other, Unknown
-Immune profile induced: mixed Th1/Th2
-By routes: IM, IN, IP, SQ, inhalation,
-Point of Contact: Nikolai Petrovsky, Vaxine
-https://www.ncbi.nlm.nih.gov/pubmed/?term=31009889
-https://www.ncbi.nlm.nih.gov/pubmed/?term=25520500
-https://www.ncbi.nlm.nih.gov/pubmed/?term=28758637
-https://www.ncbi.nlm.nih.gov/pubmed/?term=23864620
-https://www.ncbi.nlm.nih.gov/pubmed/?term=24342245
-https://www.ncbi.nlm.nih.gov/pubmed/?term=23306367
-https://www.ncbi.nlm.nih.gov/pubmed/?term=21147758
-https://www.ncbi.nlm.nih.gov/pubmed/?term=15479440
-https://www.ncbi.nlm.nih.gov/pubmed/?term=26031451
-https://www.ncbi.nlm.nih.gov/pubmed/?term=25659269
-https://www.ncbi.nlm.nih.gov/pubmed/?term=33883559
-https://www.ncbi.nlm.nih.gov/pubmed/?term=30312742
-https://www.ncbi.nlm.nih.gov/pubmed/?term=21736913
-https://www.ncbi.nlm.nih.gov/pubmed/?term=30218687
-https://www.ncbi.nlm.nih.gov/pubmed/?term=25459531
-https://www.ncbi.nlm.nih.gov/pubmed/?term=24958701
-https://www.ncbi.nlm.nih.gov/pubmed/?term=25516480
-https://www.ncbi.nlm.nih.gov/pubmed/?term=20130134
-https://www.ncbi.nlm.nih.gov/pubmed/?term=23388724
-https://www.ncbi.nlm.nih.gov/pubmed/?term=21169215
-https://www.ncbi.nlm.nih.gov/pubmed/?term=30832356
-https://www.ncbi.nlm.nih.gov/pubmed/?term=30322015
-https://www.ncbi.nlm.nih.gov/pubmed/?term=28602608
-https://www.ncbi.nlm.nih.gov/pubmed/?term=28676380
-https://www.ncbi.nlm.nih.gov/pubmed/?term=33542494
-https://www.ncbi.nlm.nih.gov/pubmed/?term=26232344
-https://www.ncbi.nlm.nih.gov/pubmed/?term=22728225
-https://www.ncbi.nlm.nih.gov/pubmed/?term=22728225
-https://www.ncbi.nlm.nih.gov/pubmed/?term=25267153
-https://www.ncbi.nlm.nih.gov/pubmed/?term=31300280
-https://www.ncbi.nlm.nih.gov/pubmed/?term=28301280
-https://www.ncbi.nlm.nih.gov/pubmed/?term=22717330
-https://www.ncbi.nlm.nih.gov/pubmed/?term=26177480
-https://www.ncbi.nlm.nih.gov/pubmed/?term=10000000
-https://www.ncbi.nlm.nih.gov/pubmed/?term=27342914
-https://www.ncbi.nlm.nih.gov/pubmed/?term=12
- Nikolai Petrovsky, Wolfgang Leitner, Philip Huang, Oliver He
- PMID: 22728225
- https://vac.niaid.nih.gov/view?id=37
- https://www.ncbi.nlm.nih.gov/pubmed/?term=10000000
- https://www.ncbi.nlm.nih.gov/pubmed/?term=12
- https://www.ncbi.nlm.nih.gov/pubmed/?term=15479440
- https://www.ncbi.nlm.nih.gov/pubmed/?term=20130134
- https://www.ncbi.nlm.nih.gov/pubmed/?term=21147758
- https://www.ncbi.nlm.nih.gov/pubmed/?term=21169215
- https://www.ncbi.nlm.nih.gov/pubmed/?term=21736913
- https://www.ncbi.nlm.nih.gov/pubmed/?term=22717330
- https://www.ncbi.nlm.nih.gov/pubmed/?term=22728225
- https://www.ncbi.nlm.nih.gov/pubmed/?term=23306367
- https://www.ncbi.nlm.nih.gov/pubmed/?term=23388724
- https://www.ncbi.nlm.nih.gov/pubmed/?term=23864620
- https://www.ncbi.nlm.nih.gov/pubmed/?term=24342245
- https://www.ncbi.nlm.nih.gov/pubmed/?term=24958701
- https://www.ncbi.nlm.nih.gov/pubmed/?term=25267153
- https://www.ncbi.nlm.nih.gov/pubmed/?term=25459531
- https://www.ncbi.nlm.nih.gov/pubmed/?term=25516480
- https://www.ncbi.nlm.nih.gov/pubmed/?term=25520500
- https://www.ncbi.nlm.nih.gov/pubmed/?term=25659269
- https://www.ncbi.nlm.nih.gov/pubmed/?term=26031451
- https://www.ncbi.nlm.nih.gov/pubmed/?term=26177480
- https://www.ncbi.nlm.nih.gov/pubmed/?term=26232344
- https://www.ncbi.nlm.nih.gov/pubmed/?term=27342914
- https://www.ncbi.nlm.nih.gov/pubmed/?term=28301280
- https://www.ncbi.nlm.nih.gov/pubmed/?term=28602608
- https://www.ncbi.nlm.nih.gov/pubmed/?term=28676380
- https://www.ncbi.nlm.nih.gov/pubmed/?term=28758637
- https://www.ncbi.nlm.nih.gov/pubmed/?term=30218687
- https://www.ncbi.nlm.nih.gov/pubmed/?term=30312742
- https://www.ncbi.nlm.nih.gov/pubmed/?term=30322015
- https://www.ncbi.nlm.nih.gov/pubmed/?term=30832356
- https://www.ncbi.nlm.nih.gov/pubmed/?term=31009889
- https://www.ncbi.nlm.nih.gov/pubmed/?term=31300280
- https://www.ncbi.nlm.nih.gov/pubmed/?term=33542494
- https://www.ncbi.nlm.nih.gov/pubmed/?term=33883559
-
- 37
- Advax vaccine adjuvant
+ vaccine
+ COVID-19 virus-like particle vaccine
@@ -808744,7 +818215,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
A SARS-CoV-2 protein subunit vaccine manufactured by the Razi Vaccine and Serum Research Institute with a Spike protein antigen
Philip Huang
- Razi Cov Pars
+ vaccine
+ Razi Cov Pars
@@ -808769,7 +818241,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04751682
- BBV154
+ vaccine
+ BBV154
@@ -808794,7 +818267,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04776317
- ChAdV68-S
+ vaccine
+ ChAdV68-S
@@ -808802,7 +818276,6 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
-
@@ -808832,7 +818305,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
https://en.irct.ir/trial/52701
- COVIran Barakat
+ vaccine
+ COVIran Barakat
@@ -808857,7 +818331,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
https://www.clinicaltrialsregister.eu/ctr-search/trial/2020-003734-20/IT
- COVID-eVax
+ vaccine
+ COVID-eVax
@@ -808882,7 +818357,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04742842
- COVIGEN
+ vaccine
+ COVIGEN
@@ -808907,7 +818383,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04783311
- EuCorVac-19
+ vaccine
+ EuCorVac-19
@@ -808938,7 +818415,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04785144
- mRNA-1273.351
+ vaccine
+ mRNA-1273.351
@@ -808963,7 +818441,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04760743
- NBP2001
+ vaccine
+ NBP2001
@@ -808988,7 +818467,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04764422
- NDV-HXP-S
+ vaccine
+ NDV-HXP-S
@@ -809013,7 +818493,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04765436
- PTX-COVID19-B
+ vaccine
+ PTX-COVID19-B
@@ -809038,7 +818519,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04784767
- SpFN
+ vaccine
+ SpFN
@@ -809047,12 +818529,6 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
-
-
-
-
-
-
@@ -809069,7 +818545,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04773665
- VBI-2902a
+ vaccine
+ VBI-2902a
@@ -809106,7 +818583,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
https://en.irct.ir/trial/54133
- FAKHRAVAC
+ vaccine
+ FAKHRAVAC
@@ -809137,7 +818615,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04798001
- MV-014-212
+ vaccine
+ MV-014-212
@@ -809162,7 +818641,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04798027
- MRT5500
+ vaccine
+ MRT5500
@@ -809199,7 +818679,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
- CoviVac
+ vaccine
+ CoviVac
@@ -809224,7 +818705,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
https://rpcec.sld.cu/trials/RPCEC00000366-En
- Soberana Plus
+ vaccine
+ Soberana Plus
@@ -809249,7 +818731,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
Daiichi Sankyo Co., Ltd.
- DS-5670a
+ vaccine
+ DS-5670a
@@ -809286,7 +818769,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04830800
- COVIVAC
+ vaccine
+ COVIVAC
@@ -809311,7 +818795,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
ChiCTR2100045107
- V-01
+ vaccine
+ V-01
@@ -809336,7 +818821,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04869592
- COVID-19 subunit vaccine by National Vaccine and Serum Institute of China
+ vaccine
+ COVID-19 subunit vaccine by National Vaccine and Serum Institute of China
@@ -809368,7 +818854,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
NCT04863131
Elixirgen Therapeutics, Inc.
- EXG-5003
+ vaccine
+ EXG-5003
@@ -809405,7 +818892,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
jRCT2071200106
- KD-414
+ vaccine
+ KD-414
@@ -809430,7 +818918,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04818281
- COVID-19 VLP vaccine by the Scientific and Technological Research Council of Turkey
+ vaccine
+ COVID-19 VLP vaccine by the Scientific and Technological Research Council of Turkey
@@ -809455,7 +818944,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04818801
- ReCOV
+ vaccine
+ ReCOV
@@ -809492,7 +818982,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04838080
- Koçak-19 Inaktif Adjuvanlı COVID-19 Vaccine
+ vaccine
+ Koçak-19 Inaktif Adjuvanlı COVID-19 Vaccine
@@ -809523,7 +819014,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04839042
- SC-Ad6-1
+ vaccine
+ SC-Ad6-1
@@ -809532,12 +819024,6 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
-
-
-
-
-
-
@@ -809554,7 +819040,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04839146
- ABNCoV2
+ vaccine
+ ABNCoV2
@@ -809575,11 +819062,12 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
- A SARS-CoV-2 Lipid-Inorganic Nanoparticle (LION™) formulated replicating mRNA vaccine that encodes for a full-length spike (S) protein of the SARS-CoV-2 virus
+ A SARS-CoV-2 Lipid-Inorganic Nanoparticle (LION‚Ñ¢) formulated replicating mRNA vaccine that encodes for a full-length spike (S) protein of the SARS-CoV-2 virus
Philip Huang
NCT04844268
- HDT-301
+ vaccine
+ HDT-301
@@ -809594,12 +819082,6 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
-
-
-
-
-
-
@@ -809622,7 +819104,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04866069
- COVID-19 inactivated vaccine by the Scientific and Technological Research Council of Turkey
+ vaccine
+ COVID-19 inactivated vaccine by the Scientific and Technological Research Council of Turkey
@@ -809637,12 +819120,6 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
-
-
-
-
-
-
@@ -809665,7 +819142,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
PubMed ID: 33887208
- MF59-adjuvanted SARS-CoV-2 Sclamp vaccine
+ vaccine
+ MF59-adjuvanted SARS-CoV-2 Sclamp vaccine
@@ -809696,7 +819174,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04871737
- COVID-19 rNDV vector vaccine by Laboratorio Avi-Mex
+ vaccine
+ COVID-19 rNDV vector vaccine by Laboratorio Avi-Mex
@@ -809721,7 +819200,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
ChiCTR2100045984
- COVID-19 mRNA vaccine by Shanghai East Hospital and Stemirna Therapeutics
+ vaccine
+ COVID-19 mRNA vaccine by Shanghai East Hospital and Stemirna Therapeutics
@@ -809746,7 +819226,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04885361
- CoVepiT
+ vaccine
+ CoVepiT
@@ -809777,7 +819258,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04895449
- MVA-SARS-2-ST
+ vaccine
+ MVA-SARS-2-ST
@@ -809809,7 +819291,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
NCT04893512
Syneos Health
- CoV2-OGEN1
+ vaccine
+ CoV2-OGEN1
@@ -809823,7 +819306,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
https://www.fda.gov/emergency-preparedness-and-response/coronavirus-disease-2019-covid-19/covid-19-vaccines
- authorized COVID-19 vaccine
+ vaccine
+ authorized COVID-19 vaccine
@@ -809836,7 +819320,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Oliver He
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
- authorized COVID-19 RNA vaccine
+ vaccine
+ authorized COVID-19 RNA vaccine
@@ -809849,7 +819334,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Oliver He
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
- authorized inactivated COVID-19 vaccine
+ vaccine
+ authorized inactivated COVID-19 vaccine
@@ -809862,7 +819348,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Oliver He
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
- authorized COVID-19 recombinant vector vaccine
+ vaccine
+ authorized COVID-19 recombinant vector vaccine
@@ -809874,7 +819361,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Oliver He
- authorized COVID-19 recombinant adenoviral vector vaccine
+ vaccine
+ authorized COVID-19 recombinant adenoviral vector vaccine
@@ -809887,7 +819375,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Oliver He, Philip Huang
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
- authorized COVID-19 subunit vaccine
+ vaccine
+ authorized COVID-19 subunit vaccine
@@ -809912,7 +819401,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04930003
- QazCoVac-P
+ vaccine
+ QazCoVac-P
@@ -809949,7 +819439,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04934111
- LNP-nCOV saRNA-02
+ vaccine
+ LNP-nCOV saRNA-02
@@ -809982,35 +819473,12 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
- A multivalent SARS-CoV-2 mRNA booster vaccine which combines mRNA-1273, Moderna’s authorized vaccine against ancestral strains, and mRNA-1273.351 in a single vaccine at the 50 µg dose level and lower.
+ A multivalent SARS-CoV-2 mRNA booster vaccine which combines mRNA-1273, Moderna’s authorized vaccine against ancestral strains, and mRNA-1273.351 in a single vaccine at the 50 µg dose level and lower.
Philip Huang
https://investors.modernatx.com/news-releases/news-release-details/moderna-announces-it-has-shipped-variant-specific-vaccine
- mRNA-1273.211
-
-
-
-
-
-
-
-
-
- immune response profile
-
-
-
-
-
-
-
-
- An immune profile that is characterized by the presense of both Type 1 and Type 2 T helper (Th1 and Th2) cells.
- Oliver He, Amogh Madireddi
- https://en.wikipedia.org/wiki/T_helper_cell
- https://pubmed.ncbi.nlm.nih.gov/10579123/
-
- Th1/Th2 mixed immune profile
+ vaccine
+ mRNA-1273.211
@@ -810041,7 +819509,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04950751
- SCB-2020S
+ vaccine
+ SCB-2020S
@@ -810066,7 +819535,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
https://en.irct.ir/trial/56987
- Noora
+ vaccine
+ Noora
@@ -810091,7 +819561,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04953078
- Baiya SARS-CoV-2 Vax 1
+ vaccine
+ Baiya SARS-CoV-2 Vax 1
@@ -810116,7 +819587,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04954287
- CVXGA1
+ vaccine
+ CVXGA1
@@ -810141,7 +819613,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04973449
- AZD2816
+ vaccine
+ AZD2816
@@ -810166,7 +819639,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04990544
- 202-CoV
+ vaccine
+ 202-CoV
@@ -810191,7 +819665,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05007509
- COVID-19 subunit vaccine by HIPRA
+ vaccine
+ COVID-19 subunit vaccine by HIPRA
@@ -810212,11 +819687,12 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
- A SARS-CoV-2 DNA vaccine developed by AnGes.
+ A SARS-CoV-2 DNA vaccine developed by AnGes, named as AG0302-COVID19.
Philip Huang
NCT04993586
- AG0302-COVID19
+ vaccine
+ AG0302-COVID19
@@ -810229,7 +819705,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Oliver He
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
- authorized COVID-19 DNA vaccine
+ vaccine
+ authorized COVID-19 DNA vaccine
@@ -810262,11 +819739,12 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
- A SARS-CoV-2 RNA vaccine by Arcturus Therapeutics, Inc.
+ A SARS-CoV-2 RNA vaccine by Arcturus Therapeutics, Inc., named as ARCT-165.
Philip Huang
NCT05037097
- ARCT-165
+ vaccine
+ ARCT-165
@@ -810291,7 +819769,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05029856
- SII B.1.351
+ vaccine
+ SII B.1.351
@@ -810316,7 +819795,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05029856
- SII Bivalent
+ vaccine
+ SII Bivalent
@@ -810341,7 +819821,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05029856
- SII B.1.617.2
+ vaccine
+ SII B.1.617.2
@@ -810372,7 +819853,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05037188
- AAV5-RBD-S
+ vaccine
+ AAV5-RBD-S
@@ -810397,7 +819879,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05043311
- SCTV01C
+ vaccine
+ SCTV01C
@@ -810422,7 +819905,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05094609
- Ad5-triCoV/Mac
+ vaccine
+ Ad5-triCoV/Mac
@@ -810447,7 +819931,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05069623
- VB10.2129
+ vaccine
+ VB10.2129
@@ -810472,7 +819957,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05069623
- VB10.2210
+ vaccine
+ VB10.2210
@@ -810497,7 +819983,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05094609
- ChAd-triCoV/Mac
+ vaccine
+ ChAd-triCoV/Mac
@@ -810522,7 +820009,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05067894
- COVID-19 subunit vaccine by PT Bio Farma
+ vaccine
+ COVID-19 subunit vaccine by PT Bio Farma
@@ -810553,7 +820041,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05047445
- COVIDITY
+ vaccine
+ COVIDITY
@@ -810578,7 +820067,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
ACTRN12621001009808
- PIKA Recombinant COVID-19 Vaccine
+ vaccine
+ PIKA Recombinant COVID-19 Vaccine
@@ -810603,7 +820093,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05102643
- COVID-19 DNA vaccine by the University of Hong Kong and Immuno Cure 3 Limited
+ vaccine
+ COVID-19 DNA vaccine by the University of Hong Kong and Immuno Cure 3 Limited
@@ -810636,11 +820127,12 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
- A SARS-CoV-2 RNA vaccine by Arcturus Therapeutics, Inc.
+ A SARS-CoV-2 RNA vaccine by Arcturus Therapeutics, Inc., named as ARCT-154.
Philip Huang
ISRCTN15779782
- ARCT-154
+ vaccine
+ ARCT-154
@@ -810665,7 +820157,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05137444
- LYB001
+ vaccine
+ LYB001
@@ -810702,7 +820195,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05128721
- Covi Vax
+ vaccine
+ Covi Vax
@@ -810727,7 +820221,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05113862
- naNO-COVID
+ vaccine
+ naNO-COVID
@@ -810752,7 +820247,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05113849
- IN-B009
+ vaccine
+ IN-B009
@@ -810777,7 +820273,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
jRCT2071210067
- VLPCOV-01
+ vaccine
+ VLPCOV-01
@@ -810802,7 +820299,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05434585
- ABO1009-DP
+ vaccine
+ ABO1009-DP
@@ -810810,7 +820308,6 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
-
@@ -810828,7 +820325,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05385991
- ACM-001
+ vaccine
+ ACM-001
@@ -810853,7 +820351,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05171946
- Almansour-001
+ vaccine
+ Almansour-001
@@ -810878,7 +820377,9 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04639466
- ChAdV68-S
+ VO:0005176
+ vaccine
+ Synthetic MVA-based SARS-CoV-2 Vaccine COH04S1
@@ -810903,7 +820404,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05272605
- DoCo-Pro-RBD-1 + MF59
+ vaccine
+ DoCo-Pro-RBD-1 + MF59
@@ -810940,7 +820442,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05218070
- EgyVax
+ vaccine
+ EgyVax
@@ -810965,7 +820468,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05435027
- GRT-R912
+ vaccine
+ GRT-R912
@@ -810990,7 +820494,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05272605
- MIPSCo-mRNA-RBD-1
+ vaccine
+ MIPSCo-mRNA-RBD-1
@@ -811027,7 +820532,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
IRCT20210622051670N1
- Osvid-19
+ vaccine
+ Osvid-19
@@ -811052,7 +820558,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05389319
- Prime-2-CoV-Beta
+ vaccine
+ Prime-2-CoV-Beta
@@ -811077,7 +820584,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05366296
- RH109
+ vaccine
+ RH109
@@ -811102,7 +820610,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05394012
- RQ3013
+ vaccine
+ RQ3013
@@ -811127,7 +820636,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05420077
- RVM-V001
+ vaccine
+ RVM-V001
@@ -811152,7 +820662,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
ACTRN12622000597796
- VXS-1223
+ vaccine
+ VXS-1223
@@ -811177,7 +820688,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05370040
- AAHI-SC2
+ vaccine
+ AAHI-SC2
@@ -811202,7 +820714,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05270954
- Betuvax-CoV2
+ vaccine
+ Betuvax-CoV2
@@ -811227,7 +820740,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05373472
- COVID-19 mRNA vaccine by CanSino Biologics
+ vaccine
+ COVID-19 mRNA vaccine by CanSino Biologics
@@ -811252,7 +820766,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05188469
- EG-COVID
+ vaccine
+ EG-COVID
@@ -811277,7 +820792,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05375838
- mRNA-1073
+ vaccine
+ mRNA-1073
@@ -811302,7 +820818,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05439824
- SYS6006
+ vaccine
+ SYS6006
@@ -811339,7 +820856,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05226429
- UNAIR Inactivated COVID-19 Vaccine
+ vaccine
+ UNAIR Inactivated COVID-19 Vaccine
@@ -811364,7 +820882,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05273528
- V-01-351/V-01D Bivalence Vaccine
+ vaccine
+ V-01-351/V-01D Bivalence Vaccine
@@ -811389,7 +820908,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
CTRI/2022/04/041880
- GEMCOVAC-19
+ vaccine
+ GEMCOVAC-19
@@ -811414,7 +820934,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05428592
- LVRNA009
+ vaccine
+ LVRNA009
@@ -811439,7 +820960,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05436834
- mRNA-1273.214
+ vaccine
+ mRNA-1273.214
@@ -811464,7 +820986,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05249829
- mRNA-1273.529
+ vaccine
+ mRNA-1273.529
@@ -811501,7 +821024,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05374954
- Omicron COVID-19 inactivated vaccine by China National Biotec Group Company Limited
+ vaccine
+ Omicron COVID-19 inactivated vaccine by China National Biotec Group Company Limited
@@ -811514,7 +821038,580 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Oliver He
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
- authorized COVID-19 virus-like particle vaccine
+ vaccine
+ authorized COVID-19 virus-like particle vaccine
+
+
+
+
+
+
+
+
+ A Comirnaty COVID-19 mRNA vaccine produced by Pfizer-BioNTech,which is a bivalent vaccine that is effective against the original strain of COVID-19 as well as the Omicron BA.1 variant.A non-US vaccine product.
+ Penny Pan, Oliver He
+ Comirnaty Bivalent
+ PMID: 36541943
+ https://secure.medicalletter.org/TML-article-1665f
+ https://www2a.cdc.gov/vaccines/iis/iisstandards/vaccines.asp?rpt=cvx
+
+ Comirnaty
+ 520
+ vaccine
+ Authorized by WHO 10/19/2022 - Counted toward immunity in US.Ref:https://www2a.cdc.gov/vaccines/iis/iisstandards/vaccines.asp?rpt=cvx
+ SARS-COV-2 COVID-19 mRNA, bivalent, original/Omicron BA.1, Non-US Vaccine Product (Comirnaty Bivalent), Pfizer-BioNTech
+
+
+
+
+
+
+
+
+ A Comirnaty COVID-19 mRNA vaccine utilizes Lipid Nanoparticle-Self-amplifying RNA technology, available as a bivalent boosters against the original strain of COVID-19 as well as the Omicron BA.1 variant produced by Pfizer (PF) with a dose of 30 mcg/0.3 mL to provide enhanced protection.
+ Penny Pan, Oliver He
+ PMID: 36206167
+ https://secure.medicalletter.org/TML-article-1660c
+ https://www2a.cdc.gov/vaccines/iis/iisstandards/vaccines.asp?rpt=cvx
+
+ Comirnaty
+ 300
+ vaccine
+ EUA authorized Pfizer adult bivalent booster ages 12+ yrs, original strain + omicron BA.4/BA.5. Not Authorized by WHO. Non-US Tradename for same formulation (Comirnaty Bivalent) counted toward immunity in US. Ref:https://www2a.cdc.gov/vaccines/iis/iisstandards/vaccines.asp?rpt=cvx
+ SARS-COV-2 (COVID-19) vaccine, mRNA, spike protein, LNP, bivalent booster, preservative free, 30 mcg/0.3 mL dose, tris-sucrose formulation
+
+
+
+
+
+
+
+
+ A Comirnaty COVID-19 mRNA vaccine utilizing Lipid Nanoparticle-Self-amplifying RNA technology against the original strain of COVID-19 without preservative ,which is produced by Pfizer (PF) with a dose of 30 mcg/0.3 mL.
+ Penny Pan, Oliver He
+ https://www2a.cdc.gov/vaccines/iis/iisstandards/vaccines.asp?rpt=cvx
+
+ 208
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine, mRNA, spike protein, LNP, preservative free, 30 mcg/0.3mL dose
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ a grouping class for vaccines for specific pathogens
+
+ vaccine
+ vaccine for pathogen
+
+
+
+
+
+
+
+
+ a grouping class for vaccines for specific platforms
+
+ vaccine
+ vaccine by platform type
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 D614 recomb preS dTM AS03 adjuvant add PF 10mcg/0.5mL
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine D614 prefusion spike recombinant protein subunit (CoV2 preS dTM) AS03 adjuvant added preservative free 10mcg/0.5mL dose
+ CVX:226
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 D614 recomb preS dTM AS03 adjuvant add PF 5mcg/0.5mL
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine D614 prefusion spike recombinant protein subunit (CoV2 preS dTM) AS03 adjuvant added preservative free 5mcg/0.5mL dose
+ CVX:225
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S bivalent booster PF 10 mcg/0.2 mL
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP bivalent booster preservative free 10 mcg/0.2 mL dose
+ CVX:230
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S bivalent booster PF 10 mcg/0.2 mL dose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP bivalent booster preservative free 10 mcg/0.2 mL dose tris-sucrose formulation
+ CVX:301
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S bivalent booster PF 30 mcg/0.3 mL dose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP bivalent booster preservative free 30 mcg/0.3 mL dose tris-sucrose formulation
+ CVX:300
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S bivalent booster PF 50 mcg/0.5 mL or 25mcg/0.25 mL dose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP bivalent booster preservative free 50 mcg/0.5 mL or 25 mcg/0.25 mL dose
+ CVX:229
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S bivalent PF 3 mcg/0.2 mL dose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP bivalent preservative free 3 mcg/0.2 mL dose tris-sucrose formulation
+ CVX:302
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S PF 10 mcg/0.2 mL dose tris-sucrose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP preservative free 10 mcg/0.2mL dose tris-sucrose formulation
+ CVX:218
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S PF 100 mcg/0.5mL dose or 50 mcg/0.25mL dose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP preservative free 100 mcg/0.5mL dose or 50 mcg/0.25mL dose
+ CVX:207
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S PF 3 mcg/0.2 mL dose tris-sucrose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP preservative free 3 mcg/0.2mL dose tris-sucrose formulation
+ CVX:219
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S PF 30 mcg/0.3 mL dose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP preservative free 30 mcg/0.3mL dose
+ CVX:208
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S PF 30 mcg/0.3 mL dose tris-sucrose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP preservative free 30 mcg/0.3mL dose tris-sucrose formulation
+ CVX:217
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S PF 50 mcg/0.5 mL dose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP preservative free 50 mcg/0.5 mL dose
+ CVX:221
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S PF pediatric 25 mcg/0.25 mL dose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP preservative free pediatric 25 mcg/0.25 mL dose
+ CVX:228
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S PF pediatric 50 mcg/0.5 mL dose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP preservative free pediatric 50 mcg/0.5 mL dose
+ CVX:227
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ SARS-COV-2 (COVID-19) vaccine UNSPECIFIED
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine UNSPECIFIED
+ CVX:213
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA bivalent original/Omicron BA.1 Non-US Vaccine (Spikevax Bivalent) Moderna
+
+ vaccine
+ SARS-COV-2 COVID-19 mRNA bivalent original/Omicron BA.1 Non-US Vaccine (Spikevax Bivalent) Moderna
+ CVX:519
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA bivalent original/Omicron BA.1 Non-US Vaccine Product Pfizer-BioNTech
+
+ vaccine
+ SARS-COV-2 COVID-19 mRNA bivalent original/Omicron BA.1 Non-US Vaccine Product (Comirnaty Bivalent) Pfizer-BioNTech
+ CVX:520
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 Non-US Vaccine Product Unknown
+
+ vaccine
+ SARS-COV-2 COVID-19 Non-US Vaccine Specific Product Unknown
+ CVX:500
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 PS Non-US Vaccine (Jiangsu Province Centers for Disease Control and Prevention)
+
+ vaccine
+ SARS-COV-2 COVID-19 Protein Subunit Non-US Vaccine Product (Jiangsu Province Centers for Disease Control and Prevention)
+ CVX:508
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 PS Non-US Vaccine (Anhui Zhifei Longcom Biopharm + Inst of Micro Chinese Acad of Sciences)
+
+ vaccine
+ SARS-COV-2 COVID-19 Protein Subunit Non-US Vaccine Product (Anhui Zhifei Longcom Biopharmaceutical + Institute of Microbiology Chinese Academy of Sciences)
+ CVX:507
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ SARS-COV-2 COVID-19 PS Non-US Vaccine (Anhui Zhifei Longcom Zifivax)
+
+ vaccine
+ SARS-COV-2 COVID-19 Protein Subunit Non-US Vaccine Product (Anhui Zhifei Longcom Zifivax)
+ CVX:513
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 VVnr Non-US Vaccine (CanSino Biological Inc./Beijing Institute of Biotechnology
+
+ vaccine
+ SARS-COV-2 COVID-19 Viral Vector Non-replicating Non-US Vaccine Product (CONVIDECIA) CanSino Biological Inc./Beijing Institute of Biotechnology
+ CVX:506
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 VVnr Non-US Vaccine (Sputnik Light)
+
+ vaccine
+ SARS-COV-2 COVID-19 Viral Vector Non-replicating Non-US Vaccine Product (Sputnik Light)
+ CVX:504
@@ -811526,6 +821623,7 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
a protein from a virus
YH, ZX
+ protein
virus protein
@@ -811548,6 +821646,7 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
YH, ZX
+ protein
SARS-CoV protein
@@ -811556,6 +821655,7 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
+
@@ -811565,6 +821665,7 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
YH, ZX
+ protein
The receptor-binding domain (RBD) of SARS-CoV spike (S) protein is an important target in developing safe and effective SARS vaccines. A previous study has demonstrated that vaccination with adeno-associated virus encoding RBD (RBD-rAAV) induces high titer of neutralizing antibodies. The immune responses and protective effect of the immunization with RBD-rAAV prime/RBD-specific T cell peptide boost were assessed. Compared with the RBD-rAAV prime/boost vaccination, RBD-rAAV prime/RBD-peptide (RBD-Pep) boost induced similar levels of Th1 and neutralizing antibody responses that protected the vaccinated mice from subsequent SARS-CoV challenge, but stronger Th2 and CTL responses. No significant immune responses and protective effects were detected in mice vaccinated with RBD-Pep or blank AAV alone [PubMed: 18289745].
S protein of SARS-CoV
Protegen ID: 789; NCBI Gene GI: 1489668; NCBI Protein GI: 29836496; NCBI Protein Accession: NP_828851; NCBITaxon: 694009
@@ -811584,12 +821685,32 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
YH, ZX
+ vaccine
SARS Subunit Spike Protein Vaccine
VIOLIN Vaccine ID: 842
+
+
+
+
+
+
+
+
+
+
+ A vaccine that protects against Canine distemper virus.
+ YH, ZX
+
+ vaccine
+ canine distemper virus vaccine
+
+
+
+
@@ -811610,6 +821731,7 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
YH, ZX
SARS-CoV vaccine
+ vaccine
SARS vaccine
@@ -811623,21 +821745,11 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
-
-
-
-
-
-
-
-
-
-
@@ -814426,14 +824538,23 @@ This interpretation is *not* the same as an at-all-times relation
- Intervet has merged with Schering-Plough Animal Health and become Intervet/Schering-Plough Animal Health™ (YL.)
+ Intervet has merged with Schering-Plough Animal Health and become Intervet/Schering-Plough Animal Health™ (YL.)
YH
- http://www.intervet.com/
Intervet
+
+
+
+
+ YL
+ Novartis Animal Health US, Inc.
+
+
+
+
@@ -814441,8 +824562,7 @@ This interpretation is *not* the same as an at-all-times relation
A British multinational pharmaceutical company headquartered in Brentford, England
Oliver He, Philip Huang
https://en.wikipedia.org/wiki/GlaxoSmithKline
- https://www.gsk.com/en-gb/home/
- GlaxoSmithKline plc
+ GlaxoSmithKline plc
@@ -814452,7 +824572,6 @@ This interpretation is *not* the same as an at-all-times relation
YH
- http://www.wyeth.com/
Wyeth Pharmaceuticals Inc
@@ -814463,31 +824582,47 @@ This interpretation is *not* the same as an at-all-times relation
YH
- http://www.pfizerah.com/
Pfizer Animal Health
-
+
-
+
YH
- http://www.merial.com/
- Merial, Inc
+ Boehringer-Ingelheim Vetmedica, Inc
-
+
-
+
- YL
- Vaccicel, Inc. has a location in Belton, TX. Active officers include Andre Menchu, Andres Menchu, Kathryn M Baker, Katheryn Becker and Andres Menches. Vaccicel, Inc. filed as a Domestic For-Profit Corporation on Tuesday, August 22, 1995 in the state of Texas and is currently active. Andres Menchu serves as the registered agent for this organization.The company's line of business includes Mfg Research & Development Veterinary Bacterial Vaccines.
-(http://www.corporationwiki.com/Texas/Belton/vaccicel-inc/34296230.aspx)
- VacciCel, Inc.
+ YH
+ Biomune
+
+
+
+
+
+
+
+
+ YH
+ Lohman Animal Health International
+
+
+
+
+
+
+
+
+ YH
+ Merial, Inc
@@ -814499,7 +824634,7 @@ This interpretation is *not* the same as an at-all-times relation
A company trhat is located at Berkeley, CA, USA. Its website is: http://www.dynavax.com.
Oliver He, Randi Rita, Kallan Roan
http://www.dynavax.com/
- Dynavax Technologies Corporation
+ Dynavax Technologies Corporation
@@ -814512,7 +824647,7 @@ This interpretation is *not* the same as an at-all-times relation
Oliver He, Philip Huang
https://en.wikipedia.org/wiki/Janssen_Pharmaceutica
https://www.janssen.com/us/
- Janssen Pharmaceutica
+ Janssen Pharmaceutica
@@ -814521,11 +824656,11 @@ This interpretation is *not* the same as an at-all-times relation
- An American multinational pharmaceutical corporation headquartered in New York City.
+ An American multinational pharmaceutical corporation headquartered in New York City.
Philip, Oliver
- https://en.wikipedia.org/wiki/Pfizer
- https://www.pfizer.com/
- Pfizer Inc.
+ https://en.wikipedia.org/wiki/Pfizer
+ https://www.pfizer.com/
+ Pfizer Inc.
@@ -814535,8 +824670,7 @@ This interpretation is *not* the same as an at-all-times relation
Philip Huang, Oliver He
- https://vaxxinity.com/
- Vaxxinity
+ Vaxxinity
@@ -814546,8 +824680,7 @@ This interpretation is *not* the same as an at-all-times relation
Philip Huang
- https://www.symvivo.com/
- Symvivo
+ Symvivo
@@ -814557,8 +824690,7 @@ This interpretation is *not* the same as an at-all-times relation
Philip Huang
- https://www.chula.ac.th/en/
- Chulalongkorn University
+ Chulalongkorn University
@@ -814568,8 +824700,7 @@ This interpretation is *not* the same as an at-all-times relation
Philip Huang
- https://medigen-usa.com/
- Medigen, Inc.
+ Medigen, Inc.
@@ -814579,8 +824710,7 @@ This interpretation is *not* the same as an at-all-times relation
Philip Huang
- www.cloverbiopharma.com
- Clover Biopharmaceuticals, Inc.
+ Clover Biopharmaceuticals, Inc.
@@ -814590,8 +824720,7 @@ This interpretation is *not* the same as an at-all-times relation
Philip Huang
- http://www.cellid.co.kr/eng/
- Cellid Co., Ltd.
+ Cellid Co., Ltd.
@@ -814601,8 +824730,7 @@ This interpretation is *not* the same as an at-all-times relation
Philip Huang
- https://www.umcg.nl/EN/corporate/The_University_Medical_Center/Paginas/default.aspx
- University Medical Center Groningen
+ University Medical Center Groningen
@@ -814662,8 +824790,8 @@ This interpretation is *not* the same as an at-all-times relation
Mervi Heiskanen
Monnie McGee
Norman Morrison
- Philip Lord
Philippe Rocca-Serra
+ Phillip Lord
Pierre Grenon
Richard Bruskiewich
Richard Scheuermann
@@ -814676,64 +824804,853 @@ This interpretation is *not* the same as an at-all-times relation
Trish Whetzel
Yongqun He
2009-07-31
- The Ontology for Biomedical Investigations (OBI) is build in a collaborative, international effort and will serve as a resource for annotating biomedical investigations, including the study design, protocols and instrumentation used, the data generated and the types of analysis performed on the data. This ontology arose from the Functional Genomics Investigation Ontology (FuGO) and will contain both terms that are common to all biomedical investigations, including functional genomics investigations and those that are more domain specific.
+ An ontology for representing biomedical investigations, including study designs, the collection and preparation of the targets of investigation, assays, instrumentation and reagents used, as well as the data generated and the types of analysis performed on the data to reach conclusions, and their documentation.
OWL-DL
An ontology for the annotation of biomedical and functional genomics experiments.
http://creativecommons.org/licenses/by/4.0/
Ontology for Biomedical Investigations
Please cite the OBI consortium http://purl.obolibrary.org/obo/obi where traditional citation is called for. However it is adequate that individual terms be attributed simply by use of the identifying PURL for the term, in projects that refer to them.
- 2021-04-06
+ 2024-01-09
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -814900,6 +825817,12 @@ This interpretation is *not* the same as an at-all-times relation
+
+
+
+
+
+
@@ -814910,10 +825833,19 @@ This interpretation is *not* the same as an at-all-times relation
-
+
-
+
+
+
+
+
+
+
+
+
+
@@ -814928,19 +825860,19 @@ This interpretation is *not* the same as an at-all-times relation
-
+
-
+
-
+
-
+
-
+
@@ -814961,37 +825893,37 @@ This interpretation is *not* the same as an at-all-times relation
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
@@ -815354,343 +826286,244 @@ This interpretation is *not* the same as an at-all-times relation
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
@@ -815741,13 +826574,7 @@ This interpretation is *not* the same as an at-all-times relation
-
-
-
-
-
-
-
+
@@ -815819,268 +826646,52 @@ This interpretation is *not* the same as an at-all-times relation
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
@@ -822149,14 +832760,14 @@ This interpretation is *not* the same as an at-all-times relation
Erica Marcos
Ningxian Fan
Paul Fabry
- Randi Vita
+ Randi Vita
Ryan R. Brinkman
- Shunzhou Deng
+ Shunzhou Deng
Alan Ruttenburg
Alexander D. Diehl
Amogh Madireddi
- Anna Maria Masci
- Anthony Huffman
+ Anna Maria Masci
+ Anthony Huffman
Barry Smith
Bjoern Peters
Edison Ong
@@ -822167,26 +832778,26 @@ This interpretation is *not* the same as an at-all-times relation
Khadeejah Khan
Lindsay Cowell
Melanie Courtot
- Ningxian Fan
+ Ningxian Fan
Omar Tibi
- Philip Huang
+ Philip Huang
Randi Vita
Rebecca Racz
Richard H. Scheuermann
- Rohit Goru
- Ronak Sutariya
+ Rohit Goru
+ Ronak Sutariya
Samantha G. Sayers (SGS)
Thomas Todd
- Yongqun "Oliver" He (YH)
- Yu Lin (YL)
- Zuoshuang "Allen" Xiang
- July 31, 2022
- The Vaccine Ontology (VO) is a biomedical ontology in the domain of vaccine and vaccination. VO aims to standardize vaccine annotation, integrate various vaccine data, and support computer-assisted reasoning. VO supports basic vaccine R&D and clincal vaccine usage. VO is being developed as a community-based ontology with support and collaborations from the vaccine and bio-ontology communities.
+ Yongqun "Oliver" He (YH)
+ Yu Lin (YL)
+ Yuanyi (Penny) Pan
+ Zuoshuang "Allen" Xiang
+ The Vaccine Ontology (VO) is a community-based biomedical ontology in the domain of vaccine and vaccination. VO aims to standardize vaccine types and annotations, integrate various vaccine data, and support computer-assisted reasoning. The VO supports basic vaccine R&D and clincal vaccine usage. VO is being developed as a community-based ontology with support and collaborations from the vaccine and bio-ontology communities.
OWL-DL
-
An ontology in the domain of vaccine and vaccination
Vaccine Ontology
- 1.1.201
+
+ 2024-02-07
Obsolete term
@@ -822207,5 +832818,5 @@ This interpretation is *not* the same as an at-all-times relation
-
+
diff --git a/src/ontology/cido.owl b/src/ontology/cido.owl
index 754379f..6baa4be 100644
--- a/src/ontology/cido.owl
+++ b/src/ontology/cido.owl
@@ -26,11 +26,12 @@
xmlns:ncbitaxon="http://purl.obolibrary.org/obo/ncbitaxon#"
xmlns:rdf-schema="http://www.w3.org/20000/01/rdf-schema#">
- Ghida Arnous
+
Barry Smith
Brian Athey
Gil Omenn
Hongfang Liu
+ Ghida Arnous
Anthony Huffman
Ashley Yan
Asiyah Yu Lin
@@ -41,8 +42,10 @@
Guirui Huang (Ray)
Hong Yu
Hsin-Hui Huang
+ Jie Zheng
John Beverley
Liwei Wang
+ Muhui Ye
Roshan Desai
Sivaram Arabandi
Suyuan Peng
@@ -53,14 +56,12 @@
Yujia Tian
Zalan Shah
Zhigang Wang
- 11-4-2023
The Ontology of Coronavirus Infectious Disease (CIDO) is a community-driven open-source biomedical ontology in the area of coronavirus infectious disease. The CIDO is developed to provide standardized human- and computer-interpretable annotation and representation of various coronavirus infectious diseases, including their etiology, transmission, pathogenesis, diagnosis, prevention, and treatment.
OWL-DL
CIDO: A biomedical ontology in the area of coronavirus infectious disease.
CIDO: Ontology of Coronavirus Infectious Disease
- Muhui Ye
http://creativecommons.org/licenses/by/4.0/
- 1.0.369
+ 2024-02-16
@@ -371,14 +372,14 @@
- definition
definition
+ definition
textual definition
English language definitions of what NCI means by the concept. These are limited to 1024 characters. They may also include information about the definition's source and attribution in a form that can easily be interpreted by software.
The official OBI definition, explaining the meaning of a class or property. Shall be Aristotelian, formalized and normalized. Can be augmented with colloquial definitions.
- The official definition, explaining the meaning of a class or property. Shall be Aristotelian, formalized and normalized. Can be augmented with colloquial definitions.
The official definition, explaining the meaning of a class or property. Shall be Aristotelian, formalized and normalized. Can be augmented with colloquial definitions.
+ The official definition, explaining the meaning of a class or property. Shall be Aristotelian, formalized and normalized. Can be augmented with colloquial definitions.
The official definition.
2012-04-05:
Barry Smith
@@ -399,13 +400,33 @@ We don't have definitions of 'meaning' or 'expression'
Personally, I am more comfortable weakening definition to documentation, with instructions as to what is desirable.
+We also have the outstanding issue of how to aim different definitions to different audiences. A clinical audience reading chebi wants a different sort of definition documentation/definition from a chemistry trained audience, and similarly there is a need for a definition that is adequate for an ontologist to work with.
+ 2012-04-05:
+Barry Smith
+
+The official OBI definition, explaining the meaning of a class or property: 'Shall be Aristotelian, formalized and normalized. Can be augmented with colloquial definitions' is terrible.
+
+Can you fix to something like:
+
+A statement of necessary and sufficient conditions explaining the meaning of an expression referring to a class or property.
+
+Alan Ruttenberg
+
+Your proposed definition is a reasonable candidate, except that it is very common that necessary and sufficient conditions are not given. Mostly they are necessary, occasionally they are necessary and sufficient or just sufficient. Often they use terms that are not themselves defined and so they effectively can't be evaluated by those criteria.
+
+On the specifics of the proposed definition:
+
+We don't have definitions of 'meaning' or 'expression' or 'property'. For 'reference' in the intended sense I think we use the term 'denotation'. For 'expression', I think we you mean symbol, or identifier. For 'meaning' it differs for class and property. For class we want documentation that let's the intended reader determine whether an entity is instance of the class, or not. For property we want documentation that let's the intended reader determine, given a pair of potential relata, whether the assertion that the relation holds is true. The 'intended reader' part suggests that we also specify who, we expect, would be able to understand the definition, and also generalizes over human and computer reader to include textual and logical definition.
+
+Personally, I am more comfortable weakening definition to documentation, with instructions as to what is desirable.
+
We also have the outstanding issue of how to aim different definitions to different audiences. A clinical audience reading chebi wants a different sort of definition documentation/definition from a chemistry trained audience, and similarly there is a need for a definition that is adequate for an ontologist to work with.
PERSON:Daniel Schober
GROUP:OBI:<http://purl.obolibrary.org/obo/obi>
DEFINITION
- definition
definition
+ definition
textual definition
@@ -427,8 +448,8 @@ We also have the outstanding issue of how to aim different definitions to differ
1
editor_note
- editor note
editor note
+ editor note
@@ -446,10 +467,10 @@ We also have the outstanding issue of how to aim different definitions to differ
PERSON:Daniel Schober
GROUP:OBI:<http://purl.obolibrary.org/obo/obi>
+ definition editor
definition editor
term editor
term editor
- definition editor
@@ -457,12 +478,17 @@ We also have the outstanding issue of how to aim different definitions to differ
+ alternative label
alternative term
+ A label for a class or property that can be used to refer to the class or property instead of the preferred rdfs:label. Alternative labels should be used to indicate community- or context-specific labels, abbreviations, shorthand forms and the like.
An alternative name for a class or property which means the same thing as the preferred name (semantically equivalent)
+ OBO Operations committee
PERSON:Daniel Schober
GROUP:OBI:<http://purl.obolibrary.org/obo/obi>
+ Consider re-defing to: An alternative name for a class or property which can mean the same thing as the preferred name (semantically equivalent, narrow, broad or related).
+ alternative label
alternative term
alternative term
@@ -477,12 +503,12 @@ We also have the outstanding issue of how to aim different definitions to differ
Formal citation, e.g. identifier in external database to indicate / attribute source(s) for the definition. Free text indicate / attribute source(s) for the definition. EXAMPLE: Author Name, URI, MeSH Term C04, PUBMED ID, Wiki uri on 31.01.2007
formal citation, e.g. identifier in external database to indicate / attribute source(s) for the definition. Free text indicate / attribute source(s) for the definition. EXAMPLE: Author Name, URI, MeSH Term C04, PUBMED ID, Wiki uri on 31.01.2007
PERSON:Daniel Schober
+ Discussion on obo-discuss mailing-list, see http://bit.ly/hgm99w
Discussion on obo-discuss mailing-list, see http://bit.ly/hgm99w
GROUP:OBI:<http://purl.obolibrary.org/obo/obi>
- Discussion on obo-discuss mailing-list, see http://bit.ly/hgm99w
- definition source
definition source
+ definition source
@@ -587,8 +613,8 @@ We also have the outstanding issue of how to aim different definitions to differ
OBO foundry unique label
An alternative name for a class or property which is unique across the OBO Foundry.
- The intended usage of that property is as follow: OBO foundry unique labels are automatically generated based on regular expressions provided by each ontology, so that SO could specify unique label = 'sequence ' + [label], etc. , MA could specify 'mouse + [label]' etc. Upon importing terms, ontology developers can choose to use the 'OBO foundry unique label' for an imported term or not. The same applies to tools .
The intended usage of that property is as follow: OBO foundry unique labels are automatically generated based on regular expressions provided by each ontology, so that SO could specify unique label = 'sequence ' + [label], etc. , MA could specify 'mouse + [label]' etc. Upon importing terms, ontology developers can choose to use the 'OBO foundry unique label' for an imported term or not. The same applies to tools .
+ The intended usage of that property is as follow: OBO foundry unique labels are automatically generated based on regular expressions provided by each ontology, so that SO could specify unique label = 'sequence ' + [label], etc. , MA could specify 'mouse + [label]' etc. Upon importing terms, ontology developers can choose to use the 'OBO foundry unique label' for an imported term or not. The same applies to tools .
PERSON:Alan Ruttenberg
PERSON:Bjoern Peters
PERSON:Chris Mungall
@@ -1073,10 +1099,8 @@ where pmid1 and pmid2 are specfic PubMed IDs (PMIDs).
An assertion that involves at least one OWL object that is intended to be expanded into one or more logical axioms. The logical expansion can yield axioms expressed using any formal logical system, including, but not limited to OWL2-DL.
- logical macro assertion
logical macro assertion
http://purl.obolibrary.org/obo/ro/docs/shortcut-relations/
- https://github.com/oborel/obo-relations/wiki/ShortcutRelations
@@ -1085,7 +1109,6 @@ where pmid1 and pmid2 are specfic PubMed IDs (PMIDs).
A logical macro assertion whose domain is an IRI for a property
- logical macro assertion on a property
logical macro assertion on a property
@@ -1096,7 +1119,6 @@ where pmid1 and pmid2 are specfic PubMed IDs (PMIDs).
Used to annotate object properties to describe a logical meta-property or characteristic of the object property.
- logical macro assertion on an object property
logical macro assertion on an object property
@@ -1328,9 +1350,8 @@ Where we have an annotation assertion
An annotation property that represents the trade name of a product.
- YH
+ Oliver He
trade name
- trade name
@@ -1340,9 +1361,9 @@ Where we have an annotation assertion
The vaccine Prevnar (trade name) has a FDA-defined proper name: Pneumococcal 7-valent Conjugate Vaccine (Diphtheria CRM197 Protein). Reference: https://www.fda.gov/biologicsbloodvaccines/vaccines/approvedproducts/ucm180017.htm
An annotation property that represents the proper name of a vaccine, which is defined in an official way such as one defined by FDA.
- Oliver He, Kallan Roan
+ Kallan Roan
+ Oliver He
vaccine proper name
- vaccine proper name
@@ -1351,20 +1372,22 @@ Where we have an annotation assertion
The vaccine Prevnar has the manufacturer: Wyeth Pharmaceuticals Inc. Reference: https://www.fda.gov/biologicsbloodvaccines/vaccines/approvedproducts/ucm180017.htm
- An annotation property that represents the manufacturer of a product such as vaccine
- Oliver He, Kallan Roan
- manufacturer
- manufacturer
+ An annotation property that represents the manufacturer of a vaccine
+ Kallan Roan
+ Oliver He
+ vaccine manufacturer
-
+
-
- An identifier assigned by the Vaccine Adjuvant Compendium (VAC: https://vac.niaid.nih.gov/)
- https://vac.niaid.nih.gov/
- VAC adjuvant ID
+
+ An annotation property that refers to a specific CVX ID.
+ Oliver He
+ Penny Pan
+ https://www2a.cdc.gov/vaccines/iis/iisstandards/vaccines.asp?rpt=cvx
+ CVX code
@@ -1475,7 +1498,6 @@ Where we have an annotation assertion
Creator
Creator
- creator
@@ -1657,7 +1679,13 @@ Where we have an annotation assertion
+ An alternative label for a class or property which has a more general meaning than the preferred name/primary label.
+
+ https://github.com/information-artifact-ontology/ontology-metadata/issues/18
+ has broad synonym
has_broad_synonym
+ https://github.com/information-artifact-ontology/ontology-metadata/issues/18
+
@@ -1682,12 +1710,18 @@ Where we have an annotation assertion
- Fully qualified synonym, contains the string, term type, source, and an optional source code if appropriate. Each subfield is deliniated to facilitate interpretation by software.
+ An alternative label for a class or property which has the exact same meaning than the preferred name/primary label.
Exact synonym.
+ Fully qualified synonym, contains the string, term type, source, and an optional source code if appropriate. Each subfield is deliniated to facilitate interpretation by software.
+
+ https://github.com/information-artifact-ontology/ontology-metadata/issues/20
FULL_SYN
Synonym with Source Data
has exact synonym
+ has exact synonym
has_exact_synonym
+ https://github.com/information-artifact-ontology/ontology-metadata/issues/20
+
@@ -1695,7 +1729,13 @@ Where we have an annotation assertion
+ An alternative label for a class or property which has a more specific meaning than the preferred name/primary label.
+
+ https://github.com/information-artifact-ontology/ontology-metadata/issues/19
+ has narrow synonym
has_narrow_synonym
+ https://github.com/information-artifact-ontology/ontology-metadata/issues/19
+
@@ -1721,18 +1761,18 @@ Where we have an annotation assertion
+ An alternative label for a class or property that has been used synonymously with the primary term name, but the usage is not strictly correct.
Has related synonym.
+
+ https://github.com/information-artifact-ontology/ontology-metadata/issues/21
+ has related synonym
has_related_synonym
+ https://github.com/information-artifact-ontology/ontology-metadata/issues/21
+
-
-
-
-
-
-
@@ -1741,12 +1781,6 @@ Where we have an annotation assertion
-
-
-
-
-
-
@@ -1760,8 +1794,8 @@ Where we have an annotation assertion
- Used to associate the concept defining a particular terminology subset with concepts that belong to this subset.
In subset.
+ Used to associate the concept defining a particular terminology subset with concepts that belong to this subset.
Concept_In_Subset
in subset
in_subset
@@ -1886,12 +1920,6 @@ Where we have an annotation assertion
-
-
-
-
-
-
@@ -2324,10 +2352,10 @@ A continuant cannot be part of an occurrent: use 'participates in'. An
part_of
is part of
- part of
- part_of
part of
+ part of
part_of
+ part_of
http://www.obofoundry.org/ro/#OBO_REL:part_of
@@ -2374,8 +2402,8 @@ A continuant cannot have an occurrent as part: use 'participates in'.
false
has_part
- has part
has part
+ has part
has_part
@@ -2441,7 +2469,6 @@ A continuant cannot have an occurrent as part: use 'participates in'.
realized_in
-
http://purl.obolibrary.org/obo/ro.owl
[copied from inverse property 'realizes'] to say that b realizes c at t is to assert that there is some material entity d & b is a process which has participant d at t & c is a disposition or role of which d is bearer_of at t& the type instantiated by b is correlated with the type instantiated by c. (axiom label in BFO2 Reference: [059-003])
@@ -2463,11 +2490,9 @@ A continuant cannot have an occurrent as part: use 'participates in'.
this shattering realizes this fragility
-
to say that b realizes c at t is to assert that there is some material entity d & b is a process which has participant d at t & c is a disposition or role of which d is bearer_of at t& the type instantiated by b is correlated with the type instantiated by c. (axiom label in BFO2 Reference: [059-003])
Paraphrase of elucidation: a relation between a process and a realizable entity, where there is some material entity that is bearer of the realizable entity and participates in the process, and the realizable entity comes to be realized in the course of the process
-
realizes
@@ -4288,10 +4313,8 @@ Some currently missing phenomena that should be considered "about" are
person:Alan Ruttenberg
Smith, Ceusters, Ruttenberg, 2000 years of philosophy
-
-
http://purl.obolibrary.org/obo/iao.owl
is about
is about
@@ -4318,11 +4341,12 @@ Some currently missing phenomena that should be considered "about" are
- has_specified_input
has_specified_input
+ has_specified_input
see is_input_of example_of_usage
A relation between a planned process and a continuant participating in that process that is not created during the process. The presence of the continuant during the process is explicitly specified in the plan specification which the process realizes the concretization of.
+ The inverse property of is_specified_input_of
8/17/09: specified inputs of one process are not necessarily specified inputs of a larger process that it is part of. This is in contrast to how 'has participant' works.
PERSON: Alan Ruttenberg
PERSON: Bjoern Peters
@@ -4341,8 +4365,8 @@ Some currently missing phenomena that should be considered "about" are
- is_specified_input_of
is_specified_input_of
+ is_specified_input_of
some Autologous EBV(Epstein-Barr virus)-transformed B-LCL (B lymphocyte cell line) is_input_for instance of Chromum Release Assay described at https://wiki.cbil.upenn.edu/obiwiki/index.php/Chromium_Release_assay
A relation between a planned process and a continuant participating in that process that is not created during the process. The presence of the continuant during the process is explicitly specified in the plan specification which the process realizes the concretization of.
@@ -4367,10 +4391,11 @@ Some currently missing phenomena that should be considered "about" are
- has_specified_output
has_specified_output
+ has_specified_output
A relation between a planned process and a continuant participating in that process. The presence of the continuant at the end of the process is explicitly specified in the objective specification which the process realizes the concretization of.
+ The inverse property of is_specified_output_of
PERSON: Alan Ruttenberg
PERSON: Bjoern Peters
PERSON: Larry Hunter
@@ -4386,15 +4411,6 @@ Some currently missing phenomena that should be considered "about" are
-
-
-
-
-
-
-
-
-
is_manufactured_by
http://www.affymetrix.com/products/arrays/specific/hgu133.affx is_manufactered_by http://www.affymetrix.com/ (if we decide to use these URIs for the actual entities)
@@ -4415,8 +4431,8 @@ Some currently missing phenomena that should be considered "about" are
- is_specified_output_of
is_specified_output_of
+ is_specified_output_of
A relation between a planned process and a continuant participating in that process. The presence of the continuant at the end of the process is explicitly specified in the objective specification which the process realizes the concretization of.
Alan Ruttenberg
@@ -4451,6 +4467,7 @@ Some currently missing phenomena that should be considered "about" are
+
achieves_planned_objective
@@ -4495,7 +4512,6 @@ Some currently missing phenomena that should be considered "about" are
OBI
OBI
-
objective_achieved_by
@@ -4637,7 +4653,10 @@ Some currently missing phenomena that should be considered "about" are
inheres in
this fragility inheres in this vase
+ this fragility is a characteristic of this vase
this red color inheres in this apple
+ this red color is a characteristic of this apple
+ a relation between a specifically dependent continuant (the characteristic) and any other entity (the bearer), in which the characteristic depends on the bearer for its existence.
a relation between a specifically dependent continuant (the dependent) and an independent continuant (the bearer), in which the dependent specifically depends on the bearer for its existence
A dependent inheres in its bearer at all times for which the dependent exists.
inheres_in
@@ -4647,6 +4666,7 @@ Some currently missing phenomena that should be considered "about" are
http://purl.obolibrary.org/obo/ro.owl
+ Note that this relation was previously called "inheres in", but was changed to be called "characteristic of" because BFO2 uses "inheres in" in a more restricted fashion. This relation differs from BFO2:inheres_in in two respects: (1) it does not impose a range constraint, and thus it allows qualities of processes, as well as of information entities, whereas BFO2 restricts inheres_in to only apply to independent continuants (2) it is declared functional, i.e. something can only be a characteristic of one thing.
characteristic of
inheres in
@@ -4656,10 +4676,12 @@ Some currently missing phenomena that should be considered "about" are
+
bearer of
this apple is bearer of this red color
this vase is bearer of this fragility
+ Inverse of characteristic_of
a relation between an independent continuant (the bearer) and a specifically dependent continuant (the dependent), in which the dependent specifically depends on the bearer for its existence
A bearer can have many dependents, and its dependents can exist for different periods of time, but none of its dependents can exist when the bearer does not exist.
bearer_of
@@ -4670,6 +4692,7 @@ Some currently missing phenomena that should be considered "about" are
bearer of
+ has characteristic
@@ -4677,6 +4700,7 @@ Some currently missing phenomena that should be considered "about" are
+
participates in
@@ -4713,6 +4737,7 @@ Some currently missing phenomena that should be considered "about" are
http://purl.obolibrary.org/obo/ro.owl
http://www.obofoundry.org/ro/#OBO_REL:has_participant
+ http://www.obofoundry.org/ro/#OBO_REL:has_participant
has participant
has_participant
@@ -4730,7 +4755,6 @@ Some currently missing phenomena that should be considered "about" are
A relationship between a specifically dependent continuant and a generically dependent continuant, in which the generically dependent continuant depends on some independent continuant in virtue of the fact that the specifically dependent continuant also depends on that same independent continuant. Multiple specifically dependent continuants can concretize the same generically dependent continuant.
-
concretizes
@@ -4764,9 +4788,9 @@ Some currently missing phenomena that should be considered "about" are
A role inheres in its bearer at all times for which the role exists, however the role need not be realized at all the times that the role exists.
is role of
role_of
-
+ This relation is modeled after the BFO relation of the same name which was in BFO2, but is used in a more restricted sense - specifically, we model this relation as functional (inherited from characteristic-of). Note that this relation is now removed from BFO2020.
role of
@@ -4828,8 +4852,8 @@ Some currently missing phenomena that should be considered "about" are
false
false
has_role
- has role
has role
+ has role
@@ -4941,6 +4965,7 @@ Some currently missing phenomena that should be considered "about" are
+
@@ -4968,13 +4993,14 @@ Some currently missing phenomena that should be considered "about" are
this rat is located in this cage
a relation between two independent continuants, the target and the location, in which the target is entirely within the location
Location as a relation between instances: The primitive instance-level relation c located_in r at t reflects the fact that each continuant is at any given time associated with exactly one spatial region, namely its exact location. Following we can use this relation to define a further instance-level location relation - not between a continuant and the region which it exactly occupies, but rather between one continuant and another. c is located in c1, in this sense, whenever the spatial region occupied by c is part_of the spatial region occupied by c1. Note that this relation comprehends both the relation of exact location between one continuant and another which obtains when r and r1 are identical (for example, when a portion of fluid exactly fills a cavity), as well as those sorts of inexact location relations which obtain, for example, between brain and head or between ovum and uterus
+ Most location relations will only hold at certain times, but this is difficult to specify in OWL. See http://purl.obolibrary.org/obo/ro/docs/temporal-semantics/
Most location relations will only hold at certain times, but this is difficult to specify in OWL. See https://code.google.com/p/obo-relations/wiki/ROAndTime
located_in
-
http://www.obofoundry.org/ro/#OBO_REL:located_in
+ http://www.obofoundry.org/ro/#OBO_REL:located_in
located in
@@ -5616,14 +5642,16 @@ Some currently missing phenomena that should be considered "about" are
- q inheres in part of w if and only if there exists some p such that q inheres in p and p part of w.
- Because part_of is transitive, inheres in is a sub-relation of inheres in part of
- Chris Mungall
+ q characteristic of part of w if and only if there exists some p such that q inheres in p and p part of w.
+ Because part_of is transitive, inheres in is a sub-relation of characteristic of part of
+
+ inheres in part of
- inheres in part of
+ characteristic of part of
+
@@ -6166,10 +6194,11 @@ For example, A and B may be gene products and binding of B by A positively regul
- Chris Mungall
+
depends on
+
@@ -7461,24 +7490,13 @@ For example, protein A (transcription factor) indirectly increases by expression
-
-
-
-
- an object property that specifies a process that is induced by vaccination of a vaccine
- YH
-
- induced by vaccination of
-
-
-
-
- an object property that defines a relation between a vaccine and its component
- YL, YH
+ An object property that defines a relation between a vaccine and its component
+ Asiyah Yu Lin
+ Oliver He
has vaccine component
@@ -7488,35 +7506,24 @@ For example, protein A (transcription factor) indirectly increases by expression
-
- an object property that specifies a vaccine antigen
- YL, YH
+ An object property that specifies a vaccine antigen
+ This relation only works for those vaccine antigen that is physically part of a vaccine preparation. It does not include those antigens that are not part of vaccine. For example, a protein antigen expressed in a DNA vaccine is not a part of vaccine pe ser. In this case, the vaccine expresses the protein, but the gene is part of the vaccine, not the protein. For the case, we can use the relation 'DNA vaccine expresses protein antigen' under the relation 'expresses'.
+ Asiyah Yu Lin
+ Oliver He
- This relation only works for those vaccine antigen that is physically part of a vaccine preparation. It does not include those antigens that are not part of vaccine. For example, a protein antigen expressed in a DNA vaccine is not a part of vaccine pe ser. In this case, the vaccine expresses the protein, but the gene is part of the vaccine, not the protein. For the case, we can use the relation 'DNA vaccine expresses protein antigen' under the relation 'expresses'.
has vaccine antigen
-
-
-
-
- a type of 'has vaccine component' relation that is specifically for vaccine adjuvant component
- YL, YH
-
- has vaccine adjuvant
-
-
-
-
- a type of 'has vaccine component' relation that is specifically for vaccine vector component
- YL, YH
+ A type of 'has vaccine component' relation that is specifically for vaccine vector component
+ Asiyah Yu Lin
+ Oliver He
has vaccine vector
@@ -7528,8 +7535,8 @@ For example, protein A (transcription factor) indirectly increases by expression
+ An object property that specifies a relation between a vaccine and a vaccinate route
- an object property that specifies a relation between a vaccine and a vaccinate route
vaccinated in route
@@ -7540,12 +7547,12 @@ For example, protein A (transcription factor) indirectly increases by expression
- a shortcut relation that equals to:
+ A shortcut relation that equals to:
'processed material' and (is_specified_output_of some 'vaccine preparation') and ('has function' some ('vaccine function' and ('is realized by' only ('vaccine immunization' and (realizes some ('vaccine host role' and (role_of some 'organism')))))))).
The domain of this relation is a vaccine.
The range of this relation is a organism.
- YL
- Yongqun He
+ Asiyah Yu Lin
+ Oliver He
immunization for host
vaccine immunization for host
@@ -7557,17 +7564,31 @@ The range of this relation is a organism.
- a shortcut relation that equals to:
-
-processed material and (is_specified_output_of some vaccine preparation) and (has function some (vaccine function and (is realized by only (vaccine immunization and (realizes some ('immunization target role' and (role_of some 'MICROBE'))))))))
+
+
+
+
+
+
+
+
+
+
+
+
+ A shortcut relation that equals to:
+processed material and (is_specified_output_of some vaccine preparation) and (has function some (vaccine function and (is realized by only (vaccine immunization and (realizes some ('immunization target role' and (role_of some 'pathogen'))))))))
-The domain of this relation is a vaccine.
-The range of this relation is a microbe (a bacterium, a virus, a fungus, and a parasite)
- Yongqun He
- immunization against microbe
- vaccine immunization against microbe
+The domain of this relation is a vaccine.
+The range of this relation is a pathogen (a bacterium, a virus, a fungus, and a parasite)
+Ranges: organism and 'has role' some 'pathogen role'
+ Oliver He
+ immunization against pathogen
+ immunizes against microbe
+ vaccine immunization against pathogen
+ https://github.com/vaccineontology/VO/issues/675
- immunizes against microbe
+ immunizes against pathogen
@@ -7587,20 +7608,10 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
An object property that represents a relation between a material entity and biological process
- Anthony Huffman, Oliver He
-
- up-expressed as immune signature of
-
-
-
-
-
-
-
- An object property that represents a relation between a material entity (such as vaccine or vaccine adjuvant) and an immune profile where the material entity can induce the immune profile in a host.
- Oliver He, Amogh Madireddi
+ Anthony Huffman
+ Oliver He
- induces immune profile
+ up-expressed as immune signature of
@@ -7750,8 +7761,8 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
http://purl.org/obo/owl/relationship
OBO_REL:0000007
relationship
- has_proper_part
has_proper_part
+ has_proper_part
@@ -27752,7 +27763,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
your body mass index
BFO 2 Reference: In all areas of empirical inquiry we encounter general terms of two sorts. First are general terms which refer to universals or types:animaltuberculosissurgical procedurediseaseSecond, are general terms used to refer to groups of entities which instantiate a given universal but do not correspond to the extension of any subuniversal of that universal because there is nothing intrinsic to the entities in question by virtue of which they – and only they – are counted as belonging to the given group. Examples are: animal purchased by the Emperortuberculosis diagnosed on a Wednesdaysurgical procedure performed on a patient from Stockholmperson identified as candidate for clinical trial #2056-555person who is signatory of Form 656-PPVpainting by Leonardo da VinciSuch terms, which represent what are called ‘specializations’ in [81
Entity doesn't have a closure axiom because the subclasses don't necessarily exhaust all possibilites. For example Werner Ceusters 'portions of reality' include 4 sorts, entities (as BFO construes them), universals, configurations, and relations. It is an open question as to whether entities as construed in BFO will at some point also include these other portions of reality. See, for example, 'How to track absolutely everything' at http://www.referent-tracking.com/_RTU/papers/CeustersICbookRevised.pdf
-
@@ -27772,7 +27782,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
An entity is anything that exists or has existed or will exist. (axiom label in BFO2 Reference: [001-001])
- entity
entity
@@ -27785,11 +27794,9 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
continuant
Continuant
continuant
- An entity that exists in full at any time in which it exists at all, persists through time while maintaining its identity and has no temporal parts.
An entity that exists in full at any time in which it exists at all, persists through time while maintaining its identity and has no temporal parts.
BFO 2 Reference: Continuant entities are entities which can be sliced to yield parts only along the spatial dimension, yielding for example the parts of your table which we call its legs, its top, its nails. ‘My desk stretches from the window to the door. It has spatial parts, and can be sliced (in space) in two. With respect to time, however, a thing is a continuant.’ [60, p. 240
Continuant doesn't have a closure axiom because the subclasses don't necessarily exhaust all possibilites. For example, in an expansion involving bringing in some of Ceuster's other portions of reality, questions are raised as to whether universals are continuants
-
@@ -27816,7 +27823,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
(forall (x) (if (Continuant x) (Entity x))) // axiom label in BFO2 CLIF: [008-002]
(forall (x) (if (Material Entity x) (exists (t) (and (TemporalRegion t) (existsAt x t))))) // axiom label in BFO2 CLIF: [011-002]
- continuant
continuant
@@ -27834,7 +27840,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
BFO 2 Reference: s-dependence obtains between every process and its participants in the sense that, as a matter of necessity, this process could not have existed unless these or those participants existed also. A process may have a succession of participants at different phases of its unfolding. Thus there may be different players on the field at different times during the course of a football game; but the process which is the entire game s-depends_on all of these players nonetheless. Some temporal parts of this process will s-depend_on on only some of the players.
Occurrent doesn't have a closure axiom because the subclasses don't necessarily exhaust all possibilites. An example would be the sum of a process and the process boundary of another process.
Simons uses different terminology for relations of occurrents to regions: Denote the spatio-temporal location of a given occurrent e by 'spn[e]' and call this region its span. We may say an occurrent is at its span, in any larger region, and covers any smaller region. Now suppose we have fixed a frame of reference so that we can speak not merely of spatio-temporal but also of spatial regions (places) and temporal regions (times). The spread of an occurrent, (relative to a frame of reference) is the space it exactly occupies, and its spell is likewise the time it exactly occupies. We write 'spr[e]' and `spl[e]' respectively for the spread and spell of e, omitting mention of the frame.
-
@@ -27881,7 +27886,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
the interior of your mouth
A continuant that is a bearer of quality and realizable entity entities, in which other entities inhere and which itself cannot inhere in anything.
b is an independent continuant = Def. b is a continuant which is such that there is no c and no t such that b s-depends_on c at t. (axiom label in BFO2 Reference: [017-002])
-
@@ -27900,6 +27904,7 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
(forall (x t) (if (IndependentContinuant x) (exists (r) (and (SpatialRegion r) (locatedInAt x r t))))) // axiom label in BFO2 CLIF: [134-001]
(forall (x t) (if (and (IndependentContinuant x) (existsAt x t)) (exists (y) (and (Entity y) (specificallyDependsOnAt y x t))))) // axiom label in BFO2 CLIF: [018-002]
(iff (IndependentContinuant a) (and (Continuant a) (not (exists (b t) (specificallyDependsOnAt a b t))))) // axiom label in BFO2 CLIF: [017-002]
+ A continuant that is a bearer of quality and realizable entity entities, in which other entities inhere and which itself cannot inhere in anything.
independent continuant
@@ -27994,7 +27999,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
An occurrent that has temporal proper parts and for some time t, p s-depends_on some material entity at t.
p is a process = Def. p is an occurrent that has temporal proper parts and for some time t, p s-depends_on some material entity at t. (axiom label in BFO2 Reference: [083-003])
BFO 2 Reference: The realm of occurrents is less pervasively marked by the presence of natural units than is the case in the realm of independent continuants. Thus there is here no counterpart of ‘object’. In BFO 1.0 ‘process’ served as such a counterpart. In BFO 2.0 ‘process’ is, rather, the occurrent counterpart of ‘material entity’. Those natural – as contrasted with engineered, which here means: deliberately executed – units which do exist in the realm of occurrents are typically either parasitic on the existence of natural units on the continuant side, or they are fiat in nature. Thus we can count lives; we can count football games; we can count chemical reactions performed in experiments or in chemical manufacturing. We cannot count the processes taking place, for instance, in an episode of insect mating behavior.Even where natural units are identifiable, for example cycles in a cyclical process such as the beating of a heart or an organism’s sleep/wake cycle, the processes in question form a sequence with no discontinuities (temporal gaps) of the sort that we find for instance where billiard balls or zebrafish or planets are separated by clear spatial gaps. Lives of organisms are process units, but they too unfold in a continuous series from other, prior processes such as fertilization, and they unfold in turn in continuous series of post-life processes such as post-mortem decay. Clear examples of boundaries of processes are almost always of the fiat sort (midnight, a time of death as declared in an operating theater or on a death certificate, the initiation of a state of war)
-
@@ -28012,6 +28016,7 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
(iff (Process a) (and (Occurrent a) (exists (b) (properTemporalPartOf b a)) (exists (c t) (and (MaterialEntity c) (specificallyDependsOnAt a c t))))) // axiom label in BFO2 CLIF: [083-003]
+ An occurrent that has temporal proper parts and for some time t, p s-depends_on some material entity at t.
process
@@ -28034,7 +28039,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
BFO 2 Reference: Dispositions exist along a strength continuum. Weaker forms of disposition are realized in only a fraction of triggering cases. These forms occur in a significant number of cases of a similar type.
-
@@ -28066,7 +28070,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
-
@@ -28132,7 +28135,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
the role of being a doctor
the shape of this hole.
the smell of this portion of mozzarella
- A continuant that inheres in or is borne by other entities. Every instance of A requires some specific instance of B which must always be the same.
A continuant that inheres in or is borne by other entities. Every instance of A requires some specific instance of B which must always be the same.
b is a relational specifically dependent continuant = Def. b is a specifically dependent continuant and there are n > 1 independent continuants c1, … cn which are not spatial regions are such that for all 1 i < j n, ci and cj share no common parts, are such that for each 1 i n, b s-depends_on ci at every time t during the course of b’s existence (axiom label in BFO2 Reference: [131-004])
b is a specifically dependent continuant = Def. b is a continuant & there is some independent continuant c which is not a spatial region and which is such that b s-depends_on c at every time t during the course of b’s existence. (axiom label in BFO2 Reference: [050-003])
@@ -28155,6 +28157,7 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
(iff (RelationalSpecificallyDependentContinuant a) (and (SpecificallyDependentContinuant a) (forall (t) (exists (b c) (and (not (SpatialRegion b)) (not (SpatialRegion c)) (not (= b c)) (not (exists (d) (and (continuantPartOfAt d b t) (continuantPartOfAt d c t)))) (specificallyDependsOnAt a b t) (specificallyDependsOnAt a c t)))))) // axiom label in BFO2 CLIF: [131-004]
(iff (SpecificallyDependentContinuant a) (and (Continuant a) (forall (t) (if (existsAt a t) (exists (b) (and (IndependentContinuant b) (not (SpatialRegion b)) (specificallyDependsOnAt a b t))))))) // axiom label in BFO2 CLIF: [050-003]
+ A continuant that inheres in or is borne by other entities. Every instance of A requires some specific instance of B which must always be the same.
specifically dependent continuant
@@ -28274,7 +28277,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
your left nostril (a fiat part – the opening – of your left nasal cavity)
-
@@ -28336,6 +28338,7 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
(iff (GenericallyDependentContinuant a) (and (Continuant a) (exists (b t) (genericallyDependsOnAt a b t)))) // axiom label in BFO2 CLIF: [074-001]
+ A continuant that is dependent on one or other independent continuant bearers. For every instance of A requires some instance of (an independent continuant type) B but which instance of B serves can change from time to time.
generically dependent continuant
@@ -28426,8 +28429,8 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
BFO 2 Reference: Material entities (continuants) can preserve their identity even while gaining and losing material parts. Continuants are contrasted with occurrents, which unfold themselves in successive temporal parts or phases [60
BFO 2 Reference: Object, Fiat Object Part and Object Aggregate are not intended to be exhaustive of Material Entity. Users are invited to propose new subcategories of Material Entity.
BFO 2 Reference: ‘Matter’ is intended to encompass both mass and energy (we will address the ontological treatment of portions of energy in a later version of BFO). A portion of matter is anything that includes elementary particles among its proper or improper parts: quarks and leptons, including electrons, as the smallest particles thus far discovered; baryons (including protons and neutrons) at a higher level of granularity; atoms and molecules at still higher levels, forming the cells, organs, organisms and other material entities studied by biologists, the portions of rock studied by geologists, the fossils studied by paleontologists, and so on.Material entities are three-dimensional entities (entities extended in three spatial dimensions), as contrasted with the processes in which they participate, which are four-dimensional entities (entities extended also along the dimension of time).According to the FMA, material entities may have immaterial entities as parts – including the entities identified below as sites; for example the interior (or ‘lumen’) of your small intestine is a part of your body. BFO 2.0 embodies a decision to follow the FMA here.
-
+
@@ -28437,6 +28440,7 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
+
A material entity is an independent continuant that has some portion of matter as proper or improper continuant part. (axiom label in BFO2 Reference: [019-002])
Every entity which has a material entity as continuant part is a material entity. (axiom label in BFO2 Reference: [020-002])
@@ -28477,7 +28481,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
The simplest type of process profiles are what we shall call ‘quality process profiles’, which are the process profiles which serve as the foci of the sort of selective abstraction that is involved when measurements are made of changes in single qualities, as illustrated, for example, by process profiles of mass, temperature, aortic pressure, and so on.
b is a process_profile =Def. there is some process c such that b process_profile_of c (axiom label in BFO2 Reference: [093-002])
-
b process_profile_of c holds when b proper_occurrent_part_of c& there is some proper_occurrent_part d of c which has no parts in common with b & is mutually dependent on b& is such that b, c and d occupy the same temporal region (axiom label in BFO2 Reference: [094-005])
(forall (x y) (if (processProfileOf x y) (and (properContinuantPartOf x y) (exists (z t) (and (properOccurrentPartOf z y) (TemporalRegion t) (occupiesSpatioTemporalRegion x t) (occupiesSpatioTemporalRegion y t) (occupiesSpatioTemporalRegion z t) (not (exists (w) (and (occurrentPartOf w x) (occurrentPartOf w z))))))))) // axiom label in BFO2 CLIF: [094-005]
(iff (ProcessProfile a) (exists (b) (and (Process b) (processProfileOf a b)))) // axiom label in BFO2 CLIF: [093-002]
@@ -31663,7 +31666,6 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
602.585
602.22540
[C@]1(O[C@@H]([C@H]([C@H]1O)O)CO[P@@](N[C@H](C(OCC(CC)CC)=O)C)(OC=2C=CC=CC2)=O)(C#N)C=3N4N=CN=C(C4=CC3)N
- PubChem CID: 121304016
CAS:1809249-37-3
DrugBank:DB14761
KEGG:D11472
@@ -31684,6 +31686,7 @@ The range of this relation is a microbe (a bacterium, a virus, a fungus, and a p
PMID:32145386
PMID:32147516
PMID:32152082
+ PubChem CID: 121304016
Wikipedia:Remdesivir
2-ethylbutyl N-[(S)-{[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxytetrahydrofuran-2-yl]methoxy}(phenoxy)phosphoryl]-L-alaninate
chebi_ontology
@@ -100704,36 +100707,6 @@ results from evaporation of droplets coughed or sneezed into the atmosphere or b
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
Anthony Huffman, Oliver He
https://pubmed.ncbi.nlm.nih.gov/32753554/
SLLIVNNATNVVIKV
@@ -558418,18 +558391,29 @@ POC: https://www.fda.gov/media/136315/download
- cell
cell
PMID:18089833.Cancer Res. 2007 Dec 15;67(24):12018-25. "...Epithelial cells were harvested from histologically confirmed adenocarcinomas .."
A material entity of anatomical origin (part of or deriving from an organism) that has as its parts a maximally connected cell compartment surrounded by a plasma membrane.
- cell
cell
+
+
+
+
+ native cell
+ A cell that is found in a natural setting, which includes multicellular organism cells 'in vivo' (i.e. part of an organism), and unicellular organisms 'in environment' (i.e. part of a natural environment).
+
+
+ native cell
+
+
+
+
@@ -558521,6 +558505,33 @@ POC: https://www.fda.gov/media/136315/download
+
+
+
+
+ mononuclear cell
+ A leukocyte with a single non-segmented nucleus in the mature form.
+
+
+ mononuclear cell
+
+
+
+
+
+
+
+
+
+ peripheral blood mononuclear cell
+ A leukocyte with a single non-segmented nucleus in the mature form found in the circulatory pool of blood.
+
+
+ peripheral blood mononuclear cell
+
+
+
+
@@ -558970,10 +558981,10 @@ POC: https://www.fda.gov/media/136315/download
UMLS_CUI:C5203670
2019 Novel Coronavirus (2019-nCoV)
2019-nCoV infection
- Wuhan coronavirus infection
- Wuhan seafood market pneumonia virus infection
COVID19
SARS-CoV-2 infection
+ Wuhan coronavirus infection
+ Wuhan seafood market pneumonia virus infection
disease_ontology
DOID:0080600
COVID-19
@@ -559100,8 +559111,8 @@ POC: https://www.fda.gov/media/136315/download
DOID:0060208
OMIM:600795
- FTD3
CHMP2B-related frontotemporal dementia
+ FTD3
amyotrophic lateral sclerosis type 17
disease_ontology
DOID:0111227
@@ -559260,8 +559271,8 @@ POC: https://www.fda.gov/media/136315/download
ARDS
Non-cardiogenic pulmonary edema
Shock lung
- adult RDS
acute respiratory distress syndrome
+ adult RDS
disease_ontology
DOID:11394
@@ -559653,8 +559664,8 @@ POC: https://www.fda.gov/media/136315/download
NCI:C3389
SNOMEDCT_US_2021_09_01:192415000
UMLS_CUI:C0038436
- traumatic neurosis
PTSD
+ traumatic neurosis
disease_ontology
post-traumatic stress disorder
DOID:2055
@@ -560979,8 +560990,8 @@ OMIM mapping confirmed by DO. [SN].
William R. Hogan
mu agonist
- function-activating mu receptor binding disposition
function-activating mu receptor binding disposition
+ function-activating mu receptor binding disposition
@@ -567166,7 +567177,6 @@ OMIM mapping confirmed by DO. [SN].
-
immune response
@@ -567174,11 +567184,10 @@ OMIM mapping confirmed by DO. [SN].
-
biological_process
GO:0006955
+
- This term was improved by GO_REF:0000022. It was redefined and moved.
immune response
@@ -568751,7 +568760,9 @@ OMIM mapping confirmed by DO. [SN].
biological_process
+ A biological process is the execution of a genetically-encoded biological module or program. It consists of all the steps required to achieve the specific biological objective of the module. A biological process is accomplished by a particular set of molecular functions carried out by specific gene products (or macromolecular complexes), often in a highly regulated manner and in a particular temporal sequence.
A biological process represents a specific objective that the organism is genetically programmed to achieve. Biological processes are often described by their outcome or ending state, e.g., the biological process of cell division results in the creation of two daughter cells (a divided cell) from a single parent cell. A biological process is accomplished by a particular set of molecular functions carried out by specific gene products (or macromolecular complexes), often in a highly regulated manner and in a particular temporal sequence.
+ https://github.com/geneontology/go-ontology/issues/24968
@@ -568767,6 +568778,13 @@ OMIM mapping confirmed by DO. [SN].
single organism process
single-organism process
GO:0008150
+
+
+
+
+
+
+
@@ -577124,6 +577142,12 @@ OMIM mapping confirmed by DO. [SN].
physiological response to stimulus
biological_process
GO:0050896
+
+
+
+
+
+
@@ -580752,8 +580776,8 @@ OMIM mapping confirmed by DO. [SN].
UMLS:C1290857
UMLS:C4025871
Abnormal face
- Facial abnormality
Abnormality of the face
+ Facial abnormality
Disorder of the face
human_phenotype
Anomaly of face
@@ -580777,10 +580801,10 @@ OMIM mapping confirmed by DO. [SN].
UMLS:C0240547
UMLS:C0265736
UMLS:C2235909
+ Abnormality of the nose
Anomaly of the nose
Nasal abnormality
Nasal anomaly
- Abnormality of the nose
Deformity of the nose
Malformation of the nose
Nasal deformity
@@ -580961,8 +580985,8 @@ OMIM mapping confirmed by DO. [SN].
MSH:D007037
SNOMEDCT_US:40930008
UMLS:C0020676
- Underactive thyroid
Low T4
+ Underactive thyroid
human_phenotype
HP:0000821
Hypothyroidism
@@ -581177,8 +581201,8 @@ OMIM mapping confirmed by DO. [SN].
MSH:D001168
SNOMEDCT_US:3723001
UMLS:C0003864
- Joint inflammation
Arthritis
+ Joint inflammation
human_phenotype
HP:0001369
Arthritis
@@ -581214,8 +581238,8 @@ OMIM mapping confirmed by DO. [SN].
MSH:D008103
SNOMEDCT_US:19943007
UMLS:C0023890
- Scar tissue replaces healthy tissue in the liver
Hepatic cirrhosis
+ Scar tissue replaces healthy tissue in the liver
Liver cirrhosis
HP:0001394
Cirrhosis is caused by chronic liver disease as a result of viral infections (hepatitis), alcohol abuse, certain medications, certain metabolic disorders of iron and copper, and many others. Cirrhosis may lead to a number of abnormalities including hepatomegaly, jaundice, abnormal liver function tests, ascites, dilatation of veins in the abdominal wall, anemia, and clotting deficiencies.
@@ -581295,14 +581319,14 @@ OMIM mapping confirmed by DO. [SN].
UMLS:C0018798
UMLS:C0152021
Abnormality of cardiac morphology
+ Abnormality of the heart
Abnormally shaped heart
+ Cardiac abnormality
+ Cardiac anomalies
Cardiac anomaly
Congenital heart defect
Congenital heart defects
Heart defect
- Abnormality of the heart
- Cardiac abnormality
- Cardiac anomalies
human_phenotype
HP:0001627
Abnormal heart morphology
@@ -581323,10 +581347,10 @@ OMIM mapping confirmed by DO. [SN].
UMLS:C0018801
UMLS:C0018802
CHF
- Cardiac failures
- Chronic heart failure
Cardiac failure
+ Cardiac failures
Cardiac insufficiency
+ Chronic heart failure
Heart failure
human_phenotype
HP:0001635
@@ -581447,8 +581471,8 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:53741008
UMLS:C1956346
Coronary atherosclerosis
- Plaque build-up in arteries supplying blood to heart
Coronary disease
+ Plaque build-up in arteries supplying blood to heart
human_phenotype
HP:0001677
Coronary artery disease, also called atherosclerotic heart disease, is the result of atheromatous plaques within the coronary arteries leading to myocardial ischemia and infarction.
@@ -581596,9 +581620,9 @@ OMIM mapping confirmed by DO. [SN].
UMLS:C0027429
Blockage of nose
Nasal blockage
+ Nasal obstruction
Obstruction of nose
Stuffy nose
- Nasal obstruction
Congestion of nose
Nasal congestion
human_phenotype
@@ -581644,8 +581668,8 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:134199001
SNOMEDCT_US:24827003
UMLS:C0152009
- Abnormality of leukocytes
Abnormal leukocyte function
+ Abnormality of leukocytes
human_phenotype
HP:0001881
Leukocytes are nucleated cells of the myeloid or lymphoid lineages, found in blood or other tissue.
@@ -581748,9 +581772,9 @@ OMIM mapping confirmed by DO. [SN].
+ HP:0002146
HP:0004355
HP:0004367
- HP:0002146
UMLS:C4021768
Laboratory abnormality
Metabolism abnormality
@@ -581775,12 +581799,12 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:386661006
SNOMEDCT_US:50177009
UMLS:C0015967
- elevated body temperature
- febris
- high body temperature
Fever
Hyperthermia
Pyrexia
+ elevated body temperature
+ febris
+ high body temperature
human_phenotype
HP:0001945
Hyperthermia is defined as a temperature greater than 37.5-38.3 degree celsius (100-101 degree Fahrenheit).
@@ -581840,9 +581864,9 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:23853001
UMLS:C0007682
UMLS:C4021765
+ Abnormality of the central nervous system
Morphological abnormality of the CNS
Morphological abnormality of the central nervous system
- Abnormality of the central nervous system
Central nervous system disease
HP:0002011
Morphological central nervous system abnormality
@@ -581863,8 +581887,8 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:300359004
SNOMEDCT_US:422400008
UMLS:C0042963
- Throwing up
Emesis
+ Throwing up
Vomiting
human_phenotype
HP:0002013
@@ -581885,13 +581909,13 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:267060006
SNOMEDCT_US:62315008
UMLS:C0011991
+ Diarrhea
Diarrhoea
Watery stool
diarhea
diarhoea
loose bowel movement
loose stool
- Diarrhea
human_phenotype
HP:0002014
Diarrhea
@@ -581947,9 +581971,9 @@ OMIM mapping confirmed by DO. [SN].
MSH:D015746
SNOMEDCT_US:21522001
UMLS:C0000737
+ Abdominal pain
Pain in stomach
Stomach pain
- Abdominal pain
human_phenotype
Abdominal discomfort
Upset stomach
@@ -581971,10 +581995,10 @@ OMIM mapping confirmed by DO. [SN].
MSH:D000855
SNOMEDCT_US:79890006
UMLS:C0003123
+ Anorexia
appetite loss
loss of appetite
no appetite
- Anorexia
human_phenotype
HP:0002039
Note that this term does not refer to the condition anorexia nervosa (A disorder characterized by an obsessive desire to lose weight by refusing to eat).
@@ -582007,10 +582031,10 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:19829001
UMLS:C0024115
UMLS:C4021760
- Abnormally shaped lung
- Unusal lung shape
Abnormality of lung structure
Abnormality of the lungs
+ Abnormally shaped lung
+ Unusal lung shape
Lung disease
HP:0002088
Abnormal lung morphology
@@ -582033,9 +582057,9 @@ OMIM mapping confirmed by DO. [SN].
Abnormal breathing
Breathing difficulty
Difficult to breathe
+ Dyspnoea
Trouble breathing
shortness of breath
- Dyspnoea
HP:0002094
Dyspnea
@@ -582207,9 +582231,9 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:53888004
UMLS:C0037317
Difficulty sleeping
- Trouble sleeping
Sleep disturbances
Sleep dysfunction
+ Trouble sleeping
human_phenotype
HP:0002360
Sleep disturbance
@@ -582243,16 +582267,16 @@ OMIM mapping confirmed by DO. [SN].
HP:0003008
HP:0006741
Abnormal tissue mass
- NCIT:C3262
MSH:D009369
+ NCIT:C3262
SNOMEDCT_US:108369006
SNOMEDCT_US:363346000
UMLS:C0006826
UMLS:C0027651
- Tumor
- Tumour
Neoplasia
Oncological abnormality
+ Tumor
+ Tumour
human_phenotype
Cancer
Oncology
@@ -582316,10 +582340,10 @@ OMIM mapping confirmed by DO. [SN].
HP:0002784
SNOMEDCT_US:195708003
UMLS:C0581381
- Recurrent URI
- Recurrent colds
Frequent upper respiratory infections
Frequent upper respiratory tract infections
+ Recurrent URI
+ Recurrent colds
Recurrent upper respiratory and lower respiratory infections
Recurrent upper respiratory infection
Recurrent upper respiratory infections
@@ -582393,8 +582417,8 @@ OMIM mapping confirmed by DO. [SN].
HP:0001439
UMLS:C4021750
- Abnormality of the thighbone
Abnormality of the femora
+ Abnormality of the thighbone
human_phenotype
HP:0002823
The femur (plural: femora) is the thigh bone.
@@ -582486,17 +582510,17 @@ OMIM mapping confirmed by DO. [SN].
UMLS:C0877359
UMLS:C1842003
UMLS:C1848701
- High liver enzymes
- Raised liver enzymes
Abnormal liver enzymes
Abnormal liver function
Abnormal liver function tests
Elevated liver enzymes
Elevated serum transaminases
Elevated transaminases
+ High liver enzymes
Increased liver enzymes
Increased liver function tests
Increased transaminases
+ Raised liver enzymes
Subclinical abnormal liver function tests
Elevated liver function tests
HP:0002910
@@ -582547,8 +582571,8 @@ OMIM mapping confirmed by DO. [SN].
高脂血症
An elevated lipid concentration in the blood.
- HP:0008356
HP:0008159
+ HP:0008356
MSH:D006949
SNOMEDCT_US:55822004
UMLS:C0020473
@@ -583053,8 +583077,8 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:111255008
SNOMEDCT_US:240241003
UMLS:C0023234
- Osteonecrosis of the femoral head
Osteochondrosis of the femoral head
+ Osteonecrosis of the femoral head
Perthes-like femoral head changes
human_phenotype
Coxa plana
@@ -583080,15 +583104,15 @@ OMIM mapping confirmed by DO. [SN].
MSH:D003924
SNOMEDCT_US:44054006
UMLS:C0011860
- NIDDM
- Non-insulin dependent diabetes
- Type 2 diabetes
- Type II diabetes
Diabetes mellitus Type II
Diabetes mellitus, noninsulin-dependent
+ NIDDM
NIDDM diabetes mellitus
+ Non-insulin dependent diabetes
Noninsulin dependent diabetes mellitus
Noninsulin-dependent diabetes
+ Type 2 diabetes
+ Type II diabetes
human_phenotype
Diabetes mellitus type 2
Noninsulin-dependent diabetes mellitus
@@ -583190,8 +583214,8 @@ OMIM mapping confirmed by DO. [SN].
UMLS:C0206062
Abnormal lung parenchyma morphology
Abnormality in area between air sacs in lung
- Interstitial pulmonary disease
Interstitial lung disease
+ Interstitial pulmonary disease
HP:0006530
Abnormal pulmonary Interstitial morphology
@@ -583326,8 +583350,8 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:418107008
SNOMEDCT_US:419045004
UMLS:C0041657
- Passing out
Loss of consciousness
+ Passing out
human_phenotype
HP:0007185
Loss of consciousness
@@ -583358,15 +583382,15 @@ OMIM mapping confirmed by DO. [SN].
peter
2008-04-01T11:55:00Z
- NCIT:C3262
MSH:D005770
+ NCIT:C3262
SNOMEDCT_US:126768004
UMLS:C0017185
GI tract tumor
- Neoplasm of the GI tract
Gastrointestinal tract neoplasia
Gastrointestinal tract neoplasm
Gastrointestinal tract tumor
+ Neoplasm of the GI tract
human_phenotype
HP:0007378
Neoplasm of the gastrointestinal tract
@@ -584169,9 +584193,9 @@ OMIM mapping confirmed by DO. [SN].
SNOMEDCT_US:248274002
SNOMEDCT_US:84229001
UMLS:C0015672
+ Fatigue
Tired
Tiredness
- Fatigue
Malaise
HP:0012378
Fatigue is distinct from muscle weakness.
@@ -585015,8 +585039,8 @@ However, with the advent of genetic analysis, adenovirus and parvovirus B19 have
UMLS:C0239337
UMLS:C4073131
Abnormal limbs
- Limb anomaly
Abnormality of limbs
+ Limb anomaly
Dysmelia
Abnormality of limbs
@@ -585045,8 +585069,8 @@ However, with the advent of genetic analysis, adenovirus and parvovirus B19 have
HPO:skoehler
HP:0040066
- UMLS:C4022457
UMLS:C4022455
+ UMLS:C4022457
Abnormal morphology of bones of the lower limbs
Abnormal shape of bones of the lower limbs
Abnormality of lower limb bone
@@ -585065,11 +585089,11 @@ However, with the advent of genetic analysis, adenovirus and parvovirus B19 have
HPO:skoehler
SNOMEDCT_US:165534000
UMLS:C0580550
+ Abnormal lymphocyte count
Abnormal lymphocyte counts
Abnormal number of lymphocytes
Abnormal numbers of lymphocytes
Abnormality of lymphocyte number
- Abnormal lymphocyte count
Abnormal lymphocyte count
@@ -585203,8 +585227,8 @@ However, with the advent of genetic analysis, adenovirus and parvovirus B19 have
MSH:D002637
SNOMEDCT_US:29857009
UMLS:C0008031
- Thoracic pain
Chest pain
+ Thoracic pain
human_phenotype
HP:0100749
Chest pain
@@ -585243,8 +585267,8 @@ However, with the advent of genetic analysis, adenovirus and parvovirus B19 have
doelkens
2011-06-07T05:28:27Z
UMLS:C0747556
- Recurrent sore throat
Pharyngitis, recurrent
+ Recurrent sore throat
human_phenotype
HP:0100776
Recurrent pharyngitis
@@ -585280,8 +585304,8 @@ However, with the advent of genetic analysis, adenovirus and parvovirus B19 have
doelkens
2011-06-09T06:03:45Z
- NCIT:C3262
MSH:D015179
+ NCIT:C3262
SNOMEDCT_US:126837005
UMLS:C0009404
Large intestine tumor
@@ -585397,6 +585421,7 @@ of a plan towards which the realization of the plan is directed."OBI Plan and Planned Process/Roles Branch
OBI_0000217
+
@@ -585421,7 +585446,6 @@ of a plan towards which the realization of the plan is directed."
-
action specification
@@ -585458,14 +585482,16 @@ of a plan towards which the realization of the plan is directed."
- data item
data item
+ data item
Data items include counts of things, analyte concentrations, and statistical summaries.
An information content entity that is intended to be a truthful statement about something (modulo, e.g., measurement precision or other systematic errors) and is constructed/acquired by a method which reliably tends to produce (approximately) truthful statements.
a data item is an information content entity that is intended to be a truthful statement about something (modulo, e.g., measurement precision or other systematic errors) and is constructed/acquired by a method which reliably tends to produce (approximately) truthful statements.
2/2/2009 Alan and Bjoern discussing FACS run output data. This is a data item because it is about the cell population. Each element records an event and is typically further composed a set of measurment data items that record the fluorescent intensity stimulated by one of the lasers.
+ 2009-03-16: data item deliberatly ambiguous: we merged data set and datum to be one entity, not knowing how to define singular versus plural. So data item is more general than datum.
2009-03-16: data item deliberatly ambiguous: we merged data set and datum to be one entity, not knowing how to define singular versus plural. So data item is more general than datum.
+ 2009-03-16: removed datum as alternative term as datum specifically refers to singular form, and is thus not an exact synonym.
2009-03-16: removed datum as alternative term as datum specifically refers to singular form, and is thus not an exact synonym.
2014-03-31: See discussion at http://odontomachus.wordpress.com/2014/03/30/aboutness-objects-propositions/
JAR: datum -- well, this will be very tricky to define, but maybe some
@@ -585475,14 +585501,12 @@ process... I would include lists, tables, sentences... I think I might
defer to Barry, or to Brian Cantwell Smith
JAR: A data item is an approximately justified approximately true approximate belief
- 2009-03-16: data item deliberatly ambiguous: we merged data set and datum to be one entity, not knowing how to define singular versus plural. So data item is more general than datum.
- 2009-03-16: removed datum as alternative term as datum specifically refers to singular form, and is thus not an exact synonym.
- PERSON: Alan Ruttenberg
- PERSON: Chris Stoeckert
- PERSON: Jonathan Rees
PERSON: Alan Ruttenberg
+ PERSON: Alan Ruttenberg
PERSON: Chris Stoeckert
+ PERSON: Chris Stoeckert
PERSON: Jonathan Rees
+ PERSON: Jonathan Rees
data
@@ -585546,10 +585570,10 @@ JAR: A data item is an approximately justified approximately true approximate be
information_content_entity 'is_encoded_in' some digital_entity in obi before split (040907). information_content_entity 'is_encoded_in' some physical_document in obi before split (040907).
Previous. An information content entity is a non-realizable information entity that 'is encoded in' some digital or physical entity.
- PERSON: Chris Stoeckert
PERSON: Chris Stoeckert
- OBI_0000142
+ PERSON: Chris Stoeckert
OBI_0000142
+ OBI_0000142
@@ -585751,8 +585775,8 @@ concretized and realized by an actor" with alternative term "instruct
data about an ontology part
Data about an ontology part is a data item about a part of an ontology, for example a term
data about an ontology part is a data item about a part of an ontology, for example a term
- Person:Alan Ruttenberg
Person:Alan Ruttenberg
+ Person:Alan Ruttenberg
@@ -585784,11 +585808,14 @@ concretized and realized by an actor" with alternative term "instruct
A directive information entity with action specifications and objective specifications as parts that, when concretized, is realized in a process in which the bearer tries to achieve the objectives by taking the actions specified.
+ A directive information entity with action specifications and objective specifications as parts, and that may be concretized as a realizable entity that, if realized, is realized in a process in which the bearer tries to achieve the objectives by taking the actions specified.
a directive information entity that when concretized it is realized in a process in which the bearer tries to achieve the objectives, in part by taking the actions specified. Plan specifications includes parts such as objective specification, action specifications and conditional specifications.
2009-03-16: provenance: a term a plan was proposed for OBI (OBI_0000344) , edited by the PlanAndPlannedProcess branch. Original definition was " a plan is a specification of a process that is realized by an actor to achieve the objective specified as part of the plan". It has been subsequently moved to IAO where the objective for which the original term was defined was satisfied with the definitionof this, different, term.
2014-03-31: A plan specification can have other parts, such as conditional specifications.
+ 2022-01-16 Updated definition to that proposed by Clint Dowloand, IAO Issue 231.
Alternative previous definition: a plan is a set of instructions that specify how an objective should be achieved
Alan Ruttenberg
+ Clint Dowland
OBI Plan and Planned Process branch
OBI_0000344
@@ -585813,6 +585840,7 @@ Request that IAO either clarify these or change definitions not to use them
plan specification
+ https://github.com/information-artifact-ontology/IAO/issues/231#issuecomment-1010455131
@@ -586716,6 +586744,53 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Adenoviridae
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Mastadenovirus
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ Canine adenovirus type 2
+ Canine adenovirus type 2 Cav-1
+ Mastadenovirus c2
+ Mastadenovirus can2
+ dog adenovirus 2
+ ncbi_taxonomy
+ Canine adenovirus 2
+
+
+
+
@@ -586766,6 +586841,22 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:1
+ Canine adenovirus
+ Canine adenovirus A
+ ncbi_taxonomy
+ Canine mastadenovirus A
+
+
+
+
@@ -586988,6 +587079,20 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+ CPV
+ GC_ID:1
+ ncbi_taxonomy
+ Canine parvovirus
+
+
+
+
@@ -587010,6 +587115,81 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:1
+ Rotaviruses
+ ncbi_taxonomy
+ Rotavirus
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Porcine rotavirus
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ bovine rotavirus BRV
+ ncbi_taxonomy
+ Bovine rotavirus
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Birnaviridae
+
+
+
+
+
+
+
+
+
+
+ NCBITaxon:12740
+ IBDV
+ GC_ID:1
+ Avian infectious bursal disease virus
+ Gumboro virus
+ Infectious bursal disease virus of chickens
+ infectious bursal disease virus IBDV
+ ncbi_taxonomy
+ Infectious bursal disease virus
+
+
+
+
@@ -587070,8 +587250,10 @@ Request that IAO either clarify these or change definitions not to use them
+
+
IBV
GC_ID:1
Avian infectious bronchitis virus
@@ -587274,7 +587456,9 @@ Request that IAO either clarify these or change definitions not to use them
+
+
FIPV
GC_ID:1
ncbi_taxonomy
@@ -587455,6 +587639,7 @@ Request that IAO either clarify these or change definitions not to use them
+
NCBITaxon:12859
TGEV
GC_ID:1
@@ -587524,6 +587709,35 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:1
+ negative-sense genome single-stranded RNA viruses
+ ncbi_taxonomy
+ Mononegavirales
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Paramyxoviridae
+
+
+
+
@@ -587554,6 +587768,21 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:1
+ Morbilliviruses
+ ncbi_taxonomy
+ Morbillivirus
+
+
+
+
@@ -587937,10 +588166,7 @@ Request that IAO either clarify these or change definitions not to use them
- Euteleostomi
- bony vertebrates
-
NCBITaxon:40673
@@ -588024,6 +588250,28 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:11
+ PMID:11321122
+ PMID:11837318
+ purple photosynthetic bacteria and relatives
+ ncbi_taxonomy
+ "Alphaproteobacteriota" Whitman et al. 2018
+ Alphaproteobacteriota
+ Proteobacteria
+ Proteobacteriota
+ proteobacteria
+ Pseudomonadota
+
+
+
+
@@ -588152,6 +588400,61 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:11
+ PMID:23334881
+ ncbi_taxonomy
+ Proteobacteria gamma subdivision
+ Pseudomonadia
+ Purple bacteria, gamma subdivision
+ g-proteobacteria
+ gamma proteobacteria
+ gamma subdivision
+ gamma subgroup
+ Gammaproteobacteria
+
+
+
+
+
+
+
+
+
+
+
+ NCBITaxon:31968
+ GC_ID:11
+ PMID:10555317
+ PMID:11034484
+ PMID:11542017
+ PMID:15143038
+ PMID:25403554
+ PMID:37409558
+ Firmicutes
+ low G+C Gram-positive bacteria
+ low GC Gram+
+ ncbi_taxonomy
+ "Firmicutes" corrig. Gibbons and Murray 1978 (Approved Lists 1980)
+ Bacillaeota
+ Bacillota corrig. Gibbons and Murray 2021
+ Bacillus/Clostridium group
+ Clostridium group firmicutes
+ Firmicuteota
+ Low G+C firmicutes
+ clostridial firmicutes
+ firmicutes
+ Bacillota
+
+
+
+
@@ -589811,6 +590114,26 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:11
+ PMID:11075904
+ PMID:11542017
+ PMID:16558735
+ PMID:1917844
+ PMID:23908650
+ ncbi_taxonomy
+ spirochetes
+ Spirochaetales
+
+
+
+
@@ -589954,6 +590277,29 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:11
+ PMID:1380285
+ PMID:1503971
+ PMID:24744012
+ PMID:7699027
+ PMID:7981102
+ PMID:8995796
+ PMID:9336916
+ Lyme disease spirochete
+ ncbi_taxonomy
+ Borrelia burgdorferi
+ Borreliella burgdorferi
+
+
+
+
@@ -590831,6 +591177,24 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ NCBITaxon:69207
+ GC_ID:11
+ PMID:26643615
+ PMID:27488356
+ ncbi_taxonomy
+ Anaerobacter
+ Clostridium
+
+
+
+
@@ -590908,6 +591272,41 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+ NCBITaxon:2588446
+ NCBITaxon:2588447
+ NCBITaxon:41533
+ NCBITaxon:592
+ GC_ID:11
+ PMID:10758910
+ Salmonella enterica serovar Enteritidis
+ ncbi_taxonomy
+ Bacillus enteritidis
+ Salmonella enteritidis
+ Salmonella enterica subsp. enterica serovar Enteritidis
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Canine parainfluenza virus
+
+
+
+
@@ -590921,6 +591320,27 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ NCBITaxon:1683536
+ GC_ID:11
+ PMID:1374625
+ PMID:184898
+ ncbi_taxonomy
+ 'Clostridium plagarum'
+ Bacillus perfringens
+ Bacterium welchii
+ Clostridium plagarum
+ Clostridium perfringens
+
+
+
+
@@ -591255,6 +591675,23 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ NCBITaxon:10781
+ GC_ID:1
+ Parvovirus
+ Parvoviruses
+ ncbi_taxonomy
+ Protoparvovirus
+
+
+
+
@@ -591748,6 +592185,22 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Galloanseri
+ ducks, geese, chickens, fowl, quail, currasows and allies
+ Galloanserae
+
+
+
+
@@ -592017,6 +592470,29 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:11
+ PMID:1503975
+ PMID:8427802
+ ncbi_taxonomy
+ Bacillus insidiosus
+ Bacillus rhusiopathiae suis
+ Bacterium rhusiopathiae
+ Erysipelothrix erysipeloides
+ Erysipelothrix insidiosa
+ Erysipelothrix murisepticus
+ Erysipelothrix porci
+ Erysipelothrix rhusiopathiae
+
+
+
+
@@ -593510,6 +593986,27 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ NCBITaxon:29512
+ NCBITaxon:29514
+ NCBITaxon:29516
+ GC_ID:11
+ PMID:10425768
+ PMID:1581182
+ PMID:19868121
+ PMID:9103653
+ ncbi_taxonomy
+ Leptospira
+
+
+
+
@@ -593536,6 +594033,34 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ NCBITaxon:2843297
+ NCBITaxon:2843299
+ GC_ID:11
+ PMID:15545494
+ PMID:19867994
+ PMID:19868337
+ PMID:19972157
+ PMID:25288661
+ PMID:9542090
+ ncbi_taxonomy
+ Leptospira icteroides
+ Spirochaeta biflexa
+ Spirochaeta icterogenes
+ Spirochaeta icterohaemorrhagiae
+ Spirochaeta interrogans
+ Spirochaeta nodosa
+ Leptospira interrogans
+
+
+
+
@@ -593692,6 +594217,22 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:11
+ PMID:18988685
+ PMID:23851394
+ ncbi_taxonomy
+ Terrabacteria group
+
+
+
+
@@ -595275,7 +595816,6 @@ Request that IAO either clarify these or change definitions not to use themeubacteria
-
GC_ID:11
@@ -595298,6 +595838,8 @@ Request that IAO either clarify these or change definitions not to use themPMID:12054223
PMID:2112744
PMID:270744
+ PMID:32628106
+ PMID:36748408
PMID:7520741
PMID:8123559
PMID:8186100
@@ -595445,6 +595987,25 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:11
+ PMID:11837318
+ PMID:25288668
+ PMID:26654112
+ ncbi_taxonomy
+ "Leptospiria" Cavalier-Smith 2020
+ Spirochaetes
+ Spirochaetia
+
+
+
+
@@ -596490,6 +597051,21 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:4
+ ncbi_taxonomy
+ Mycoplasma gallisepticum
+ Mycoplasmoides gallisepticum
+
+
+
+
@@ -596529,6 +597105,20 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+ GC_ID:11
+ ncbi_taxonomy
+ Leptospira canicola
+ Leptospira interrogans serovar Canicola
+
+
+
+
@@ -596597,6 +597187,8 @@ Request that IAO either clarify these or change definitions not to use themPMID:2112744
PMID:25527841
PMID:270744
+ PMID:32628106
+ PMID:36748408
PMID:8123559
PMID:8590690
PMID:9103655
@@ -598129,6 +598721,21 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:1
+ Negative-strand RNA viruses
+ ncbi_taxonomy
+ Negarnaviricota
+
+
+
+
@@ -598726,6 +599333,56 @@ Request that IAO either clarify these or change definitions not to use them
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Avulavirinae
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Orthoparamyxovirinae
+
+
+
+
+
+
+
+
+
+
+ NCBITaxon:11176
+ NDV
+ GC_ID:1
+ Avian Paramyxovirus Serotype I
+ Avian paramyxovirus type 1
+ Avian paramyxovirus type-1
+ Newcastle disease virus
+ Newcastle disease virus NDV
+ avian paramyxovirus 1
+ ncbi_taxonomy
+ Avian avulavirus 1
+ Avian orthoavulavirus 1
+
+
+
+
@@ -600080,7 +600737,6 @@ Request that IAO either clarify these or change definitions not to use them
-
@@ -600349,8 +601005,6 @@ Request that IAO either clarify these or change definitions not to use them
SARS-CoV-2
GC_ID:1
- HCoV-19; COVID-19 virus; SARS-2; Human coronavirus 2019; SARS-CoV2; SARS2; 2019-nCoV
- Wuhan coronavirus
2019-nCoV
COVID-19
COVID-19 virus
@@ -600361,6 +601015,7 @@ Request that IAO either clarify these or change definitions not to use themSARS-CoV-2
SARS-CoV2
SARS2
+ Wuhan coronavirus
ncbi_taxonomy
NCBITaxon:2697049
The list of the marker variants is as follows (as of 3/6/2021):
@@ -601240,6 +601895,34 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Bamfordvirae
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Shotokuvirae
+
+
+
+
@@ -601280,6 +601963,20 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Cossaviricota
+
+
+
+
@@ -601308,6 +602005,22 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ NCBITaxon:10880
+ GC_ID:1
+ ncbi_taxonomy
+ Reoviridae
+ Reovirales
+
+
+
+
@@ -601533,6 +602246,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
GC_ID:1
ncbi_taxonomy
@@ -601647,6 +602361,23 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:4
+ PMID:31385780
+ PMID:31971499
+ PMID:35947640
+ ncbi_taxonomy
+ Mycoplasmoidales
+
+
+
+
@@ -604088,6 +604819,22 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ NCBITaxon:689832
+ GC_ID:1
+ ncbi_taxonomy
+ Sedoreovirinae
+ Sedoreoviridae
+
+
+
+
@@ -604818,6 +605565,41 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ NCBITaxon:11232
+ CDV
+ GC_ID:1
+ Canine distemper virus
+ Canine morbillivirus
+ canine distemper virus CDV
+ ncbi_taxonomy
+ Morbillivirus canis
+
+
+
+
+
+
+
+
+
+
+
+ NCBITaxon:1511906
+ GC_ID:1
+ Carnivore protoparvovirus 1
+ ncbi_taxonomy
+ Protoparvovirus carnivoran1
+
+
+
+
@@ -605191,10 +605973,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
-
- Euarchontoglires
-
GC_ID:1
@@ -605229,8 +606008,8 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
-
+
@@ -605434,13 +606213,8 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
-
- Tetrapoda
- tetrapods
-
-
GC_ID:1
tetrapods
@@ -605455,10 +606229,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
- Amniota
- amniotes
-
GC_ID:1
@@ -605486,8 +606257,10 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
GC_ID:1
diapsids
@@ -605515,9 +606288,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
- Opisthokonta
-
GC_ID:1
@@ -605551,9 +606322,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
- Bilateria
-
GC_ID:1
@@ -605991,8 +606760,10 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
GC_ID:1
ncbi_taxonomy
@@ -606140,6 +606911,21 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:1
+ Avian reovirus
+ ncbi_taxonomy
+ Avian orthoreovirus
+
+
+
+
@@ -607412,6 +608198,20 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Parvovirinae
+
+
+
+
@@ -607428,10 +608228,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
- Mammalia
- mammals
-
GC_ID:1
@@ -609176,6 +609973,45 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:11
+ PMID:10555323
+ PMID:10555334
+ PMID:16166704
+ PMID:27620848
+ ncbi_taxonomy
+ Enterobacteraceae
+ enterobacteria
+ gamma-3 proteobacteria
+ Enterobacteriaceae
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:11
+ Tenericutes
+ ncbi_taxonomy
+ "Mollicutaeota" Oren et al. 2015
+ "Tenericutes" Murray 1984
+ Mollicutota
+ Mycoplasmatota
+
+
+
+
@@ -609280,6 +610116,32 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ NCBITaxon:1637691
+ NCBITaxon:1806490
+ NCBITaxon:469598
+ NCBITaxon:662101
+ NCBITaxon:662104
+ GC_ID:11
+ PMID:10319482
+ E. coli
+ Escherichia/Shigella coli
+ ncbi_taxonomy
+ Bacillus coli
+ Bacterium coli
+ Bacterium coli commune
+ Enterococcus coli
+ Escherichia coli
+
+
+
+
@@ -609448,6 +610310,28 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:11
+ PMID:10319519
+ PMID:10939679
+ PMID:12072558
+ PMID:15653929
+ PMID:15653930
+ PMID:3231714
+ PMID:37486130
+ PMID:9731304
+ ncbi_taxonomy
+ Salmonella
+
+
+
+
@@ -609496,6 +610380,30 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ NCBITaxon:149049
+ GC_ID:11
+ PMID:15653929
+ PMID:15653930
+ PMID:7149525
+ ncbi_taxonomy
+ Salmonella cholerae-suis subsp. cholerae-suis
+ Salmonella choleraesuis subsp. choleraesuis
+ Salmonella enterica I
+ Salmonella enterica subsp. I
+ Salmonella enterica subsp. Subsp. I
+ Salmonella enterica subsp. Subsp. Ixxx
+ Salmonella enterica subsp. enterica
+
+
+
+
@@ -609954,6 +610862,43 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ NCBITaxon:1618316
+ GC_ID:11
+ PMID:10515907
+ PMID:10758897
+ PMID:16585709
+ PMID:24744012
+ PMID:27930271
+ PMID:28141502
+ PMID:30154058
+ PMID:30586413
+ PMID:31454394
+ PMID:31722850
+ PMID:31836459
+ PMID:32320380
+ PMID:35816828
+ PMID:36748499
+ PMID:7981102
+ PMID:8573491
+ PMID:8934900
+ PMID:8995795
+ PMID:9336916
+ Lyme Disease Borrelia
+ ncbi_taxonomy
+ Borrelia burgdorferi group
+ Borrelia burgdorferi sensu lato
+ Borreliella
+
+
+
+
@@ -611117,6 +612062,26 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:11
+ PMID:10843050
+ PMID:15280320
+ PMID:15388716
+ PMID:17220461
+ PMID:2223605
+ PMID:29923825
+ ncbi_taxonomy
+ Pasteurellaceae
+
+
+
+
@@ -611597,6 +612562,25 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:11
+ PMID:15184562
+ ncbi_taxonomy
+ Bacterium multocidum
+ Micrococcus gallicidus
+ Pasteurella cholerae-gallinarum
+ Pasteurella gallicida
+ Pasteurella multocida
+
+
+
+
@@ -612154,11 +613138,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
- Vertebrata <vertebrates>
- Vertebrata
- vertebrates
-
GC_ID:1
@@ -612186,6 +613166,19 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+ GC_ID:11
+ ncbi_taxonomy
+ Clostridium perfringens C
+
+
+
+
@@ -612855,6 +613848,37 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:1
+ birds
+ ncbi_taxonomy
+ avian
+ birds
+ Aves
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ ncbi_taxonomy
+ Neognathae
+
+
+
+
@@ -612904,6 +613928,55 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ NCBITaxon:9099
+ GC_ID:1
+ turkeys
+ ncbi_taxonomy
+ Phasianidae
+
+
+
+
+
+
+
+
+
+
+ GC_ID:11
+ ncbi_taxonomy
+ Leptospira interrogans serovar Icterohaemorrhagiae
+
+
+
+
+
+
+
+
+
+
+
+ GC_ID:1
+ Gallus domesticus
+ bantam
+ chicken
+ chickens
+ ncbi_taxonomy
+ Gallus gallus domesticus
+ Phasianus gallus
+ Gallus gallus
+
+
+
+
@@ -613862,11 +614935,31 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
+
+
+
+
+
+ GC_ID:11
+ PMID:27620848
+ ncbi_taxonomy
+ Enterobacteriaceae and related endosymbionts
+ Enterobacteriaceae group
+ Enterobacteriales
+ gamma-3 proteobacteria
+ Enterobacterales
+
+
+
+
+
GC_ID:1
whales, hippos, ruminants, pigs, camels etc.
@@ -614654,6 +615747,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
GC_ID:1
primate
@@ -614861,7 +615955,9 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
grivet
savanah monkey
ncbi_taxonomy
+ Cercopithecus aethiops
Ceropithecus aethiops
+ Simia aethiops
Chlorocebus aethiops
@@ -615123,12 +616219,12 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
- Homo sapiens
Homo sapiens
- person
+ Homo sapiens
human
human being
man
+ person
https://pubmed.ncbi.nlm.nih.gov/15347429/
https://pubmed.ncbi.nlm.nih.gov/26695637/
https://pubmed.ncbi.nlm.nih.gov/29551135/
@@ -615146,8 +616242,8 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
man
ncbi_taxonomy
humans
- Homo sapiens
Homo sapiens
+ Homo sapiens
@@ -615544,8 +616640,10 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
GC_ID:1
ncbi_taxonomy
@@ -615573,6 +616671,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
https://pubmed.ncbi.nlm.nih.gov/15921605/
https://pubmed.ncbi.nlm.nih.gov/32402157/
+
NCBITaxon:36475
GC_ID:1
@@ -615800,8 +616899,10 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
+
GC_ID:1
pig
@@ -616190,6 +617291,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
GC_ID:1
ncbi_taxonomy
@@ -616215,6 +617317,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
+
@@ -616224,6 +617327,7 @@ Reference: https://www.gisaid.org/references/statements-clarifications/clade-and
https://pubmed.ncbi.nlm.nih.gov/32629960
+
NCBITaxon:272461
GC_ID:1
@@ -618306,8 +619410,8 @@ https://www.nlm.nih.gov/medlineplus/ency/article/003088.htm
- planned process
planned process
+ planned process
Injecting mice with a vaccine in order to test its efficacy
A process that realizes a plan which is the concretization of a plan specification.
@@ -618317,8 +619421,8 @@ https://www.nlm.nih.gov/medlineplus/ency/article/003088.htm
objectives is a planned process.
Bjoern Peters
branch derived
- This class merges the previously separated objective driven process and planned process, as they the separation proved hard to maintain. (1/22/09, branch call)
6/11/9: Edited at workshop. Used to include: is initiated by an agent
+ This class merges the previously separated objective driven process and planned process, as they the separation proved hard to maintain. (1/22/09, branch call)
@@ -618481,8 +619585,9 @@ objectives is a planned process.
assay
Assay the wavelength of light emitted by excited Neon atoms. Count of geese flying over a house.
- A planned process with the objective to produce information about the material entity that is the evaluant, by physically examining it or its proxies.
- 12/3/12: BP: the reference to the 'physical examination' is included to point out that a prediction is not an assay, as that does not require physical examiniation.
+ A planned process that has the objective to produce information about a material entity (the evaluant) by examining it.
+ 12/3/12: BP: the reference to the 'physical examination' is included to point out that a prediction is not an assay, as that does not require physical examiniation.
+ Discussion on OBI call 2023-05-01 resulted in an agreement to revise the textual definition of 'assay'. https://github.com/obi-ontology/obi/issues/1683.
PlanAndPlannedProcess Branch
measuring
scientific observation
@@ -618516,7 +619621,7 @@ Modification made by JZ.
-
+
reagent role
Buffer, dye, a catalyst, a solvating agent.
@@ -618526,8 +619631,7 @@ Modification made by JZ.
PERSON:Matthew Brush
Feb 10, 2009. changes after discussion at OBI Consortium Workshop Feb 2-6, 2009. accepted as core term.
-May 28 2013. Updated definition taken from ReO based on discussions initiated in Philly 2011 workshop. Former defnition described a narrower view of reagents in chemistry that restricts bearers of the role to be chemical entities ("a role played by a molecular entity used to produce a chemical reaction to detect, measure, or produce other substances"). Updated definition allows for broader view of reagents in the domain of biomedical research to include larger materials that have parts that participate chemically in a molecular reaction or interaction.
-
+May 28 2013. Updated definition taken from ReO based on discussions initiated in Philly 2011 workshop. Former defnition described a narrower view of reagents in chemistry that restricts bearers of the role to be chemical entities ("a role played by a molecular entity used to produce a chemical reaction to detect, measure, or produce other substances"). Updated definition allows for broader view of reagents in the domain of biomedical research to include larger materials that have parts that participate chemically in a molecular reaction or interaction.
(copied from ReO)
Reagents are distinguished from instruments or devices that also participate in scientific techniques by the fact that reagents are chemical or biological in nature and necessarily participate in or have parts that participate in some chemical interaction or reaction during their intended participation in some technique. By contrast, instruments do not participate in a chemical reaction/interaction during the technique.
@@ -618604,16 +619708,17 @@ In regard to the statement that reagents are 'distinct' from the speci
liver section; a portion of a culture of cells; a nemotode or other animal once no longer a subject (generally killed); portion of blood from a patient.
a role borne by a material entity that is gained during a specimen collection process and that can be realized by use of the specimen in an investigation
+ 22Jun09. The definition includes whole organisms, and can include a human. The link between specimen role and study subject role has been removed. A specimen taken as part of a case study is not considered to be a population representative, while a specimen taken as representing a population, e.g. person taken from a cohort, blood specimen taken from an animal) would be considered a population representative and would also bear material sample role.
+ Note: definition is in specimen creation objective which is defined as an objective to obtain and store a material entity for potential use as an input during an investigation.
blood taken from animal: animal continues in study, whereas blood has role specimen.
something taken from study subject, leaves the study and becomes the specimen.
parasite example
- when parasite in people we study people, people are subjects and parasites are specimen
- when parasite extracted, they become subject in the following study
specimen can later be subject.
- 22Jun09. The definition includes whole organisms, and can include a human. The link between specimen role and study subject role has been removed. A specimen taken as part of a case study is not considered to be a population representative, while a specimen taken as representing a population, e.g. person taken from a cohort, blood specimen taken from an animal) would be considered a population representative and would also bear material sample role.
- Note: definition is in specimen creation objective which is defined as an objective to obtain and store a material entity for potential use as an input during an investigation.
GROUP: Role Branch
OBI
+
specimen role
@@ -618653,8 +619758,7 @@ specimen can later be subject.
antigen role
- Antigen is a role played by material which when introduced into an immune-competent organism causes an immune response
- a role that inheres in a vaccine component and plays an antigen role, i.e., it is introducd into an immune-competent organism to cause an immune response
+ A role of a material entity that is being recognized in whole or in part by receptors of the immune system such as antibodies or T cell receptors.
An antigen is a substance that prompts the generation of antibodies and can cause an immune response. Wikipedia http://en.wikipedia.org/wiki/Antigen. In the strict sense, immunogens are those substances that elicit a response from the immune system, whereas antigens are defined as substances that bind to specific antibodies. Not all antigens produce an immunogenic response, but all immunogens are antigens
Role Branch
OBI
@@ -618720,7 +619824,7 @@ for now.
-
+
DNA extraction
@@ -618807,7 +619911,7 @@ for now.
material to be added role
drug added to a buffer contained in a tube; substance injected into an animal;
- material to be added role is a protocol participant role realized by a material which is added into a material bearing the target of material addition role in a material addition process
+ A role of a material entity that is realized in an "adding a material entity into a target" process where the bearer of the role is added into another material entity (the target).
Role Branch
OBI
9 March 09 from discussion with PA branch
@@ -619227,7 +620331,7 @@ that has_part some material entity is a material entity. If we add as equivalent
target of material addition role
peritoneum of an animal receiving an interperitoneal injection; solution in a tube receiving additional material; location of absorbed material following a dermal application.
- target of material addition role is a role realized by an entity into which a material is added in a material addition process
+ A role of a material entity that is realized in an "adding a material entity into a target" process where the bearer of the role (the target) receives the addition of another material entity.
From Branch discussion with BP, AR, MC -- there is a need for the recipient to interact with the administered material. for example, a tooth receiving a filling was not considered to be a target role.
GROUP: Role Branch
OBI
@@ -619426,7 +620530,7 @@ Eur J Cancer. 2009 Jan;45(1):74-81. PMID: 19008094
urine specimen
a portion of urine collected from an organism
- 4/10/2011BP: It seems to me that the editor notes refer to a previous version, and are no longer relevant.
+ 4/10/2011BP: It seems to me that the editor notes refer to a previous version, and are no longer relevant.
This could be instead a kind of collection of secreted stuff. Among secreted stuff there is passive, and active. urine is secreted, passiv. lavage is secreted, active
are we happy calling collection of urine a material separation?
@@ -619536,11 +620640,11 @@ Eur J Cancer. 2009 Jan;45(1):74-81. PMID: 19008094
drawing blood from a patient for analysis, collecting a piece of a plant for depositing in a herbarium, buying meat from a butcher in order to measure its protein content in an investigation
A planned process with the objective of collecting a specimen.
+ Note: definition is in specimen creation objective which is defined as an objective to obtain and store a material entity for potential use as an input during an investigation.
Philly2013: A specimen collection can have as part a material entity acquisition, such as ordering from a bank. The distinction is that specimen collection necessarily involves the creation of a specimen role. However ordering cell lines cells from ATCC for use in an investigation is NOT a specimen collection, because the cell lines already have a specimen role.
Philly2013: The specimen_role for the specimen is created during the specimen collection process.
label changed to 'specimen collection process' on 10/27/2014, details see tracker:
http://sourceforge.net/p/obi/obi-terms/716/
- Note: definition is in specimen creation objective which is defined as an objective to obtain and store a material entity for potential use as an input during an investigation.
Bjoern Peters
specimen collection
5/31/2012: This process is not necessarily an acquisition, as specimens may be collected from materials already in posession
@@ -619686,6 +620790,36 @@ http://sourceforge.net/p/obi/obi-terms/716/
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ pathogen role
+ Pathogen: An agent of disease. A disease producer. The term pathogen most commonly is used to refer to infectious organisms. These include bacteria (such as staph), viruses (such as HIV), and fungi (such as yeast). Less commonly, pathogen refers to a noninfectious agent of disease such as a chemical. http://www.medterms.com/script/main/art.asp?articlekey=6383
+
+ pathogen role is a role which inheres in an organism and realized in the process of disease course in the organism bearing host role caused by the organism bearing pathogen role
+ GROUP: Role Branch
+ OBI
+ 6 April 2009: from the Vaccine Community
+
+
+ pathogen role
+
+
+
+
@@ -619706,7 +620840,6 @@ http://sourceforge.net/p/obi/obi-terms/716/
OBI
http://en.wikipedia.org/wiki/Host_(biology)
-
host role
@@ -619721,6 +620854,7 @@ http://sourceforge.net/p/obi/obi-terms/716/
A material sample role is a specimen role borne by a material entity that is the output of a material sampling process.
7/13/09: Note that this is a relational role: between the sample taken and the 'sampled' material of which the sample is thought to be representative off.
+
material sample role
@@ -619748,6 +620882,7 @@ http://sourceforge.net/p/obi/obi-terms/716/
A material entity that has the material sample role
OBI: workshop
sample population
+
sample
material sample
@@ -619853,7 +620988,7 @@ http://sourceforge.net/p/obi/obi-terms/716/
material maintenance
- a process with that achieves the objective to maintain some or all of the characteristics of an input material over time
+ A planned process with the objective to maintain some or all of the characteristics of an input material over time.
material maintenance
@@ -620701,6 +621836,17 @@ A blood specimen that has been centrifuged to obtain the white blood cells.
+ 2012-12-17 JAO: In common lab usage, there is a distinction made between devices and reagents that is difficult to model. Therefore we have chosen to specifically exclude reagents from the definition of "device", and are enumerating the types of roles that a reagent can perform.
+
+2013-6-5 MHB: The following clarifications are outcomes of the May 2013 Philly Workshop. Reagents are distinguished from devices that also participate in scientific techniques by the fact that reagents are chemical or biological in nature and necessarily participate in some chemical interaction or reaction during the realization of their experimental role. By contrast, devices do not participate in such chemical reactions/interactions. Note that there are cases where devices use reagent components during their operation, where the reagent-device distinction is less clear. For example:
+
+(1) An HPLC machine is considered a device, but has a column that holds a stationary phase resin as an operational component. This resin qualifies as a device if it participates purely in size exclusion, but bears a reagent role that is realized in the running of a column if it interacts electrostatically or chemically with the evaluant. The container the resin is in (“the column”) considered alone is a device. So the entire column as well as the entire HPLC machine are devices that have a reagent as an operating part.
+
+(2) A pH meter is a device, but its electrode component bears a reagent role in virtue of its interacting directly with the evaluant in execution of an assay.
+
+(3) A gel running box is a device that has a metallic lead as a component that participates in a chemical reaction with the running buffer when a charge is passed through it. This metallic lead is considered to have a reagent role as a component of this device realized in the running of a gel.
+
In the examples above, a reagent is an operational component of a device, but the device itself does not realize a reagent role (as bearing a reagent role is not transitive across the part_of relation). In this way, the asserted disjointness between a reagent and device holds, as both roles are never realized in the same bearer during execution of an assay.
PERSON: Helen Parkinson
instrument
@@ -620747,8 +621893,7 @@ In the examples above, a reagent is an operational component of a device, but th
sequence data
example of usage: the representation of a nucleotide sequence in FASTA format used for a sequence similarity search.
- A measurement datum that representing the primary structure of a macromolecule(it's sequence) sometimes associated with an indicator of confidence of that measurement.
-
+ A measurement datum that representing the primary structure of a macromolecule(it's sequence) sometimes associated with an indicator of confidence of that measurement.
Person:Chris Stoeckert
GROUP: OBI
@@ -621202,7 +622347,7 @@ In regard to the statement that reagents are 'distinct' from the speci
cell freezing medium
- A processed material that serves as a liquid vehicle for freezing cells for long term quiescent stroage, which contains chemicls needed to sustain cell viability across freeze-thaw cycles.
+ A processed material that serves as a liquid vehicle for freezing cells for long term quiescent stroage, which contains chemicls needed to sustain cell viability across freeze-thaw cycles.
PERSON: Matthew Brush
cell freezing medium
@@ -621389,7 +622534,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621397,6 +622542,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621423,7 +622577,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621431,6 +622585,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621457,7 +622620,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621465,6 +622628,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621491,7 +622663,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621499,6 +622671,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621526,7 +622707,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621534,6 +622715,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621561,7 +622751,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621569,6 +622759,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621595,7 +622794,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621603,6 +622802,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621629,7 +622837,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621637,6 +622845,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621663,7 +622880,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621671,6 +622888,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621697,7 +622923,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621705,6 +622931,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621731,7 +622966,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621739,6 +622974,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621765,11 +623009,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -621800,7 +623063,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621808,6 +623071,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621834,11 +623106,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -621868,7 +623159,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621876,6 +623167,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621902,7 +623202,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621910,6 +623210,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621936,11 +623245,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -621952,7 +623280,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from brain.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
brain specimen
@@ -621970,7 +623298,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -621978,6 +623306,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -621986,7 +623323,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from hair.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
hair specimen
@@ -622004,11 +623341,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622020,7 +623376,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from prostate gland.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
prostate gland specimen
@@ -622038,7 +623394,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -622046,6 +623402,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -622054,7 +623419,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from skeletal muscle.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
skeletal muscle tissue specimen
@@ -622072,11 +623437,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622088,7 +623472,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from heart.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
heart specimen
@@ -622106,11 +623490,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622123,7 +623526,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from renal medulla.
Chris Stoeckert
kidney medulla specimen
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
renal medulla specimen
@@ -622141,11 +623544,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622157,7 +623579,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from adrenal gland.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
adrenal gland specimen
@@ -622175,11 +623597,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622189,10 +623630,10 @@ In regard to the statement that reagents are 'distinct' from the speci
breast specimen
- A specimen that is derived from breast.
+ A specimen that is derived from breast.
Chris Stoeckert
mammary tissue specimen
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
breast specimen
@@ -622210,11 +623651,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622226,7 +623686,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from urinary bladder.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
urinary bladder specimen
@@ -622244,11 +623704,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622260,7 +623739,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from tibial artery.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
tibial artery specimen
@@ -622278,11 +623757,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622295,7 +623793,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from skin.
Chris Stoeckert
skin specimen
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
skin of body specimen
@@ -622313,11 +623811,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622329,7 +623846,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from pancreas.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
pancreas specimen
@@ -622347,11 +623864,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622363,7 +623899,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from stomach.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
stomach specimen
@@ -622381,11 +623917,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622397,7 +623952,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from pituitary gland.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
pituitary gland specimen
@@ -622415,7 +623970,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -622423,6 +623978,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -622431,7 +623995,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from adipose tissue.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
adipose tissue specimen
@@ -622449,11 +624013,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622466,7 +624049,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from cortex of kidney.
Chris Stoeckert
kidney cortex specimen
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
cortex of kidney specimen
@@ -622484,11 +624067,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622500,7 +624102,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from esophagus mucosa.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
esophagus mucosa specimen
@@ -622518,11 +624120,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622534,7 +624155,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from colon.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
colon specimen
@@ -622552,11 +624173,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622568,7 +624208,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from lung.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
lung specimen
@@ -622586,11 +624226,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622603,7 +624262,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from esophagus muscularis mucosa.
Chris Stoeckert
esophagus muscularis specimen
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
esophagus muscularis mucosa specimen
@@ -622621,11 +624280,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622638,7 +624316,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from cerebral cortex.
Chris Stoeckert
brain cortex specimen
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
cerebral cortex specimen
@@ -622656,11 +624334,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622672,7 +624369,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from thyroid gland.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
thyroid gland specimen
@@ -622690,11 +624387,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622707,7 +624423,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from cerebellum.
Chris Stoeckert
brain cerebellum specimen
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
cerebellum specimen
@@ -622725,11 +624441,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622741,7 +624476,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from tibial nerve.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
tibial nerve specimen
@@ -622759,11 +624494,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622775,7 +624529,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from coronary artery.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
coronary artery specimen
@@ -622793,11 +624547,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622809,7 +624582,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from spleen.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
spleen specimen
@@ -622827,11 +624600,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622843,7 +624635,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from aorta.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
aorta specimen
@@ -622861,11 +624653,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622877,7 +624688,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from the atrium auricular region.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
atrial appendage specimen
@@ -622895,11 +624706,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622911,7 +624741,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from the esophagogastric junction.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
esophagogastric junction specimen
@@ -622929,11 +624759,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622945,7 +624794,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from ileum.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
ileum specimen
@@ -622963,11 +624812,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -622979,7 +624847,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from liver.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
liver specimen
@@ -622997,11 +624865,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -623013,7 +624900,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from minor salivary gland.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
minor salivary gland specimen
@@ -623031,11 +624918,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -623047,7 +624953,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from omentum.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
omentum specimen
@@ -623065,11 +624971,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -623081,7 +625006,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from female gonad.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
ovary specimen
@@ -623099,11 +625024,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -623115,7 +625059,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from sigmoid colon.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
sigmoid colon specimen
@@ -623133,11 +625077,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -623149,7 +625112,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from suprapubic skin.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
suprapubic skin specimen
@@ -623167,11 +625130,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -623183,7 +625165,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from testis.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
testis specimen
@@ -623201,11 +625183,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -623217,7 +625218,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from uterus.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
uterus specimen
@@ -623235,11 +625236,30 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -623251,7 +625271,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is derived from vagina.
Chris Stoeckert
- Chris Stoeckert, NCI BBRB
+ Chris Stoeckert, NCI BBRB
vagina specimen
@@ -623344,6 +625364,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623352,7 +625381,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623371,7 +625400,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the surface of an areola of a breast.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
areolar swab specimen
@@ -623384,6 +625413,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623392,7 +625430,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623411,7 +625449,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the surface of a breast.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
breast swab specimen
@@ -623424,6 +625462,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623432,7 +625479,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623451,7 +625498,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the cheek portion of the inside surface of a mouth.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
cheek swab specimen
@@ -623464,6 +625511,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623472,7 +625528,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623491,7 +625547,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the surface of a nasopharynx.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
nasopharyngeal swab specimen
@@ -623504,6 +625560,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623512,7 +625577,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623531,7 +625596,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the inside surface of a mouth.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
oral swab specimen
@@ -623544,6 +625609,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623552,7 +625626,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623571,7 +625645,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the surface of a oropharynx.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
oropharyngeal swab specimen
@@ -623584,6 +625658,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623592,7 +625675,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623611,7 +625694,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the surface of a rectum.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
rectal swab specimen
@@ -623624,6 +625707,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623632,7 +625724,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623651,7 +625743,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the surface of a tongue.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
tongue swab specimen
@@ -623664,6 +625756,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623672,7 +625773,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623691,7 +625792,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the surface of a vagina.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
vagina swab specimen
@@ -623704,6 +625805,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623712,7 +625822,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623732,7 +625842,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the surface of a feces.
Chris Stoeckert
stool swab specimen
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
fecal swab specimen
@@ -623745,6 +625855,15 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
@@ -623753,7 +625872,7 @@ In regard to the statement that reagents are 'distinct' from the speci
-
+
@@ -623772,7 +625891,7 @@ In regard to the statement that reagents are 'distinct' from the speci
A specimen that is collected with a swab from the surface of an environmenal material.
Chris Stoeckert
- Chris Stoeckert, OBIB
+ Chris Stoeckert, OBIB
environmental swab specimen
@@ -623818,6 +625937,63 @@ In regard to the statement that reagents are 'distinct' from the speci
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ biopsy
+ Biopsy of a potentially cancerous mole.
+
+ A specimen collection that obtains a sample of tissue or cell from a living multicellular organism body for diagnostic purposes by means intended to be minimally invasive.
+ Damion Dooley
+ Nicole Vasilevsky
+ https://en.wikipedia.org/wiki/Biopsy
+
+ biopsy
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ bone marrow biopsy
+ A bone marrow biopsy removes bone with the marrow inside to look at under a microscope
+
+ A biopsy where a small amount of bone and a small amount of fluid and bone marrow are collected.
+ Nicole Vasilevsky
+ http://www.webmd.com/cancer/bone-marrow-aspiration-and-biopsy
+
+ bone marrow biopsy
+
+
+
+
@@ -623898,7 +626074,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
@@ -623907,6 +626083,17 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
+
+
induced sputum specimen
A sputum specimen that is collected from an organism following its inhalation of a nebulized salt solution.
@@ -623935,7 +626122,18 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
+
+
+
+
+
+
+
+
+
+
+
@@ -623945,7 +626143,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
@@ -623960,7 +626158,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
tracheal aspirate specimen
A specimen that is collected with a suctioning tube from the trachea.
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
tracheal wash specimen
PMID:25338241
@@ -623975,6 +626173,15 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
@@ -623983,7 +626190,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
@@ -624001,7 +626208,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
mid-turbinate nasal swab specimen
A specimen that is collected with a mid-turbinate nasal swab from the turbinate area of the nasal cavity.
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
https://seattlechildrenslab.testcatalog.org/catalogs/185/files/11633
mid-turbinate nasal swab specimen
@@ -624015,6 +626222,15 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
@@ -624023,7 +626239,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
@@ -624037,13 +626253,13 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
nasal aspirate specimen
A specimen that is collected with a suctioning tube from the nasal cavity.
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
nasal wash specimen|nasopharyngeal aspirate
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
nasal aspirate specimen
@@ -624056,6 +626272,15 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
@@ -624064,7 +626289,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
@@ -624078,13 +626303,13 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
lower respiratory tract aspirate specimen
A specimen that is collected with a suctioning tube from the lower respiratory tract.
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
lower respiratory tract wash specimen
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
lower respiratory tract aspirate specimen
@@ -624097,6 +626322,15 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
@@ -624105,7 +626339,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
@@ -624123,8 +626357,8 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
upper respiratory specimen
A specimen that is derived from the upper respiratory tract
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
upper respiratory specimen
@@ -624137,34 +626371,30 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
-
+
lower respiratory tract specimen
A specimen that is derived from the lower respiratory tract.
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
lower respiratory tract specimen
@@ -624177,6 +626407,15 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
@@ -624185,7 +626424,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
@@ -624203,14 +626442,30 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
anterior nasal swab specimen
A specimen that is derived from the anterior nasal wall
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
- Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
+ Asiyah Yu Lin ORCID:0000-0003-2620-0345
anterior nasal swab specimen
+
+
+
+
+ aspiration specimen collection
+
+ Procedure using suction, usually with a thin needle and syringe, to remove bodily fluid or tissue.
+ Asiyah Yu Lin|ORCID:0000-0003-2620-0345
+ aspiration procedure
+ https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI_Thesaurus&ns=ncit&code=C15631
+
+ aspiration specimen collection
+
+
+
+
@@ -624221,7 +626476,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
@@ -624230,10 +626485,21 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
+
+
endotracheal tube specimen
A specimen that derives from a biofilm that forms on the inner surface of an endotracheal tube while the tube is in the trachea. The specimen is collected upon removal of the tube from the trachea.
- John Judkins|ORCID:0000-0001-6595-0902
+ John Judkins ORCID:0000-0001-6595-0902
https://bmcpulmmed.biomedcentral.com/articles/10.1186/s12890-019-0926-3
endotracheal tube specimen
@@ -624251,7 +626517,7 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
-
+
@@ -624260,10 +626526,21 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
+
+
endotracheal aspirate specimen
A specimen that derives from a biofilm that forms on the inner surface of an endotracheal tube while the tube is in the trachea. The specimen is collected by suction without removing the tube.
- John Judkins|ORCID:0000-0001-6595-0902
+ John Judkins ORCID:0000-0001-6595-0902
https://bmcpulmmed.biomedcentral.com/articles/10.1186/s12890-019-0926-3
endotracheal aspirate specimen
@@ -624271,6 +626548,340 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ blood specimen in vacutainer
+
+ A blood specimen that is located in a vacutainer.
+ John Judkins
+ Vacutainer sample
+ VEuPathDB
+
+ blood specimen in vacutainer
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ blood specimen on filter paper
+
+ A blood specimen that is located on a filter paper.
+ Chris Stoeckert
+ Jie Zheng
+ Filter paper sample
+ Penn Group
+
+ blood specimen on filter paper
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ placental blood specimen
+
+ A specimen that is derived from placental blood.
+ John Judkins
+ VEuPathDB
+
+ placental blood specimen
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ peripheral blood mononuclear cell specimen
+
+ A processed specimen that is extracted from whole blood using gradient centrifugation that separates the blood into a layer of peripheral blood mononuclear cells under the top layer of plasma. It contains lymphocytes, monocytes or macrophages that are critical components in the immune system.
+ Chris Stoeckert
+ Jie Zheng
+ PBMC specimen
+ http://en.wikipedia.org/wiki/Peripheral_blood_mononuclear_cell
+
+ peripheral blood mononuclear cell specimen
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ lymph specimen
+
+ A specimen that is derived from a portion of lymph collected from an organism.
+ John Judkins ORCID:0000-0001-6595-0902
+ VEuPathDB
+
+ lymph specimen
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ digestive tract specimen
+
+ A specimen that is derived from part of a digestive tract.
+ John Judkins ORCID:0000-0001-6595-0902
+ VEuPathDB
+
+ digestive tract specimen
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ nasal lavage fluid
+
+ A specimen collected through nasal cavity lavage that contains the reagents used to for the lavage process, organisms, cells, cellular secretions, and other biomaterials present in the nasal cavity space.
+ Randi Vita
+ Sebastian Duesing
+
+ nasal lavage fluid
+
+
+
+
+
+
+
+
+ reactant role
+
+ A role borne by a biological or chemical entity that participates or has molecular components that participate in a chemical reaction.
+ Sebastian Duesing
+
+ reactant role
+
+
+
+
@@ -624367,6 +626978,16 @@ JZ (3-30-20): discussed on the OBI call. Since the REO was never actually regist
+
+
+
+
+
+
+
+
+
+
organism
animal
@@ -624415,6 +627036,7 @@ This issue is outside the scope of OBI.
PERSON: James Malone
PERSON: Philippe Rocca-Serra
GROUP: OBI Biomaterial Branch
+
@@ -624592,10 +627214,10 @@ Thyroidectomy during laryngectomy for advanced laryngeal carcinoma--whole organ
Helen Parkinson
James Malone
Melanie Courtot
+ Philippe Rocca-Serra
Richard Scheuermann
Ryan Brinkman
Tina Hernandez-Boussard
- Philippe Rocca-Serra
data analysis
data operation
data processing
@@ -624802,7 +627424,7 @@ Thyroidectomy during laryngectomy for advanced laryngeal carcinoma--whole organ
storage
PMID: 18550121.Total Prostate Specific Antigen Stability Confirmed After Long-Term Storage of Serum at -80C. J Urol. 2008 Jun 10.
- A maintenance process by which material entities that are not actively metabolizing are placed in well identified location and possibly under controlled environment in ad-hoc devices/structures in order to preserve and protect them from decay/alteration and maintain availability
+ A planned process with the objective to preserve and protect material entities by placing them in an identified location which may have a controlled environment.
Philippe Rocca-Serra
OBI-Branch
@@ -624927,48 +627549,17 @@ Thyroidectomy during laryngectomy for advanced laryngeal carcinoma--whole organ
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
administering substance in vivo
- injecting mice with 10 ug morphine intranasally, a patient taking two pills of 1 mg aspirin orally
Balb/c mice received an intracameral or subconjunctival injection of trinitrophenylated spleen cells
+ injecting mice with 10 ug morphine intranasally, a patient taking two pills of 1 mg aspirin orally
A process by which a substance is intentionally given to an organism resulting in exposure of the organism to that substance.
+ 2009-11-10. Tracker: https://sourceforge.net/tracker/?func=detail&aid=2893050&group_id=177891&atid=886178
Different routes and means of administration should go as children underneath this
Update the definition based on the discussion. Details see the tracker:
https://sourceforge.net/p/obi/obi-terms/738/
needs roles such as perturber and perturbee (children of input role). Perturb is too strong. Host might be the name for one role. Others considered: Doner, Donated, Acceptor.
- 2009-11-10. Tracker: https://sourceforge.net/tracker/?func=detail&aid=2893050&group_id=177891&atid=886178
Bjoern Peters
Person:Bjoern Peters
IEDB
@@ -625051,7 +627642,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
maintaining cell culture
When harvesting blood from a human, isolating T cells, and then limited dilution cloning of the cells, the maintaining_cell_culture step comprises all steps after the initial dilution and plating of the cells into culture, e.g. placing the culture into an incubator, changing or adding media, and splitting a cell culture
- a protocol application in which cells are kept alive in a defined environment outside of an organism. part of cell_culturing
+ A planned process with the objective to keep cells alive in a defined environment outside of an organism.
PlanAndPlannedProcess Branch
OBI branch derived
@@ -625092,8 +627683,8 @@ https://sourceforge.net/p/obi/obi-terms/738/
The use of M-MLV reverse transcriptase from the Moloney murine leukemia virus to transcribe an RNA sample into cDNA
a protocol with the objective to transcribe single-stranded RNA into complementary DNA (cDNA)
- We need to indicate the relationship between the cDNA generated and the RNA that was used as a template. This may be outside of the OBI scope
It could also be added that the reverse transcriptase is bearer of a GO:0003964 RNA-directed DNA polymerase activity, which is realized in this process.
+ We need to indicate the relationship between the cDNA generated and the RNA that was used as a template. This may be outside of the OBI scope
PERSON:Kevin Clancy
OBI branch derived
@@ -625290,7 +627881,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
RNA extraction
@@ -625326,7 +627917,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
nucleic acid extraction
@@ -625387,7 +627978,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
epitope
- a material entity bearing the epitope role
+ A material entity with the disposition to be bound by an adaptive immune receptor.
IEDB
IEDB
@@ -625467,16 +628058,17 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
antigen
- is a material entity that has the antigen role
+ A material entity that has the antigen role.
IEDB
IEDB
+
antigen
@@ -625564,7 +628156,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
target of material addition
A cell culture into which a mixture of peptides is being added.
- A material entity into which another is being added in a material combinatino process
+ A material entity that receives the addition of another material entity in an “adding a material entity into a target” process.
10/26/09: This defined class is used as a 'macro' to reduce the size of the IEDB export.
IEDB
@@ -625605,27 +628197,6 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
-
-
-
-
-
-
-
-
-
- assay antigen role
-
- Any molecule recognized by the adaptive immune receptors? Recognized means bound with a certain affinity? From GO ag binding:Interacting selectively with an antigen, any substance which is capable of inducing a specific immune response and of reacting with the products of that response, the specific antibody or specifically sensitized T-lymphocytes, or both. Binding may counteract the biological activity of the antigen. see OBI_1110120 below
- IEDB
- IEDB
-
- assay antigen role
-
-
-
-
@@ -625657,11 +628228,30 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -625671,9 +628261,11 @@ https://sourceforge.net/p/obi/obi-terms/738/
uterine cervix specimen
- A specimen that is derived from some uterine cervix
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some uterine cervix
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
uterine cervix specimen
@@ -625691,11 +628283,30 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -625705,9 +628316,11 @@ https://sourceforge.net/p/obi/obi-terms/738/
urethra specimen
- A specimen that is derived from some urethra
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some urethra
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
urethra specimen
@@ -625725,7 +628338,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -625733,15 +628346,26 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
cervical mucus specimen
- A specimen that is derived from some cervical mucus
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some cervical mucus
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
cervical mucus specimen
@@ -625759,11 +628383,30 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -625773,9 +628416,11 @@ https://sourceforge.net/p/obi/obi-terms/738/
throat specimen
- A specimen that is derived from some throat
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some throat
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
throat specimen
@@ -625793,11 +628438,30 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -625807,9 +628471,11 @@ https://sourceforge.net/p/obi/obi-terms/738/
eye specimen
- A specimen that is derived from some eye
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some eye
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
eye specimen
@@ -625827,11 +628493,30 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -625841,9 +628526,11 @@ https://sourceforge.net/p/obi/obi-terms/738/
respiratory system specimen
- A specimen that is derived from some respiratory system
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some respiratory system
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
respiratory system specimen
@@ -625861,11 +628548,30 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -625875,9 +628581,11 @@ https://sourceforge.net/p/obi/obi-terms/738/
upper respiratory tract specimen
- A specimen that is derived from some upper respiratory tract
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some upper respiratory tract
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
upper respiratory tract specimen
@@ -625895,11 +628603,30 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -625909,9 +628636,11 @@ https://sourceforge.net/p/obi/obi-terms/738/
nasopharynx specimen
- A specimen that is derived from some nasopharynx
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some nasopharynx
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
nasopharynx specimen
@@ -625929,7 +628658,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -625937,6 +628666,15 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
@@ -625944,8 +628682,10 @@ https://sourceforge.net/p/obi/obi-terms/738/
semen specimen
A specimen that is derived from some semen
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
semen specimen
@@ -625963,7 +628703,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -625971,6 +628711,15 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
@@ -625978,8 +628727,10 @@ https://sourceforge.net/p/obi/obi-terms/738/
bodily fluid specimen
A specimen that is derived from some bodily fluid
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
bodily fluid specimen
@@ -625997,11 +628748,30 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -626011,9 +628781,11 @@ https://sourceforge.net/p/obi/obi-terms/738/
chorionic villus specimen
- A specimen that is derived from some chorionic villus
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some chorionic villus
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
chorionic villus specimen
@@ -626031,7 +628803,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -626039,15 +628811,26 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
meconium specimen
- A specimen that is derived from some meconium
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some meconium
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
meconium specimen
@@ -626065,7 +628848,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -626073,15 +628856,26 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
-
+
umbilical cord blood specimen
A specimen that is derived from some umbilical cord blood
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
umbilical cord blood specimen
@@ -626099,7 +628893,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -626107,6 +628901,15 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
@@ -626114,8 +628917,10 @@ https://sourceforge.net/p/obi/obi-terms/738/
arterial blood specimen
A specimen that is derived from some arterial blood
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
arterial blood specimen
@@ -626133,7 +628938,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -626141,6 +628946,15 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
@@ -626148,8 +628962,10 @@ https://sourceforge.net/p/obi/obi-terms/738/
venous blood specimen
A specimen that is derived from some venous blood
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
venous blood specimen
@@ -626167,7 +628983,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -626175,6 +628991,15 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
@@ -626182,8 +629007,10 @@ https://sourceforge.net/p/obi/obi-terms/738/
capillary blood specimen
A specimen that is derived from some capillary blood
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
capillary blood specimen
@@ -626194,6 +629021,17 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
+
+
@@ -626203,7 +629041,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -626218,8 +629056,10 @@ https://sourceforge.net/p/obi/obi-terms/738/
erythrocyte specimen
A specimen that is derived from some erythrocytes
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
erythrocyte specimen
@@ -626230,6 +629070,17 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
+
+
@@ -626239,7 +629090,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -626253,9 +629104,11 @@ https://sourceforge.net/p/obi/obi-terms/738/
reticulocyte specimen
- A specimen that is derived from some reticulocytes
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ A specimen that is derived from some reticulocytes
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
reticulocyte specimen
@@ -626266,6 +629119,17 @@ https://sourceforge.net/p/obi/obi-terms/738/
+
+
+
+
+
+
+
+
+
+
+
@@ -626275,7 +629139,7 @@ https://sourceforge.net/p/obi/obi-terms/738/
-
+
@@ -626290,8 +629154,10 @@ https://sourceforge.net/p/obi/obi-terms/738/
leukocyte specimen
A specimen that is derived from some leukocytes
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
- Mark A. Miller|ORCID:0000-0001-9076-6066|Christian Stoeckert|ORCID:0000-0002-5714-991X
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
+ Christian Stoeckert ORCID:0000-0002-5714-991X
+ Mark A. Miller ORCID:0000-0001-9076-6066
leukocyte specimen
@@ -627315,8 +630181,12 @@ https://sourceforge.net/p/obi/obi-terms/738/
The totality of all processes through which a given disease instance is realized.
+ Albert Goldfain
+ http://ontology.buffalo.edu/medo/Disease_and_Diagnosis.pdf
+ creation date: 2009-06-23T11:55:44Z
+
disease course
@@ -629566,17 +632436,16 @@ Daily dose = Acetaminophen dose/drug duration
-
- viability
viability
- An organismal quality inhering in a bearer or a population by virtue of the bearer's ability or inability to survive and develop normally or the number of surviving individuals in a given population.
An organismal quality inhering in a bearer or a population by virtue of the bearer's disposition to survive and develop normally or the number of surviving individuals in a given population.
-
- viability
+ quality
+ PATO:0000169
+
+
viability
@@ -629629,32 +632498,19 @@ Daily dose = Acetaminophen dose/drug duration
-
-
-
-
- quality of a single physical entity
- A physical object quality which inheres in a single-bearer.
-
-
- quality of a single physical entity
-
-
-
-
- physical object quality
physical object quality
- A quality which inheres in a continuant.
A quality which inheres in a continuant.
-
+ PATO:0001237
+ PATO:0001238
+ snap:Quality
monadic quality of a continuant
multiply inhering quality of a physical entity
quality of a continuant
@@ -629663,7 +632519,9 @@ Daily dose = Acetaminophen dose/drug duration
quality of continuant
monadic quality of an object
monadic quality of continuant
- physical object quality
+ quality
+ PATO:0001241
+ Relational qualities are qualities that hold between multiple entities. Normal (monadic) qualities such as the shape of a eyeball exist purely as a quality of that eyeball. A relational quality such as sensitivity to light is a quality of that eyeball (and connecting nervous system) as it relates to incoming light waves/particles.
physical object quality
@@ -629773,17 +632631,14 @@ Daily dose = Acetaminophen dose/drug duration
-
- organismal quality
organismal quality
- A quality that inheres in an entire organism or part of an organism.
A quality that inheres in an entire organism or part of an organism.
-
- organismal quality
+ quality
+ PATO:0001995
organismal quality
@@ -629793,11 +632648,16 @@ Daily dose = Acetaminophen dose/drug duration
- virulence
- A quality inhering in a bearer by virtue of the bearer's pathogenicity.
+ A quality inhering in a bearer by virtue of the severity of infectious disease caused by the bearer in a target organism.
+
-
- virulence
+
+ 2009-10-30T05:04:06Z
+ quality
+ PATO:0002146
+
+
+ virulence
@@ -629824,7 +632684,6 @@ Daily dose = Acetaminophen dose/drug duration
-
natural protein
native protein
protein
@@ -644389,8 +647248,8 @@ Daily dose = Acetaminophen dose/drug duration
angiotensinogenase
PR:000013883
Category=gene.
- renin
renin
+ renin
@@ -650220,8 +653079,8 @@ Daily dose = Acetaminophen dose/drug duration
protein
PR:000050025
Category=family.
- angiotensinogenase
angiotensinogenase
+ angiotensinogenase
@@ -679671,8 +682530,8 @@ Daily dose = Acetaminophen dose/drug duration
+
-
@@ -679744,7 +682603,6 @@ Daily dose = Acetaminophen dose/drug duration
S
PR:P0DTC2
Category=organism-gene. Note: 1273 aa protein. Undergoes additional processing by proteolytic cleavage.
- S protein of SARS-CoV-2 Wuhan strain
spike glycoprotein (SARS-CoV-2)
@@ -680009,6 +682867,7 @@ Daily dose = Acetaminophen dose/drug duration
+
@@ -680070,12 +682929,17 @@ Daily dose = Acetaminophen dose/drug duration
A protein that is a translation product of the E gene in SARS-CoV-2.
+ Category=organism-gene. Note: 75 aa protein. A protein that is a translation product of the E gene in SARS-CoV-2.
+ E (SARS2)
+ envelope protein (SARS-CoV-2)
+ sM protein (SARS-CoV-2)
Reference: PMID: 24391744
Reference: PMID: 26035625
Reference: PMID: 26815195
Reference: PMID: 29764999
Reference: PMID: 31969702
+
GenPept:YP_009724392
UniProtKB:P0DTC4
E (SARS2)
@@ -800963,14 +803827,12 @@ Daily dose = Acetaminophen dose/drug duration
-
The olfactory organ of vertebrates, consisting of nares, olfactory epithelia and the structures and skeletal framework of the nasal cavity.
-
Organ that is the specialized structure of the face that contains olfactory neurons. The peripheral olfactory organ is paired[ZFA:0000047].
a protuberance in vertebrates that houses the nostrils, or nares, which admit and expel air for respiration in conjunction with the mouth. Behind the nose are the olfactory mucosa and the sinuses. Behind the nasal cavity, air next passes through the pharynx, shared with the digestive system, and then into the rest of the respiratory system. In humans, the nose is located centrally on the face; on most other mammals, it is on the upper tip of the snout[WP]. GO: The nose is the specialized structure of the face that serves as the organ of the sense of smell and as part of the respiratory system. Includes the nasi externus (external nose) and cavitas nasi (nasal cavity)[Wikipedia:Nose].
the organ that is specialized for smell and is part of the respiratory system
@@ -801003,21 +803865,14 @@ Daily dose = Acetaminophen dose/drug duration
uberon
nasus
olfactory apparatus
- proboInOwlInOwlscis
proboInOwlscis
UBERON:0000004
-
-
-
-
-
nose
-
http://upload.wikimedia.org/wikipedia/commons/d/d0/Canine-nose.jpg
@@ -801093,7 +803948,7 @@ Daily dose = Acetaminophen dose/drug duration
urethra
- the fibromuscular tubular canal through which urine is discharged from the bladder to the exterior via the external urinary meatus; in males, the urethra is joined by the ejaculatory ducts and serves as a passageway for semen during ejaculation, as well as a canal for urine during voiding; in females, the urethra is shorter and emerges above the vaginal opening
+ The fibromuscular tubular canal through which urine is discharged from the bladder to the exterior via the external urinary meatus; in males, the urethra is joined by the ejaculatory ducts and serves as a passageway for semen during ejaculation, as well as a canal for urine during voiding; in females, the urethra is shorter and emerges above the vaginal opening.
urethra
@@ -801105,7 +803960,6 @@ Daily dose = Acetaminophen dose/drug duration
-
@@ -801116,7 +803970,6 @@ Daily dose = Acetaminophen dose/drug duration
-
AAO:0010825
@@ -801156,12 +804009,10 @@ Daily dose = Acetaminophen dose/drug duration
Anatomical structure that performs a specific function or group of functions [WP].
-
Organs are commonly observed as visibly distinct structures, but may also exist as loosely associated clusters of cells that work together to perform a specific function or functions.
CARO v1 does not include a generic 'organ' class, only simple and compound organ. CARO v2 may include organ, see https://github.com/obophenotype/caro/issues/4
-
BIRNLEX:4
CARO:0020004
@@ -801180,7 +804031,6 @@ Daily dose = Acetaminophen dose/drug duration
body organ
element
UBERON:0000062
-
organ
@@ -801194,8 +804044,6 @@ Daily dose = Acetaminophen dose/drug duration
A multicellular structure that is a part of an organ.
currently defined in a very broad sense, may be replaced by more specific classes in the future
-
-
AAO:0011124
@@ -801206,9 +804054,6 @@ Daily dose = Acetaminophen dose/drug duration
uberon
regional part of organ
UBERON:0000064
-
-
-
@@ -801314,14 +804159,12 @@ Daily dose = Acetaminophen dose/drug duration
The proximal portion of the digestive tract, containing the oral cavity and bounded by the oral opening. In vertebrates, this extends to the pharynx and includes gums, lips, tongue and parts of the palate. Typically also includes the teeth, except where these occur elsewhere (e.g. pharyngeal jaws) or protrude from the mouth (tusks).
-
Cavity in which food is initially ingested and generally contains teeth, tongue and glands.[AAO]
Molecular and developmental cell lineage data suggest that the acoel mouth opening is homologous to the mouth of protostomes and deuterostomes and that the last common ancestor of the Bilateria (the 'urbilaterian') had only this single digestive opening.[well established][VHOG]
oral
some AOs place this as developing from the stomodeum but we weaken this to developmental contribution, as the mouth includes non-ectodermal derivatives
in FMA, the tongue, palate etc are part of the mouth which is itself a subdivision of the face. ZFA includes a separate class 'oral region' which is part of the mouth, but excludes tongue and lips
-
AAO:0010355
@@ -801367,14 +804210,6 @@ Daily dose = Acetaminophen dose/drug duration
vestibule of mouth
vestibulum oris
UBERON:0000165
-
-
-
-
-
-
-
-
@@ -801382,7 +804217,6 @@ Daily dose = Acetaminophen dose/drug duration
mouth
https://github.com/obophenotype/uberon/issues/661
-
http://upload.wikimedia.org/wikipedia/commons/0/06/Mouth_illustration-Otis_Archives.jpg
@@ -801474,7 +804308,7 @@ Daily dose = Acetaminophen dose/drug duration
renal medulla
- the inner portion of the kidney consisting of the renal pyramids
+ The inner portion of the kidney consisting of the renal pyramids.
renal medulla
@@ -801506,7 +804340,6 @@ Daily dose = Acetaminophen dose/drug duration
-
AAO:0010264
AEO:0000006
BILA:0000006
@@ -801546,7 +804379,7 @@ Daily dose = Acetaminophen dose/drug duration
anatomical cluster
- Anatomical group that has its parts adjacent to one another.
+ Anatomical group whose component anatomical structures lie in close proximity to each other.
anatomical cluster
@@ -801720,7 +804553,7 @@ Daily dose = Acetaminophen dose/drug duration
aorta
- The main trunk of the systemic arterial system that carries blood from the heart to all the organs and other structures of the body, bringing oxygenated blood to all parts of the body in the systemic circulation
+ The main trunk of the systemic arterial system that carries blood from the heart to all the organs and other structures of the body, bringing oxygenated blood to all parts of the body in the systemic circulation.
aorta
@@ -801806,7 +804639,7 @@ Daily dose = Acetaminophen dose/drug duration
-
+
cerebral cortex
The thin layer of gray matter on the surface of the cerebral hemisphere that develops from the telencephalon. It consists of the neocortex (6 layered cortex or isocortex), the hippocampal formation and the olfactory cortex.
@@ -801834,7 +804667,7 @@ Daily dose = Acetaminophen dose/drug duration
ovary
- the gonad of a female organism which contains germ cells
+ The gonad of a female organism which contains germ cells.
ovary
@@ -801847,7 +804680,7 @@ Daily dose = Acetaminophen dose/drug duration
uterus
- the female muscular organ of gestation in which the developing embryo or fetus is nourished until birth
+ The female muscular organ of gestation in which the developing embryo or fetus is nourished until birth.
uterus
@@ -801886,7 +804719,7 @@ Daily dose = Acetaminophen dose/drug duration
adipose tissue
- Portion of connective tissue composed of adipocytes enmeshed in areolar tissue
+ Portion of connective tissue composed of adipocytes enmeshed in areolar tissue.
adipose tissue
@@ -801912,7 +804745,7 @@ Daily dose = Acetaminophen dose/drug duration
rectum
- the terminal portion of the intestinal tube, terminating with the anus
+ The terminal portion of the intestinal tube, terminating with the anus.
rectum
@@ -801930,7 +804763,6 @@ Daily dose = Acetaminophen dose/drug duration
-
@@ -801980,7 +804812,7 @@ Daily dose = Acetaminophen dose/drug duration
urine
- Excretion that is the output of a kidney
+ Excretion that is the output of a kidney.
urine
@@ -802018,40 +804850,11 @@ Daily dose = Acetaminophen dose/drug duration
-
skeletal muscle tissue
Muscle tissue that consists primarily of skeletal muscle fibers.
- TODO - add skeletal muscle organ? See GO:0060538 skeletal muscle organ development. Todo - group FBbt:00005073 - somatic muscle.
-
- Muscle, composed of long cylindrical, multinucleated cells that attaches to the skeleton via tendons.[TAO]
- Tissue which consists of skeletal muscle fibers surrounded by endomysium. Examples: Skeletal muscle tissue of biceps, Skeletal muscle tissue of diaphragm[FMA]
- This result implies the following views in terms of evolutionary differentiation: (1) Arthropod striated muscle and vertebrate skeletal and cardiac muscles share a common ancestor. In other words, they did not evolve independently (...) (5) The divergence of vertebrate skeletal and cardiac muscles/vertebrate smooth muscle and nonmuscle is at least before that of vertebrates/arthropods. In other words, emergence of skeletal and cardiac musle type tissues preceded the vertebrate/arthropod divergence (ca. 700 MYA).[well established][VHOG]
-
-
-
-
- skeletal muscle
-
-
-
- EMAPA:32716
- FMA:14069
- MA:0002439
- NCIT:C13050
- UMLS:C0242692
- uberon
- skeletal muscle system
- somatic muscle
- UBERON:0001134
-
-
-
-
-
skeletal muscle tissue
-
@@ -802061,7 +804864,7 @@ Daily dose = Acetaminophen dose/drug duration
colon
- Last portion of the large intestine before it becomes the rectum.
+ A portion of the large intestine before it becomes the rectum. In mammals, the colon is the most part of the large intestine, excluding the vermiform appendix, the rectum and the anal canal.
colon
@@ -802100,7 +804903,7 @@ Daily dose = Acetaminophen dose/drug duration
urinary bladder
- distensible musculomembranous organ situated in the anterior part of the pelvic cavity in which urine collects before excretion[MP].
+ Distensible musculomembranous organ situated in the anterior part of the pelvic cavity in which urine collects before excretion[MP].
urinary bladder
@@ -802113,7 +804916,7 @@ Daily dose = Acetaminophen dose/drug duration
pancreas
- An endoderm derived structure that produces precursors of digestive enzymes and blood glucose regulating enzymes[GO].
+ An endoderm derived structure that produces precursors of digestive enzymes and blood glucose regulating hormones[GO].
pancreas
@@ -802137,7 +804940,7 @@ Daily dose = Acetaminophen dose/drug duration
-
+
tibial nerve
The tibial nerve is a branch of the sciatic nerve. The tibial nerve passes through the popliteal fossa to pass below the arch of soleus. In the popliteal fossa the nerve gives off branches to gastrocnemius, popliteus, soleus and plantaris muscles, an articular branch to the knee joint, and a cutaneous branch that will become the sural nerve. The sural nerve is joined by fibres from the common peroneal nerve and runs down the calf to supply the lateral side of the foot. Below the soleus muscle the nerve lies close to the tibia and supplies the tibialis posterior, the flexor digitorum longus and the flexor hallucis longus. The nerve passes into the foot running posterior to the medial malleolus. Here it is bound down by the flexor retinaculum in company with the posterior tibial artery. [WP,unvetted].
@@ -802160,6 +804963,19 @@ Daily dose = Acetaminophen dose/drug duration
+
+
+
+
+ digestive tract
+ A tube extending from the mouth to the anus.
+
+
+ digestive tract
+
+
+
+
@@ -802178,7 +804994,7 @@ Daily dose = Acetaminophen dose/drug duration
lower respiratory tract
- The segment of the respiratory tract that starts proximally with the trachea and includes all distal structures including the lungs[WP,modified]
+ The segment of the respiratory tract that starts proximally with the trachea and includes all distal structures including the lungs[WP,modified].
lower respiratory tract
@@ -802202,7 +805018,7 @@ Daily dose = Acetaminophen dose/drug duration
-
+
coronary artery
An artery that supplies the myocardium.
@@ -802212,6 +805028,19 @@ Daily dose = Acetaminophen dose/drug duration
+
+
+
+
+ artery
+ An epithelial tube or tree of tibes that transports blood away from the heart[modified from AEO definition].
+
+
+ artery
+
+
+
+
@@ -802230,7 +805059,7 @@ Daily dose = Acetaminophen dose/drug duration
nasopharynx
- the section of the pharynx that lies above the soft palate
+ The section of the pharynx that lies above the soft palate.
nasopharynx
@@ -802243,7 +805072,7 @@ Daily dose = Acetaminophen dose/drug duration
oropharynx
- the portion of the pharynx that lies between the soft palate and the upper edge of the epiglottis
+ The portion of the pharynx that lies between the soft palate and the upper edge of the epiglottis.
oropharynx
@@ -802256,7 +805085,7 @@ Daily dose = Acetaminophen dose/drug duration
vitreous humor
- A transparent, semigelatinous substance that fills the cavity behind the crystalline lens of the eye and in front of the retina
+ A transparent, semigelatinous substance that fills the cavity behind the crystalline lens of the eye and in front of the retina.
vitreous humor
@@ -802334,7 +805163,7 @@ Daily dose = Acetaminophen dose/drug duration
bile
- vital aqueous secretion of the liver that is formed by hepatocytes and modified down stream by absorptive and secretory properties of the bile duct epithelium.
+ Vital aqueous secretion of the liver that is formed by hepatocytes and modified down stream by absorptive and secretory properties of the bile duct epithelium.
bile
@@ -802376,7 +805205,7 @@ Daily dose = Acetaminophen dose/drug duration
placenta
- organ of metabolic interchange between fetus and mother, partly of embryonic origin and partly of maternal origin[GO]. The fetal portion of the placenta is known as the villous chorion. The maternal portion is known as the decidua basalis. The two portions are held together by anchoring villi that are anchored to the decidua basalis by the cytotrophoblastic shell.
+ Organ of metabolic interchange between fetus and mother, partly of embryonic origin and partly of maternal origin[GO]. The fetal portion of the placenta is known as the villous chorion. The maternal portion is known as the decidua basalis. The two portions are held together by anchoring villi that are anchored to the decidua basalis by the cytotrophoblastic shell.
placenta
@@ -802391,6 +805220,7 @@ Daily dose = Acetaminophen dose/drug duration
feces
Portion of semisolid bodily waste discharged through the anus[MW,modified]
+ Portion of semisolid bodily waste discharged through the anus[MW,modified].
Excretion in semisolid state processed by the intestine.[FMA]
@@ -802546,96 +805376,15 @@ Daily dose = Acetaminophen dose/drug duration
-
-
-
-
-
- Lowermost layer of the integumentary system in vertebrates. Types of cells that are found in the hypodermis are fibroblasts, adipose cells, and macrophages. It is derived from the mesoderm, but unlike the dermis, it is not derived from the dermatome region of the mesoderm. The hypodermis is used mainly for fat storage[WP].
-
-
- A layer separating the inner face of the dermis from the subjacent muscle cells. It is covered on both sides by a basement membrane. It contains pigment cells. Le Guellec et al, 2004.[TAO]
- A layer separating the inner face of the dermis from the subjacent muscle cells. It is covered on both sides by a basement membrane. It contains pigment cells[FMA:70544].
- hypodermal
- subcutaneous
- subcutaneus
- BTO has 'subcutis', as part of dermis. We follow FMA in having distinct classes for hypodermis and superficial fascia, and including these as part of the non-skin intgeument.
-
-
- BTO:0001314
- CALOHA:TS-2366
- FMA:70544
- NCIT:C33645
- TAO:0001136
- UMLS:C0278403
- ZFA:0001136
- hypoderm
- vertebrate hypodermis
- uberon
- sub-tegumental tissue
- subcutaneous tissue
- subcutis
- subtegumental tissue
- superficial fascia
- tela subcutanea
- UBERON:0002072
-
-
-
-
-
- hypodermis
-
-
-
-
-
-
-
skin of body
The organ covering the body that consists of the dermis and epidermis.
- consider 'integumentary system' for invertebrates
-
- MA uses the term skin to refer to what is called here: zone of skin
-
-
-
- BTO:0001253
- CALOHA:TS-0934
- EFO:0000962
- EHDAA2:0001844
- EMAPA:17525
- FMA:7163
- MESH:D012867
- MFMO:0000099
- NCIT:C12470
- OpenCyc:Mx4rvVjX3ZwpEbGdrcN5Y29ycA
- UMLS:C1123023
- XAO:0000023
- galen:Skin
- entire skin
- skin organ
- uberon
- entire integument
- integument
- integumental organ
- pelt
- skin
- UBERON:0002097
-
-
-
-
-
-
skin of body
-
@@ -802645,7 +805394,7 @@ Daily dose = Acetaminophen dose/drug duration
spleen
- the organ that functions to filter blood and to store red corpuscles and platelets
+ The organ that functions to filter blood and to store red corpuscles and platelets.
spleen
@@ -802716,7 +805465,7 @@ Daily dose = Acetaminophen dose/drug duration
ileum
- the portion of the small intestine that extends from the jejunum to the colon
+ The portion of the small intestine that extends from the jejunum to the colon.
ileum
@@ -802857,7 +805606,7 @@ Daily dose = Acetaminophen dose/drug duration
bone marrow
- the soft tissue that fills the cavities of bones
+ The soft tissue that fills the cavities of bones.
bone marrow
@@ -802865,37 +805614,15 @@ Daily dose = Acetaminophen dose/drug duration
-
+
-
-
-
- Muscle tissue is a contractile tissue made up of actin and myosin fibers[GO].
+
+
+ lymph
+ Lymph is the fluid that is formed when interstitial fluid enters the conduits of the lymphatic system through lymph capillaries[WP].
+
-
- One of the four types of tissue in traditional classifications. Tissue that contains cells with contractile filaments that move past each other and change the size of the cell. Muscle tissue also is separated into three distinct categories.[AAO]
-
-
-
- AAO:0000306
- AEO:0000122
- CALOHA:TS-0642
- EHDAA2:0003122
- EMAPA:32715
- FMA:9641
- MA:0002437
- MESH:D009132
- NCIT:C12435
- UMLS:C2328219
- galen:MuscleTissue
- muscular tissue
- portion of muscle tissue
- textus muscularis
- uberon
- UBERON:0002385
-
- Vertebrate muscle is categorized into three major muscle types defined by their structural and functional properties: skeletal, cardiac and smooth. In Dmel the counterparts are somatic, heart/cardiac and visceral. Here we take a cell type based approach.
- muscle tissue
+ lymph
@@ -802905,7 +805632,7 @@ Daily dose = Acetaminophen dose/drug duration
pericardial fluid
- Transudate contained in the pericardial cavity.[FMA]
+ Transudate contained in the pericardial cavity.[FMA].
pericardial fluid
@@ -803003,12 +805730,10 @@ Daily dose = Acetaminophen dose/drug duration
An anatomical structure that develops (entirely or partially) from the mesoderm.
Grouping term for query purposes
-
FBbt:00025998
mesodermal derivative
uberon
UBERON:0004120
-
mesoderm-derived structure
@@ -803022,12 +805747,10 @@ Daily dose = Acetaminophen dose/drug duration
An anatomical structure that develops (entirely or partially) from the ectoderm.
Grouping term for query purposes
-
FBbt:00025990
ectodermal deriviative
uberon
UBERON:0004121
-
ectoderm-derived structure
@@ -803054,7 +805777,6 @@ Daily dose = Acetaminophen dose/drug duration
A proximal-distal subdivision of the digestive tract.
intended to denote both embryonic and adult structures. Note the FMA grouping here is not quite correct.
-
FBbt:00100315
FMA:71131
uberon
@@ -803063,7 +805785,6 @@ Daily dose = Acetaminophen dose/drug duration
segment of intestinal tract
subdivision of alimentary system
UBERON:0004921
-
subdivision of digestive tract
@@ -803253,7 +805974,7 @@ Daily dose = Acetaminophen dose/drug duration
-
+
tibial artery
The anterior and posterior arteries created at the bifurcation of the popliteal artery. The anterior tibial artery begins at the lower border of the popliteus muscle and lies along the tibia at the distal part of the leg to surface superficially anterior to the ankle joint. Its branches are distributed throughout the leg, ankle, and pes. The posterior tibial artery begins at the lower border of the popliteus muscle, lies behind the tibia in the lower part of its course, and is found situated between the medial malleolus and the medial process of the calcaneal tuberosity. Its branches are distributed throughout the leg and foot.
@@ -803268,7 +805989,7 @@ Daily dose = Acetaminophen dose/drug duration
esophagogastric junction
- The junction between the esophagus and the stomach epithelium
+ The junction between the esophagus and the stomach epithelium.
esophagogastric junction
@@ -803282,13 +806003,11 @@ Daily dose = Acetaminophen dose/drug duration
An anatomical structure that has more than one cell as a part.
-
CARO:0010000
FBbt:00100313
multicellular structure
uberon
UBERON:0010000
-
multicellular anatomical structure
@@ -803313,9 +806032,9 @@ Daily dose = Acetaminophen dose/drug duration
-
+
umbilical cord blood
- blood that remains in the placenta and in the attached umbilical cord after childbirth[WP].
+ Blood that remains in the placenta and in the attached umbilical cord after childbirth[WP].
umbilical cord blood
@@ -803454,6 +806173,19 @@ Daily dose = Acetaminophen dose/drug duration
+
+
+
+
+ placental blood
+ Blood located in the placenta.
+
+
+ placental blood
+
+
+
+
@@ -803471,35 +806203,17 @@ Daily dose = Acetaminophen dose/drug duration
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
+
+
+
A vaccine is a processed material with the function that when administered, it prevents or ameliorates a disorder in a target organism by inducing or modifying adaptive immune responses specific to the antigens in the vaccine.
Many vaccines are developed to protect against infectious pathogens that causes infectious diseases. Many vaccines are also being developed against other diseases such as cancer, allergy, and autoimmune diseases.
YH, BP, BS, MC, LC, XZ, RS
- a role that inheres in a prepared material entity that is designed to induce protection or treament for a diease or infection in vivo.
+ vaccine
vaccine
MeSH: D014612
@@ -803545,6 +806259,38 @@ Daily dose = Acetaminophen dose/drug duration
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -803571,94 +806317,63 @@ Daily dose = Acetaminophen dose/drug duration
YH, BP
vaccine administration
+ process
vaccination
-
-
-
-
- YH
-
- vaccine-induced B cell mediated immunity
-
-
-
-
-
-
-
-
- a vaccine adjuvant that is formed as a mineral salt.
- SGS, YH
-
- mineral salt vaccine adjuvant
- CVX: 119
-
-
-
-
-
-
-
-
- YH
-
- vaccine-induced T cell mediated immunity
-
-
-
-
-
-
-
-
- YH, SGS
- a vaccine adjuvant that contains microbial derived material.
-
- microbial derivative vaccine adjuvant
- CVX: 52
- CVX: 83
-
-
+
-
-
-
-
-
- an aluminum vaccine adjuvant that contains aluminum hydroxide.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A vaccine that is composed of a plasmid vaccine vector (a circular double stranded DNA molecule) containing the whole of parts of genes encoding one or more vaccine antigen proteins.
YH
- alum
+ genetic vaccine
+ naked DNA vaccine
+ nucleic acid vaccine
- aluminum hydroxide vaccine adjuvant
+ vaccine
+ DNA vaccine
-
+
-
-
- an aluminum vaccine adjuvant that is aluminum phosphate.
- YH, SGS
- Adju-Phos®
- Al(PO)4
-
- aluminum phosphate vaccine adjuvant
-
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A bacterial vaccine that prevents against Escherichia coli infection.
YH
+ E. coli vaccine
- vaccine-induced adaptive immune response
+ vaccine
+ Escherichia coli vaccine
+ MeSH: D022361
@@ -803670,6 +806385,7 @@ Daily dose = Acetaminophen dose/drug duration
a viral vaccine vector that uses an adenovirus as the vector.
YH
+ vaccine component
adenovirus vaccine vector
NCBI Taxonomy ID: 10508
@@ -803681,26 +806397,37 @@ Daily dose = Acetaminophen dose/drug duration
a vaccine component role that inheres in a recombinant vaccine vector as a vaccine component. The combination of a recombinant vaccine vector and a heterogenous protective antigen(s) inserted inside the vector for a recombinant vector vaccine.
- YH,YL
+ YH
+ YL
+ role
recombinant vaccine vector role
-
+
-
-
- an adjuvant role that inheres in a vaccine component which is added as part of a vaccine and induces enhanced adaptive immune response to the vaccine antigen.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A vaccine that targets against a bacterial disease.
YH
- The Latin "adjuvans" means to help, particularly to reach a goal.
-
-Adjuvant therapy for cancer is surgery followed by chemotherapy or radiation to help decrease the risk of the cancer recurring (coming back).
-
-An adjuvant is a substance that helps and enhances the pharmacological effect of a drug or increases the ability of an antigen to stimulate the immune system.
- vaccine adjuvant role
+ vaccine
+ bacterial vaccine
+ MeSH: D001428
@@ -803712,6 +806439,7 @@ An adjuvant is a substance that helps and enhances the pharmacological effect of
a virulence of vaccine organism that shows an attenuated pheontype of the organism as the major component of a vaccine.
YH
+ quality
vaccine organism live attenuated
@@ -803732,46 +806460,61 @@ An adjuvant is a substance that helps and enhances the pharmacological effect of
+
+
+
+
+
+
a processed material that is output of the vaccine preparation and part of a vaccine.
YH
cardinal part of vaccine
vaccine ingredient
+ vaccine component
vaccine component
-
+
-
-
- an organismal quality of a whole organism vaccine where the whole organism is inactivated/killed and lacks the capability of replication.
- YH
- vaccine organism killed
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A vaccine that uses RNA(s) derived from a pathogen organism.
+ Using RNA may eliminate the problem of having to tailor a vaccine for each individual patient with their specific immunity. The advantage of RNA is that it can be used for all immunity types and can be taken from a single cell. DNA vaccines need to produce RNA which then prompts the manufacture of proteins. However, RNA vaccine eliminates the step from DNA to RNA.
+ Oliver He
+ mRNA vaccine
+ https://en.wikipedia.org/wiki/RNA_vaccine
- vaccine organism inactivated
+ vaccine
+ RNA vaccine
-
+
-
-
+
+
+ an organismal quality of a whole organism vaccine where the whole organism is inactivated/killed and lacks the capability of replication.
YH
+ vaccine organism killed
- vaccine-induced antiviral neutralizing antibody response
-
-
-
-
-
-
-
-
-
- vaccine-induced T cell interferon-gamma production
+ quality
+ vaccine organism inactivated
@@ -803788,136 +806531,164 @@ An adjuvant is a substance that helps and enhances the pharmacological effect of
- vaccine function is a function that inheres in a vaccine that induces protective immune response against a disease. It is realized in the immunization process in the host.
+ vaccine function is a function that inheres in a vaccine that induces protective immune response against a disease. It is realized in the immunization process in the host.
PERSPN: Oliver He: There has been hot discussion about whether we use 'vaccine function' or 'vaccine role'. Vaccine role may not be the good term to use. Vaccine is designed to be 'vaccine', so it should be vaccine function. One special case is cowpox virus. The cowpox virus can be mixed with some liquid like water and used as a smallpox vaccine. In this case, people often say: the cowpox virus has a 'vaccine role'. However, the cowpox virus vaccine is a processed material of a mix of the virus with water. The virus is a virus, it is not a vaccine per se. Therefore, vaccine role may not be an accurate term.
- YH, MC, XZ, and AR
+ MC
+ XZ
+ and AR
+ YH
+ disposition
vaccine function
-
+
-
-
- Any immune system process that functions in the calibrated response of the host to a vaccine.
- The definition of this term is based on the definition of 'immune response (GO:0006955)' . It is a child term of this GO term.
- Y.L.
+
+
+ A legal organization that represents an association of people with a specific objective.
+ YH
+ https://en.wikipedia.org/wiki/Company
- Y.H.
- vaccine-induced host immune response
+ material entity
+ company
-
+
-
-
-
+
+
-
-
+
+
-
+
+
-
-
-
-
-
-
-
-
-
-
-
-
+
+
- a processual entity that specifies host response to a vaccine.
+ A whole organism vaccine that uses an inativated pathogen organism as its component.
YH
+ inactivated organism vaccine
+ killed vaccine
- vaccine-induced host response
+ vaccine
+ inactivated vaccine
-
+
-
-
- YH
- https://en.wikipedia.org/wiki/Company
+
+
+ A route of administration that inject the material(such as vaccines, allergens) directly into a muscle.
+ YH,YL
+ intramuscular injection route
- A legal organization that represents an association of people with a specific objective.
- company
+ site
+ intramuscular route
-
+
-
-
+
+
+ A rounte of administration that located in nose.
YH
- immunoglobulin mediated immune response to vaccine
- vaccine-induced antibody mediated immune response
+ site
+ intranasal route
-
+
-
-
+
+
+
+
+
+
+
+
-
-
+
+
- a route of administration that inject the material(such as vaccines, allergens) directly into a muscle.
- YH,YL
- intramuscular injection route
+ A vaccine that is licensed for commercial use.
+ YH
- I.M.
- intramuscular route
+ vaccine
+ licensed vaccine
-
+
-
-
+
+
+
+
+
+
+
+
-
-
+
+
- rounte of administration that located in nose.
+ A vaccine that is made from microbes that have been attenuated (weakened) in the laboratory so that they can't cause disease.
YH
+ attenuated vaccine
- I.N.
- intranasal route
+ vaccine
+ live attenuated vaccine
-
+
-
-
- YL,YH
- Page 73, Chapter 6, Vaccine, 5th Edition. EXPERT CONSULT by Plotkin SA., et. al. 2008
- a role inheres in a material entity, that has been added into a vaccine's formulation by the manufacture for a specific purpose. For example: adjuvant to enhance the effect of immunogen, perservatives, stablizers and those materials added for affecting PH and isotonicity.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ bacterial vaccine that is used to protect against Leptospira spp. infection
+ YL
- vaccine additive role
+ vaccine
+ Leptospira spp. vaccine
@@ -803929,6 +806700,7 @@ An adjuvant is a substance that helps and enhances the pharmacological effect of
a viral vaccine vector that uses an poxvirus as the vector.
YH
+ vaccine component
poxvirus vaccine vector
NCBI Taxonomy ID: 10240
@@ -803961,6 +806733,7 @@ An adjuvant is a substance that helps and enhances the pharmacological effect of
YH
prophylactic vaccine function
+ disposition
preventive vaccine function
@@ -803970,9 +806743,10 @@ An adjuvant is a substance that helps and enhances the pharmacological effect of
- Protective antigen is an antigen that stimulates protective immunity when used in vivo.
+ An antigen that stimulates protective immunity when used in vivo.
YH
+ role
protective antigen role
@@ -803987,16 +806761,23 @@ An adjuvant is a substance that helps and enhances the pharmacological effect of
-
+
- A vaccine that uses a modified virus or bacterium to deliver genes that code for microbial antigens to cells of the body.
+
+
+
+
+
+
+ A vaccine that uses a modified virus or bacterium as the vector to deliver vaccine antigen(s) to the cells of the host body.
YH
+ vaccine
recombinant vector vaccine
@@ -804007,9 +806788,10 @@ An adjuvant is a substance that helps and enhances the pharmacological effect of
immunization is a processual entity that primes or modifies an adaptivie immune response to some antigens.
- YH, XZ, BP
+ YH, XZ, BP
WEB: http://en.wikipedia.org/wiki/Immunization
+ process
immunization
@@ -804023,9 +806805,7 @@ An adjuvant is a substance that helps and enhances the pharmacological effect of
YH, XZ
WEB: http://en.wikipedia.org/wiki/Immunization
- Active immunization entails the introduction of a foreign molecule into the body, which causes the body itself to generate immunity against the target. This immunity comes from the T cells and the B cells with their antibodies.
-Active immunization can occur naturally when a person comes in contact with, for example, a microbe. If the person has not yet come into contact with the microbe and has no pre-made antibodies for defense (like in passive immunization), the person becomes immunized. The immune system will eventually create antibodies and other defenses against the microbe. The next time, the immune response against this microbe can be very efficient; this is the case in many of the childhood infections that a person only contracts once, but then is immune.
-Artificial active immunization is where the microbe, or parts of it, are injected into the person before they are able to take it in naturally. If whole microbes are used, they are pre-treated, Attenuated vaccine. (Wikipedia)
+ process
active immunization
@@ -804068,6 +806848,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
artificial active immunization
WEB: http://en.wikipedia.org/wiki/Immunization
+ process
vaccine immunization
@@ -804080,6 +806861,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
induction of adaptive immune response to antigen is an active immunization process that results in induction of adaptive immune response to some antigens, for example, in a vaccine.
YH, XZ
+ process
induction of adaptive immune response to antigen
@@ -804092,6 +806874,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
disorder prevention is a processual entity that prevents a disorder that is the physical basis of a disease.
YH, XZ
+ process
disorder prevention
@@ -804104,39 +806887,60 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
disorder treatment is a processual entity that leads to treat a disorder that is the physical basis of a disease.
YH, XZ
+ process
disorder treatment
-
+
-
-
- modification of adaptive immune response to antigen is an active immunization process that results in modification of an adaptive immune response to some antigens, for example, in a therapeutic vaccine.
- YH, XZ
+
+
+ A route of administration that is loacted in the hypodermis (subcutaneous tissue) region.
+ YL, YH
- modification of adaptive immune response to antigen
+ site
+ subcutaneous route
-
+
-
-
+
+
+
+
+
+
+
+
-
-
+
+
- a route of administration that is loacted in the hypodermis (subcutaneous tissue) region.
- YL
+ A vaccine that is composed of a purified protein(s) or other antigenic determinant(s) from a disease-causing organism. A subunit vaccine does not include the whole organism of a pathogen, so the subunits have less risk of causing adverse reactions.
+ YH
- YH
- S.C.
- subcutaneous route
+ vaccine
+ subunit vaccine
+
+
+
+
+
+
+
+
+ a vaccine that is designed to immunize against two or more strains of the same microorganism, or against two or more microorganisms.
+ NF, YH
+ WEB: http://coastalcarolinaresearch.com/?p=679
+
+ vaccine
+ multivalent vaccine
@@ -804145,20 +806949,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
-
-
-
-
-
-
-
-
@@ -804174,6 +806964,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
The therapeutic vaccine function is a function realized by the process of vaccination and leading to induction of an adaptive immune response to the antigens in a vaccine, which ameliorates a specific disorder.
YH
+ disposition
therapeutic vaccine function
@@ -804183,17 +806974,12 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
- a path that is located in gross anatomical part of an organism (e.g., human) and is used for administering a vaccine, a drug, fluid, poison, or other substance into the body.
+ A path that is located in gross anatomical part of an organism (e.g., human) and is used for administering a vaccine, a drug, fluid, poison, or other substance into the body.
CDISC has a codelist: Rout of Administration. Desription from CDISC: The course by which a substance was administered in order to reach the site of action in the body. CDISC_SDTM_Route_of_Administration_Terminology
YH,YL
http://en.wikipedia.org/wiki/Route_of_administration
+ site
route of administration
http://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C38114
http://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66729
@@ -804201,79 +806987,58 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- a vaccine component that is chemical substance added to vaccine and enhance and direct immune response to protective antigen. Many of vaccine adjuvants cause a range of serious side-effects.
- YH
-
- vaccine adjuvant
-
-
-
-
immunization objective is the specification of an objective to achieve immunization.
- YH, XZ
+ XZ
+ YH
WEB: http://en.wikipedia.org/wiki/Immunization
+ information content entity
immunization objective
-
+
-
-
-
-
-
-
+
+
+
+
-
-
+
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
-
-
+
+
- vaccine preparation is a manufacturing process to produce a vaccine.
- YH, BP
- vaccine generation
- vaccine production
+ a multivalent vaccine that is designed to immunize against at least one bacterial disease and one viral disease.
+ NF, YH
- vaccine preparation
-
-
-
-
-
-
-
-
- YH
-
- vaccine specific T cell cytokine production
+ vaccine
+ multivalent vaccine against bacterial and viral diseases
@@ -804293,6 +807058,12 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+
+
+
+
+
+
a vaccine component that uses a microbe (e.g., bacterium, virus, and parasitic organism) as a vector that is inserted with the DNA(s) of a heterologous protective antigen(s) to generate a "recombinant vector vaccine". The microorganism used as a vector generally has a stable non or low pathogenic phenotype for the species the vaccine is intended for.
YH
recombinant vector
@@ -804300,6 +807071,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
WEB: http://www.biosafety.be/GT/Regulatory/Veterinary_vaccines/EMEA_000404en.pdf
WEB: http://www.ema.europa.eu/docs/en_GB/document_library/Scientific_guideline/2009/09/WC500003856.pdf
+ vaccine component
recombinant vaccine vector
@@ -804312,6 +807084,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
an orthopoxvirus vaccine vector that uses vaccinia virus as the vector
YH
+ vaccine component
vaccinia virus vector
NCBI Taxonomy ID: 10245
@@ -804327,7 +807100,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
+
@@ -804337,6 +807110,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A vaccine that targets against a viral disease.
YH
+ vaccine
viral vaccine
MeSH: D014765
@@ -804350,6 +807124,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
a vaccine vector that uses a virus as the vector.
YH
+ vaccine component
viral vaccine vector
NCBI Taxonomy ID: 10239
@@ -804360,10 +807135,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+ A role that inheres in a prepared material entity that is designed to induce protection or treatment for a disease or infection.
YH
- a role that inheres in a prepared material entity that is designed to induce protection or treatment for a disease or infection.
- vaccine role
+ role
+ vaccine role
@@ -804383,10 +807159,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+ A role that inheres in a material entity that becomes an ingredient of a vaccine.
YH
- a role that inheres in a material entity that becomes an ingredient of a vaccine.
- vaccine component role
+ role
+ vaccine component role
@@ -804398,7 +807175,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
a vaccine role that indicates the vaccine being a DNA vaccine.
YH
- DNA vaccine role
+ role
+ DNA vaccine role
@@ -804410,7 +807188,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
a vaccine role that indicates the vaccine being a subunit vaccine.
YH
- subunit vaccine role
+ role
+ subunit vaccine role
@@ -804422,6 +807201,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
licensed vaccine role is a regulation-assigned role that indicates that a vaccine obtains official approval for commercial production and selling on the market.
YH
+ role
licensed vaccine role
@@ -804434,7 +807214,70 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
a vaccine role that indicates the vaccine being a recombinant vector vaccine.
YH
- recombinant vector vaccine role
+ role
+ recombinant vector vaccine role
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A viral vaccine that protects against infection with Rotavirus.
+ YH
+
+ vaccine
+ Rotavirus vaccine
+ MeSH: D022243; UMLS_CUI: C0597418; SNOMEDCT: 116077000
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ a viral vaccine that is inactivated
+ killed viral vaccine
+
+ vaccine
+ inactivated viral vaccine
@@ -804446,32 +807289,48 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
a vaccine role that indicates the vaccine being a RNA vaccine.
YH
- RNA vaccine role
+ role
+ RNA vaccine role
-
+
-
-
- a licensed vaccine role that indicates the vaccine occurs in USA.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A bacterial vaccine that protects against infections by various Salmonella species.
YH
+ https://en.wikipedia.org/wiki/Salmonella
- USA licensed vaccine role
+ vaccine
+ Salmonella vaccine
+ MeSH: D022562
-
+
-
-
- a mineral salt vaccine adjuvant that is composed of aluminum salt.
- Aluminum vaccine adjuvant is a vaccine adjuvant that is composed of some aluminum compound.
+
+
+ a licensed vaccine role that indicates the vaccine occurs in USA.
YH
- aluminum vaccine adjuvant
+ role
+ USA licensed vaccine role
@@ -804480,15 +807339,10 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
+ A route of administration that located in the mouth
YH
- a route of administration that located in the mouth
+ site
oral route
@@ -804498,17 +807352,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
- a route of administration that inject the material(such as vaccines, allergens) into the skin itself.
+ A route of administration that inject the material(such as vaccines, allergens) into the skin itself.
YH,YL
intradermal injection route
- I.D.
+ site
intradermal route
@@ -804533,6 +807381,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Modified live virus
YH
+ vaccine
RECOMBITEK Corona MLV
@@ -804550,6 +807399,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
YH
+ vaccine
canine coronavirus vaccine
@@ -804562,7 +807412,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
an adenovirus vaccine vector that uses a chimpanzee adenovirus strain
Yongqun He, Shunzhou Deng
- chimpanzee adenovirus vaccine vector
+ vaccine component
+ chimpanzee adenovirus vaccine vector
NCBI Taxonomy ID: 310542
@@ -804577,7 +807428,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
NDV vaccine vector
PMID: 23845804
- Newcastle disease virus vaccine vector
+ vaccine component
+ Newcastle disease virus vaccine vector
NCBI Taxonomy ID: 11176
@@ -804591,6 +807443,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Yongqun He
human adenovirus 5 vaccine vector
+ vaccine component
adenovirus serotype 5 vaccine vector
NCBI Taxonomy ID: 28285
@@ -804605,7 +807458,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
YH
PMID: 24933081
- Modified Vaccinia Ankara (MVA) virus vaccine vector
+ vaccine component
+ Modified Vaccinia Ankara (MVA) virus vaccine vector
NCBI Taxonomy ID: 467144
@@ -804616,8 +807470,10 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
vaccine viability is a viability of a vaccine organism.
- YH, ZX
+ ZX
+ YH
+ quality
vaccine organism viability
@@ -804630,32 +807486,101 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
a poxvirus vaccine vector that uses an orthopox virus as the vector
Yongqun He
+ vaccine component
Orthopoxvirus vaccine vector
NCBI Taxonomy ID: 10242
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ a bacterial vaccine that uses inactivated bacterial organism.
+ YH
+
+ vaccine
+ inactivated bacterial vaccine
+
+
+
+
+
-
-
- A microbial derivative vaccine adjuvant compsed of CpG DNA.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A viral vaccine that protects aganist Newcastle disease virus infection.
YH
- PMID: 12899580
- CpG DNA vaccine adjuvant
+ vaccine
+ Newcastle disease virus vaccine
-
+
-
-
- a tensoactive compound vaccine adjuvant that is derived from saponin, a compound that is an immunostimulator found in the plant P. senega.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ ZX
+ YH
- saponin vaccine adjuvant
+ material entity
+ protective antigen
@@ -804663,7 +807588,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
+
@@ -804676,135 +807601,1104 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- a role of host that contains vaccine. It is a role that inheres in an organism that is the target of a vaccine administration (vaccination process).
- YH, ZX
+ A role that inheres in an organism that is the target of a vaccination.
+ Jie Zheng
+ ZX
+ YH
+ https://github.com/vaccineontology/VO/issues/677
+ role
vaccine host role
-
+
-
-
- An emulsion vaccine adjuvant consisting of an oil (squalene)-in-water nano emulsion.
- PMID: 20488726
- SGS
- MF59
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A vaccine licensed in the USA
+ Oliver He, Kallan Roan
+ https://www.fda.gov/BiologicsBloodVaccines/Vaccines/ApprovedProducts/ucm093833.htm
- MF59 vaccine adjuvant
+ vaccine
+ USA licensed vaccine
-
+
-
-
- AS03 is an emusion vaccine adjuvant that contains α-tocopherol and squalene, two biodegradable polyprenyls, in an oil-in-water emulsion.
- SGS
- AS03
- PMID: 21256188
+
+
+
+
+
+
+
+
+ viral vaccine that is used to protect against Porcine rotavirus infection
+ YL
- AS03 vaccine adjuvant
+ vaccine
+ Porcine rotavirus vaccine
-
+
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ viral vaccine that is used to protect against Infectious Bursal Disease Virus (IBDV) infection
+ YL, YH, RS, NF
+ IBDV vaccine
- emulsion vaccine adjuvant
+ vaccine
+ infectious bursal disease virus vaccine
-
+
-
-
- a vaccine adjuvant that includes tensioactive material. Tensioactive materials, surfactants or active surface agents are chemical substances with a polar-non polar structure. These substances have a tendency to locate themselves at the surface creating an adsorbed monomolecular layer on the interface.
- YH, SGS
- tensioactive compound vaccine adjuvant
- WEB: http://www.citt.ufl.edu/team/sepulveda/html/en_tensioactivos.htm
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ viral vaccine that is used to protect against Infectious Bronchitis Virus (IBV) infection
+ YL
- tensoactive compound vaccine adjuvant
+ vaccine
+ Infectious Bronchitis Virus vaccine
-
+
-
-
- YH, SGS
- a vaccine adjuvant that is primarily composed of carbohydrates.
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ viral vaccine that is used to protect against Bovine coronavirus infection
+ YL
- carbohydrate vaccine adjuvant
+ vaccine
+ bovine coronavirus vaccine
-
+
-
-
- The objective that intends to produce vaccine via the vaccine preparation process.
+
+
+
+
+
+
+
+
+ viral vaccine that is used to protect against Feline infectious peritonitis virus infection
+ YL, YH
- YH
- vaccine target specification
+ vaccine
+ Feline infectious peritonitis virus vaccine
-
+
-
-
+
+
+
-
+
-
-
- viral vaccine that is used to protect against Bovine coronavirus infection
- generated using OntoRat
+
+ viral vaccine that is used to protect against Transmissible gastroenteritis virus infection
YL
- bovine coronavirus vaccine
+ vaccine
+ Transmissible gastroenteritis virus vaccine
-
+
-
-
-
+
+
-
-
-
-
-
-
-
-
-
-
-
-
-
+
+
-
-
+
+
-
+
+
+
+
+
+
+
+
+
+ viral vaccine that is used to protect against Canine parainfluenza virus infection
+ YL
+
+ vaccine
+ canine parainfluenza virus vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Feline Infectious Peritonitis Modified Live Virus Vaccine (USDA: 15A1.20)
+ USDA: 15A1.20
+ violinID:1771
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass Type, Live Virus Vaccine (USDA: 1231.11)
+ USDA: 1231.11
+ violinID:1361
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bronchitis Ark Type, Live Virus Vaccine (USDA: 1231.1M)
+ USDA: 1231.1M
+ violinID:1373
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Ark Type, Live Virus Vaccine (USDA: 1231.20)
+ USDA: 1231.20
+ violinID:1375
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Ark Type, Live Virus Vaccine (USDA: 1231.21)
+ USDA: 1231.21
+ violinID:1376
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bronchitis Ark Type, Live Virus Vaccine (USDA: 1231.22)
+ USDA: 1231.22
+ violinID:1377
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Conn Type, Live Virus Vaccine (USDA: 1231.15)
+ USDA: 1231.15
+ violinID:1365
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bronchitis Delaware Type, Modified Live Virus Vaccine (USDA: 1231.1D)
+ USDA: 1231.1D
+ violinID:1368
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Georgia Type, Live Virus Vaccine (USDA: 1231.1J)
+ USDA: 1231.1J
+ violinID:1371
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bronchitis Georgia Type, Live Virus Vaccine (USDA: 1231.1L)
+ USDA: 1231.1L
+ violinID:1372
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass & Ark Types, Killed Virus Vaccine (USDA: 1235.15)
+ USDA: 1235.15
+ violinID:1382
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass & Ark Types, Live Virus Vaccine (USDA: 1231.13)
+ USDA: 1231.13
+ violinID:1363
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass & Conn Types, Live Virus Vaccine (USDA: 1231.14)
+ USDA: 1231.14
+ violinID:1364
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bronchitis Mass & Conn Types, Live Virus Vaccine (USDA: 1231.1G)
+ USDA: 1231.1G
+ violinID:1370
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bronchitis Mass & Conn Types, Live Virus Vaccine (USDA:1231.1N)
+ USDA:1231.1N
+ violinID:1374
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass Type, Live Virus Vaccine (USDA: 1231.12)
+ USDA: 1231.12
+ violinID:1362
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass Type, Live Virus Vaccine (USDA: 1231.18)
+ USDA: 1231.18
+ violinID:1366
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bronchitis Mass Type, Live Virus Vaccine (USDA: 1231.1A)
+ USDA: 1231.1A
+ violinID:1367
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bronchitis Mass Type, Live Virus Vaccine (USDA: 1231.1F)
+ USDA: 1231.1F
+ violinID:1369
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass Type, Live Virus Vaccine (USDA: 1232.10)
+ USDA: 1232.10
+ violinID:1378
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass Type, Live Virus Vaccine (USDA: 1232.15)
+ USDA: 1232.15
+ violinID:1379
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass Type, Live Virus Vaccine (USDA: 1233.10)
+ USDA: 1233.10
+ violinID:1380
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bronchitis Mass Type, Live Virus Vaccine (USDA: 1235.10)
+ USDA: 1235.10
+ violinID:1381
+
+
+
+
+
+
+
+
+
+
@@ -804829,9 +808723,9 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- generated using OntoRat
YL
+ vaccine
Canine Coronavirus Killed Virus Vaccine (USDA: 14P5.20)
USDA: 14P5.20
violinID:1562
@@ -804842,7 +808736,9 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+
+
@@ -804876,6 +808772,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
generated using OntoRat
YL
+ vaccine
Canine Coronavirus Killed Virus Vaccine (USDA: 14P5.21)
USDA: 14P5.21
violinID:1563
@@ -804886,7 +808783,9 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+
+
@@ -804917,9 +808816,9 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- generated using OntoRat
YL
+ vaccine
Canine Coronavirus Modified Live Virus Vaccine (USDA: 14P1.20)
USDA: 14P1.20
violinID:1561
@@ -804927,33 +808826,5720 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
+
-
-
- Rebecca Racz, Yongqun He
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
- An E mutant is attenuated in hamsters and induces significant protection from challenge with wild type SARS
- SARS-CoV E gene mutant vaccine
+ vaccine
+ Transmissible Gastroenteritis Modified Live Virus Vaccine (USDA: 1961.20)
+ USDA: 1961.20
+ violinID:2142
-
+
-
-
- A CpG DNA vaccine adjuvant that is a short, synthetic, unmethylated CpG oligodeoxynucleotide (CpG ODN) with immunostimulatory activity.
- Oliver He, Kallan Roan
- ISS 1018 CpG ODN
- ISS 1018 CpG oligodeoxynucleotide
- ISS-1018
- https://www.cancer.gov/publications/dictionaries/cancer-drug/def/iss-1018-cpg-oligodeoxynucleotide
- https://www.drugbank.ca/drugs/DB05463
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Modified Killed Virus Vaccine (USDA: 1935.20)
+ USDA: 1935.20
+ violinID:1350
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Modified Live Virus Vaccine (USDA: 1931.20)
+ USDA: 1931.20
+ violinID:1349
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Killed Virus Vaccine-Clostridium Perfringens Type C-Escherichia Coli Bacterin-Toxoid (USDA: 4570.20)
+ USDA: 4570.20
+ violinID:2520;2521;2522;2523
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Killed Virus Vaccine-Clostridium Perfringens Type C-Escherichia Coli Bacterin-Toxoid (USDA: 4570.22)
+ USDA: 4570.22
+ violinID:2524;2525;2526;2527
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Killed Virus Vaccine-Clostridium Perfringens Types C & D-Escherichia Coli Bacterin-Toxoid (USDA: 4575.20)
+ USDA: 4575.20
+ violinID:2528;2529;2530;2531
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Killed Virus Vaccine-Escherichia Coli Bacterin (USDA: 4585.20)
+ USDA: 4585.20
+ violinID:2532;2533;2534
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Killed Virus Vaccine-Escherichia Coli Bacterin (USDA: 4585.22)
+ USDA: 4585.22
+ violinID:2535;2536;2537
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis Standard & Variant, Mass & Ark Types, Killed Virus Vaccine (USDA: 12D5.45)
+ USDA: 12D5.45
+ violinID:1467;1465;1466
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis B1 Type, B1 Strain, Mass & Ark Types, Live Virus Vaccine (USDA: 12H1.4M)
+ USDA: 12H1.4M
+ violinID:1469;1468;1470
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis B1 Type, B1 Strain, Mass & Ark Types, Live Virus Vaccine (USDA: 12H1.67)
+ USDA: 12H1.67
+ violinID:1471;1473;1472
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis Mass Type, Killed Virus Vaccine (USDA: 12J5.40)
+ USDA: 12J5.40
+ violinID:1475;1474;1476
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis Mass Type, Killed Virus Vaccine (USDA: 12J5.43)
+ USDA: 12J5.43
+ violinID:1477;1479;1478
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis Standard & Variant, Mass Type, Killed Virus Vaccine (USDA: 12J5.61)
+ USDA: 12J5.61
+ violinID:1481;1480;1482
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis Mass Type, Killed Virus Vaccine (USDA: 12J5.62)
+ USDA: 12J5.62
+ violinID:1483;1485;1484
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Standard & Variant, Mass Type, Killed Virus Vaccine (USDA: 12M5.00)
+ USDA: 12M5.00
+ violinID:1487;1489;1486;1488
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Standard & Variant, Mass Type, Killed Virus Vaccine (USDA: 12M5.01)
+ USDA: 12M5.01
+ violinID:1491;1493;1490;1492
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Mass Type, Killed Virus Vaccine (USDA: 12M5.11)
+ USDA: 12M5.11
+ violinID:1495;1497;1494;1496
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Killed Virus Vaccine (USDA: 12M5.40)
+ USDA: 12M5.40
+ violinID:1499;1501;1500;1498
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Standard & Variant, Mass & Ark Types, Killed Virus Vaccine (USDA: 12M5.41)
+ USDA: 12M5.41
+ violinID:1503;1505;1502;1504
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Standard & Variant, Mass & Ark Types, Killed Virus Vaccine (USDA: 12M5.42)
+ USDA: 12M5.42
+ violinID:1507;1509;1506;1508
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Mass Type, Killed Virus Vaccine (USDA: 12M5.43)
+ USDA: 12M5.43
+ violinID:1511;1513;1510;1512
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Mass Type, Killed Virus Vaccine (USDA: 12M5.50)
+ USDA: 12M5.50
+ violinID:1517;1515;1516;1514
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Mass Type, Killed Virus Vaccine (USDA: 12M5.90)
+ USDA: 12M5.90
+ violinID:1519;1521;1518;1520
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Mass Type, Killed Virus Vaccine (USDA: 12M5.91)
+ USDA: 12M5.91
+ violinID:1523;1525;1522;1524
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Standard & Variant, Mass Type, Killed Virus Vaccine (USDA: 12M5.E0)
+ USDA: 12M5.E0
+ violinID:1527;1529;1526;1528
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Coronavirus-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 14D7.20)
+ USDA: 14D7.20
+ violinID:1677;1676;1678
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Coronavirus-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 14D9.27)
+ USDA: 14D9.27
+ violinID:1681;1679;1680
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus-Parvovirus Modified Live Virus Vaccine (USDA: 14R1.20)
+ USDA: 14R1.20
+ violinID:1565;1564
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Coronavirus-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 14R7.20)
+ USDA: 14R7.20
+ violinID:1567;1566
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Coronavirus-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 14R7.21)
+ USDA: 14R7.21
+ violinID:1569;1568
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Coronavirus-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 14R7.22)
+ USDA: 14R7.22
+ violinID:1571;1570
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Coronavirus-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 14R7.25)
+ USDA: 14R7.25
+ violinID:1573;1572
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Coronavirus-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 14R7.29)
+ USDA: 14R7.29
+ violinID:1575;1574
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live Virus; Canarypox Vector Vaccine (USDA: 1591.R1)
+ USDA: 1591.R1
+ violinID:1583;1581;1582;1584;1580
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 1599.20)
+ USDA: 1599.20
+ violinID:1585;1587;1589;1586;1588
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 1599.21)
+ USDA: 1599.21
+ violinID:1591;1593;1590;1592;1594
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 1599.25)
+ USDA: 1599.25
+ violinID:1599;1595;1597;1598;1596
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine (USDA: 1599.29)
+ USDA: 1599.29
+ violinID:1601;1603;1600;1602;1604
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass Type, Live Virus Vaccine (USDA: 1761.11)
+ USDA: 1761.11
+ violinID:1996;1997
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass Type, Live Virus Vaccine (USDA: 1761.12)
+ USDA: 1761.12
+ violinID:1998;1999
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Conn Type, Live Virus Vaccine (USDA: 1761.13)
+ USDA: 1761.13
+ violinID:2000;2001
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 1761.14)
+ USDA: 1761.14
+ violinID:2002;2003
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 1761.15)
+ USDA: 1761.15
+ violinID:2004;2005
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 1761.17)
+ USDA: 1761.17
+ violinID:2006;2007
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass Type, Live Virus Vaccine (USDA: 1761.18)
+ USDA: 1761.18
+ violinID:2008;2009
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass Type, Live Virus Vaccine (USDA: 1761.19)
+ USDA: 1761.19
+ violinID:2010;2011
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Conn Type, Live Virus Vaccine (USDA: 1761.1A)
+ USDA: 1761.1A
+ violinID:2012;2013
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass Type, Live Virus Vaccine (USDA: 1762.11)
+ USDA: 1762.11
+ violinID:2014;2015
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Conn Type, Live Virus Vaccine (USDA: 1762.13)
+ USDA: 1762.13
+ violinID:2016;2017
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 1762.1H)
+ USDA: 1762.1H
+ violinID:2018;2019
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, LaSota Strain, Mass Type, Live Virus Vaccine (USDA: 1771.11)
+ USDA: 1771.11
+ violinID:2020;2021
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, LaSota Strain, Mass Type, Live Virus Vaccine (USDA: 1771.12)
+ USDA: 1771.12
+ violinID:2022;2023
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, LaSota Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 1771.14)
+ USDA: 1771.14
+ violinID:2024;2025
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, LaSota Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 1771.17)
+ USDA: 1771.17
+ violinID:2026;2027
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, LaSota Strain, Mass Type, Live Virus Vaccine (USDA: 1771.18)
+ USDA: 1771.18
+ violinID:2028;2029
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, LaSota Strain, Mass Type, Live Virus Vaccine (USDA: 1771.19)
+ USDA: 1771.19
+ violinID:2030;2031
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, LaSota Strain, Mass Type, Live Virus Vaccine (USDA: 1771.1A)
+ USDA: 1771.1A
+ violinID:2032;2033
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Mass Type, Killed Virus Vaccine (USDA: 1775.10)
+ USDA: 1775.10
+ violinID:2034;2035
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Mass Type, Killed Virus Vaccine (USDA: 1775.11)
+ USDA: 1775.11
+ violinID:2036;2037
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Mass Type, Killed Virus Vaccine (USDA: 1776.10)
+ USDA: 1776.10
+ violinID:2038;2039
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Mass & Ark Types, Killed Virus Vaccine (USDA: 1785.10)
+ USDA: 1785.10
+ violinID:2040;2041
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Mass Type, Killed Virus Vaccine (USDA: 1785.11)
+ USDA: 1785.11
+ violinID:2042;2043
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Mass & Ark Types, Killed Virus Vaccine (USDA: 1785.12)
+ USDA: 1785.12
+ violinID:2044;2045
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 1791.14)
+ USDA: 1791.14
+ violinID:2046;2047
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 1791.15)
+ USDA: 1791.15
+ violinID:2048;2049
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass Type, Live Virus Vaccine (USDA: 1791.19)
+ USDA: 1791.19
+ violinID:2050;2051
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Ark Types, Live Virus Vaccine (USDA: 1791.1X)
+ USDA: 1791.1X
+ violinID:2054;2055;2052;2053
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Ark Types, Live Virus Vaccine (USDA: 17A1.1M)
+ USDA: 17A1.1M
+ violinID:2056;2057
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Ark Types, Live Virus Vaccine (USDA: 17A1.1N)
+ USDA: 17A1.1N
+ violinID:2058;2059
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, B1 Strain, Mass & Ark Types, Live Virus Vaccine (USDA: 17A2.1M)
+ USDA: 17A2.1M
+ violinID:2060;2061
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, LaSota Strain, Mass & Conn Types Vaccine (USDA: 17B1.17)
+ USDA: 17B1.17
+ violinID:2062;2063
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis VG/GA Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 17V1.10)
+ USDA: 17V1.10
+ violinID:2064;2065
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis VG/GA Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 17V1.11)
+ USDA: 17V1.11
+ violinID:2066;2067
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Porcine Rotavirus-Transmissible Gastroenteritis Modified Live Virus Vaccine (USDA: 19H1.20)
+ USDA: 19H1.20
+ violinID:2106;2105
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, C2 Strain, Mass Type, Live Virus Vaccine (USDA: 1XB1.10)
+ USDA: 1XB1.10
+ violinID:2068;2069
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Newcastle-Bronchitis B1 Type, C2 Strain, Mass & Conn Types, Live Virus Vaccine (USDA: 1XC1.10)
+ USDA: 1XC1.10
+ violinID:2070;2071
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2 Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 4629.20)
+ USDA: 4629.20
+ violinID:2574;2576;2575
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2 Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract (USDA: 4629.27)
+ USDA: 4629.27
+ violinID:2572;2573;2571
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 4637.20)
+ USDA: 4637.20
+ violinID:2698;2697;2696;2700;2699
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 4637.22)
+ USDA: 4637.22
+ violinID:2704;2702;2705;2701;2703
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 4637.23)
+ USDA: 4637.23
+ violinID:2706;2708;2710;2707;2709
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract (USDA: 4637.29)
+ USDA: 4637.29
+ violinID:2672;2674;2671;2673;2675
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 4639.21)
+ USDA: 4639.21
+ violinID:2712;2714;2711;2713;2715
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 4639.22)
+ USDA: 4639.22
+ violinID:2716;2718;2720;2717;2719
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract (USDA: 4639.25)
+ USDA: 4639.25
+ violinID:2676;2678;2680;2677;2679
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract (USDA: 4639.27)
+ USDA: 4639.27
+ violinID:2688;2690;2686;2689;2687
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract (USDA: 4639.28)
+ USDA: 4639.28
+ violinID:2692;2694;2691;2693;2695
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus, Live Canarypox Vector Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 4639.R1)
+ USDA: 4639.R1
+ violinID:2722;2724;2721;2723;2725
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 4659.20)
+ USDA: 4659.20
+ violinID:2668;2670;2667;2669
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Borrelia Burgdorferi Bacterin-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract (USDA: 46B9.21)
+ USDA: 46B9.21
+ violinID:2590;2592;2594;2589;2591;2593;2595
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Killed Virus Vaccine-Leptospira Icterohaemorrhagiae Bacterial Extract (USDA: 46D5.27)
+ USDA: 46D5.27
+ violinID:1154;1159
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Killed Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 46E5.20)
+ USDA: 46E5.20
+ violinID:1153;1158
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Killed Virus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract (USDA: 46E5.21)
+ USDA: 46E5.21
+ violinID:1145;1144
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Killed Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract (USDA: 46E5.23)
+ USDA: 46E5.23
+ violinID:1150;1151
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Killed Virus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract (USDA: 46E5.24)
+ USDA: 46E5.24
+ violinID:1147;1149
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Killed Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract (USDA: 46E5.25)
+ USDA: 46E5.25
+ violinID:1152;1146
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 46J7.20)
+ USDA: 46J7.20
+ violinID:2632;2634;2636;2633;2635;2637
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 46J7.22)
+ USDA: 46J7.22
+ violinID:2640;2642;2638;2639;2641;2643
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 46J8.20)
+ USDA: 46J8.20
+ violinID:2726;2728;2730;2727;2729
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 46J9.20)
+ USDA: 46J9.20
+ violinID:2644;2646;2648;2645;2647;2649
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract (USDA: 46J9.21)
+ USDA: 46J9.21
+ violinID:2614;2616;2618;2615;2617;2619
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract (USDA: 46J9.25)
+ USDA: 46J9.25
+ violinID:2596;2598;2600;2597;2599;2601
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract (USDA: 46J9.26)
+ USDA: 46J9.26
+ violinID:2622;2624;2620;2623;2625;2621
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract (USDA: 46J9.27)
+ USDA: 46J9.27
+ violinID:2626;2628;2630;2627;2629;2631
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract (USDA: 46J9.29)
+ USDA: 46J9.29
+ violinID:2606;2602;2604;2607;2603;2605
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live Virus, Live Canarypox Vector Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin (USDA: 46J9.R1)
+ USDA: 46J9.R1
+ violinID:2650;2652;2654;2655;2651;2653
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Icterohaemorrhagiae Bacterial Extract (USDA: 46L9.27)
+ USDA: 46L9.27
+ violinID:2656;2658;2660;2657;2659;2661
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Icterohaemorrhagiae Bacterial Extract (USDA: 46P9.27)
+ USDA: 46P9.27
+ violinID:2662;2664;2666;2663;2665
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Coronavirus Killed Virus Vaccine-Borrelia Burgdorferi Bacterin (USDA: 47A5.20)
+ USDA: 47A5.20
+ violinID:1137;1136
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Borrelia Burgdorferi Bacterin (USDA: 47C5.20)
+ USDA: 47C5.20
+ violinID:2578;2580;2582;2577;2579;2581
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Borrelia Burgdorferi Bacterin (USDA: 47C5.29)
+ USDA: 47C5.29
+ violinID:2584;2586;2588;2583;2585;2587
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Killed Virus Vaccine-Borrelia Burgdorferi Bacterin-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract (USDA: 47E5.20)
+ USDA: 47E5.20
+ violinID:1140;1142;1143
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Killed Virus Vaccine-Borrelia Burgdorferi Bacterin-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract (USDA: 47E5.21)
+ USDA: 47E5.21
+ violinID:1139;1138;1141
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Modified Live Virus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterin (USDA: 47K1.20)
+ USDA: 47K1.20
+ violinID:2682;2684;2681;2683;2685
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterin (USDA: 47L9.20)
+ USDA: 47L9.20
+ violinID:2608;2610;2612;2609;2611;2613
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Mass Type, Killed Virus Vaccine-Mycoplasma Gallisepticum Bacterin (USDA: 48B5.10)
+ USDA: 48B5.10
+ violinID:2912;2911;2913
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Mass Type, Killed Virus Vaccine-Mycoplasma Gallisepticum Bacterin (USDA: 48B6.10)
+ USDA: 48B6.10
+ violinID:2914;2916;2915
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Mass Type, Killed Virus Vaccine-Salmonella Enteritidis Bacterin (USDA: 48D6.10)
+ USDA: 48D6.10
+ violinID:2918;2919;2917
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle Disease-Bronchitis Mass & Ark Types, Killed Virus Vaccine-Salmonella Enteritidis Bacterin (USDA: 48D7.10)
+ USDA: 48D7.10
+ violinID:2906;2905;2907
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle Disease-Bronchitis Mass & Ark Types, Killed Virus Vaccine-Salmonella Enteritidis Bacterin (USDA: 48D7.11)
+ USDA: 48D7.11
+ violinID:2908;2910;2909
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Porcine Rotavirus-Transmissible Gastroenteritis Modified Live Virus Vaccine-Clostridium Perfringens Type C-Escherichia Coli Bacterin-Toxoid (USDA: 49B1.21)
+ USDA: 49B1.21
+ violinID:3004;3006;3003;3005
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Porcine Rotavirus-Transmissible Gastroenteritis Modified Live Virus Vaccine-Escherichia Coli Bacterin (USDA: 49P1.20)
+ USDA: 49P1.20
+ violinID:3008;3007;3009
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ generated using OntoRat
+ YL
+
+ vaccine
+ Porcine Rotavirus-Transmissible Gastroenteritis Modified Live Virus Vaccine-Bordetella Bronchiseptica-Clostridium Perfringens Type C-Erysipelothrix Rhusiopathiae-Escherichia Coli-Pasteurella Multocida Bacterin-Toxoid (USDA: 49T9.21)
+ USDA: 49T9.21
+ violinID:3002;2996;2998;3000;2997;2999;3001
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ chicken bursal disease-Newcastle disease vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Vaccine-Clostridium Perfringens Type C-Escherichia Coli Bacterin-Toxoid
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Vaccine-Clostridium Perfringens Types C & D-Escherichia Coli Bacterin-Toxoid
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bovine Rotavirus-Coronavirus Vaccine-Escherichia Coli Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Bursal Disease-Newcastle Disease-Bronchitis-Reovirus Vaccine
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Vaccine-Borrelia Burgdorferi Bacterin-Leptospira Canicola-GrippotyphosaIcterohaemorrhagiae-Pomona Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Vaccine-Borrelia Burgdorferi Bacterin-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Vaccine-Leptospira Icterohaemorrhagiae Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus Vaccine-Borrelia Burgdorferi Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Coronavirus-Parvovirus Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2 Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Vaccine
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2 Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2 Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Vaccine-Borrelia Burgdorferi Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Vaccine-Borrelia Burgdorferi Bacterin-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Vaccine-Leptospira Canicola-Grippotyphosa-Icterohaemorrhagiae-Pomona Bacterin
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Vaccine-Leptospira Icterohaemorrhagiae Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parvovirus Vaccine-Leptospira Icterohaemorrhagiae Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Vaccine-Leptospira CanicolaGrippotyphosa-Icterohaemorrhagiae-Pomona Bacterial Extract
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Vaccine-Leptospira CanicolaGrippotyphosa-Icterohaemorrhagiae-Pomona Bacterin
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza-Parvovirus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Parvovirus Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Parainfluenza Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle Disease-Bronchitis Vaccine-Salmonella Enteritidis Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Vaccine-Mycoplasma Gallisepticum Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Newcastle-Bronchitis Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Porcine Rotavirus-Transmissible Gastroenteritis Vaccine-Bordetella Bronchiseptica-Clostridium Perfringens Type C-Erysipelothrix Rhusiopathiae-Escherichia Coli-Pasteurella Multocida Bacterin-Toxoid
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Porcine Rotavirus-Transmissible Gastroenteritis Vaccine-Clostridium Perfringens Type C-Escherichia Coli Bacterin-Toxoid
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Porcine Rotavirus-Transmissible Gastroenteritis Vaccine-Escherichia Coli Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Porcine Rotavirus Vaccine-Clostridium Perfringens Type C-Escherichia Coli Bacterin-Toxoid
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Porcine Rotavirus Vaccine-Escherichia Coli Bacterin
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Porcine Rotavirus-Transmissible Gastroenteritis Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Coronavirus-Parvovirus Vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Vaccine-Leptospira Canicola-Icterohaemorrhagiae Bacterial Extract
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ YL
+
+ vaccine
+ Canine Distemper-Adenovirus Type 2-Coronavirus-Parainfluenza-Parvovirus Modified Live & Killed Virus Vaccine-Leptospira Icterohaemorrhagiae Bacterial Extract (USDA: 46L9.20)
+ USDA: 46L9.20
+
+
+
+
+
+
+
+
+ Rebecca Racz, Yongqun He
+
+ VO:0002962
+ VO:0002963
+ vaccine
+ A 3abc deletion mutant in Feline infectious peritonitis virus (FIPV) was attenuated and provided protection against virulent FIPV strain 79-1146 challenge in kittens
+ Feline infectiour peritonitis virus 3abc mutant vaccine
+
+
+
+
+
+
+
+
+ Rebecca Racz, Yongqun He
+
+ VO:0002965
+ vaccine
+ A 7ab deletion mutant in Feline infectious peritonitis virus is attenuated and provides protection against virulent FIPV strain 79-1146 challenge in kittens
+ Feline infectious peritonitis virus 7ab mutant vaccine
+
+
+
+
+
+
+
+
+ Rebecca Racz, Yongqun He
+
+ vaccine
+ An E mutant is attenuated in hamsters and induces significant protection from challenge with wild type SARS
+ SARS-CoV E gene mutant vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A vaccine that is used against an infection by a pathogen under Spirochaetes.
+ vaccine against Spirochaetes
+ https://en.wikipedia.org/wiki/Spirochaete
+
+ vaccine
+ Spirochaetes vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A vaccine that is used against an infection by a pathogen under Borreliella.
+ vaccine against Borreliella
+ https://en.wikipedia.org/wiki/Borrelia
+
+ vaccine
+ Borreliella vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ Kallan Roan, Oliver He
+
+ vaccine
+ Proteobacteria vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ vaccine
+ Gammaproteobacteria vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A vaccine that is used against an infection by a pathogen under Reoviridae.
+ vaccine against Reoviridae
+ https://en.wikipedia.org/wiki/Reoviridae
+
+ vaccine
+ Reoviridae vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A vaccine that is used against an infection by a pathogen under Sedoreovirinae.
+ vaccine against Sedoreovirinae
+ https://en.wikipedia.org/wiki/Sedoreovirinae
+
+ vaccine
+ Sedoreovirinae vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A vaccine that is used against an infection by a pathogen under Morbillivirus.
+ vaccine against Morbillivirus
+ https://en.wikipedia.org/wiki/Morbillivirus
+
+ vaccine
+ Morbillivirus vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ vaccine
+ Enterobacterales vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ vaccine
+ Enterobacteriaceae vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ vaccine
+ Spirochaetia vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ vaccine
+ Firmicutes vaccine
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ RS, NF, YH
+
+ vaccine
+ IBV DNA vaccine pVAX1-16S1/M/N
+ violinID: 3889
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ RS, NF, YH
+
+ vaccine
+ IBV DNA vaccine pVAX1-N
+ violinID: 3938
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ RS, NF, YH
+
+ vaccine
+ IBV DNA vaccine pVAX-S1 with GM-CSF adjuvant
+ violinID: 3939
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ RS, NF, YH
- ISS 1018 is a short, synthetic, unmethylated CpG oligodeoxynucleotide (CpG ODN) with immunostimulatory activity. ISS 1018 signals through Toll-like receptor 9 (TLR9) to induce the production of immunoglobulin by B cells and interferon (IFN) -alpha, IFN-beta, interleukin-12 (IL-12), and tumor necrosis factor - alpha (TNF-alpha) by plasmacytoid dendritic cells (pDC). ISS 1018 CpG ODN promotes antigen presentation and co-stimulatory molecule expression. ISS 1018 is currently being investigated in combination with HBsAg vaccine as a prophylactic treatment for to prevent Hepatitis B in adults. It is also being investigated in combination with rituximab for treatment of b-cell or non-hodgkin's lymphoma.
- ISS 1018 CpG ODN vaccine adjuvant
- DrugBank Accession number: DB05463
+ vaccine
+ Infectious Bronchitis Virus DNA Vaccine encoding S1, N, and M
+ violinID: 3941
@@ -804972,6 +814558,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=4160
https://pubmed.ncbi.nlm.nih.gov/18708674/
+ vaccine
RBD-rAAV-SARS-CoV
violinID: 4160
@@ -804992,6 +814579,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=4161
https://pubmed.ncbi.nlm.nih.gov/18289745/
+ vaccine
RBD-rAAV-SARS-CoV prime/RBD-specific T cell peptide boost
violinID: 4161
@@ -805010,12 +814598,32 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
RS, NF, YH
+ vaccine
rMV- SARS-CoV -S/Ssol
violinID: 4196
+
+
+
+
+
+
+
+
+
+
+ RS, NF, YH
+
+ vaccine
+ Ac-CMV-S1 (infectious bronchitis virus)
+ violinID: 4242
+
+
+
+
@@ -805035,7 +814643,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A vaccine against coronavirus infection
Hong Yu, Oliver He
- coronavirus vaccine
+ vaccine
+ coronavirus vaccine
@@ -805058,7 +814667,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
MERS-CoV vaccine
- MERS vaccine
+ vaccine
+ MERS vaccine
@@ -805073,22 +814683,10 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
-
-
-
-
-
-
-
https://www.ncbi.nlm.nih.gov/pmc/articles/PMC5884803/
- MERS-CoV S protein with alum and CpG adjuvant
+ vaccine
+ MERS-CoV S protein with alum and CpG adjuvant
@@ -805109,7 +814707,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- MERS-CoV protein
+ protein
+ MERS-CoV protein
@@ -805119,7 +814718,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- MERS-CoV S protein
+ protein
+ MERS-CoV S protein
@@ -805127,7 +814727,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
+
@@ -805146,7 +814746,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
https://en.wikipedia.org/wiki/COVID-19_vaccine
https://www.fda.gov/emergency-preparedness-and-response/coronavirus-disease-2019-covid-19/covid-19-vaccines
- COVID-19 vaccine
+ vaccine
+ COVID-19 vaccine
@@ -805187,7 +814788,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A SARS-CoV-2 RNA vaccine formed from a lipid nanoparticle-formulated trimerized SARS-CoV-2 receptor-binding domain
Philip Huang, Rohit Goru, Oliver He
- BNT162b2
+ BNT162b2
PF-07302048
Tozinameran
PubMed: 32839784
@@ -805197,6 +814798,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
https://www.fda.gov/emergency-preparedness-and-response/coronavirus-disease-2019-covid-19/pfizer-biontech-covid-19-vaccine
https://www.fda.gov/media/144246/download
+ vaccine
Comirnaty
@@ -805219,37 +814821,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Oliver He, Philip Huang
- SARS-CoV-2 protein
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- Replaced term with S protein of SARS-CoV-2 Wuhan strain (PR_P0DTC2) for ontology harmonization
- Anthony Huffman
-
- S protein of SARS-CoV-2
- true
+ protein
+ SARS-CoV-2 protein
@@ -805259,7 +814832,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- E protein of SARS-CoV-2
+ protein
+ E protein of SARS-CoV-2
@@ -805299,7 +814873,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
https://en.wikipedia.org/wiki/BBV152
https://go.drugbank.com/drugs/DB15847
- COVAXIN
+ vaccine
+ COVAXIN
@@ -805308,12 +814883,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
@@ -805330,7 +814899,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04636697
- CoVLP
+ vaccine
+ CoVLP
@@ -805379,7 +814949,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04405908
- SCB-2019
+ vaccine
+ SCB-2019
@@ -805416,7 +814987,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04545749
- UB-612
+ vaccine
+ UB-612
@@ -805447,7 +815019,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04666012
- AdCLD-CoV19
+ vaccine
+ AdCLD-CoV19
@@ -805484,7 +815057,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
https://www.akstonbio.com/programs/covid-19-vaccine/
- AKS-452
+ vaccine
+ AKS-452
@@ -805515,7 +815089,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04386252
- AV-COVID-19
+ vaccine
+ AV-COVID-19
@@ -805546,7 +815121,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
https://www.biologicale.com/news.html
- Corbevax
+ vaccine
+ Corbevax
@@ -805554,7 +815130,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
@@ -805568,12 +815143,13 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A SARS-CoV-2 protein subunit vaccine based on recombinant RBD subunits manufactured by the Center for Genetic Engineering and Biotechnology (CIGB).
+ An authorized SARS-CoV-2 protein subunit vaccine based on recombinant RBD subunits manufactured by the Center for Genetic Engineering and Biotechnology (CIGB).
Philip Huang
CIGB-66
https://rpcec.sld.cu/en/trials/RPCEC00000345-En
- Abdala
+ vaccine
+ Abdala
@@ -805598,7 +815174,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
https://rpcec.sld.cu/en/trials/RPCEC00000345-En
- CIGB-669
+ vaccine
+ CIGB-669
@@ -805631,277 +815208,196 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A SARS-CoV-2 inactivated virus vaccine by Shenzhen Kangtai Biological Products and Beijing Minhai Biotechnology Co.
- Philip Huang, Oliver He
- NCT04852705
- http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
-
- KCONVAC
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- A stabilised pre-fusion SARS-CoV-2 spike protein vaccine produced in a baculovirus expression system and manufactured by Sanofi Pasteur and GlaxoSmithKline
- Philip Huang
- CoV2 preS dTM
- PubMed ID: 33887209
-
- VAT00002
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- An influenza virus vector SARS-CoV-2 vaccine administered as an intranasal spray manufactured by University of Hong Kong, Xiamen University, and Beijing Wantai Biological Pharmacy.
- Philip Huang
- http://www.chictr.org.cn/showprojen.aspx?proj=55421
-
- DelNS1-2019-nCoV-RBD-OPT1
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- A SARS-CoV-2 protein subunit vaccine that relies on chemically synthesized peptide antigens of SARS-CoV-2 proteins, conjugated to a carrier protein and adsorbed on an aluminum-containing adjuvant (aluminum hydroxide).
- Philip Huang
- NCT04527575
- http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
-
- EpiVacCorona
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- A SARS-CoV-2 plasmid DNA vaccine developed by GeneOne Life Science.
- Philip Huang
- NCT04673149
-
- GLS-5310
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- A rVSV-SARS-CoV-2-S vaccine developed by the Israel Institute for Biological Research (IIBR)
- Philip Huang
- Brilife
- NCT04608305
-
- IIBR-100
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- A SARS-CoV-2 recombinant vector vaccine by Shenzhen Geno-Immune Medical Institute
- Philip Huang
- NCT04276896
-
- LV-SMENP-DC
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- A SARS-CoV-2 subunit vaccine with recombinant SARS-CoV-2 spike (S) protein and aluminum phosphate adjuvant
- Philip Huang
- NCT04683484
-
- Nanocovax
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- A SARS-CoV-2 inactivated vaccine manufactured by the Research Institute for Biological Safety Problems (Republic of Kazakhstan)
+ A SARS-CoV-2 inactivated virus vaccine by Shenzhen Kangtai Biological Products and Beijing Minhai Biotechnology Co.
+ Philip Huang, Oliver He
+ NCT04852705
+ http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
+
+ vaccine
+ KCONVAC
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A stabilised pre-fusion SARS-CoV-2 spike protein vaccine produced in a baculovirus expression system and manufactured by Sanofi Pasteur and GlaxoSmithKline
Philip Huang
- QazCovid-in
- NCT04691908
+ CoV2 preS dTM
+ PubMed ID: 33887209
+
+ vaccine
+ VAT00002
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ An influenza virus vector SARS-CoV-2 vaccine administered as an intranasal spray manufactured by University of Hong Kong, Xiamen University, and Beijing Wantai Biological Pharmacy.
+ Philip Huang
+ http://www.chictr.org.cn/showprojen.aspx?proj=55421
+
+ vaccine
+ DelNS1-2019-nCoV-RBD-OPT1
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A SARS-CoV-2 protein subunit vaccine that relies on chemically synthesized peptide antigens of SARS-CoV-2 proteins, conjugated to a carrier protein and adsorbed on an aluminum-containing adjuvant (aluminum hydroxide).
+ Philip Huang
+ NCT04527575
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
- QazVac
+ vaccine
+ EpiVacCorona
-
+
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A SARS-CoV-2 plasmid DNA vaccine developed by GeneOne Life Science.
+ Philip Huang
+ NCT04673149
+
+ vaccine
+ GLS-5310
+
+
+
+
+
+
+
+
-
+
-
-
+
+
+
+
+
+
+
+
+
+
+ A rVSV-SARS-CoV-2-S vaccine developed by the Israel Institute for Biological Research (IIBR)
+ Philip Huang
+ Brilife
+ NCT04608305
+
+ vaccine
+ IIBR-100
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A SARS-CoV-2 recombinant vector vaccine by Shenzhen Geno-Immune Medical Institute
+ Philip Huang
+ NCT04276896
+
+ vaccine
+ LV-SMENP-DC
+
+
+
+
+
+
+
+
+
+
+
+
@@ -805916,11 +815412,78 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+ A SARS-CoV-2 subunit vaccine with recombinant SARS-CoV-2 spike (S) protein and aluminum phosphate adjuvant
+ Philip Huang
+ NCT04683484
+
+ vaccine
+ Nanocovax
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ A SARS-CoV-2 inactivated vaccine manufactured by the Research Institute for Biological Safety Problems (Republic of Kazakhstan)
+ Philip Huang
+ QazCovid-in
+ NCT04691908
+ http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
+
+ vaccine
+ QazVac
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
A SARS-CoV-2 virus-like particle vaccine that contains the Receptor Binding Domain (RBD) of the SARS-CoV-2 spike (S) protein and is adjuvanted with aluminum.
Philip Huang
ACTRN12620001308987
- RBD-HBsAg VLP
+ vaccine
+ RBD-HBsAg VLP
@@ -805945,7 +815508,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04640402
- Recombinant SARS-CoV-2 vaccine (Sf9 cell)
+ vaccine
+ Recombinant SARS-CoV-2 vaccine (Sf9 cell)
@@ -805967,10 +815531,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
- A SARS-CoV-2 recombinant protein vaccine that uses the Baculovirus expression vector system
+ A SARS-CoV-2 recombinant protein vaccine that uses the Baculovirus expression vector system
https://www.shionogi.com/content/dam/shionogi/global/news/pdf/2020/12/e-201216.pdf
- S-268019
+ vaccine
+ S-268019
@@ -805978,7 +815543,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
@@ -805994,9 +815558,10 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A SARS-CoV-2 subunit vaccine developed by Finlay Vaccine Institute (IFV)
Philip Huang
- FINLAY-FR-2
+ FINLAY-FR-2
https://rpcec.sld.cu/en/trials/RPCEC00000347-En
+ vaccine
Soberana 02
@@ -806022,7 +815587,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang, Oliver He
https://www.merck.com/news/merck-discontinues-development-of-sars-cov-2-covid-19-vaccine-candidates-continues-development-of-two-investigational-therapeutic-candidates/
- V591
+ vaccine
+ V591
@@ -806037,18 +815603,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
-
-
-
-
-
-
@@ -806067,11 +815621,12 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A SARS-CoV-2 inactivated, Vero-cell based vaccine adjuvanted with aluminum and CpG 1018. It uses the manufacturing platform of Valneva’s commercial Japanese encephalitis (JE) vaccine
+ A SARS-CoV-2 inactivated, Vero-cell based vaccine adjuvanted with aluminum and CpG 1018. It uses the manufacturing platform of Valneva’s commercial Japanese encephalitis (JE) vaccine
Philip Huang
https://valneva.com/research-development/covid-19-vla2001/
- VLA2001
+ vaccine
+ VLA2001
@@ -806080,10 +815635,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- 'A SARS DNA vaccine that is made from recombinant plasmid containing nucleocapsid protein (N) sequence constructed then expressed and purified from E. coli bacteria’
+ 'A SARS DNA vaccine that is made from recombinant plasmid containing nucleocapsid protein (N) sequence constructed then expressed and purified from E. coli bacteria’
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5732
+ vaccine
PubMed ID:16423399
SARS N protein DNA vaccine
VIOLIN ID: 5732
@@ -806095,10 +815651,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- 'A SARS DNA combination vaccine that is made from recombinant plasmids’ containing membrane protein (M) and nucleocapsid protein (N) sequences constructed then expressed and purified from E. coli bacteria’
+ 'A SARS DNA combination vaccine that is made from recombinant plasmids’ containing membrane protein (M) and nucleocapsid protein (N) sequences constructed then expressed and purified from E. coli bacteria’
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5733
+ vaccine
PubMed ID:16423399
SARS N + SARS M DNA vaccine
VIOLIN ID: 5733
@@ -806110,10 +815667,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- 'A SARS DNA vaccine that is made from recombinant plasmid containing membrane protein (M) sequence constructed then expressed and purified from E. coli bacteria’
+ 'A SARS DNA vaccine that is made from recombinant plasmid containing membrane protein (M) sequence constructed then expressed and purified from E. coli bacteria’
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5731
+ vaccine
PubMed ID:16423399
SARS M protein DNA vaccine
VIOLIN ID: 5731
@@ -806125,10 +815683,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- 'A SARS DNA vaccine that is made from oral live-attenuated auxotrophic S. typhimurium aroA strain SL7207 that contained CTLA4HingeSARS800 with SARS-CoV S protein‘
+ 'A SARS DNA vaccine that is made from oral live-attenuated auxotrophic S. typhimurium aroA strain SL7207 that contained CTLA4HingeSARS800 with SARS-CoV S protein‘
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5738
+ vaccine
PubMed ID:15993989
Salmonella-CTLA4-S SARS DNA vaccine
VIOLIN ID: 5738
@@ -806139,6 +815698,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+
@@ -806150,6 +815710,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5734
+ vaccine
PubMed ID:15993989
Recombinant SARS spike polypeptide vaccine
VIOLIN ID: 5734
@@ -806165,6 +815726,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5737
+ vaccine
PubMed ID:15993989
SARS CTLA4-S DNA vaccine
VIOLIN ID: 5737
@@ -806180,6 +815742,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5736
+ vaccine
PubMed ID:15993989
SARS tPA-S DNA vaccine
VIOLIN ID: 5736
@@ -806195,6 +815758,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5739
+ vaccine
PubMed ID:15993989
Salmonella-tPA-S SARS DNA vaccine
VIOLIN ID: 5739
@@ -806210,6 +815774,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5729
+ vaccine
PubMed ID:23142821
SARS MA-ExoN vaccine
VIOLIN ID: 5729
@@ -806221,10 +815786,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A SARS recombinant vector vaccine that is made from recombinant MA15 virulent mouse-adapted SARS-CoV (MA15) background of E-deleted vaccine candidate (rMA15-ΔE)
+ A SARS recombinant vector vaccine that is made from recombinant MA15 virulent mouse-adapted SARS-CoV (MA15) background of E-deleted vaccine candidate (rMA15-ΔE)
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5728
+ vaccine
PubMed ID:16423399
SARS rMA15-ΔE vaccine
VIOLIN ID: 5728
@@ -806240,6 +815806,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5726
+ vaccine
PubMed ID:15708987
SARS ADS-MVA vaccine
VIOLIN ID: 5726
@@ -806251,16 +815818,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
A MERS subunit vaccine that has a combined adjuvant of aluminum hydroxide and CpG oligodeoxynucleotides.
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5714
+ vaccine
PubMed ID:29618723
MERS-CoV S vaccine adjuvanted with CpG and Alum
VIOLIN ID: 5714
@@ -806282,6 +815844,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5721
+ vaccine
PubMed ID:29618723
Inactivated whole MERS-CoV (IV) vaccine with CpG and Alum
VIOLIN ID: 5721
@@ -806297,6 +815860,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5725
+ vaccine
PubMed ID:15096611
SARS MVA/S vaccine
VIOLIN ID: 5725
@@ -806318,6 +815882,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5730
+ vaccine
PubMed ID:16476986
β-propiolactone-inactivated SARS-CoV vaccine
VIOLIN ID: 5730
@@ -806333,6 +815898,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5727
+ vaccine
PubMed ID:16476986
SARS Ad S/N vaccine
VIOLIN ID: 5727
@@ -806354,6 +815920,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5719
+ vaccine
PubMed ID:25192975
Ad5.MERS-S1 vaccine
VIOLIN ID: 5719
@@ -806375,6 +815942,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5720
+ vaccine
PubMed ID:25192975
Ad5.MERS-S vaccine
VIOLIN ID: 5720
@@ -806390,6 +815958,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5715
+ vaccine
PubMed ID:26218507
MERS England1 S1 protein subunit Vaccine
VIOLIN ID: 5715
@@ -806405,6 +815974,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5717
+ vaccine
PubMed ID:26218507
MERS England1 S DNA + England1 S protein subunit vaccine
VIOLIN ID: 5717
@@ -806420,6 +815990,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5716
+ vaccine
PubMed ID:26218507
MERS England1 S DNA Vaccine
VIOLIN ID: 5716
@@ -806435,6 +816006,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5723
+ vaccine
PubMed ID:28536429
MERS rRBD plus alum vaccine
VIOLIN ID: 5723
@@ -806450,6 +816022,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5718
+ vaccine
PubMed ID:28314561
MERS-CoV pcDNA3.1-S1 DNA vaccine
VIOLIN ID: 5718
@@ -806461,10 +816034,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A MERS recombinant vector virus made from chimeric virus based on the vesicular stomatitis virus (VSV) in which the G gene was replaced by MERS-CoV S gene (VSVΔG-MERS).
+ A MERS recombinant vector virus made from chimeric virus based on the vesicular stomatitis virus (VSV) in which the G gene was replaced by MERS-CoV S gene (VSVΔG-MERS).
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5722
+ vaccine
PubMed ID:29246504
VSVΔG-MERS vaccine
VIOLIN ID: 5722
@@ -806480,6 +816054,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5724
+ vaccine
PubMed ID:28536429
MERS rNTD vaccine
VIOLIN ID: 5724
@@ -806501,6 +816076,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5742
+ vaccine
PubMed ID:22536382
inactivated whole (formalin and UV radiation) SARS-CoV vaccine
VIOLIN ID: 5742
@@ -806511,6 +816087,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+
@@ -806518,10 +816095,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A SARS DNA vaccine made from rDNA-expressed ectodomain of the S protein.
+ A recombinant SARS DNA vaccine made from rDNA-expressed ectodomain of the S protein.
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5743
+ vaccine
PubMed ID:22536382
recombinant SARS DNA spike protein vaccine
VIOLIN ID: 5743
@@ -806537,8 +816115,9 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5747
+ vaccine
PubMed ID:22536382
- Viral-like-particle S-MHV SARS vaccine
+ Viral-like-particle S-MHV SARS vaccine
VIOLIN ID: 5747
@@ -806558,6 +816137,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5741
+ vaccine
PubMed ID:22536382
UV-Inactivated SARS + TLR agonist vaccine
VIOLIN ID: 5741
@@ -806579,6 +816159,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5740
+ vaccine
PubMed ID:22536382
UV-Inactivated SARS vaccine
VIOLIN ID: 5740
@@ -806594,6 +816175,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5748
+ vaccine
PubMed ID:26954467
VRP-MERS-N vaccine
VIOLIN ID: 5748
@@ -806609,6 +816191,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5749
+ vaccine
PubMed ID:26954467
VRP-SARS-N vaccine
VIOLIN ID: 5749
@@ -806624,6 +816207,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5750
+ vaccine
PubMed ID:26954467
rVV-SARS vaccine
VIOLIN ID: 5750
@@ -806639,6 +816223,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5757
+ vaccine
PubMed ID:26355094
MVvac2-MERS-S(H) vaccine
VIOLIN ID: 5757
@@ -806654,6 +816239,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5760
+ vaccine
PubMed ID:29902727
MVvac2-MERS-N vaccine
VIOLIN ID: 5760
@@ -806671,10 +816257,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A MERS recombinant vector made of Chimpanzee adenovirus Oxford 1 vector expressing S protein from MERS-CoV’
+ A MERS recombinant vector made of Chimpanzee adenovirus Oxford 1 vector expressing S protein from MERS-CoV’
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5751
+ vaccine
PubMed ID:29263883
ChAdOx1-MERS-S vaccine
VIOLIN ID: 5751
@@ -806686,10 +816273,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A MERS recombinant vector made of Adenovirus type 41 used as vector for MERS-CoV S protein.’
+ A MERS recombinant vector made of Adenovirus type 41 used as vector for MERS-CoV S protein.’
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5760
+ vaccine
PubMed ID:25762305
Ad41.MERS vaccine
VIOLIN ID: 5760
@@ -806705,6 +816293,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5758
+ vaccine
PubMed ID:23986586
MVA-MERS vaccine
VIOLIN ID: 5758
@@ -806720,6 +816309,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5753
+ vaccine
PubMed ID:15078946
CRT-N SARS vaccine
VIOLIN ID: 5753
@@ -806735,8 +816325,9 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=3155
+ vaccine
PubMed ID:18463152
- rSARS-CoV-ΔE vaccine
+ rSARS-CoV-ΔE vaccine
VIOLIN ID: 3155
@@ -806750,6 +816341,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5759
+ vaccine
PubMed ID:26355094
MVvac2-MERS-solS vaccine
VIOLIN ID: 5759
@@ -806792,6 +816384,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
https://en.wikipedia.org/wiki/CoronaVac
+ vaccine
PubMed ID:32376603
CoronaVac
VIOLIN ID: 5761
@@ -806809,12 +816402,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
@@ -806838,6 +816425,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5764
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
+ vaccine
ZF2001
VIOLIN ID: 5764
@@ -806882,6 +816470,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman, Philip Huang
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5771
+ vaccine
PubMed ID:32647131
LNP-nCoVsaRNA
VIOLIN ID: 5771
@@ -806893,12 +816482,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
@@ -806917,12 +816500,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
@@ -806930,11 +816507,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A SARS-CoV-2 vaccine made from a recombinant adinvorius type-5 expressing SARS-CoV-2 S protein.
- A SARS-CoV-2 vaccine made of self-coding RNA encoding SARS-CoV-2 spike protein encapsulated within a lipid nanoparticle.
Anthony Huffman, Philip Huang
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5768
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
+ vaccine
PubMed ID:32450106
Ad5-nCoV
VIOLIN ID: 5768
@@ -806962,6 +816539,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5769
+ vaccine
PubMed ID:32450106
MERS GLS-5300 vaccine
VIOLIN ID: 5769
@@ -806983,6 +816561,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5770
+ vaccine
PubMed ID:18824060
VRC-SRSDNA015-00-VP vaccine
VIOLIN ID: 5770
@@ -807004,6 +816583,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5766
+ vaccine
PubMed ID:17535926
SARS NDV-BC/S vaccine
VIOLIN ID: 5766
@@ -807025,6 +816605,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5767
+ vaccine
PubMed ID:17535926
SARS NDV-VF/S vaccine
VIOLIN ID: 5767
@@ -807037,9 +816618,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A SARS DNA vaccine made from rDNA-expressed ectodomain of the S protein.
+ JZ: may be same as VO:0005126
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5745
+ vaccine
PubMed ID:16497416
rDNA-expressed S SARS protein vaccine
VIOLIN ID: 5745
@@ -807061,6 +816644,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5762
+ vaccine
PubMed ID:18346823
rMV-S + rMV-N vaccine
VIOLIN ID: 5762
@@ -807082,8 +816666,9 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5763
+ vaccine
PubMed ID:22536382
- SARS-CoV Baculovirus S protein Vaccine
+ SARS-CoV Baculovirus S protein Vaccine
VIOLIN ID: 5763
@@ -807103,6 +816688,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
VIOLIN: http://www.violinet.org/vaxquery/vaccine_detail.php?c_vaccine_id=5752
+ vaccine
PubMed ID:32325037
MVA-MERS-S vaccine
VIOLIN ID: 5752
@@ -807130,7 +816716,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
https://altimmune.com/adcovid/
- AdCOVID
+ vaccine
+ AdCOVID
@@ -807148,7 +816735,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A plasmid pCI-N, encoding the full-length N gene of SARS-CoV, was constructed and expressed in Escherichia coli DH5alpha
[PubMed: 15582659]
- SARS-CoV pCI-N DNA vaccine
+ vaccine
+ SARS-CoV pCI-N DNA vaccine
VIOLIN ID: 5735
@@ -807170,12 +816758,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
@@ -807193,6 +816775,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Covovax
PubMed:32376603
+ vaccine
NVX-CoV2373
@@ -807224,6 +816807,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman, Philip Huang
NCT04758962
+ vaccine
CoV2 SAM
@@ -807268,6 +816852,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
https://www.cdc.gov/coronavirus/2019-ncov/vaccines/different-vaccines/Moderna.html
https://www.fda.gov/emergency-preparedness-and-response/coronavirus-disease-2019-covid-19/moderna-covid-19-vaccine
+ vaccine
Moderna COVID-19 vaccine
@@ -807277,12 +816862,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
@@ -807316,7 +816895,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
https://en.wikipedia.org/wiki/AZD1222
Covishield
- Oxford–AstraZeneca COVID-19 vaccine
+ vaccine
+ Oxford-AstraZeneca COVID-19 vaccine
violinID:2020-001072-15, 2020-001228-32, ISRCTN89951424
@@ -807377,6 +816957,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
PubMed:32731257
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
+ vaccine
Ad26.COV2.S
@@ -807415,6 +816996,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
PubMed:32789505
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
+ vaccine
WIBP-CorV
@@ -807446,6 +817028,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman, Philip Huang
PubMed:32795413
+ vaccine
ARCoV
@@ -807458,7 +817041,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
+
@@ -807477,6 +817060,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
PubMed:32800805
+ vaccine
ZyCoV-D
@@ -807530,6 +817114,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
https://en.wikipedia.org/wiki/Gam-COVID-Vac
Gam-COVID-Vac
+ vaccine
Sputnik V
@@ -807567,6 +817152,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman, Philip Huang
PubMed:32973505
+ vaccine
ARCT-021
@@ -807588,10 +817174,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A SARS-CoV-2 DNA vaccine developed by AnGes.
+ A SARS-CoV-2 DNA vaccine developed by AnGes, named as AG0301-COVID19.
Anthony Huffman
NCT04463472
+ vaccine
AG0301-COVID19
@@ -807632,6 +817219,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
https://en.wikipedia.org/wiki/BBIBP-CorV
https://go.drugbank.com/drugs/DB15807
+ vaccine
BBIBP-CorV
@@ -807640,7 +817228,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
@@ -807672,6 +817259,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
PubMed:32376603
Covidful
+ vaccine
Chinese Academy of Medical Sciences COVID-19 vaccine
@@ -807697,6 +817285,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman, Philip Huang
NCT04449276
+ vaccine
CVnCoV
@@ -807734,6 +817323,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman, Philip Huang
https://www.covidx.eu/grad-cov2
+ vaccine
GRAd-COV2
@@ -807759,6 +817349,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman, Philip Huang
NCT04445389
+ vaccine
GX-19
@@ -807793,11 +817384,12 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A SARS-CoV-2 subunit vaccine that is made of a protein subunit made of the RBD domain of the S protein.
+ Anthony Huffman
Philip Huang
PMID:32973505
- Anthony Huffman
- KBP-COVID-19
+ vaccine
+ KBP-COVID-19
@@ -807825,11 +817417,12 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A DNA vaccine that expresses S protein from the pGX9501 vector
+ Anthony Huffman
Philip Huang
PMID:32433465
- Anthony Huffman
- INO-4800
+ vaccine
+ INO-4800
@@ -807856,14 +817449,14 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
- A SARS-CoV-2 protein subunit vaccine developed by Adimmune Corporation.
- AdimrSC-2f is a candidate vaccine against COVID-19 developed by Adimmune Corporation (Adimmune). Using the baculovirus-insect cells expression system, the recombinant receptor binding domain (RBD) of SARS-CoV-2 spike (S) protein is amplified and purified. AdimrSC-2f is formulated in the different dosages of Spike (S) protein without/with aluminum content as adjuvant.
+ A SARS-CoV-2 protein subunit vaccine developed by Adimmune Corporation. AdimrSC-2f is a candidate vaccine against COVID-19 developed by Adimmune Corporation (Adimmune). Using the baculovirus-insect cells expression system, the recombinant receptor binding domain (RBD) of SARS-CoV-2 spike (S) protein is amplified and purified. AdimrSC-2f is formulated in the different dosages of Spike (S) protein without/with aluminum content as adjuvant.
Philip Huang, Oliver He
NCT04522089
https://go.drugbank.com/drugs/DB16436
https://www.smartpatients.com/trials/NCT04522089
- AdimrSC-2f
+ vaccine
+ AdimrSC-2f
@@ -807907,7 +817500,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
NCT04334980
https://www.symvivo.com/covid-19
- bacTRL-Spike
+ vaccine
+ bacTRL-Spike
@@ -807938,32 +817532,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04566276
- ChulaCov19
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- A synthetic modified vaccinia Ankara (MVA)-based SARS-CoV-2 vaccine
- Philip Huang
- NCT04639466
-
- COH04S1
+ vaccine
+ ChulaCov19
@@ -807972,10 +817542,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+ an adenovirus vaccine vector that uses a gorilla adenovirus.
+ Anthony Huffman
- Anthony Huffman
- gorilla adenovirus vector
- an adenovirus vaccine vector that uses a gorilla adenovirus.
+ vaccine component
+ gorilla adenovirus vector
@@ -807986,9 +817557,9 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Anthony Huffman
- adenovirus serotype 26 vaccine vector
+ vaccine component
+ adenovirus serotype 26 vaccine vector
NCBI Taxonomy ID: 46928
- an adenovirus vaccine vector that uses an Adenovirus serotype 26 strain.
@@ -807998,10 +817569,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A nanoparticle vector composed of lipids.
+ Anthony Huffman
PMID: 20402623
- Anthony Huffman
- lipid nanoparticle vector
+ vaccine component
+ lipid nanoparticle vector
@@ -808011,10 +817583,11 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A vaccine component composed of a synthetic component that is solid and spherical structures ranging to around 100 nm in size and prepared from natural or synthetic polymers.
+ Anthony Huffman
PMID: 22353619
- Anthony Huffman
- nanoparticle vector
+ vaccine component
+ nanoparticle vector
@@ -808026,7 +817599,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A chimpanzee adenovirus vaccine vector that patented by Oxford and derived from ChAd serotype Y25 that exchanges the native E4 orf4, orf6 and orf6/7 genes for those from HAdV-C5
PMID: 29527232
- chimpanzee adenovirus Oxford1 vaccine vector
+ vaccine component
+ chimpanzee adenovirus Oxford1 vaccine vector
ChAdOx1
@@ -808058,7 +817632,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04627675
- CORVax12
+ vaccine
+ CORVax12
@@ -808083,7 +817658,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04299724
- COVID-19 aAPC vaccine
+ vaccine
+ COVID-19 aAPC vaccine
@@ -808115,7 +817691,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
NCT04813796
https://investors.modernatx.com/news-releases/news-release-details/first-participants-dosed-phase-1-study-evaluating-mrna-1283
- mRNA-1283
+ vaccine
+ mRNA-1283
@@ -808140,7 +817717,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04591184
- Covigenix VAX-001
+ vaccine
+ Covigenix VAX-001
@@ -808165,7 +817743,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04619628
- COVI-VAC
+ vaccine
+ COVI-VAC
@@ -808173,7 +817752,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
@@ -808201,9 +817779,10 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
A SARS-CoV-2 inactivated vaccine developed by Health Institutes of Turkey
Philip Huang
- ERUCOV-VAC
+ ERUCOV-VAC
NCT04691947
+ vaccine
Turkovac
@@ -808241,7 +817820,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04591717
- hAd5-COVID-19
+ vaccine
+ hAd5-COVID-19
@@ -808266,7 +817846,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04546841
- IMP CoVac-1
+ vaccine
+ IMP CoVac-1
@@ -808297,7 +817878,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04569383
- MVA-SARS-2-S
+ vaccine
+ MVA-SARS-2-S
@@ -808312,12 +817894,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
@@ -808346,7 +817922,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04487210
- MVC-COV1901
+ vaccine
+ MVC-COV1901
@@ -808361,12 +817938,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
@@ -808384,7 +817955,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
SpikoGen
NCT04453852
- COVAX-19
+ vaccine
+ COVAX-19
@@ -808415,7 +817987,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04702178
- COVAC
+ vaccine
+ COVAC
@@ -808434,7 +818007,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang, Oliver He
https://www.merck.com/news/merck-discontinues-development-of-sars-cov-2-covid-19-vaccine-candidates-continues-development-of-two-investigational-therapeutic-candidates/
- V590
+ vaccine
+ V590
@@ -808459,7 +818033,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04563702
- VXA-CoV2-1
+ vaccine
+ VXA-CoV2-1
@@ -808468,12 +818043,6 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
-
-
-
-
-
-
@@ -808490,7 +818059,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
NCT04750343
- SKYCovione
+ vaccine
+ SKYCovione
@@ -808498,6 +818068,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+
@@ -808507,7 +818078,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang, Rohit Goru, Oliver He
- COVID-19 RNA vaccine
+ vaccine
+ COVID-19 RNA vaccine
@@ -808523,10 +818095,12 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+
Philip Huang, Rohit Goru, Oliver He
- COVID-19 recombinant vector vaccine
+ vaccine
+ COVID-19 recombinant vector vaccine
@@ -808537,7 +818111,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang, Rohit Goru, Oliver He
- COVID-19 recombinant adenoviral vector vaccine
+ vaccine
+ COVID-19 recombinant adenoviral vector vaccine
@@ -808548,7 +818123,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang, Rohit Goru, Oliver He
- COVID-19 inactivated vaccine
+ vaccine
+ COVID-19 inactivated vaccine
@@ -808556,6 +818132,7 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
+
@@ -808565,7 +818142,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
- COVID-19 subunit vaccine
+ vaccine
+ COVID-19 subunit vaccine
@@ -808576,7 +818154,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
- COVID-19 DNA vaccine
+ vaccine
+ COVID-19 DNA vaccine
@@ -808587,7 +818166,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
- COVID-19 live, attenuated vaccine
+ vaccine
+ COVID-19 live, attenuated vaccine
@@ -808598,117 +818178,8 @@ Artificial active immunization is where the microbe, or parts of it, are injecte
Philip Huang
- COVID-19 virus-like particle vaccine
-
-
-
-
-
-
-
-
- A vaccine adjuvant comprised of 40 nm nanoparticles composed of Quillaja saponins, cholesterol and phospholipid.
- Philip Huang
- PMID: 22844480
-
- Matrix-M vaccine adjuvant
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- A polysaccharide adjuvant derived from delta inulin
- Chemical Nature: Carbohydrate
-Mechanism of Action: Complement, Dendritic cells (unknown receptor), Other, Unknown
-Immune profile induced: mixed Th1/Th2
-By routes: IM, IN, IP, SQ, inhalation,
-Point of Contact: Nikolai Petrovsky, Vaxine
-https://www.ncbi.nlm.nih.gov/pubmed/?term=31009889
-https://www.ncbi.nlm.nih.gov/pubmed/?term=25520500
-https://www.ncbi.nlm.nih.gov/pubmed/?term=28758637
-https://www.ncbi.nlm.nih.gov/pubmed/?term=23864620
-https://www.ncbi.nlm.nih.gov/pubmed/?term=24342245
-https://www.ncbi.nlm.nih.gov/pubmed/?term=23306367
-https://www.ncbi.nlm.nih.gov/pubmed/?term=21147758
-https://www.ncbi.nlm.nih.gov/pubmed/?term=15479440
-https://www.ncbi.nlm.nih.gov/pubmed/?term=26031451
-https://www.ncbi.nlm.nih.gov/pubmed/?term=25659269
-https://www.ncbi.nlm.nih.gov/pubmed/?term=33883559
-https://www.ncbi.nlm.nih.gov/pubmed/?term=30312742
-https://www.ncbi.nlm.nih.gov/pubmed/?term=21736913
-https://www.ncbi.nlm.nih.gov/pubmed/?term=30218687
-https://www.ncbi.nlm.nih.gov/pubmed/?term=25459531
-https://www.ncbi.nlm.nih.gov/pubmed/?term=24958701
-https://www.ncbi.nlm.nih.gov/pubmed/?term=25516480
-https://www.ncbi.nlm.nih.gov/pubmed/?term=20130134
-https://www.ncbi.nlm.nih.gov/pubmed/?term=23388724
-https://www.ncbi.nlm.nih.gov/pubmed/?term=21169215
-https://www.ncbi.nlm.nih.gov/pubmed/?term=30832356
-https://www.ncbi.nlm.nih.gov/pubmed/?term=30322015
-https://www.ncbi.nlm.nih.gov/pubmed/?term=28602608
-https://www.ncbi.nlm.nih.gov/pubmed/?term=28676380
-https://www.ncbi.nlm.nih.gov/pubmed/?term=33542494
-https://www.ncbi.nlm.nih.gov/pubmed/?term=26232344
-https://www.ncbi.nlm.nih.gov/pubmed/?term=22728225
-https://www.ncbi.nlm.nih.gov/pubmed/?term=22728225
-https://www.ncbi.nlm.nih.gov/pubmed/?term=25267153
-https://www.ncbi.nlm.nih.gov/pubmed/?term=31300280
-https://www.ncbi.nlm.nih.gov/pubmed/?term=28301280
-https://www.ncbi.nlm.nih.gov/pubmed/?term=22717330
-https://www.ncbi.nlm.nih.gov/pubmed/?term=26177480
-https://www.ncbi.nlm.nih.gov/pubmed/?term=10000000
-https://www.ncbi.nlm.nih.gov/pubmed/?term=27342914
-https://www.ncbi.nlm.nih.gov/pubmed/?term=12
- Nikolai Petrovsky, Wolfgang Leitner, Philip Huang, Oliver He
- PMID: 22728225
- https://vac.niaid.nih.gov/view?id=37
- https://www.ncbi.nlm.nih.gov/pubmed/?term=10000000
- https://www.ncbi.nlm.nih.gov/pubmed/?term=12
- https://www.ncbi.nlm.nih.gov/pubmed/?term=15479440
- https://www.ncbi.nlm.nih.gov/pubmed/?term=20130134
- https://www.ncbi.nlm.nih.gov/pubmed/?term=21147758
- https://www.ncbi.nlm.nih.gov/pubmed/?term=21169215
- https://www.ncbi.nlm.nih.gov/pubmed/?term=21736913
- https://www.ncbi.nlm.nih.gov/pubmed/?term=22717330
- https://www.ncbi.nlm.nih.gov/pubmed/?term=22728225
- https://www.ncbi.nlm.nih.gov/pubmed/?term=23306367
- https://www.ncbi.nlm.nih.gov/pubmed/?term=23388724
- https://www.ncbi.nlm.nih.gov/pubmed/?term=23864620
- https://www.ncbi.nlm.nih.gov/pubmed/?term=24342245
- https://www.ncbi.nlm.nih.gov/pubmed/?term=24958701
- https://www.ncbi.nlm.nih.gov/pubmed/?term=25267153
- https://www.ncbi.nlm.nih.gov/pubmed/?term=25459531
- https://www.ncbi.nlm.nih.gov/pubmed/?term=25516480
- https://www.ncbi.nlm.nih.gov/pubmed/?term=25520500
- https://www.ncbi.nlm.nih.gov/pubmed/?term=25659269
- https://www.ncbi.nlm.nih.gov/pubmed/?term=26031451
- https://www.ncbi.nlm.nih.gov/pubmed/?term=26177480
- https://www.ncbi.nlm.nih.gov/pubmed/?term=26232344
- https://www.ncbi.nlm.nih.gov/pubmed/?term=27342914
- https://www.ncbi.nlm.nih.gov/pubmed/?term=28301280
- https://www.ncbi.nlm.nih.gov/pubmed/?term=28602608
- https://www.ncbi.nlm.nih.gov/pubmed/?term=28676380
- https://www.ncbi.nlm.nih.gov/pubmed/?term=28758637
- https://www.ncbi.nlm.nih.gov/pubmed/?term=30218687
- https://www.ncbi.nlm.nih.gov/pubmed/?term=30312742
- https://www.ncbi.nlm.nih.gov/pubmed/?term=30322015
- https://www.ncbi.nlm.nih.gov/pubmed/?term=30832356
- https://www.ncbi.nlm.nih.gov/pubmed/?term=31009889
- https://www.ncbi.nlm.nih.gov/pubmed/?term=31300280
- https://www.ncbi.nlm.nih.gov/pubmed/?term=33542494
- https://www.ncbi.nlm.nih.gov/pubmed/?term=33883559
-
- 37
- Advax vaccine adjuvant
+ vaccine
+ COVID-19 virus-like particle vaccine
@@ -808744,7 +818215,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
A SARS-CoV-2 protein subunit vaccine manufactured by the Razi Vaccine and Serum Research Institute with a Spike protein antigen
Philip Huang
- Razi Cov Pars
+ vaccine
+ Razi Cov Pars
@@ -808769,7 +818241,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04751682
- BBV154
+ vaccine
+ BBV154
@@ -808794,7 +818267,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04776317
- ChAdV68-S
+ vaccine
+ ChAdV68-S
@@ -808802,7 +818276,6 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
-
@@ -808832,7 +818305,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
https://en.irct.ir/trial/52701
- COVIran Barakat
+ vaccine
+ COVIran Barakat
@@ -808857,7 +818331,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
https://www.clinicaltrialsregister.eu/ctr-search/trial/2020-003734-20/IT
- COVID-eVax
+ vaccine
+ COVID-eVax
@@ -808882,7 +818357,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04742842
- COVIGEN
+ vaccine
+ COVIGEN
@@ -808907,7 +818383,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04783311
- EuCorVac-19
+ vaccine
+ EuCorVac-19
@@ -808938,7 +818415,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04785144
- mRNA-1273.351
+ vaccine
+ mRNA-1273.351
@@ -808963,7 +818441,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04760743
- NBP2001
+ vaccine
+ NBP2001
@@ -808988,7 +818467,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04764422
- NDV-HXP-S
+ vaccine
+ NDV-HXP-S
@@ -809013,7 +818493,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04765436
- PTX-COVID19-B
+ vaccine
+ PTX-COVID19-B
@@ -809038,7 +818519,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04784767
- SpFN
+ vaccine
+ SpFN
@@ -809047,12 +818529,6 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
-
-
-
-
-
-
@@ -809069,7 +818545,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04773665
- VBI-2902a
+ vaccine
+ VBI-2902a
@@ -809106,7 +818583,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
https://en.irct.ir/trial/54133
- FAKHRAVAC
+ vaccine
+ FAKHRAVAC
@@ -809137,7 +818615,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04798001
- MV-014-212
+ vaccine
+ MV-014-212
@@ -809162,7 +818641,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04798027
- MRT5500
+ vaccine
+ MRT5500
@@ -809199,7 +818679,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
- CoviVac
+ vaccine
+ CoviVac
@@ -809224,7 +818705,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
https://rpcec.sld.cu/trials/RPCEC00000366-En
- Soberana Plus
+ vaccine
+ Soberana Plus
@@ -809249,7 +818731,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
Daiichi Sankyo Co., Ltd.
- DS-5670a
+ vaccine
+ DS-5670a
@@ -809286,7 +818769,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04830800
- COVIVAC
+ vaccine
+ COVIVAC
@@ -809311,7 +818795,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
ChiCTR2100045107
- V-01
+ vaccine
+ V-01
@@ -809336,7 +818821,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04869592
- COVID-19 subunit vaccine by National Vaccine and Serum Institute of China
+ vaccine
+ COVID-19 subunit vaccine by National Vaccine and Serum Institute of China
@@ -809368,7 +818854,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
NCT04863131
Elixirgen Therapeutics, Inc.
- EXG-5003
+ vaccine
+ EXG-5003
@@ -809405,7 +818892,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
jRCT2071200106
- KD-414
+ vaccine
+ KD-414
@@ -809430,7 +818918,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04818281
- COVID-19 VLP vaccine by the Scientific and Technological Research Council of Turkey
+ vaccine
+ COVID-19 VLP vaccine by the Scientific and Technological Research Council of Turkey
@@ -809455,7 +818944,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04818801
- ReCOV
+ vaccine
+ ReCOV
@@ -809492,7 +818982,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04838080
- Koçak-19 Inaktif Adjuvanlı COVID-19 Vaccine
+ vaccine
+ Koçak-19 Inaktif Adjuvanlı COVID-19 Vaccine
@@ -809523,7 +819014,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04839042
- SC-Ad6-1
+ vaccine
+ SC-Ad6-1
@@ -809532,12 +819024,6 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
-
-
-
-
-
-
@@ -809554,7 +819040,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04839146
- ABNCoV2
+ vaccine
+ ABNCoV2
@@ -809575,11 +819062,12 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
- A SARS-CoV-2 Lipid-Inorganic Nanoparticle (LION™) formulated replicating mRNA vaccine that encodes for a full-length spike (S) protein of the SARS-CoV-2 virus
+ A SARS-CoV-2 Lipid-Inorganic Nanoparticle (LION‚Ñ¢) formulated replicating mRNA vaccine that encodes for a full-length spike (S) protein of the SARS-CoV-2 virus
Philip Huang
NCT04844268
- HDT-301
+ vaccine
+ HDT-301
@@ -809594,12 +819082,6 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
-
-
-
-
-
-
@@ -809622,7 +819104,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04866069
- COVID-19 inactivated vaccine by the Scientific and Technological Research Council of Turkey
+ vaccine
+ COVID-19 inactivated vaccine by the Scientific and Technological Research Council of Turkey
@@ -809637,12 +819120,6 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
-
-
-
-
-
-
@@ -809665,7 +819142,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
PubMed ID: 33887208
- MF59-adjuvanted SARS-CoV-2 Sclamp vaccine
+ vaccine
+ MF59-adjuvanted SARS-CoV-2 Sclamp vaccine
@@ -809696,7 +819174,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04871737
- COVID-19 rNDV vector vaccine by Laboratorio Avi-Mex
+ vaccine
+ COVID-19 rNDV vector vaccine by Laboratorio Avi-Mex
@@ -809721,7 +819200,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
ChiCTR2100045984
- COVID-19 mRNA vaccine by Shanghai East Hospital and Stemirna Therapeutics
+ vaccine
+ COVID-19 mRNA vaccine by Shanghai East Hospital and Stemirna Therapeutics
@@ -809746,7 +819226,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04885361
- CoVepiT
+ vaccine
+ CoVepiT
@@ -809777,7 +819258,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04895449
- MVA-SARS-2-ST
+ vaccine
+ MVA-SARS-2-ST
@@ -809809,7 +819291,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
NCT04893512
Syneos Health
- CoV2-OGEN1
+ vaccine
+ CoV2-OGEN1
@@ -809823,7 +819306,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
https://www.fda.gov/emergency-preparedness-and-response/coronavirus-disease-2019-covid-19/covid-19-vaccines
- authorized COVID-19 vaccine
+ vaccine
+ authorized COVID-19 vaccine
@@ -809836,7 +819320,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Oliver He
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
- authorized COVID-19 RNA vaccine
+ vaccine
+ authorized COVID-19 RNA vaccine
@@ -809849,7 +819334,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Oliver He
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
- authorized inactivated COVID-19 vaccine
+ vaccine
+ authorized inactivated COVID-19 vaccine
@@ -809862,7 +819348,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Oliver He
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
- authorized COVID-19 recombinant vector vaccine
+ vaccine
+ authorized COVID-19 recombinant vector vaccine
@@ -809874,7 +819361,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Oliver He
- authorized COVID-19 recombinant adenoviral vector vaccine
+ vaccine
+ authorized COVID-19 recombinant adenoviral vector vaccine
@@ -809887,7 +819375,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Oliver He, Philip Huang
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
- authorized COVID-19 subunit vaccine
+ vaccine
+ authorized COVID-19 subunit vaccine
@@ -809912,7 +819401,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04930003
- QazCoVac-P
+ vaccine
+ QazCoVac-P
@@ -809949,7 +819439,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04934111
- LNP-nCOV saRNA-02
+ vaccine
+ LNP-nCOV saRNA-02
@@ -809982,35 +819473,12 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
- A multivalent SARS-CoV-2 mRNA booster vaccine which combines mRNA-1273, Moderna’s authorized vaccine against ancestral strains, and mRNA-1273.351 in a single vaccine at the 50 µg dose level and lower.
+ A multivalent SARS-CoV-2 mRNA booster vaccine which combines mRNA-1273, Moderna’s authorized vaccine against ancestral strains, and mRNA-1273.351 in a single vaccine at the 50 µg dose level and lower.
Philip Huang
https://investors.modernatx.com/news-releases/news-release-details/moderna-announces-it-has-shipped-variant-specific-vaccine
- mRNA-1273.211
-
-
-
-
-
-
-
-
-
- immune response profile
-
-
-
-
-
-
-
-
- An immune profile that is characterized by the presense of both Type 1 and Type 2 T helper (Th1 and Th2) cells.
- Oliver He, Amogh Madireddi
- https://en.wikipedia.org/wiki/T_helper_cell
- https://pubmed.ncbi.nlm.nih.gov/10579123/
-
- Th1/Th2 mixed immune profile
+ vaccine
+ mRNA-1273.211
@@ -810041,7 +819509,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04950751
- SCB-2020S
+ vaccine
+ SCB-2020S
@@ -810066,7 +819535,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
https://en.irct.ir/trial/56987
- Noora
+ vaccine
+ Noora
@@ -810091,7 +819561,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04953078
- Baiya SARS-CoV-2 Vax 1
+ vaccine
+ Baiya SARS-CoV-2 Vax 1
@@ -810116,7 +819587,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04954287
- CVXGA1
+ vaccine
+ CVXGA1
@@ -810141,7 +819613,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04973449
- AZD2816
+ vaccine
+ AZD2816
@@ -810166,7 +819639,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04990544
- 202-CoV
+ vaccine
+ 202-CoV
@@ -810191,7 +819665,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05007509
- COVID-19 subunit vaccine by HIPRA
+ vaccine
+ COVID-19 subunit vaccine by HIPRA
@@ -810212,11 +819687,12 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
- A SARS-CoV-2 DNA vaccine developed by AnGes.
+ A SARS-CoV-2 DNA vaccine developed by AnGes, named as AG0302-COVID19.
Philip Huang
NCT04993586
- AG0302-COVID19
+ vaccine
+ AG0302-COVID19
@@ -810229,7 +819705,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Oliver He
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
- authorized COVID-19 DNA vaccine
+ vaccine
+ authorized COVID-19 DNA vaccine
@@ -810262,11 +819739,12 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
- A SARS-CoV-2 RNA vaccine by Arcturus Therapeutics, Inc.
+ A SARS-CoV-2 RNA vaccine by Arcturus Therapeutics, Inc., named as ARCT-165.
Philip Huang
NCT05037097
- ARCT-165
+ vaccine
+ ARCT-165
@@ -810291,7 +819769,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05029856
- SII B.1.351
+ vaccine
+ SII B.1.351
@@ -810316,7 +819795,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05029856
- SII Bivalent
+ vaccine
+ SII Bivalent
@@ -810341,7 +819821,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05029856
- SII B.1.617.2
+ vaccine
+ SII B.1.617.2
@@ -810372,7 +819853,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05037188
- AAV5-RBD-S
+ vaccine
+ AAV5-RBD-S
@@ -810397,7 +819879,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05043311
- SCTV01C
+ vaccine
+ SCTV01C
@@ -810422,7 +819905,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05094609
- Ad5-triCoV/Mac
+ vaccine
+ Ad5-triCoV/Mac
@@ -810447,7 +819931,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05069623
- VB10.2129
+ vaccine
+ VB10.2129
@@ -810472,7 +819957,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05069623
- VB10.2210
+ vaccine
+ VB10.2210
@@ -810497,7 +819983,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05094609
- ChAd-triCoV/Mac
+ vaccine
+ ChAd-triCoV/Mac
@@ -810522,7 +820009,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05067894
- COVID-19 subunit vaccine by PT Bio Farma
+ vaccine
+ COVID-19 subunit vaccine by PT Bio Farma
@@ -810553,7 +820041,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05047445
- COVIDITY
+ vaccine
+ COVIDITY
@@ -810578,7 +820067,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
ACTRN12621001009808
- PIKA Recombinant COVID-19 Vaccine
+ vaccine
+ PIKA Recombinant COVID-19 Vaccine
@@ -810603,7 +820093,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05102643
- COVID-19 DNA vaccine by the University of Hong Kong and Immuno Cure 3 Limited
+ vaccine
+ COVID-19 DNA vaccine by the University of Hong Kong and Immuno Cure 3 Limited
@@ -810636,11 +820127,12 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
- A SARS-CoV-2 RNA vaccine by Arcturus Therapeutics, Inc.
+ A SARS-CoV-2 RNA vaccine by Arcturus Therapeutics, Inc., named as ARCT-154.
Philip Huang
ISRCTN15779782
- ARCT-154
+ vaccine
+ ARCT-154
@@ -810665,7 +820157,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05137444
- LYB001
+ vaccine
+ LYB001
@@ -810702,7 +820195,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05128721
- Covi Vax
+ vaccine
+ Covi Vax
@@ -810727,7 +820221,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05113862
- naNO-COVID
+ vaccine
+ naNO-COVID
@@ -810752,7 +820247,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05113849
- IN-B009
+ vaccine
+ IN-B009
@@ -810777,7 +820273,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
jRCT2071210067
- VLPCOV-01
+ vaccine
+ VLPCOV-01
@@ -810802,7 +820299,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05434585
- ABO1009-DP
+ vaccine
+ ABO1009-DP
@@ -810810,7 +820308,6 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
-
@@ -810828,7 +820325,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05385991
- ACM-001
+ vaccine
+ ACM-001
@@ -810853,7 +820351,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05171946
- Almansour-001
+ vaccine
+ Almansour-001
@@ -810878,7 +820377,9 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT04639466
- ChAdV68-S
+ VO:0005176
+ vaccine
+ Synthetic MVA-based SARS-CoV-2 Vaccine COH04S1
@@ -810903,7 +820404,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05272605
- DoCo-Pro-RBD-1 + MF59
+ vaccine
+ DoCo-Pro-RBD-1 + MF59
@@ -810940,7 +820442,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05218070
- EgyVax
+ vaccine
+ EgyVax
@@ -810965,7 +820468,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05435027
- GRT-R912
+ vaccine
+ GRT-R912
@@ -810990,7 +820494,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05272605
- MIPSCo-mRNA-RBD-1
+ vaccine
+ MIPSCo-mRNA-RBD-1
@@ -811027,7 +820532,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
IRCT20210622051670N1
- Osvid-19
+ vaccine
+ Osvid-19
@@ -811052,7 +820558,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05389319
- Prime-2-CoV-Beta
+ vaccine
+ Prime-2-CoV-Beta
@@ -811077,7 +820584,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05366296
- RH109
+ vaccine
+ RH109
@@ -811102,7 +820610,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05394012
- RQ3013
+ vaccine
+ RQ3013
@@ -811127,7 +820636,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05420077
- RVM-V001
+ vaccine
+ RVM-V001
@@ -811152,7 +820662,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
ACTRN12622000597796
- VXS-1223
+ vaccine
+ VXS-1223
@@ -811177,7 +820688,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05370040
- AAHI-SC2
+ vaccine
+ AAHI-SC2
@@ -811202,7 +820714,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05270954
- Betuvax-CoV2
+ vaccine
+ Betuvax-CoV2
@@ -811227,7 +820740,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05373472
- COVID-19 mRNA vaccine by CanSino Biologics
+ vaccine
+ COVID-19 mRNA vaccine by CanSino Biologics
@@ -811252,7 +820766,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05188469
- EG-COVID
+ vaccine
+ EG-COVID
@@ -811277,7 +820792,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05375838
- mRNA-1073
+ vaccine
+ mRNA-1073
@@ -811302,7 +820818,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05439824
- SYS6006
+ vaccine
+ SYS6006
@@ -811339,7 +820856,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05226429
- UNAIR Inactivated COVID-19 Vaccine
+ vaccine
+ UNAIR Inactivated COVID-19 Vaccine
@@ -811364,7 +820882,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05273528
- V-01-351/V-01D Bivalence Vaccine
+ vaccine
+ V-01-351/V-01D Bivalence Vaccine
@@ -811389,7 +820908,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
CTRI/2022/04/041880
- GEMCOVAC-19
+ vaccine
+ GEMCOVAC-19
@@ -811414,7 +820934,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05428592
- LVRNA009
+ vaccine
+ LVRNA009
@@ -811439,7 +820960,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05436834
- mRNA-1273.214
+ vaccine
+ mRNA-1273.214
@@ -811464,7 +820986,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05249829
- mRNA-1273.529
+ vaccine
+ mRNA-1273.529
@@ -811501,7 +821024,8 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Philip Huang
NCT05374954
- Omicron COVID-19 inactivated vaccine by China National Biotec Group Company Limited
+ vaccine
+ Omicron COVID-19 inactivated vaccine by China National Biotec Group Company Limited
@@ -811514,7 +821038,580 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
Oliver He
http://www.violinet.org/cov19vaxkb/authorizedcov19vax.php
- authorized COVID-19 virus-like particle vaccine
+ vaccine
+ authorized COVID-19 virus-like particle vaccine
+
+
+
+
+
+
+
+
+ A Comirnaty COVID-19 mRNA vaccine produced by Pfizer-BioNTech,which is a bivalent vaccine that is effective against the original strain of COVID-19 as well as the Omicron BA.1 variant.A non-US vaccine product.
+ Penny Pan, Oliver He
+ Comirnaty Bivalent
+ PMID: 36541943
+ https://secure.medicalletter.org/TML-article-1665f
+ https://www2a.cdc.gov/vaccines/iis/iisstandards/vaccines.asp?rpt=cvx
+
+ Comirnaty
+ 520
+ vaccine
+ Authorized by WHO 10/19/2022 - Counted toward immunity in US.Ref:https://www2a.cdc.gov/vaccines/iis/iisstandards/vaccines.asp?rpt=cvx
+ SARS-COV-2 COVID-19 mRNA, bivalent, original/Omicron BA.1, Non-US Vaccine Product (Comirnaty Bivalent), Pfizer-BioNTech
+
+
+
+
+
+
+
+
+ A Comirnaty COVID-19 mRNA vaccine utilizes Lipid Nanoparticle-Self-amplifying RNA technology, available as a bivalent boosters against the original strain of COVID-19 as well as the Omicron BA.1 variant produced by Pfizer (PF) with a dose of 30 mcg/0.3 mL to provide enhanced protection.
+ Penny Pan, Oliver He
+ PMID: 36206167
+ https://secure.medicalletter.org/TML-article-1660c
+ https://www2a.cdc.gov/vaccines/iis/iisstandards/vaccines.asp?rpt=cvx
+
+ Comirnaty
+ 300
+ vaccine
+ EUA authorized Pfizer adult bivalent booster ages 12+ yrs, original strain + omicron BA.4/BA.5. Not Authorized by WHO. Non-US Tradename for same formulation (Comirnaty Bivalent) counted toward immunity in US. Ref:https://www2a.cdc.gov/vaccines/iis/iisstandards/vaccines.asp?rpt=cvx
+ SARS-COV-2 (COVID-19) vaccine, mRNA, spike protein, LNP, bivalent booster, preservative free, 30 mcg/0.3 mL dose, tris-sucrose formulation
+
+
+
+
+
+
+
+
+ A Comirnaty COVID-19 mRNA vaccine utilizing Lipid Nanoparticle-Self-amplifying RNA technology against the original strain of COVID-19 without preservative ,which is produced by Pfizer (PF) with a dose of 30 mcg/0.3 mL.
+ Penny Pan, Oliver He
+ https://www2a.cdc.gov/vaccines/iis/iisstandards/vaccines.asp?rpt=cvx
+
+ 208
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine, mRNA, spike protein, LNP, preservative free, 30 mcg/0.3mL dose
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ a grouping class for vaccines for specific pathogens
+
+ vaccine
+ vaccine for pathogen
+
+
+
+
+
+
+
+
+ a grouping class for vaccines for specific platforms
+
+ vaccine
+ vaccine by platform type
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 D614 recomb preS dTM AS03 adjuvant add PF 10mcg/0.5mL
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine D614 prefusion spike recombinant protein subunit (CoV2 preS dTM) AS03 adjuvant added preservative free 10mcg/0.5mL dose
+ CVX:226
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 D614 recomb preS dTM AS03 adjuvant add PF 5mcg/0.5mL
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine D614 prefusion spike recombinant protein subunit (CoV2 preS dTM) AS03 adjuvant added preservative free 5mcg/0.5mL dose
+ CVX:225
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S bivalent booster PF 10 mcg/0.2 mL
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP bivalent booster preservative free 10 mcg/0.2 mL dose
+ CVX:230
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S bivalent booster PF 10 mcg/0.2 mL dose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP bivalent booster preservative free 10 mcg/0.2 mL dose tris-sucrose formulation
+ CVX:301
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S bivalent booster PF 30 mcg/0.3 mL dose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP bivalent booster preservative free 30 mcg/0.3 mL dose tris-sucrose formulation
+ CVX:300
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S bivalent booster PF 50 mcg/0.5 mL or 25mcg/0.25 mL dose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP bivalent booster preservative free 50 mcg/0.5 mL or 25 mcg/0.25 mL dose
+ CVX:229
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S bivalent PF 3 mcg/0.2 mL dose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP bivalent preservative free 3 mcg/0.2 mL dose tris-sucrose formulation
+ CVX:302
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S PF 10 mcg/0.2 mL dose tris-sucrose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP preservative free 10 mcg/0.2mL dose tris-sucrose formulation
+ CVX:218
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S PF 100 mcg/0.5mL dose or 50 mcg/0.25mL dose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP preservative free 100 mcg/0.5mL dose or 50 mcg/0.25mL dose
+ CVX:207
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S PF 3 mcg/0.2 mL dose tris-sucrose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP preservative free 3 mcg/0.2mL dose tris-sucrose formulation
+ CVX:219
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S PF 30 mcg/0.3 mL dose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP preservative free 30 mcg/0.3mL dose
+ CVX:208
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S PF 30 mcg/0.3 mL dose tris-sucrose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP preservative free 30 mcg/0.3mL dose tris-sucrose formulation
+ CVX:217
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S PF 50 mcg/0.5 mL dose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP preservative free 50 mcg/0.5 mL dose
+ CVX:221
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S PF pediatric 25 mcg/0.25 mL dose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP preservative free pediatric 25 mcg/0.25 mL dose
+ CVX:228
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA LNP-S PF pediatric 50 mcg/0.5 mL dose
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine mRNA spike protein LNP preservative free pediatric 50 mcg/0.5 mL dose
+ CVX:227
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ SARS-COV-2 (COVID-19) vaccine UNSPECIFIED
+
+ vaccine
+ SARS-COV-2 (COVID-19) vaccine UNSPECIFIED
+ CVX:213
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA bivalent original/Omicron BA.1 Non-US Vaccine (Spikevax Bivalent) Moderna
+
+ vaccine
+ SARS-COV-2 COVID-19 mRNA bivalent original/Omicron BA.1 Non-US Vaccine (Spikevax Bivalent) Moderna
+ CVX:519
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 mRNA bivalent original/Omicron BA.1 Non-US Vaccine Product Pfizer-BioNTech
+
+ vaccine
+ SARS-COV-2 COVID-19 mRNA bivalent original/Omicron BA.1 Non-US Vaccine Product (Comirnaty Bivalent) Pfizer-BioNTech
+ CVX:520
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 Non-US Vaccine Product Unknown
+
+ vaccine
+ SARS-COV-2 COVID-19 Non-US Vaccine Specific Product Unknown
+ CVX:500
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 PS Non-US Vaccine (Jiangsu Province Centers for Disease Control and Prevention)
+
+ vaccine
+ SARS-COV-2 COVID-19 Protein Subunit Non-US Vaccine Product (Jiangsu Province Centers for Disease Control and Prevention)
+ CVX:508
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 PS Non-US Vaccine (Anhui Zhifei Longcom Biopharm + Inst of Micro Chinese Acad of Sciences)
+
+ vaccine
+ SARS-COV-2 COVID-19 Protein Subunit Non-US Vaccine Product (Anhui Zhifei Longcom Biopharmaceutical + Institute of Microbiology Chinese Academy of Sciences)
+ CVX:507
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ SARS-COV-2 COVID-19 PS Non-US Vaccine (Anhui Zhifei Longcom Zifivax)
+
+ vaccine
+ SARS-COV-2 COVID-19 Protein Subunit Non-US Vaccine Product (Anhui Zhifei Longcom Zifivax)
+ CVX:513
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 VVnr Non-US Vaccine (CanSino Biological Inc./Beijing Institute of Biotechnology
+
+ vaccine
+ SARS-COV-2 COVID-19 Viral Vector Non-replicating Non-US Vaccine Product (CONVIDECIA) CanSino Biological Inc./Beijing Institute of Biotechnology
+ CVX:506
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ COVID-19 VVnr Non-US Vaccine (Sputnik Light)
+
+ vaccine
+ SARS-COV-2 COVID-19 Viral Vector Non-replicating Non-US Vaccine Product (Sputnik Light)
+ CVX:504
@@ -811526,6 +821623,7 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
a protein from a virus
YH, ZX
+ protein
virus protein
@@ -811548,6 +821646,7 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
YH, ZX
+ protein
SARS-CoV protein
@@ -811556,6 +821655,7 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
+
@@ -811565,6 +821665,7 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
YH, ZX
+ protein
The receptor-binding domain (RBD) of SARS-CoV spike (S) protein is an important target in developing safe and effective SARS vaccines. A previous study has demonstrated that vaccination with adeno-associated virus encoding RBD (RBD-rAAV) induces high titer of neutralizing antibodies. The immune responses and protective effect of the immunization with RBD-rAAV prime/RBD-specific T cell peptide boost were assessed. Compared with the RBD-rAAV prime/boost vaccination, RBD-rAAV prime/RBD-peptide (RBD-Pep) boost induced similar levels of Th1 and neutralizing antibody responses that protected the vaccinated mice from subsequent SARS-CoV challenge, but stronger Th2 and CTL responses. No significant immune responses and protective effects were detected in mice vaccinated with RBD-Pep or blank AAV alone [PubMed: 18289745].
S protein of SARS-CoV
Protegen ID: 789; NCBI Gene GI: 1489668; NCBI Protein GI: 29836496; NCBI Protein Accession: NP_828851; NCBITaxon: 694009
@@ -811584,12 +821685,32 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
YH, ZX
+ vaccine
SARS Subunit Spike Protein Vaccine
VIOLIN Vaccine ID: 842
+
+
+
+
+
+
+
+
+
+
+ A vaccine that protects against Canine distemper virus.
+ YH, ZX
+
+ vaccine
+ canine distemper virus vaccine
+
+
+
+
@@ -811610,6 +821731,7 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
YH, ZX
SARS-CoV vaccine
+ vaccine
SARS vaccine
@@ -811623,21 +821745,11 @@ https://www.ncbi.nlm.nih.gov/pubmed/?term=12
-
-
-
-
-
-
-
-
-
-
@@ -814426,14 +824538,23 @@ This interpretation is *not* the same as an at-all-times relation
- Intervet has merged with Schering-Plough Animal Health and become Intervet/Schering-Plough Animal Health™ (YL.)
+ Intervet has merged with Schering-Plough Animal Health and become Intervet/Schering-Plough Animal Health™ (YL.)
YH
- http://www.intervet.com/
Intervet
+
+
+
+
+ YL
+ Novartis Animal Health US, Inc.
+
+
+
+
@@ -814441,8 +824562,7 @@ This interpretation is *not* the same as an at-all-times relation
A British multinational pharmaceutical company headquartered in Brentford, England
Oliver He, Philip Huang
https://en.wikipedia.org/wiki/GlaxoSmithKline
- https://www.gsk.com/en-gb/home/
- GlaxoSmithKline plc
+ GlaxoSmithKline plc
@@ -814452,7 +824572,6 @@ This interpretation is *not* the same as an at-all-times relation
YH
- http://www.wyeth.com/
Wyeth Pharmaceuticals Inc
@@ -814463,31 +824582,47 @@ This interpretation is *not* the same as an at-all-times relation
YH
- http://www.pfizerah.com/
Pfizer Animal Health
-
+
-
+
YH
- http://www.merial.com/
- Merial, Inc
+ Boehringer-Ingelheim Vetmedica, Inc
-
+
-
+
- YL
- Vaccicel, Inc. has a location in Belton, TX. Active officers include Andre Menchu, Andres Menchu, Kathryn M Baker, Katheryn Becker and Andres Menches. Vaccicel, Inc. filed as a Domestic For-Profit Corporation on Tuesday, August 22, 1995 in the state of Texas and is currently active. Andres Menchu serves as the registered agent for this organization.The company's line of business includes Mfg Research & Development Veterinary Bacterial Vaccines.
-(http://www.corporationwiki.com/Texas/Belton/vaccicel-inc/34296230.aspx)
- VacciCel, Inc.
+ YH
+ Biomune
+
+
+
+
+
+
+
+
+ YH
+ Lohman Animal Health International
+
+
+
+
+
+
+
+
+ YH
+ Merial, Inc
@@ -814499,7 +824634,7 @@ This interpretation is *not* the same as an at-all-times relation
A company trhat is located at Berkeley, CA, USA. Its website is: http://www.dynavax.com.
Oliver He, Randi Rita, Kallan Roan
http://www.dynavax.com/
- Dynavax Technologies Corporation
+ Dynavax Technologies Corporation
@@ -814512,7 +824647,7 @@ This interpretation is *not* the same as an at-all-times relation
Oliver He, Philip Huang
https://en.wikipedia.org/wiki/Janssen_Pharmaceutica
https://www.janssen.com/us/
- Janssen Pharmaceutica
+ Janssen Pharmaceutica
@@ -814521,11 +824656,11 @@ This interpretation is *not* the same as an at-all-times relation
- An American multinational pharmaceutical corporation headquartered in New York City.
+ An American multinational pharmaceutical corporation headquartered in New York City.
Philip, Oliver
- https://en.wikipedia.org/wiki/Pfizer
- https://www.pfizer.com/
- Pfizer Inc.
+ https://en.wikipedia.org/wiki/Pfizer
+ https://www.pfizer.com/
+ Pfizer Inc.
@@ -814535,8 +824670,7 @@ This interpretation is *not* the same as an at-all-times relation
Philip Huang, Oliver He
- https://vaxxinity.com/
- Vaxxinity
+ Vaxxinity
@@ -814546,8 +824680,7 @@ This interpretation is *not* the same as an at-all-times relation
Philip Huang
- https://www.symvivo.com/
- Symvivo
+ Symvivo
@@ -814557,8 +824690,7 @@ This interpretation is *not* the same as an at-all-times relation
Philip Huang
- https://www.chula.ac.th/en/
- Chulalongkorn University
+ Chulalongkorn University
@@ -814568,8 +824700,7 @@ This interpretation is *not* the same as an at-all-times relation
Philip Huang
- https://medigen-usa.com/
- Medigen, Inc.
+ Medigen, Inc.
@@ -814579,8 +824710,7 @@ This interpretation is *not* the same as an at-all-times relation
Philip Huang
- www.cloverbiopharma.com
- Clover Biopharmaceuticals, Inc.
+ Clover Biopharmaceuticals, Inc.
@@ -814590,8 +824720,7 @@ This interpretation is *not* the same as an at-all-times relation
Philip Huang
- http://www.cellid.co.kr/eng/
- Cellid Co., Ltd.
+ Cellid Co., Ltd.
@@ -814601,8 +824730,7 @@ This interpretation is *not* the same as an at-all-times relation
Philip Huang
- https://www.umcg.nl/EN/corporate/The_University_Medical_Center/Paginas/default.aspx
- University Medical Center Groningen
+ University Medical Center Groningen
@@ -814662,8 +824790,8 @@ This interpretation is *not* the same as an at-all-times relation
Mervi Heiskanen
Monnie McGee
Norman Morrison
- Philip Lord
Philippe Rocca-Serra
+ Phillip Lord
Pierre Grenon
Richard Bruskiewich
Richard Scheuermann
@@ -814676,64 +824804,853 @@ This interpretation is *not* the same as an at-all-times relation
Trish Whetzel
Yongqun He
2009-07-31
- The Ontology for Biomedical Investigations (OBI) is build in a collaborative, international effort and will serve as a resource for annotating biomedical investigations, including the study design, protocols and instrumentation used, the data generated and the types of analysis performed on the data. This ontology arose from the Functional Genomics Investigation Ontology (FuGO) and will contain both terms that are common to all biomedical investigations, including functional genomics investigations and those that are more domain specific.
+ An ontology for representing biomedical investigations, including study designs, the collection and preparation of the targets of investigation, assays, instrumentation and reagents used, as well as the data generated and the types of analysis performed on the data to reach conclusions, and their documentation.
OWL-DL
An ontology for the annotation of biomedical and functional genomics experiments.
http://creativecommons.org/licenses/by/4.0/
Ontology for Biomedical Investigations
Please cite the OBI consortium http://purl.obolibrary.org/obo/obi where traditional citation is called for. However it is adequate that individual terms be attributed simply by use of the identifying PURL for the term, in projects that refer to them.
- 2021-04-06
+ 2024-01-09
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
@@ -814900,6 +825817,12 @@ This interpretation is *not* the same as an at-all-times relation
+
+
+
+
+
+
@@ -814910,10 +825833,19 @@ This interpretation is *not* the same as an at-all-times relation
-
+
-
+
+
+
+
+
+
+
+
+
+
@@ -814928,19 +825860,19 @@ This interpretation is *not* the same as an at-all-times relation
-
+
-
+
-
+
-
+
-
+
@@ -814961,37 +825893,37 @@ This interpretation is *not* the same as an at-all-times relation
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
@@ -815354,343 +826286,244 @@ This interpretation is *not* the same as an at-all-times relation
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
@@ -815741,13 +826574,7 @@ This interpretation is *not* the same as an at-all-times relation
-
-
-
-
-
-
-
+
@@ -815819,268 +826646,52 @@ This interpretation is *not* the same as an at-all-times relation
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
-
+
@@ -822149,14 +832760,14 @@ This interpretation is *not* the same as an at-all-times relation
Erica Marcos
Ningxian Fan
Paul Fabry
- Randi Vita
+ Randi Vita
Ryan R. Brinkman
- Shunzhou Deng
+ Shunzhou Deng
Alan Ruttenburg
Alexander D. Diehl
Amogh Madireddi
- Anna Maria Masci
- Anthony Huffman
+ Anna Maria Masci
+ Anthony Huffman
Barry Smith
Bjoern Peters
Edison Ong
@@ -822167,26 +832778,26 @@ This interpretation is *not* the same as an at-all-times relation
Khadeejah Khan
Lindsay Cowell
Melanie Courtot
- Ningxian Fan
+ Ningxian Fan
Omar Tibi
- Philip Huang
+ Philip Huang
Randi Vita
Rebecca Racz
Richard H. Scheuermann
- Rohit Goru
- Ronak Sutariya
+ Rohit Goru
+ Ronak Sutariya
Samantha G. Sayers (SGS)
Thomas Todd
- Yongqun "Oliver" He (YH)
- Yu Lin (YL)
- Zuoshuang "Allen" Xiang
- July 31, 2022
- The Vaccine Ontology (VO) is a biomedical ontology in the domain of vaccine and vaccination. VO aims to standardize vaccine annotation, integrate various vaccine data, and support computer-assisted reasoning. VO supports basic vaccine R&D and clincal vaccine usage. VO is being developed as a community-based ontology with support and collaborations from the vaccine and bio-ontology communities.
+ Yongqun "Oliver" He (YH)
+ Yu Lin (YL)
+ Yuanyi (Penny) Pan
+ Zuoshuang "Allen" Xiang
+ The Vaccine Ontology (VO) is a community-based biomedical ontology in the domain of vaccine and vaccination. VO aims to standardize vaccine types and annotations, integrate various vaccine data, and support computer-assisted reasoning. The VO supports basic vaccine R&D and clincal vaccine usage. VO is being developed as a community-based ontology with support and collaborations from the vaccine and bio-ontology communities.
OWL-DL
-
An ontology in the domain of vaccine and vaccination
Vaccine Ontology
- 1.1.201
+
+ 2024-02-07
Obsolete term
@@ -822207,5 +832818,5 @@ This interpretation is *not* the same as an at-all-times relation
-
+